diff --git a/applications/solvers/combustion/fireFoam/pEqn.H b/applications/solvers/combustion/fireFoam/pEqn.H
index 3f4f485cf6..22c3f0139a 100644
--- a/applications/solvers/combustion/fireFoam/pEqn.H
+++ b/applications/solvers/combustion/fireFoam/pEqn.H
@@ -4,6 +4,9 @@ volScalarField rAU(1.0/UEqn.A());
 surfaceScalarField rhorAUf("Dp", fvc::interpolate(rho*rAU));
 volVectorField HbyA("HbyA", U);
 HbyA = rAU*UEqn.H();
+phi.boundaryField() =
+    fvc::interpolate(rho.boundaryField()*U.boundaryField())
+  & mesh.Sf().boundaryField();
 
 surfaceScalarField phig(-rhorAUf*ghf*fvc::snGrad(rho)*mesh.magSf());
 
diff --git a/applications/solvers/multiphase/bubbleFoam/pEqn.H b/applications/solvers/multiphase/bubbleFoam/pEqn.H
index 631c9cbba6..d438b1124f 100644
--- a/applications/solvers/multiphase/bubbleFoam/pEqn.H
+++ b/applications/solvers/multiphase/bubbleFoam/pEqn.H
@@ -38,16 +38,18 @@
     (
         (fvc::interpolate(HbyA1) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU1, U1, phi1)
-      + phiDrag1
     );
 
     surfaceScalarField phiHbyA2
     (
         (fvc::interpolate(HbyA2) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU2, U2, phi2)
-      + phiDrag2
     );
 
+    phi = alpha1f*phiHbyA1 + alpha2f*phiHbyA2;
+
+    phiHbyA1 += phiDrag1;
+    phiHbyA2 += phiDrag2;
     surfaceScalarField phiHbyA("phiHbyA", alpha1f*phiHbyA1 + alpha2f*phiHbyA2);
 
     surfaceScalarField Dp
diff --git a/applications/solvers/multiphase/cavitatingFoam/UEqn.H b/applications/solvers/multiphase/cavitatingFoam/UEqn.H
index 9a5761b59f..1ca0b9f0a5 100644
--- a/applications/solvers/multiphase/cavitatingFoam/UEqn.H
+++ b/applications/solvers/multiphase/cavitatingFoam/UEqn.H
@@ -1,17 +1,8 @@
-    surfaceScalarField muEff
-    (
-        "muEff",
-        twoPhaseProperties.muf()
-      + fvc::interpolate(rho*turbulence->nut())
-    );
-
     fvVectorMatrix UEqn
     (
         fvm::ddt(rho, U)
       + fvm::div(phi, U)
-      - fvm::laplacian(muEff, U)
-    //- (fvc::grad(U) & fvc::grad(muf))
-      - fvc::div(muEff*(fvc::interpolate(dev(fvc::grad(U))) & mesh.Sf()))
+      + turbulence->divDevRhoReff(rho, U)
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/compressibleInterFoam/UEqn.H b/applications/solvers/multiphase/compressibleInterFoam/UEqn.H
index 257f6d48b5..7cc250a66a 100644
--- a/applications/solvers/multiphase/compressibleInterFoam/UEqn.H
+++ b/applications/solvers/multiphase/compressibleInterFoam/UEqn.H
@@ -1,17 +1,8 @@
-    surfaceScalarField muEff
-    (
-        "muEff",
-        twoPhaseProperties.muf()
-      + fvc::interpolate(rho*turbulence->nut())
-    );
-
     fvVectorMatrix UEqn
     (
         fvm::ddt(rho, U)
       + fvm::div(rhoPhi, U)
-      - fvm::laplacian(muEff, U)
-      - (fvc::grad(U) & fvc::grad(muEff))
-    //- fvc::div(muEff*(fvc::interpolate(dev(fvc::grad(U))) & mesh.Sf()))
+      + turbulence->divDevRhoReff(rho, U)
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/compressibleInterFoam/pEqn.H b/applications/solvers/multiphase/compressibleInterFoam/pEqn.H
index 9e67a47c4f..80011d1ab5 100644
--- a/applications/solvers/multiphase/compressibleInterFoam/pEqn.H
+++ b/applications/solvers/multiphase/compressibleInterFoam/pEqn.H
@@ -36,6 +36,7 @@
         (fvc::interpolate(HbyA) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU, rho, U, phi)
     );
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/pEqn.H b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/pEqn.H
index 709d30c398..926abe2a09 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/pEqn.H
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/pEqn.H
@@ -2,11 +2,6 @@
     rho1 = rho10 + psi1*p;
     rho2 = rho20 + psi2*p;
 
-    mrfZones.absoluteFlux(phi1.oldTime());
-    mrfZones.absoluteFlux(phi1);
-    mrfZones.absoluteFlux(phi2.oldTime());
-    mrfZones.absoluteFlux(phi2);
-
     surfaceScalarField alpha1f(fvc::interpolate(alpha1));
     surfaceScalarField alpha2f(scalar(1) - alpha1f);
 
@@ -22,6 +17,11 @@
     volVectorField HbyA2("HbyA2", U2);
     HbyA2 = rAU2*U2Eqn.H();
 
+    mrfZones.absoluteFlux(phi1.oldTime());
+    mrfZones.absoluteFlux(phi1);
+    mrfZones.absoluteFlux(phi2.oldTime());
+    mrfZones.absoluteFlux(phi2);
+
     surfaceScalarField ppDrag("ppDrag", 0.0*phi1);
 
     if (g0.value() > 0.0)
@@ -41,18 +41,29 @@
         "phiHbyA1",
         (fvc::interpolate(HbyA1) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU1, alpha1, U1, phi1)
-      + fvc::interpolate((1.0/rho1)*rAU1*dragCoeff)*phi2
-      + ppDrag
-      + rAlphaAU1f*(g & mesh.Sf())
     );
-    mrfZones.relativeFlux(phiHbyA1);
 
     surfaceScalarField phiHbyA2
     (
         "phiHbyA2",
         (fvc::interpolate(HbyA2) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU2, alpha2, U2, phi2)
-      + fvc::interpolate((1.0/rho2)*rAU2*dragCoeff)*phi1
+    );
+
+    phi = alpha1f*phiHbyA1 + alpha2f*phiHbyA2;
+    mrfZones.relativeFlux(phi);
+
+    phiHbyA1 +=
+    (
+        fvc::interpolate((1.0/rho1)*rAU1*dragCoeff)*phi2
+      + ppDrag
+      + rAlphaAU1f*(g & mesh.Sf())
+    );
+    mrfZones.relativeFlux(phiHbyA1);
+
+    phiHbyA2 +=
+    (
+        fvc::interpolate((1.0/rho2)*rAU2*dragCoeff)*phi1
       + rAlphaAU2f*(g & mesh.Sf())
     );
     mrfZones.relativeFlux(phiHbyA2);
diff --git a/applications/solvers/multiphase/interFoam/MRFInterFoam/pEqn.H b/applications/solvers/multiphase/interFoam/MRFInterFoam/pEqn.H
index 9c56c4d26f..1f4f0bbbeb 100644
--- a/applications/solvers/multiphase/interFoam/MRFInterFoam/pEqn.H
+++ b/applications/solvers/multiphase/interFoam/MRFInterFoam/pEqn.H
@@ -11,9 +11,9 @@
         (fvc::interpolate(HbyA) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU, rho, U, phi)
     );
-    mrfZones.relativeFlux(phiHbyA);
-
     adjustPhi(phiHbyA, U, p_rgh);
+    mrfZones.relativeFlux(phiHbyA);
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/interFoam/UEqn.H b/applications/solvers/multiphase/interFoam/UEqn.H
index 257f6d48b5..7cc250a66a 100644
--- a/applications/solvers/multiphase/interFoam/UEqn.H
+++ b/applications/solvers/multiphase/interFoam/UEqn.H
@@ -1,17 +1,8 @@
-    surfaceScalarField muEff
-    (
-        "muEff",
-        twoPhaseProperties.muf()
-      + fvc::interpolate(rho*turbulence->nut())
-    );
-
     fvVectorMatrix UEqn
     (
         fvm::ddt(rho, U)
       + fvm::div(rhoPhi, U)
-      - fvm::laplacian(muEff, U)
-      - (fvc::grad(U) & fvc::grad(muEff))
-    //- fvc::div(muEff*(fvc::interpolate(dev(fvc::grad(U))) & mesh.Sf()))
+      + turbulence->divDevRhoReff(rho, U)
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/interFoam/interDyMFoam/pEqn.H b/applications/solvers/multiphase/interFoam/interDyMFoam/pEqn.H
index d942f2c501..5b089550c5 100644
--- a/applications/solvers/multiphase/interFoam/interDyMFoam/pEqn.H
+++ b/applications/solvers/multiphase/interFoam/interDyMFoam/pEqn.H
@@ -19,6 +19,8 @@
         fvc::makeAbsolute(phiHbyA, U);
     }
 
+    phiAbs = phiHbyA;
+
     surfaceScalarField phig
     (
         (
diff --git a/applications/solvers/multiphase/interFoam/pEqn.H b/applications/solvers/multiphase/interFoam/pEqn.H
index d1bc7bf1ed..53c2161f97 100644
--- a/applications/solvers/multiphase/interFoam/pEqn.H
+++ b/applications/solvers/multiphase/interFoam/pEqn.H
@@ -13,6 +13,7 @@
     );
 
     adjustPhi(phiHbyA, U, p_rgh);
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/interPhaseChangeFoam/UEqn.H b/applications/solvers/multiphase/interPhaseChangeFoam/UEqn.H
index b8fe82ff14..062c5523c9 100644
--- a/applications/solvers/multiphase/interPhaseChangeFoam/UEqn.H
+++ b/applications/solvers/multiphase/interPhaseChangeFoam/UEqn.H
@@ -1,18 +1,9 @@
-    surfaceScalarField muEff
-    (
-        "muEff",
-        twoPhaseProperties->muf()
-      + fvc::interpolate(rho*turbulence->nut())
-    );
-
     fvVectorMatrix UEqn
     (
         fvm::ddt(rho, U)
       + fvm::div(rhoPhi, U)
       - fvm::Sp(fvc::ddt(rho) + fvc::div(rhoPhi), U)
-      - fvm::laplacian(muEff, U)
-      - (fvc::grad(U) & fvc::grad(muEff))
-    //- fvc::div(muEff*(fvc::interpolate(dev2(fvc::grad(U))) & mesh.Sf()))
+      + turbulence->divDevRhoReff(rho, U)
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/interPhaseChangeFoam/pEqn.H b/applications/solvers/multiphase/interPhaseChangeFoam/pEqn.H
index e3ef0dc9ef..7ff971ed7f 100644
--- a/applications/solvers/multiphase/interPhaseChangeFoam/pEqn.H
+++ b/applications/solvers/multiphase/interPhaseChangeFoam/pEqn.H
@@ -11,8 +11,8 @@
         (fvc::interpolate(HbyA) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU, rho, U, phi)
     );
-
     adjustPhi(phiHbyA, U, p_rgh);
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H b/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H
index 9ed3fecce9..07d867b1e7 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H
@@ -58,6 +58,8 @@
         dimensionedScalar("phiHbyA", dimArea*dimVelocity, 0)
     );
 
+    phi = dimensionedScalar("phi", phi.dimensions(), 0);
+
     phasei = 0;
     forAllIter(PtrDictionary<phaseModel>, fluid.phases(), iter)
     {
@@ -74,14 +76,17 @@
         (
             (fvc::interpolate(HbyAs[phasei]) & mesh.Sf())
           + fvc::ddtPhiCorr(rAUs[phasei], alpha, phase.U(), phase.phi())
-          + rAlphaAUfs[phasei]
+        );
+        mrfZones.relativeFlux(phiHbyAs[phasei]);
+
+        phi += alphafs[phasei]*phiHbyAs[phasei];
+
+        phiHbyAs[phasei] +=
+            rAlphaAUfs[phasei]
            *(
                fluid.surfaceTension(phase)*mesh.magSf()/phase.rho()
              + (g & mesh.Sf())
-            )
-        );
-
-        mrfZones.relativeFlux(phiHbyAs[phasei]);
+            );
 
         multiphaseSystem::dragModelTable::const_iterator dmIter =
             fluid.dragModels().begin();
diff --git a/applications/solvers/multiphase/multiphaseInterFoam/MRFMultiphaseInterFoam/pEqn.H b/applications/solvers/multiphase/multiphaseInterFoam/MRFMultiphaseInterFoam/pEqn.H
index 7bc1eeb12c..823216897c 100644
--- a/applications/solvers/multiphase/multiphaseInterFoam/MRFMultiphaseInterFoam/pEqn.H
+++ b/applications/solvers/multiphase/multiphaseInterFoam/MRFMultiphaseInterFoam/pEqn.H
@@ -11,9 +11,9 @@
         (fvc::interpolate(HbyA) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU, rho, U, phi)
     );
-    mrfZones.relativeFlux(phiHbyA);
-
     adjustPhi(phiHbyA, U, p_rgh);
+    mrfZones.relativeFlux(phiHbyA);
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/multiphaseInterFoam/UEqn.H b/applications/solvers/multiphase/multiphaseInterFoam/UEqn.H
index 43ee1e3eb9..fbcba7db72 100644
--- a/applications/solvers/multiphase/multiphaseInterFoam/UEqn.H
+++ b/applications/solvers/multiphase/multiphaseInterFoam/UEqn.H
@@ -1,17 +1,8 @@
-    surfaceScalarField muEff
-    (
-        "muEff",
-        mixture.muf()
-      + fvc::interpolate(rho*turbulence->nut())
-    );
-
     fvVectorMatrix UEqn
     (
         fvm::ddt(rho, U)
       + fvm::div(mixture.rhoPhi(), U)
-      - fvm::laplacian(muEff, U)
-      - (fvc::grad(U) & fvc::grad(muEff))
-    //- fvc::div(muEff*(fvc::interpolate(dev(fvc::grad(U))) & mesh.Sf()))
+      + turbulence->divDevRhoReff(rho, U)
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/multiphaseInterFoam/pEqn.H b/applications/solvers/multiphase/multiphaseInterFoam/pEqn.H
index c1e346ce43..82bf3dbd59 100644
--- a/applications/solvers/multiphase/multiphaseInterFoam/pEqn.H
+++ b/applications/solvers/multiphase/multiphaseInterFoam/pEqn.H
@@ -11,8 +11,8 @@
         (fvc::interpolate(HbyA) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU, rho, U, phi)
     );
-
     adjustPhi(phiHbyA, U, p_rgh);
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/settlingFoam/UEqn.H b/applications/solvers/multiphase/settlingFoam/UEqn.H
index d6232da309..ff6323bca2 100644
--- a/applications/solvers/multiphase/settlingFoam/UEqn.H
+++ b/applications/solvers/multiphase/settlingFoam/UEqn.H
@@ -11,7 +11,6 @@
         )
       - fvm::laplacian(muEff, U, "laplacian(muEff,U)")
       - (fvc::grad(U) & fvc::grad(muEff))
-    //- fvc::div(muEff*dev2(T(fvc::grad(U))))
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/settlingFoam/pEqn.H b/applications/solvers/multiphase/settlingFoam/pEqn.H
index 9f27e992a8..6d61ec8730 100644
--- a/applications/solvers/multiphase/settlingFoam/pEqn.H
+++ b/applications/solvers/multiphase/settlingFoam/pEqn.H
@@ -15,6 +15,7 @@
          + fvc::ddtPhiCorr(rAU, rho, U, phi)
         )
     );
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/twoLiquidMixingFoam/UEqn.H b/applications/solvers/multiphase/twoLiquidMixingFoam/UEqn.H
index 3dbb374774..7afd323dd0 100644
--- a/applications/solvers/multiphase/twoLiquidMixingFoam/UEqn.H
+++ b/applications/solvers/multiphase/twoLiquidMixingFoam/UEqn.H
@@ -1,17 +1,8 @@
-    surfaceScalarField muEff
-    (
-        "muEff",
-        twoPhaseProperties.muf()
-      + fvc::interpolate(rho*turbulence->nut())
-    );
-
     fvVectorMatrix UEqn
     (
         fvm::ddt(rho, U)
       + fvm::div(rhoPhi, U)
-      - fvm::laplacian(muEff, U)
-      - (fvc::grad(U) & fvc::grad(muEff))
-    //- fvc::div(muEff*(fvc::interpolate(dev(fvc::grad(U))) & mesh.Sf()))
+      + turbulence->divDevRhoReff(rho, U)
     );
 
     UEqn.relax();
diff --git a/applications/solvers/multiphase/twoLiquidMixingFoam/pEqn.H b/applications/solvers/multiphase/twoLiquidMixingFoam/pEqn.H
index ddfca4e3ea..e090522de6 100644
--- a/applications/solvers/multiphase/twoLiquidMixingFoam/pEqn.H
+++ b/applications/solvers/multiphase/twoLiquidMixingFoam/pEqn.H
@@ -11,8 +11,8 @@
         (fvc::interpolate(HbyA) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU, rho, U, phi)
     );
-
     adjustPhi(phiHbyA, U, p_rgh);
+    phi = phiHbyA;
 
     surfaceScalarField phig
     (
diff --git a/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H b/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H
index 9b543bcd25..546e1a3e41 100644
--- a/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H
+++ b/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H
@@ -36,18 +36,29 @@
         "phiHbyA1",
         (fvc::interpolate(HbyA1) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU1, U1, phi1)
-      + fvc::interpolate(alpha2/rho1*K*rAU1)*phi2
-      + ppDrag
-      + rAU1f*(g & mesh.Sf())
     );
-    mrfZones.relativeFlux(phiHbyA1);
 
     surfaceScalarField phiHbyA2
     (
         "phiHbyA2",
         (fvc::interpolate(HbyA2) & mesh.Sf())
       + fvc::ddtPhiCorr(rAU2, U2, phi2)
-      + fvc::interpolate(alpha1/rho2*K*rAU2)*phi1
+    );
+
+    phi = alpha1f*phiHbyA1 + alpha2f*phiHbyA2;
+    mrfZones.relativeFlux(phi);
+
+    phiHbyA1 +=
+    (
+        fvc::interpolate(alpha2/rho1*K*rAU1)*phi2
+      + ppDrag
+      + rAU1f*(g & mesh.Sf())
+    );
+    mrfZones.relativeFlux(phiHbyA1);
+
+    phiHbyA2 +=
+    (
+        fvc::interpolate(alpha1/rho2*K*rAU2)*phi1
       + rAU2f*(g & mesh.Sf())
     );
     mrfZones.relativeFlux(phiHbyA2);
diff --git a/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H.old b/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H.old
deleted file mode 100644
index 348cc847d7..0000000000
--- a/applications/solvers/multiphase/twoPhaseEulerFoam/pEqn.H.old
+++ /dev/null
@@ -1,118 +0,0 @@
-{
-    surfaceScalarField alpha1f(fvc::interpolate(alpha1));
-    surfaceScalarField alpha2f(scalar(1) - alpha1f);
-
-    volScalarField rAU1(1.0/U1Eqn.A());
-    volScalarField rAU2(1.0/U2Eqn.A());
-
-    rAU1f = fvc::interpolate(rAU1);
-    surfaceScalarField rAU2f(fvc::interpolate(rAU2));
-
-    volVectorField HbyA1("HbyA1", U1);
-    HbyA1 = rAU1*U1Eqn.H();
-
-    volVectorField HbyA2("HbyA2", U2);
-    HbyA2 = rAU2*U2Eqn.H();
-
-    mrfZones.absoluteFlux(phi1.oldTime());
-    mrfZones.absoluteFlux(phi1);
-
-    mrfZones.absoluteFlux(phi2.oldTime());
-    mrfZones.absoluteFlux(phi2);
-
-    surfaceScalarField phiDrag1
-    (
-        fvc::interpolate(alpha2/rho1*K*rAU1)*phi2 + rAU1f*(g & mesh.Sf())
-    );
-
-    if (g0.value() > 0.0)
-    {
-        phiDrag1 -= ppMagf*fvc::snGrad(alpha1)*mesh.magSf();
-    }
-
-    if (kineticTheory.on())
-    {
-        phiDrag1 -= rAU1f*fvc::snGrad(kineticTheory.pa()/rho1)*mesh.magSf();
-    }
-
-
-    surfaceScalarField phiDrag2
-    (
-        fvc::interpolate(alpha1/rho2*K*rAU2)*phi1 + rAU2f*(g & mesh.Sf())
-    );
-
-    // Fix for gravity on outlet boundary.
-    forAll(p.boundaryField(), patchi)
-    {
-        if (isA<zeroGradientFvPatchScalarField>(p.boundaryField()[patchi]))
-        {
-            phiDrag1.boundaryField()[patchi] = 0.0;
-            phiDrag2.boundaryField()[patchi] = 0.0;
-        }
-    }
-
-    surfaceScalarField phiHbyA1
-    (
-        "phiHbyA1",
-        (fvc::interpolate(HbyA1) & mesh.Sf())
-      + fvc::ddtPhiCorr(rAU1, U1, phi1)
-      + phiDrag1
-    );
-    mrfZones.relativeFlux(phiHbyA1);
-
-    surfaceScalarField phiHbyA2
-    (
-        "phiHbyA2",
-        (fvc::interpolate(HbyA2) & mesh.Sf())
-      + fvc::ddtPhiCorr(rAU2, U2, phi2)
-      + phiDrag2
-    );
-    mrfZones.relativeFlux(phiHbyA2);
-
-    mrfZones.relativeFlux(phi1.oldTime());
-    mrfZones.relativeFlux(phi1);
-    mrfZones.relativeFlux(phi2.oldTime());
-    mrfZones.relativeFlux(phi2);
-
-    surfaceScalarField phiHbyA("phiHbyA", alpha1f*phiHbyA1 + alpha2f*phiHbyA2);
-
-    surfaceScalarField Dp
-    (
-        "Dp",
-        alpha1f*rAU1f/rho1 + alpha2f*rAU2f/rho2
-    );
-
-    while (pimple.correctNonOrthogonal())
-    {
-        fvScalarMatrix pEqn
-        (
-            fvm::laplacian(Dp, p) == fvc::div(phiHbyA)
-        );
-
-        pEqn.setReference(pRefCell, pRefValue);
-
-        pEqn.solve(mesh.solver(p.select(pimple.finalInnerIter())));
-
-        if (pimple.finalNonOrthogonalIter())
-        {
-            surfaceScalarField SfGradp(pEqn.flux()/Dp);
-
-            phi1 = phiHbyA1 - rAU1f*SfGradp/rho1;
-            phi2 = phiHbyA2 - rAU2f*SfGradp/rho2;
-            phi = alpha1f*phi1 + alpha2f*phi2;
-
-            p.relax();
-            SfGradp = pEqn.flux()/Dp;
-
-            U1 = HbyA1 + fvc::reconstruct(phiDrag1 - rAU1f*SfGradp/rho1);
-            U1.correctBoundaryConditions();
-
-            U2 = HbyA2 + fvc::reconstruct(phiDrag2 - rAU2f*SfGradp/rho2);
-            U2.correctBoundaryConditions();
-
-            U = alpha1*U1 + alpha2*U2;
-        }
-    }
-}
-
-#include "continuityErrs.H"
diff --git a/applications/solvers/stressAnalysis/solidDisplacementFoam/readMechanicalProperties.H b/applications/solvers/stressAnalysis/solidDisplacementFoam/readMechanicalProperties.H
index 97891ad639..4f85d6dad8 100644
--- a/applications/solvers/stressAnalysis/solidDisplacementFoam/readMechanicalProperties.H
+++ b/applications/solvers/stressAnalysis/solidDisplacementFoam/readMechanicalProperties.H
@@ -161,7 +161,7 @@
             )
         );
     }
-    else if(nuType == "field")
+    else if (nuType == "field")
     {
         nuIO.readOpt() = IOobject::MUST_READ;
         nuPtr.reset
diff --git a/applications/solvers/stressAnalysis/solidDisplacementFoam/readThermalProperties.H b/applications/solvers/stressAnalysis/solidDisplacementFoam/readThermalProperties.H
index c8817c5975..afcff762e4 100644
--- a/applications/solvers/stressAnalysis/solidDisplacementFoam/readThermalProperties.H
+++ b/applications/solvers/stressAnalysis/solidDisplacementFoam/readThermalProperties.H
@@ -81,7 +81,7 @@ if (thermalStress)
         );
 
     }
-    else if(CType == "field")
+    else if (CType == "field")
     {
         CIO.readOpt() = IOobject::MUST_READ;
 
@@ -214,7 +214,7 @@ if (thermalStress)
     {
         FatalErrorIn
         (
-             "readThermalProperties.H"
+            "readThermalProperties.H"
         )   << "Valid type entries are uniform or field for alpha"
             << abort(FatalError);
     }
@@ -228,5 +228,4 @@ if (thermalStress)
 
     threeKalpha = threeK*alpha;
     DT = k/C;
-
 }
diff --git a/applications/utilities/mesh/manipulation/polyDualMesh/polyDualMeshApp.C b/applications/utilities/mesh/manipulation/polyDualMesh/polyDualMeshApp.C
index 2518dc0450..0969b1e560 100644
--- a/applications/utilities/mesh/manipulation/polyDualMesh/polyDualMeshApp.C
+++ b/applications/utilities/mesh/manipulation/polyDualMesh/polyDualMeshApp.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -56,7 +56,6 @@ Usage
 
 #include "argList.H"
 #include "Time.H"
-#include "timeSelector.H"
 #include "fvMesh.H"
 #include "unitConversion.H"
 #include "polyTopoChange.H"
@@ -354,7 +353,6 @@ int main(int argc, char *argv[])
 {
 #   include "addOverwriteOption.H"
     argList::noParallel();
-    timeSelector::addOptions(true, false);
 
     argList::validArgs.append("featureAngle [0-180]");
     argList::addBoolOption
@@ -376,9 +374,6 @@ int main(int argc, char *argv[])
 
 #   include "setRootCase.H"
 #   include "createTime.H"
-
-    instantList timeDirs = timeSelector::select0(runTime, args);
-
 #   include "createMesh.H"
 
     const word oldInstance = mesh.pointsInstance();
diff --git a/applications/utilities/mesh/manipulation/topoSet/topoSetDict b/applications/utilities/mesh/manipulation/topoSet/topoSetDict
index be90a8fb80..7a2049c686 100644
--- a/applications/utilities/mesh/manipulation/topoSet/topoSetDict
+++ b/applications/utilities/mesh/manipulation/topoSet/topoSetDict
@@ -171,13 +171,13 @@ FoamFile
 //        insidePoint (1 2 3);    // point inside region to select
 //    }
 //
-//    // Cells underneath plane such that volume is reached. Can be used
-//    // in setFields.
+//    // Cells underneath plane such that volume is reached. E.g. for use
+//    // in setFields to set the level given a wanted volume.
 //    source targetVolumeToCell;
 //    sourceInfo
 //    {
 //        volume  2e-05;
-//        normal  (1 1 1);
+//        normal  (0 1 0);          // usually in direction of gravity
 //    }
 //
 //
diff --git a/applications/utilities/postProcessing/dataConversion/foamToEnsight/checkMeshMoving.H b/applications/utilities/postProcessing/dataConversion/foamToEnsight/checkMeshMoving.H
index 123036f63a..8657a9cc21 100644
--- a/applications/utilities/postProcessing/dataConversion/foamToEnsight/checkMeshMoving.H
+++ b/applications/utilities/postProcessing/dataConversion/foamToEnsight/checkMeshMoving.H
@@ -1,21 +1,27 @@
-// check for "points" in all of the result directories
+// check for "points" in any of the result directories
 
-bool meshMoving = true;
-if (Times.size() > 2)
+bool meshMoving = false;
+if (Times.size() > 1)
 {
-    for (label n1=2; n1<Times.size() && meshMoving; ++n1)
+    // We already loaded a mesh (usually from constant). See if any other
+    // points files
+    forAll(Times, timeI)
     {
-        meshMoving = IOobject
-        (
-            "points",
-            Times[n1].name(),
-            polyMesh::meshSubDir,
-            mesh,
-            IOobject::NO_READ
-        ).headerOk();
+        if (Times[timeI].name() != mesh.pointsInstance())
+        {
+            IOobject io
+            (
+                "points",
+                Times[timeI].name(),
+                polyMesh::meshSubDir,
+                mesh,
+                IOobject::NO_READ
+            );
+            if (io.headerOk())
+            {
+                meshMoving = true;
+                break;
+            }
+        }
     }
 }
-else
-{
-    meshMoving = false;
-}
diff --git a/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.C b/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.C
index b8fe91fcfe..8a44c5411b 100644
--- a/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.C
+++ b/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -1014,6 +1014,7 @@ void Foam::ensightMesh::write
     const fileName& postProcPath,
     const word& prepend,
     const label timeIndex,
+    const bool meshMoving,
     Ostream& ensightCaseFile
 ) const
 {
@@ -1027,7 +1028,7 @@ void Foam::ensightMesh::write
     {
         timeFile += "000.";
     }
-    else if (mesh_.moving())
+    else if (meshMoving)
     {
         timeFile += itoa(timeIndex) + '.';
     }
diff --git a/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.H b/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.H
index 6d860dfc91..ffcbf61d66 100644
--- a/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.H
+++ b/applications/utilities/postProcessing/dataConversion/foamToEnsight/ensightMesh.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -380,6 +380,7 @@ public:
             const fileName& postProcPath,
             const word& prepend,
             const label timeIndex,
+            const bool meshMoving,
             Ostream& ensightCaseFile
         ) const;
 
diff --git a/applications/utilities/postProcessing/dataConversion/foamToEnsight/foamToEnsight.C b/applications/utilities/postProcessing/dataConversion/foamToEnsight/foamToEnsight.C
index e9a942f38a..05db6c0d05 100644
--- a/applications/utilities/postProcessing/dataConversion/foamToEnsight/foamToEnsight.C
+++ b/applications/utilities/postProcessing/dataConversion/foamToEnsight/foamToEnsight.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -228,6 +228,13 @@ int main(int argc, char *argv[])
 
 #   include "checkMeshMoving.H"
 
+    if (meshMoving)
+    {
+        Info<< "Detected a moving mesh (multiple polyMesh/points files)."
+            << " Writing meshes for every timestep." << endl;
+    }
+
+
     wordHashSet allCloudNames;
     if (Pstream::master())
     {
@@ -346,13 +353,14 @@ int main(int argc, char *argv[])
             eMesh.correct();
         }
 
-        if (timeIndex == 0 || (meshState != polyMesh::UNCHANGED))
+        if (timeIndex == 0 || meshMoving)
         {
             eMesh.write
             (
                 ensightDir,
                 prepend,
                 timeIndex,
+                meshMoving,
                 ensightCaseFile
             );
         }
diff --git a/applications/utilities/preProcessing/setFields/setFields.C b/applications/utilities/preProcessing/setFields/setFields.C
index 41c09b6053..ebc43d84f2 100644
--- a/applications/utilities/preProcessing/setFields/setFields.C
+++ b/applications/utilities/preProcessing/setFields/setFields.C
@@ -27,7 +27,6 @@ Description
 \*---------------------------------------------------------------------------*/
 
 #include "argList.H"
-#include "timeSelector.H"
 #include "Time.H"
 #include "fvMesh.H"
 #include "topoSetSource.H"
@@ -360,14 +359,8 @@ public:
 
 int main(int argc, char *argv[])
 {
-    timeSelector::addOptions();
-
 #   include "setRootCase.H"
 #   include "createTime.H"
-
-    // Get times list
-    instantList timeDirs = timeSelector::select0(runTime, args);
-
 #   include "createMesh.H"
 
     Info<< "Reading setFieldsDict\n" << endl;
diff --git a/applications/utilities/surface/surfaceMeshConvert/surfaceMeshConvert.C b/applications/utilities/surface/surfaceMeshConvert/surfaceMeshConvert.C
index 357b2bd198..305786f963 100644
--- a/applications/utilities/surface/surfaceMeshConvert/surfaceMeshConvert.C
+++ b/applications/utilities/surface/surfaceMeshConvert/surfaceMeshConvert.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -58,7 +58,6 @@ Note
 \*---------------------------------------------------------------------------*/
 
 #include "argList.H"
-#include "timeSelector.H"
 #include "Time.H"
 
 #include "MeshedSurfaces.H"
diff --git a/applications/utilities/surface/surfaceMeshConvertTesting/surfaceMeshConvertTesting.C b/applications/utilities/surface/surfaceMeshConvertTesting/surfaceMeshConvertTesting.C
index 92f0ffbd3d..cbc5059f10 100644
--- a/applications/utilities/surface/surfaceMeshConvertTesting/surfaceMeshConvertTesting.C
+++ b/applications/utilities/surface/surfaceMeshConvertTesting/surfaceMeshConvertTesting.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -52,7 +52,6 @@ Note
 \*---------------------------------------------------------------------------*/
 
 #include "argList.H"
-#include "timeSelector.H"
 #include "Time.H"
 #include "polyMesh.H"
 #include "triSurface.H"
diff --git a/applications/utilities/surface/surfaceMeshExport/surfaceMeshExport.C b/applications/utilities/surface/surfaceMeshExport/surfaceMeshExport.C
index c9b7d62113..7c9b3be904 100644
--- a/applications/utilities/surface/surfaceMeshExport/surfaceMeshExport.C
+++ b/applications/utilities/surface/surfaceMeshExport/surfaceMeshExport.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -59,7 +59,6 @@ Note
 \*---------------------------------------------------------------------------*/
 
 #include "argList.H"
-#include "timeSelector.H"
 #include "Time.H"
 
 #include "MeshedSurfaces.H"
diff --git a/applications/utilities/surface/surfaceMeshImport/surfaceMeshImport.C b/applications/utilities/surface/surfaceMeshImport/surfaceMeshImport.C
index e9f7f63710..3a14ac63c4 100644
--- a/applications/utilities/surface/surfaceMeshImport/surfaceMeshImport.C
+++ b/applications/utilities/surface/surfaceMeshImport/surfaceMeshImport.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -59,7 +59,6 @@ Note
 \*---------------------------------------------------------------------------*/
 
 #include "argList.H"
-#include "timeSelector.H"
 #include "Time.H"
 
 #include "MeshedSurfaces.H"
diff --git a/applications/utilities/surface/surfaceMeshInfo/surfaceMeshInfo.C b/applications/utilities/surface/surfaceMeshInfo/surfaceMeshInfo.C
index 08e6a99b38..80638bf4db 100644
--- a/applications/utilities/surface/surfaceMeshInfo/surfaceMeshInfo.C
+++ b/applications/utilities/surface/surfaceMeshInfo/surfaceMeshInfo.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -56,7 +56,6 @@ Note
 \*---------------------------------------------------------------------------*/
 
 #include "argList.H"
-#include "timeSelector.H"
 #include "Time.H"
 
 #include "UnsortedMeshedSurfaces.H"
diff --git a/src/OpenFOAM/db/IOobjects/IOdictionary/IOdictionaryIO.C b/src/OpenFOAM/db/IOobjects/IOdictionary/IOdictionaryIO.C
index 8585392e27..e620b3b942 100644
--- a/src/OpenFOAM/db/IOobjects/IOdictionary/IOdictionaryIO.C
+++ b/src/OpenFOAM/db/IOobjects/IOdictionary/IOdictionaryIO.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -95,7 +95,9 @@ void Foam::IOdictionary::readFile(const bool masterOnly)
             }
 
             // Note: use ASCII for now - binary IO of dictionaries is
-            // not currently supported
+            // not currently supported or rather the primitiveEntries of
+            // the dictionary think they are in binary form whereas they are
+            // not. Could reset all the ITstreams to ascii?
             IPstream fromAbove
             (
                 Pstream::scheduled,
diff --git a/src/OpenFOAM/db/dictionary/dictionaryIO.C b/src/OpenFOAM/db/dictionary/dictionaryIO.C
index 03ce2b76a7..aa1321d914 100644
--- a/src/OpenFOAM/db/dictionary/dictionaryIO.C
+++ b/src/OpenFOAM/db/dictionary/dictionaryIO.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -80,6 +80,12 @@ Foam::autoPtr<Foam::dictionary> Foam::dictionary::New(Istream& is)
 
 bool Foam::dictionary::read(Istream& is, const bool keepHeader)
 {
+    // Check for empty dictionary
+    if (is.eof())
+    {
+        return true;
+    }
+
     if (!is.good())
     {
         FatalIOErrorIn("dictionary::read(Istream&, bool)", is)
diff --git a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.H b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.H
index 3a3c234821..1f9c51ac9f 100644
--- a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.H
+++ b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalMeshData.H
@@ -323,8 +323,6 @@ class globalMeshData
             // its own master. Maybe store as well?
 
             void calcGlobalCoPointSlaves() const;
-            const labelListList& globalCoPointSlaves() const;
-            const mapDistribute& globalCoPointSlavesMap() const;
 
 
         //- Disallow default bitwise copy construct
@@ -547,6 +545,11 @@ public:
                 //- Is my edge same orientation as master edge
                 const PackedBoolList& globalEdgeOrientation() const;
 
+            // Collocated point to collocated point
+
+                const labelListList& globalCoPointSlaves() const;
+                const mapDistribute& globalCoPointSlavesMap() const;
+
             // Coupled point to boundary faces. These are uncoupled boundary
             // faces only but include empty patches.
 
diff --git a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C
index 7ecd1b84a1..b4333fc3a7 100644
--- a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C
+++ b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -339,6 +339,31 @@ bool Foam::globalPoints::storeInitialInfo
 }
 
 
+void Foam::globalPoints::printProcPoint
+(
+    const labelList& patchToMeshPoint,
+    const labelPair& pointInfo
+) const
+{
+    label procI = globalIndexAndTransform::processor(pointInfo);
+    label index = globalIndexAndTransform::index(pointInfo);
+    label trafoI = globalIndexAndTransform::transformIndex(pointInfo);
+
+    Pout<< "    proc:" << procI;
+    Pout<< " localpoint:";
+    Pout<< index;
+    Pout<< " through transform:"
+        << trafoI << " bits:"
+        << globalTransforms_.decodeTransformIndex(trafoI);
+
+    if (procI == Pstream::myProcNo())
+    {
+        label meshPointI = localToMeshPoint(patchToMeshPoint, index);
+        Pout<< " at:" <<  mesh_.points()[meshPointI];
+    }
+}
+
+
 void Foam::globalPoints::printProcPoints
 (
     const labelList& patchToMeshPoint,
@@ -347,23 +372,7 @@ void Foam::globalPoints::printProcPoints
 {
     forAll(pointInfo, i)
     {
-        label procI = globalIndexAndTransform::processor(pointInfo[i]);
-        label index = globalIndexAndTransform::index(pointInfo[i]);
-        label trafoI = globalIndexAndTransform::transformIndex(pointInfo[i]);
-
-        Pout<< "    proc:" << procI;
-        Pout<< " localpoint:";
-        Pout<< index;
-        Pout<< " through transform:"
-            << trafoI << " bits:"
-            << globalTransforms_.decodeTransformIndex(trafoI);
-
-        if (procI == Pstream::myProcNo())
-        {
-            label meshPointI = localToMeshPoint(patchToMeshPoint, index);
-            Pout<< " at:" <<  mesh_.points()[meshPointI];
-        }
-
+        printProcPoint(patchToMeshPoint, pointInfo[i]);
         Pout<< endl;
     }
 }
diff --git a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H
index daef012fe7..de7a6b88d0 100644
--- a/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H
+++ b/src/OpenFOAM/meshes/polyMesh/globalMeshData/globalPoints.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -206,6 +206,12 @@ class globalPoints
         );
 
         //- Debug printing
+        void printProcPoint
+        (
+            const labelList& patchToMeshPoint,
+            const labelPair& pointInfo
+        ) const;
+
         void printProcPoints
         (
             const labelList& patchToMeshPoint,
diff --git a/src/OpenFOAM/meshes/polyMesh/polyMeshClear.C b/src/OpenFOAM/meshes/polyMesh/polyMeshClear.C
index 9a9830545e..d765e9f60b 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyMeshClear.C
+++ b/src/OpenFOAM/meshes/polyMesh/polyMeshClear.C
@@ -97,6 +97,16 @@ void Foam::polyMesh::clearAddressing()
     geometricD_ = Vector<label>::zero;
     solutionD_ = Vector<label>::zero;
 
+    // Update zones
+    pointZones_.clearAddressing();
+    faceZones_.clearAddressing();
+    cellZones_.clearAddressing();
+
+    // Remove the stored tet base points
+    tetBasePtIsPtr_.clear();
+    // Remove the cell tree
+    cellTreePtr_.clear();
+
     pointMesh::Delete(*this);
 }
 
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryFwd.H b/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryFwd.H
new file mode 100644
index 0000000000..326a2a4259
--- /dev/null
+++ b/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryFwd.H
@@ -0,0 +1,52 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef DataEntryFws_H
+#define DataEntryFws_H
+
+#include "DataEntry.H"
+#include "vector.H"
+#include "symmTensor.H"
+#include "sphericalTensor.H"
+#include "tensor.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    typedef DataEntry<label> labelDataEntry;
+    typedef DataEntry<scalar> scalarDataEntry;
+    typedef DataEntry<vector> vectorDataEntry;
+    typedef DataEntry<symmTensor> symmTensorDataEntry;
+    typedef DataEntry<sphericalTensor> sphericalTensorDataEntry;
+    typedef DataEntry<tensor> tensorDataEntry;
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.C b/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.C
index d015aede93..cfbaec7424 100644
--- a/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.C
+++ b/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.C
@@ -25,14 +25,14 @@ License
 
 #include "polynomial.H"
 #include "Time.H"
+#include "addToRunTimeSelectionTable.H"
 
 // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
 
 namespace Foam
 {
     defineTypeNameAndDebug(polynomial, 0);
-    DataEntry<scalar>::adddictionaryConstructorToTable<polynomial>
-        addpolynomialConstructorToTable_;
+    addToRunTimeSelectionTable(scalarDataEntry, polynomial, dictionary);
 }
 
 
@@ -40,7 +40,7 @@ namespace Foam
 
 Foam::polynomial::polynomial(const word& entryName, const dictionary& dict)
 :
-    DataEntry<scalar>(entryName),
+    scalarDataEntry(entryName),
     coeffs_(),
     canIntegrate_(true),
     dimensions_(dimless)
@@ -52,15 +52,17 @@ Foam::polynomial::polynomial(const word& entryName, const dictionary& dict)
     is.putBack(firstToken);
     if (firstToken == token::BEGIN_SQR)
     {
-        is >> this->dimensions_;
+        is  >> this->dimensions_;
     }
 
     is  >> coeffs_;
 
     if (!coeffs_.size())
     {
-        FatalErrorIn("Foam::polynomial::polynomial(const word&, dictionary&)")
-            << "polynomial coefficients for entry " << this->name_
+        FatalErrorIn
+        (
+            "Foam::polynomial::polynomial(const word&, const dictionary&)"
+        )   << "polynomial coefficients for entry " << this->name_
             << " are invalid (empty)" << nl << exit(FatalError);
     }
 
@@ -77,8 +79,10 @@ Foam::polynomial::polynomial(const word& entryName, const dictionary& dict)
     {
         if (!canIntegrate_)
         {
-            WarningIn("Foam::polynomial::polynomial(const word&, dictionary&)")
-                << "Polynomial " << this->name_ << " cannot be integrated"
+            WarningIn
+            (
+                "Foam::polynomial::polynomial(const word&, const dictionary&)"
+            )   << "Polynomial " << this->name_ << " cannot be integrated"
                 << endl;
         }
     }
@@ -91,7 +95,7 @@ Foam::polynomial::polynomial
     const List<Tuple2<scalar, scalar> >& coeffs
 )
 :
-    DataEntry<scalar>(entryName),
+    scalarDataEntry(entryName),
     coeffs_(coeffs),
     canIntegrate_(true),
     dimensions_(dimless)
@@ -101,7 +105,7 @@ Foam::polynomial::polynomial
         FatalErrorIn
         (
             "Foam::polynomial::polynomial"
-            "(const word&, const List<Tuple2<scalar, scalar> >&&)"
+            "(const word&, const List<Tuple2<scalar, scalar> >&)"
         )   << "polynomial coefficients for entry " << this->name_
             << " are invalid (empty)" << nl << exit(FatalError);
     }
@@ -122,7 +126,7 @@ Foam::polynomial::polynomial
             WarningIn
             (
                 "Foam::polynomial::polynomial"
-                "(const word&, const List<Tuple2<scalar, scalar> >&&)"
+                "(const word&, const List<Tuple2<scalar, scalar> >&)"
             )   << "Polynomial " << this->name_ << " cannot be integrated"
                 << endl;
         }
@@ -132,7 +136,7 @@ Foam::polynomial::polynomial
 
 Foam::polynomial::polynomial(const polynomial& poly)
 :
-    DataEntry<scalar>(poly),
+    scalarDataEntry(poly),
     coeffs_(poly.coeffs_),
     canIntegrate_(poly.canIntegrate_),
     dimensions_(poly.dimensions_)
@@ -201,7 +205,8 @@ Foam::dimensioned<Foam::scalar> Foam::polynomial::dimValue
 
 Foam::dimensioned<Foam::scalar> Foam::polynomial::dimIntegrate
 (
-    const scalar x1, const scalar x2
+    const scalar x1,
+    const scalar x2
 ) const
 {
     return dimensioned<scalar>
@@ -212,4 +217,5 @@ Foam::dimensioned<Foam::scalar> Foam::polynomial::dimIntegrate
     );
 }
 
+
 // ************************************************************************* //
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.H b/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.H
index dc4fc7986b..3e181c0787 100644
--- a/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.H
+++ b/src/OpenFOAM/primitives/functions/DataEntry/polynomial/polynomial.H
@@ -48,6 +48,7 @@ SourceFiles
 #include "DataEntry.H"
 #include "Tuple2.H"
 #include "dimensionSet.H"
+#include "DataEntryFwd.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -70,7 +71,7 @@ Ostream& operator<<
 
 class polynomial
 :
-    public DataEntry<scalar>
+    public scalarDataEntry
 {
     // Private data
 
@@ -107,9 +108,9 @@ public:
         polynomial(const polynomial& poly);
 
         //- Construct and return a clone
-        virtual tmp<DataEntry<scalar> > clone() const
+        virtual tmp<scalarDataEntry> clone() const
         {
-            return tmp<DataEntry<scalar> >(new polynomial(*this));
+            return tmp<scalarDataEntry>(new polynomial(*this));
         }
 
 
diff --git a/src/Pstream/mpi/UIPread.C b/src/Pstream/mpi/UIPread.C
index bcc6f4c412..19d6b16112 100644
--- a/src/Pstream/mpi/UIPread.C
+++ b/src/Pstream/mpi/UIPread.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -107,12 +107,7 @@ Foam::UIPstream::UIPstream
 
         if (!messageSize_)
         {
-            FatalErrorIn
-            (
-                "UIPstream::UIPstream(const commsTypes, const int, "
-                "DynamicList<char>&, streamFormat, versionNumber)"
-            )   << "read failed"
-                << Foam::abort(FatalError);
+            setEof();
         }
     }
 }
@@ -199,11 +194,7 @@ Foam::UIPstream::UIPstream(const int fromProcNo, PstreamBuffers& buffers)
 
         if (!messageSize_)
         {
-            FatalErrorIn
-            (
-                "UIPstream::UIPstream(const int, PstreamBuffers&)"
-            )   << "read failed"
-                << Foam::abort(FatalError);
+            setEof();
         }
     }
 }
diff --git a/src/combustionModels/FSD/FSD.C b/src/combustionModels/FSD/FSD.C
index 26f58505a7..9d86d10384 100644
--- a/src/combustionModels/FSD/FSD.C
+++ b/src/combustionModels/FSD/FSD.C
@@ -272,7 +272,7 @@ void FSD<CombThermoType, ThermoType>::calculateSourceNorm()
 
     forAll(ft_, cellI)
     {
-        if(ft_[cellI] < ftStoich)
+        if (ft_[cellI] < ftStoich)
         {
             pc[cellI] = ft_[cellI]*(YprodTotal/ftStoich);
         }
diff --git a/src/combustionModels/Make/files b/src/combustionModels/Make/files
index 20de91ecc6..88e81afe8b 100644
--- a/src/combustionModels/Make/files
+++ b/src/combustionModels/Make/files
@@ -10,6 +10,7 @@ rhoCombustionModel/rhoCombustionModel/rhoCombustionModelNew.C
 rhoCombustionModel/rhoThermoCombustion/rhoThermoCombustion.C
 rhoCombustionModel/rhoChemistryCombustion/rhoChemistryCombustion.C
 
+diffusion/diffusions.C
 infinitelyFastChemistry/infinitelyFastChemistrys.C
 
 PaSR/PaSRs.C
diff --git a/src/combustionModels/PaSR/PaSR.C b/src/combustionModels/PaSR/PaSR.C
index cd12d896e0..d90eb68357 100644
--- a/src/combustionModels/PaSR/PaSR.C
+++ b/src/combustionModels/PaSR/PaSR.C
@@ -138,7 +138,7 @@ void Foam::combustionModels::PaSR<Type>::correct()
 
 template<class Type>
 Foam::tmp<Foam::fvScalarMatrix>
-Foam::combustionModels::PaSR<Type>::R(const volScalarField& Y) const
+Foam::combustionModels::PaSR<Type>::R(volScalarField& Y) const
 {
     tmp<fvScalarMatrix> tSu(new fvScalarMatrix(Y, dimMass/dimTime));
 
diff --git a/src/combustionModels/PaSR/PaSR.H b/src/combustionModels/PaSR/PaSR.H
index 4c4c3347e5..fba886f8ac 100644
--- a/src/combustionModels/PaSR/PaSR.H
+++ b/src/combustionModels/PaSR/PaSR.H
@@ -103,7 +103,7 @@ public:
             virtual void correct();
 
             //- Fuel consumption rate matrix.
-            virtual tmp<fvScalarMatrix> R(const volScalarField& Y) const;
+            virtual tmp<fvScalarMatrix> R(volScalarField& Y) const;
 
             //- Heat release rate calculated from fuel consumption rate matrix
             virtual tmp<volScalarField> dQ() const;
diff --git a/src/combustionModels/combustionModel/combustionModel.H b/src/combustionModels/combustionModel/combustionModel.H
index 36322adf84..46077de9e4 100644
--- a/src/combustionModels/combustionModel/combustionModel.H
+++ b/src/combustionModels/combustionModel/combustionModel.H
@@ -135,7 +135,7 @@ public:
         virtual void correct() = 0;
 
         //- Fuel consumption rate matrix, i.e. source term for fuel equation
-        virtual tmp<fvScalarMatrix> R(const volScalarField& Y) const = 0;
+        virtual tmp<fvScalarMatrix> R(volScalarField& Y) const = 0;
 
         //- Heat release rate calculated from fuel consumption rate matrix
         virtual tmp<volScalarField> dQ() const = 0;
diff --git a/src/combustionModels/diffusion/diffusion.C b/src/combustionModels/diffusion/diffusion.C
new file mode 100644
index 0000000000..44e413dfc0
--- /dev/null
+++ b/src/combustionModels/diffusion/diffusion.C
@@ -0,0 +1,106 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "diffusion.H"
+#include "fvcGrad.H"
+
+namespace Foam
+{
+namespace combustionModels
+{
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+template<class CombThermoType, class ThermoType>
+diffusion<CombThermoType, ThermoType>::diffusion
+(
+    const word& modelType, const fvMesh& mesh
+)
+:
+    singleStepCombustion<CombThermoType, ThermoType>(modelType, mesh),
+    C_(readScalar(this->coeffs().lookup("C"))),
+    oxidantName_(this->coeffs().template lookupOrDefault<word>("oxidant", "O2"))
+{}
+
+
+// * * * * * * * * * * * * * * * * Destructors * * * * * * * * * * * * * * * //
+
+template<class CombThermoType, class ThermoType>
+diffusion<CombThermoType, ThermoType>::~diffusion()
+{}
+
+
+// * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * * //
+
+template<class CombThermoType, class ThermoType>
+void diffusion<CombThermoType, ThermoType>::correct()
+{
+    this->wFuel_ ==
+        dimensionedScalar("zero", dimMass/pow3(dimLength)/dimTime, 0.0);
+
+    if (this->active())
+    {
+        this->singleMixturePtr_->fresCorrect();
+
+        const label fuelI = this->singleMixturePtr_->fuelIndex();
+
+        const volScalarField& YFuel =
+            this->thermoPtr_->composition().Y()[fuelI];
+
+        if (this->thermoPtr_->composition().contains(oxidantName_))
+        {
+            const volScalarField& YO2 =
+                this->thermoPtr_->composition().Y(oxidantName_);
+
+            this->wFuel_ ==
+                C_*this->turbulence().muEff()
+               *mag(fvc::grad(YFuel) & fvc::grad(YO2))
+               *pos(YFuel)*pos(YO2);
+        }
+    }
+}
+
+
+template<class CombThermoType, class ThermoType>
+bool diffusion<CombThermoType, ThermoType>::read()
+{
+    if (singleStepCombustion<CombThermoType, ThermoType>::read())
+    {
+        this->coeffs().lookup("C") >> C_ ;
+        this->coeffs().readIfPresent("oxidant", oxidantName_);
+        return true;
+    }
+    else
+    {
+        return false;
+    }
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace combustionModels
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
diff --git a/src/combustionModels/diffusion/diffusion.H b/src/combustionModels/diffusion/diffusion.H
new file mode 100644
index 0000000000..c3002a894f
--- /dev/null
+++ b/src/combustionModels/diffusion/diffusion.H
@@ -0,0 +1,122 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::combustionModels::diffusion
+
+Description
+    Simple diffusion-based combustion model based on the principle mixed is
+    burnt. Additional parameter C is used to distribute the heat release rate
+    in time.
+
+SourceFiles
+    diffusion.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef diffusion_H
+#define diffusion_H
+
+#include "singleStepCombustion.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+namespace combustionModels
+{
+
+/*---------------------------------------------------------------------------*\
+                         Class diffusion Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class CombThermoType, class ThermoType>
+class diffusion
+:
+    public singleStepCombustion<CombThermoType, ThermoType>
+{
+    // Private data
+
+        //- Model constant
+        scalar C_;
+
+        //- Name of oxidant - default is "O2"
+        word oxidantName_;
+
+
+    // Private Member Functions
+
+        //- Disallow copy construct
+        diffusion(const diffusion&);
+
+        //- Disallow default bitwise assignment
+        void operator=(const diffusion&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("diffusion");
+
+
+    // Constructors
+
+        //- Construct from components
+        diffusion(const word& modelType, const fvMesh& mesh);
+
+
+    //- Destructor
+    virtual ~diffusion();
+
+
+    // Member Functions
+
+        // Evolution
+
+            //- Correct combustion rate
+            virtual void correct();
+
+
+        // I-O
+
+            //- Update properties
+            virtual bool read();
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace combustionModels
+} // End namespace Foam
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#ifdef NoRepository
+#   include "diffusion.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/combustionModels/diffusion/diffusions.C b/src/combustionModels/diffusion/diffusions.C
new file mode 100644
index 0000000000..73c201f0fc
--- /dev/null
+++ b/src/combustionModels/diffusion/diffusions.C
@@ -0,0 +1,74 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "makeCombustionTypes.H"
+
+#include "thermoPhysicsTypes.H"
+#include "psiThermoCombustion.H"
+#include "rhoThermoCombustion.H"
+#include "diffusion.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+namespace combustionModels
+{
+    makeCombustionTypesThermo
+    (
+        diffusion,
+        psiThermoCombustion,
+        gasThermoPhysics,
+        psiCombustionModel
+    );
+
+    makeCombustionTypesThermo
+    (
+        diffusion,
+        psiThermoCombustion,
+        constGasThermoPhysics,
+        psiCombustionModel
+    );
+
+    makeCombustionTypesThermo
+    (
+        diffusion,
+        rhoThermoCombustion,
+        gasThermoPhysics,
+        rhoCombustionModel
+    );
+
+    makeCombustionTypesThermo
+    (
+        diffusion,
+        rhoThermoCombustion,
+        constGasThermoPhysics,
+        rhoCombustionModel
+    );
+}
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
diff --git a/src/combustionModels/noCombustion/noCombustion.C b/src/combustionModels/noCombustion/noCombustion.C
index 3abdedaf29..aa38aad70f 100644
--- a/src/combustionModels/noCombustion/noCombustion.C
+++ b/src/combustionModels/noCombustion/noCombustion.C
@@ -59,7 +59,7 @@ template<class CombThermoType>
 Foam::tmp<Foam::fvScalarMatrix>
 Foam::combustionModels::noCombustion<CombThermoType>::R
 (
-    const volScalarField& Y
+    volScalarField& Y
 ) const
 {
     tmp<fvScalarMatrix> tSu
diff --git a/src/combustionModels/noCombustion/noCombustion.H b/src/combustionModels/noCombustion/noCombustion.H
index 8e845d43f1..d8f8f39912 100644
--- a/src/combustionModels/noCombustion/noCombustion.H
+++ b/src/combustionModels/noCombustion/noCombustion.H
@@ -84,8 +84,8 @@ public:
             //- Correct combustion rate
             virtual void correct();
 
-            //- Fuel consumption rate matrix.
-            virtual tmp<fvScalarMatrix> R(const volScalarField& Y) const;
+            //- Fuel consumption rate matrix
+            virtual tmp<fvScalarMatrix> R(volScalarField& Y) const;
 
             //- Heat release rate calculated from fuel consumption rate matrix
             virtual tmp<volScalarField> dQ() const;
diff --git a/src/combustionModels/singleStepCombustion/singleStepCombustion.C b/src/combustionModels/singleStepCombustion/singleStepCombustion.C
index aab73f7abf..e3754f0a58 100644
--- a/src/combustionModels/singleStepCombustion/singleStepCombustion.C
+++ b/src/combustionModels/singleStepCombustion/singleStepCombustion.C
@@ -53,7 +53,8 @@ singleStepCombustion<CombThermoType, ThermoType>::singleStepCombustion
         ),
         this->mesh(),
         dimensionedScalar("zero", dimMass/dimVolume/dimTime, 0.0)
-    )
+    ),
+    semiImplicit_(readBool(this->coeffs_.lookup("semiImplicit")))
 {
     if (isA<singleStepReactingMixture<ThermoType> >(this->thermo()))
     {
@@ -79,6 +80,15 @@ singleStepCombustion<CombThermoType, ThermoType>::singleStepCombustion
             << "Please select a thermo package based on "
             << "singleStepReactingMixture" << exit(FatalError);
     }
+
+    if (semiImplicit_)
+    {
+        Info<< "Combustion mode: semi-implicit" << endl;
+    }
+    else
+    {
+        Info<< "Combustion mode: explicit" << endl;
+    }
 }
 
 
@@ -95,17 +105,28 @@ template<class CombThermoType, class ThermoType>
 Foam::tmp<Foam::fvScalarMatrix>
 singleStepCombustion<CombThermoType, ThermoType>::R
 (
-    const volScalarField& Y
+    volScalarField& Y
 ) const
 {
     const label specieI = this->thermoPtr_->composition().species()[Y.name()];
 
-    const volScalarField wSpecie
+    volScalarField wSpecie
     (
         wFuel_*singleMixturePtr_->specieStoichCoeffs()[specieI]
     );
 
-    return wSpecie + fvm::Sp(0.0*wSpecie, Y);
+    if (semiImplicit_)
+    {
+        const label fNorm = singleMixturePtr_->specieProd()[specieI];
+        const volScalarField fres(singleMixturePtr_->fres(specieI));
+        wSpecie /= max(fNorm*(Y - fres), 1e-2);
+
+        return -fNorm*wSpecie*fres + fNorm*fvm::Sp(wSpecie, Y);
+    }
+    else
+    {
+        return wSpecie + fvm::Sp(0.0*wSpecie, Y);
+    }
 }
 
 
@@ -114,7 +135,8 @@ Foam::tmp<Foam::volScalarField>
 singleStepCombustion< CombThermoType, ThermoType>::Sh() const
 {
     const label fuelI = singleMixturePtr_->fuelIndex();
-    const volScalarField& YFuel = this->thermoPtr_->composition().Y(fuelI);
+    volScalarField& YFuel =
+        const_cast<volScalarField&>(this->thermoPtr_->composition().Y(fuelI));
 
     return -singleMixturePtr_->qFuel()*(R(YFuel) & YFuel);
 }
diff --git a/src/combustionModels/singleStepCombustion/singleStepCombustion.H b/src/combustionModels/singleStepCombustion/singleStepCombustion.H
index fd743247b3..7d691396ae 100644
--- a/src/combustionModels/singleStepCombustion/singleStepCombustion.H
+++ b/src/combustionModels/singleStepCombustion/singleStepCombustion.H
@@ -71,6 +71,9 @@ protected:
         //- Fuel consumption rate
         volScalarField wFuel_;
 
+        //- Semi-implicit (true) or explicit (false) treatment
+        bool semiImplicit_;
+
 
 public:
 
@@ -89,7 +92,7 @@ public:
         // Evolution
 
             //- Fuel consumption rate matrix
-            virtual tmp<fvScalarMatrix> R(const volScalarField& Y) const;
+            virtual tmp<fvScalarMatrix> R(volScalarField& Y) const;
 
             //- Heat release rate calculated from fuel consumption rate matrix
             virtual tmp<volScalarField> dQ() const;
diff --git a/src/fieldSources/basicSource/interRegionHeatTransferModel/interRegionHeatTransferModel/interRegionHeatTransferModel.C b/src/fieldSources/basicSource/interRegionHeatTransferModel/interRegionHeatTransferModel/interRegionHeatTransferModel.C
index f9ffec2938..3135f89124 100644
--- a/src/fieldSources/basicSource/interRegionHeatTransferModel/interRegionHeatTransferModel/interRegionHeatTransferModel.C
+++ b/src/fieldSources/basicSource/interRegionHeatTransferModel/interRegionHeatTransferModel/interRegionHeatTransferModel.C
@@ -68,17 +68,11 @@ void Foam::interRegionHeatTransferModel::check()
         }
     }
 
-    if(!secSourceFound)
+    if (!secSourceFound)
     {
         FatalErrorIn
         (
-            "constantHeatTransfer::interRegionHeatTransferModel"
-            "("
-            "   const word& name,"
-            "   const word& modelType,"
-            "   const dictionary& dict,"
-            "   const fvMesh& mesh"
-            ")"
+            "constantHeatTransfer::interRegionHeatTransferModel::check()"
         )   << "Secondary source name not found" << secondarySourceName_
             << " in region " << secondaryMesh.name()
             << nl
@@ -125,9 +119,12 @@ Foam::interRegionHeatTransferModel::interRegionHeatTransferModel
 }
 
 
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
 Foam::interRegionHeatTransferModel::~interRegionHeatTransferModel()
 {}
 
+
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
 
@@ -222,7 +219,7 @@ void Foam::interRegionHeatTransferModel::addSup
                     << endl;
             }
         }
-        else if(h.dimensions() == dimTemperature)
+        else if (h.dimensions() == dimTemperature)
         {
             eEqn += htc_*Tmapped - fvm::Sp(htc_, h);
 
@@ -269,4 +266,6 @@ bool Foam::interRegionHeatTransferModel::read(const dictionary& dict)
         return false;
     }
 }
+
+
 // ************************************************************************* //
diff --git a/src/finiteVolume/fields/fvPatchFields/basic/calculated/calculatedFvPatchField.C b/src/finiteVolume/fields/fvPatchFields/basic/calculated/calculatedFvPatchField.C
index 1f179134fe..79b8c3750e 100644
--- a/src/finiteVolume/fields/fvPatchFields/basic/calculated/calculatedFvPatchField.C
+++ b/src/finiteVolume/fields/fvPatchFields/basic/calculated/calculatedFvPatchField.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -98,20 +98,19 @@ calculatedFvPatchField<Type>::calculatedFvPatchField
 
 
 template<class Type>
-template<class Type2>
 tmp<fvPatchField<Type> > fvPatchField<Type>::NewCalculatedType
 (
-    const fvPatchField<Type2>& pf
+    const fvPatch& p
 )
 {
     typename patchConstructorTable::iterator patchTypeCstrIter =
-        patchConstructorTablePtr_->find(pf.patch().type());
+        patchConstructorTablePtr_->find(p.type());
 
     if (patchTypeCstrIter != patchConstructorTablePtr_->end())
     {
         return patchTypeCstrIter()
         (
-            pf.patch(),
+            p,
             DimensionedField<Type, volMesh>::null()
         );
     }
@@ -121,7 +120,7 @@ tmp<fvPatchField<Type> > fvPatchField<Type>::NewCalculatedType
         (
             new calculatedFvPatchField<Type>
             (
-                pf.patch(),
+                p,
                 DimensionedField<Type, volMesh>::null()
             )
         );
@@ -129,6 +128,17 @@ tmp<fvPatchField<Type> > fvPatchField<Type>::NewCalculatedType
 }
 
 
+template<class Type>
+template<class Type2>
+tmp<fvPatchField<Type> > fvPatchField<Type>::NewCalculatedType
+(
+    const fvPatchField<Type2>& pf
+)
+{
+    return NewCalculatedType(pf.patch());
+}
+
+
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
 template<class Type>
diff --git a/src/finiteVolume/fields/fvPatchFields/fvPatchField/fvPatchField.H b/src/finiteVolume/fields/fvPatchFields/fvPatchField/fvPatchField.H
index 4dc1041ffc..ecace2a051 100644
--- a/src/finiteVolume/fields/fvPatchFields/fvPatchField/fvPatchField.H
+++ b/src/finiteVolume/fields/fvPatchFields/fvPatchField/fvPatchField.H
@@ -257,6 +257,13 @@ public:
             const dictionary&
         );
 
+        //- Return a pointer to a new calculatedFvPatchField created on
+        //  freestore without setting patchField values
+        static tmp<fvPatchField<Type> > NewCalculatedType
+        (
+            const fvPatch&
+        );
+
         //- Return a pointer to a new calculatedFvPatchField created on
         //  freestore without setting patchField values
         template<class Type2>
diff --git a/src/finiteVolume/fields/fvsPatchFields/basic/calculated/calculatedFvsPatchField.C b/src/finiteVolume/fields/fvsPatchFields/basic/calculated/calculatedFvsPatchField.C
index a22514c857..efe80d2f73 100644
--- a/src/finiteVolume/fields/fvsPatchFields/basic/calculated/calculatedFvsPatchField.C
+++ b/src/finiteVolume/fields/fvsPatchFields/basic/calculated/calculatedFvsPatchField.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -97,21 +97,20 @@ calculatedFvsPatchField<Type>::calculatedFvsPatchField
 
 
 template<class Type>
-template<class Type2>
 tmp<fvsPatchField<Type> > fvsPatchField<Type>::NewCalculatedType
 (
-    const fvsPatchField<Type2>& pf
+    const fvPatch& p
 )
 {
     typename patchConstructorTable::iterator patchTypeCstrIter =
-        patchConstructorTablePtr_->find(pf.patch().type());
+        patchConstructorTablePtr_->find(p.type());
 
     if (patchTypeCstrIter != patchConstructorTablePtr_->end())
     {
         return patchTypeCstrIter()
         (
-            pf.patch(),
-            Field<Type>::null()
+            p,
+            DimensionedField<Type, surfaceMesh>::null()
         );
     }
     else
@@ -120,14 +119,25 @@ tmp<fvsPatchField<Type> > fvsPatchField<Type>::NewCalculatedType
         (
             new calculatedFvsPatchField<Type>
             (
-                pf.patch(),
-                Field<Type>::null()
+                p,
+                DimensionedField<Type, surfaceMesh>::null()
             )
         );
     }
 }
 
 
+template<class Type>
+template<class Type2>
+tmp<fvsPatchField<Type> > fvsPatchField<Type>::NewCalculatedType
+(
+    const fvsPatchField<Type2>& pf
+)
+{
+    return NewCalculatedType(pf.patch());
+}
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 } // End namespace Foam
diff --git a/src/finiteVolume/fields/fvsPatchFields/fvsPatchField/fvsPatchField.H b/src/finiteVolume/fields/fvsPatchFields/fvsPatchField/fvsPatchField.H
index 7da763f09f..88fb9a7d58 100644
--- a/src/finiteVolume/fields/fvsPatchFields/fvsPatchField/fvsPatchField.H
+++ b/src/finiteVolume/fields/fvsPatchFields/fvsPatchField/fvsPatchField.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -247,6 +247,13 @@ public:
             const dictionary&
         );
 
+        //- Return a pointer to a new calculatedFvsPatchField created on
+        //  freestore without setting patchField values
+        static tmp<fvsPatchField<Type> > NewCalculatedType
+        (
+            const fvPatch&
+        );
+
         //- Return a pointer to a new calculatedFvsPatchField created on
         //  freestore without setting patchField values
         template<class Type2>
diff --git a/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.C b/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.C
index 84f04e3a94..1cb9326e32 100644
--- a/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.C
+++ b/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -302,6 +302,43 @@ interpolate
 }
 
 
+template<class Type>
+tmp<FieldField<fvsPatchField, Type> > interpolate
+(
+    const FieldField<fvPatchField, Type>& fvpff
+)
+{
+    FieldField<fvsPatchField, Type>* fvspffPtr
+    (
+        new FieldField<fvsPatchField, Type>(fvpff.size())
+    );
+
+    forAll(*fvspffPtr, patchi)
+    {
+        fvspffPtr->set
+        (
+            patchi,
+            fvsPatchField<Type>::NewCalculatedType(fvpff[patchi].patch()).ptr()
+        );
+        (*fvspffPtr)[patchi] = fvpff[patchi];
+    }
+
+    return tmp<FieldField<fvsPatchField, Type> >(fvspffPtr);
+}
+
+
+template<class Type>
+tmp<FieldField<fvsPatchField, Type> > interpolate
+(
+    const tmp<FieldField<fvPatchField, Type> >& tfvpff
+)
+{
+    tmp<FieldField<fvsPatchField, Type> > tfvspff = interpolate(tfvpff());
+    tfvpff.clear();
+    return tfvspff;
+}
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 } // End namespace fvc
diff --git a/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.H b/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.H
index 00c0da4f65..f6f0cf04b6 100644
--- a/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.H
+++ b/src/finiteVolume/interpolation/surfaceInterpolation/surfaceInterpolation/surfaceInterpolate.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -163,12 +163,26 @@ namespace fvc
         const tmp<GeometricField<Type, fvPatchField, volMesh> >& tvf
     );
 
-    //- Interpolate tmp field onto faces using 'interpolate(\<name\>)'
+    //- Interpolate field onto faces using 'interpolate(\<name\>)'
     template<class Type>
     static tmp<GeometricField<Type, fvsPatchField, surfaceMesh> > interpolate
     (
         const GeometricField<Type, fvPatchField, volMesh>& tvf
     );
+
+    //- Interpolate boundary field onto faces (simply a type conversion)
+    template<class Type>
+    static tmp<FieldField<fvsPatchField, Type> > interpolate
+    (
+        const FieldField<fvPatchField, Type>& fvpff
+    );
+
+    //- Interpolate boundary field onto faces (simply a type conversion)
+    template<class Type>
+    static tmp<FieldField<fvsPatchField, Type> > interpolate
+    (
+        const tmp<FieldField<fvPatchField, Type> >& tfvpff
+    );
 }
 
 
diff --git a/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolate.C b/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolate.C
index 1e0aa90e41..0f2b751bbd 100644
--- a/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolate.C
+++ b/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolate.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -51,8 +51,8 @@ void volPointInterpolation::syncUntransformedData
     const indirectPrimitivePatch& cpp = gmd.coupledPatch();
     const labelList& meshPoints = cpp.meshPoints();
 
-    const mapDistribute& slavesMap = gmd.globalPointSlavesMap();
-    const labelListList& slaves = gmd.globalPointSlaves();
+    const mapDistribute& slavesMap = gmd.globalCoPointSlavesMap();
+    const labelListList& slaves = gmd.globalCoPointSlaves();
 
     List<Type> elems(slavesMap.constructSize());
     forAll(meshPoints, i)
@@ -105,8 +105,8 @@ void volPointInterpolation::pushUntransformedData
     const indirectPrimitivePatch& cpp = gmd.coupledPatch();
     const labelList& meshPoints = cpp.meshPoints();
 
-    const mapDistribute& slavesMap = gmd.globalPointSlavesMap();
-    const labelListList& slaves = gmd.globalPointSlaves();
+    const mapDistribute& slavesMap = gmd.globalCoPointSlavesMap();
+    const labelListList& slaves = gmd.globalCoPointSlaves();
 
     List<Type> elems(slavesMap.constructSize());
     forAll(meshPoints, i)
@@ -155,14 +155,14 @@ void volPointInterpolation::addSeparated
             refCast<coupledPointPatchField<Type> >
                 (pf.boundaryField()[patchI]).initSwapAddSeparated
                 (
-                    Pstream::blocking,  //Pstream::nonBlocking,
+                    Pstream::nonBlocking,
                     pf.internalField()
                 );
         }
     }
 
     // Block for any outstanding requests
-    //Pstream::waitRequests();
+    Pstream::waitRequests();
 
     forAll(pf.boundaryField(), patchI)
     {
@@ -171,7 +171,7 @@ void volPointInterpolation::addSeparated
             refCast<coupledPointPatchField<Type> >
                 (pf.boundaryField()[patchI]).swapAddSeparated
                 (
-                    Pstream::blocking,  //Pstream::nonBlocking,
+                    Pstream::nonBlocking,
                     pf.internalField()
                 );
         }
@@ -306,7 +306,6 @@ void volPointInterpolation::interpolateBoundaryField
     }
 
     // Sum collocated contributions
-    //mesh().globalData().syncPointData(pfi, plusEqOp<Type>());
     syncUntransformedData(pfi, plusEqOp<Type>());
 
     // And add separated contributions
@@ -314,9 +313,7 @@ void volPointInterpolation::interpolateBoundaryField
 
     // Push master data to slaves. It is possible (not sure how often) for
     // a coupled point to have its master on a different patch so
-    // to make sure just push master data to slaves. Reuse the syncPointData
-    // structure.
-    //mesh().globalData().syncPointData(pfi, nopEqOp<Type>());
+    // to make sure just push master data to slaves.
     pushUntransformedData(pfi);
 
 
diff --git a/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolation.C b/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolation.C
index cb47e0a101..87305f2fa8 100644
--- a/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolation.C
+++ b/src/finiteVolume/interpolation/volPointInterpolation/volPointInterpolation.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -113,10 +113,8 @@ void volPointInterpolation::calcBoundaryAddressing()
     {
         boolList oldData(isPatchPoint_);
 
-        //mesh().globalData().syncPointData(isPatchPoint_, orEqOp<bool>());
         syncUntransformedData(isPatchPoint_, orEqOp<bool>());
 
-
         forAll(isPatchPoint_, pointI)
         {
             if (isPatchPoint_[pointI] != oldData[pointI])
@@ -272,7 +270,7 @@ void volPointInterpolation::makeWeights()
     makeInternalWeights(sumWeights);
 
 
-    // Create boundary weights; add to sumWeights
+    // Create boundary weights; override sumWeights
     makeBoundaryWeights(sumWeights);
 
 
@@ -292,7 +290,6 @@ void volPointInterpolation::makeWeights()
 
 
     // Sum collocated contributions
-    //mesh().globalData().syncPointData(sumWeights, plusEqOp<scalar>());
     syncUntransformedData(sumWeights, plusEqOp<scalar>());
 
     // And add separated contributions
@@ -302,7 +299,6 @@ void volPointInterpolation::makeWeights()
     // a coupled point to have its master on a different patch so
     // to make sure just push master data to slaves. Reuse the syncPointData
     // structure.
-    //mesh().globalData().syncPointData(sumWeights, nopEqOp<scalar>());
     pushUntransformedData(sumWeights);
 
 
diff --git a/src/lagrangian/coalCombustion/Make/files b/src/lagrangian/coalCombustion/Make/files
index 019781420d..f3d07eaa1f 100644
--- a/src/lagrangian/coalCombustion/Make/files
+++ b/src/lagrangian/coalCombustion/Make/files
@@ -1,4 +1,5 @@
 /* Coal parcel and sub-models */
 coalParcel/makeCoalParcelSubmodels.C
+coalCloudList/coalCloudList.C
 
 LIB = $(FOAM_LIBBIN)/libcoalCombustion
diff --git a/src/lagrangian/coalCombustion/coalCloudList/coalCloudList.C b/src/lagrangian/coalCombustion/coalCloudList/coalCloudList.C
new file mode 100644
index 0000000000..548e81d216
--- /dev/null
+++ b/src/lagrangian/coalCombustion/coalCloudList/coalCloudList.C
@@ -0,0 +1,92 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "coalCloudList.H"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::coalCloudList::coalCloudList
+(
+    const volScalarField& rho,
+    const volVectorField& U,
+    const dimensionedVector& g,
+    const SLGThermo& slgThermo
+)
+:
+    PtrList<coalCloud>(),
+    mesh_(rho.mesh())
+{
+    IOdictionary props
+    (
+        IOobject
+        (
+            "coalCloudList",
+            mesh_.time().constant(),
+            mesh_,
+            IOobject::MUST_READ
+        )
+    );
+
+    const wordHashSet cloudNames(wordList(props.lookup("clouds")));
+
+    setSize(cloudNames.size());
+
+    label i = 0;
+    forAllConstIter(wordHashSet, cloudNames, iter)
+    {
+        const word& name = iter.key();
+
+        Info<< "creating cloud: " << name << endl;
+
+        set
+        (
+            i++,
+            new coalCloud
+            (
+                name,
+                rho,
+                U,
+                g,
+                slgThermo
+            )
+        );
+
+        Info<< endl;
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::coalCloudList::evolve()
+{
+    forAll(*this, i)
+    {
+        operator[](i).evolve();
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/src/lagrangian/coalCombustion/coalCloudList/coalCloudList.H b/src/lagrangian/coalCombustion/coalCloudList/coalCloudList.H
new file mode 100644
index 0000000000..1a023e27ba
--- /dev/null
+++ b/src/lagrangian/coalCombustion/coalCloudList/coalCloudList.H
@@ -0,0 +1,126 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef coalCloudList_H
+#define coalCloudList_H
+
+#include "coalCloud.H"
+#include "volFieldsFwd.H"
+#include "fvMatricesFwd.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                       Class coalCloudList Declaration
+\*---------------------------------------------------------------------------*/
+
+class coalCloudList
+:
+    public PtrList<coalCloud>
+{
+private:
+
+    //- Reference to the mesh
+    const fvMesh& mesh_;
+
+
+public:
+
+    // Constructor
+
+        coalCloudList
+        (
+            const volScalarField& rho,
+            const volVectorField& U,
+            const dimensionedVector& g,
+            const SLGThermo& slgThermo
+        );
+
+
+    // Member Functions
+
+        // Evolution
+
+            //- Evolve the cloud collection
+            void evolve();
+
+
+        // Source terms
+
+            //- Return const reference to momentum source
+            inline tmp<DimensionedField<vector, volMesh> > UTrans() const;
+
+            //- Return tmp momentum source term
+            inline tmp<fvVectorMatrix> SU(volVectorField& U) const;
+
+            //- Sensible enthalpy transfer [J/kg]
+            inline tmp<DimensionedField<scalar, volMesh> > hsTrans() const;
+
+            //- Return sensible enthalpy source term [J/kg/m3/s]
+            inline tmp<fvScalarMatrix> Sh(volScalarField& hs) const;
+
+
+            //- Return mass source term for specie i - specie eqn
+            inline tmp<fvScalarMatrix> SYi
+            (
+                const label i,
+                volScalarField& Yi
+            ) const;
+
+            //- Return total mass transfer [kg/m3]
+            inline tmp<DimensionedField<scalar, volMesh> > rhoTrans() const;
+
+            //- Return tmp total mass source for carrier phase
+            //  - fully explicit
+            inline tmp<DimensionedField<scalar, volMesh> > Srho() const;
+
+            //- Return tmp total mass source for carrier phase specie i
+            //  - fully explicit
+            inline tmp<DimensionedField<scalar, volMesh> > Srho
+            (
+                const label i
+            ) const;
+
+            //- Return total mass source term [kg/m3/s]
+            inline tmp<fvScalarMatrix> Srho(volScalarField& rho) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#include "coalCloudListI.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/lagrangian/coalCombustion/coalCloudList/coalCloudListI.H b/src/lagrangian/coalCombustion/coalCloudList/coalCloudListI.H
new file mode 100644
index 0000000000..005d9ef604
--- /dev/null
+++ b/src/lagrangian/coalCombustion/coalCloudList/coalCloudListI.H
@@ -0,0 +1,262 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "fvMatrices.H"
+#include "volFields.H"
+#include "DimensionedField.H"
+
+Foam::tmp<Foam::DimensionedField<Foam::vector, Foam::volMesh> >
+Foam::coalCloudList::UTrans() const
+{
+    tmp<DimensionedField<vector, volMesh> > tfld
+    (
+        new DimensionedField<vector, volMesh>
+        (
+            IOobject
+            (
+                "UTransEff",
+                mesh_.time().timeName(),
+                mesh_,
+                IOobject::NO_READ,
+                IOobject::NO_WRITE
+            ),
+            mesh_,
+            dimensionedVector("zero", dimMass*dimVelocity, vector::zero)
+        )
+    );
+
+    DimensionedField<vector, volMesh>& fld = tfld();
+
+    forAll(*this, i)
+    {
+        fld += operator[](i).UTrans();
+    }
+
+    return tfld;
+}
+
+
+Foam::tmp<Foam::fvVectorMatrix> Foam::coalCloudList::SU
+(
+    volVectorField& U
+) const
+{
+    tmp<fvVectorMatrix> tfvm(new fvVectorMatrix(U, dimForce));
+    fvVectorMatrix& fvm = tfvm();
+
+    forAll(*this, i)
+    {
+        fvm += operator[](i).SU(U);
+    }
+
+    return tfvm;
+}
+
+
+Foam::tmp<Foam::DimensionedField<Foam::scalar, Foam::volMesh> >
+Foam::coalCloudList::hsTrans() const
+{
+    tmp<DimensionedField<scalar, volMesh> > tfld
+    (
+        new DimensionedField<scalar, volMesh>
+        (
+            IOobject
+            (
+                "hsTransEff",
+                mesh_.time().timeName(),
+                mesh_,
+                IOobject::NO_READ,
+                IOobject::NO_WRITE
+            ),
+            mesh_,
+            dimensionedScalar("zero", dimEnergy, 0.0)
+        )
+    );
+
+    DimensionedField<scalar, volMesh>& fld = tfld();
+
+    forAll(*this, i)
+    {
+        fld += operator[](i).hsTrans();
+    }
+
+    return tfld;
+}
+
+
+Foam::tmp<Foam::fvScalarMatrix> Foam::coalCloudList::Sh
+(
+    volScalarField& hs
+) const
+{
+    tmp<fvScalarMatrix> tfvm(new fvScalarMatrix(hs, dimEnergy/dimTime));
+    fvScalarMatrix& fvm = tfvm();
+
+    forAll(*this, i)
+    {
+        fvm += operator[](i).Sh(hs);
+    }
+
+    return tfvm;
+}
+
+
+Foam::tmp<Foam::fvScalarMatrix> Foam::coalCloudList::SYi
+(
+    const label ii,
+    volScalarField& Yi
+) const
+{
+    tmp<fvScalarMatrix> tfvm(new fvScalarMatrix(Yi, dimMass/dimTime));
+    fvScalarMatrix& fvm = tfvm();
+
+    forAll(*this, i)
+    {
+        fvm += operator[](i).SYi(ii, Yi);
+    }
+
+    return tfvm;
+}
+
+
+Foam::tmp<Foam::DimensionedField<Foam::scalar, Foam::volMesh> >
+Foam::coalCloudList::rhoTrans() const
+{
+    tmp<DimensionedField<scalar, volMesh> > tfld
+    (
+        new DimensionedField<scalar, volMesh>
+        (
+            IOobject
+            (
+                "rhoTransEff",
+                mesh_.time().timeName(),
+                mesh_,
+                IOobject::NO_READ,
+                IOobject::NO_WRITE
+            ),
+            mesh_,
+            dimensionedScalar("zero", dimMass, 0.0)
+        )
+    );
+
+    DimensionedField<scalar, volMesh>& fld = tfld();
+
+    forAll(*this, i)
+    {
+        forAll(operator[](i).rhoTrans(), j)
+        {
+            fld += operator[](i).rhoTrans()[j];
+        }
+    }
+
+    return tfld;
+}
+
+
+
+
+Foam::tmp<Foam::DimensionedField<Foam::scalar, Foam::volMesh> >
+Foam::coalCloudList::Srho() const
+{
+    tmp<DimensionedField<scalar, volMesh> > tfld
+    (
+        new DimensionedField<scalar, volMesh>
+        (
+            IOobject
+            (
+                "rhoTransEff",
+                mesh_.time().timeName(),
+                mesh_,
+                IOobject::NO_READ,
+                IOobject::NO_WRITE
+            ),
+            mesh_,
+            dimensionedScalar("zero", dimDensity/dimTime, 0.0)
+        )
+    );
+
+    DimensionedField<scalar, volMesh>& fld = tfld();
+
+    forAll(*this, i)
+    {
+        fld += operator[](i).Srho();
+    }
+
+    return tfld;
+}
+
+
+Foam::tmp<Foam::DimensionedField<Foam::scalar, Foam::volMesh> >
+Foam::coalCloudList::Srho
+(
+    const label i
+) const
+{
+    tmp<DimensionedField<scalar, volMesh> > tfld
+    (
+        new DimensionedField<scalar, volMesh>
+        (
+            IOobject
+            (
+                "rhoTransEff",
+                mesh_.time().timeName(),
+                mesh_,
+                IOobject::NO_READ,
+                IOobject::NO_WRITE
+            ),
+            mesh_,
+            dimensionedScalar("zero", dimDensity/dimTime, 0.0)
+        )
+    );
+
+    DimensionedField<scalar, volMesh>& fld = tfld();
+
+    forAll(*this, j)
+    {
+        fld += operator[](j).Srho(i);
+    }
+
+    return tfld;
+}
+
+
+Foam::tmp<Foam::fvScalarMatrix> Foam::coalCloudList::Srho
+(
+    volScalarField& rho
+) const
+{
+    tmp<fvScalarMatrix> tfvm(new fvScalarMatrix(rho, dimMass/dimTime));
+    fvScalarMatrix& fvm = tfvm();
+
+    forAll(*this, i)
+    {
+        fvm += operator[](i).Srho(rho);
+    }
+
+    return tfvm;
+}
+
+
+// ************************************************************************* //
diff --git a/src/lagrangian/coalCombustion/include/makeCoalParcelSurfaceReactionModels.H b/src/lagrangian/coalCombustion/include/makeCoalParcelSurfaceReactionModels.H
index 37627758ff..2df26d9a3c 100644
--- a/src/lagrangian/coalCombustion/include/makeCoalParcelSurfaceReactionModels.H
+++ b/src/lagrangian/coalCombustion/include/makeCoalParcelSurfaceReactionModels.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -31,6 +31,7 @@ License
 #include "NoSurfaceReaction.H"
 #include "COxidationDiffusionLimitedRate.H"
 #include "COxidationKineticDiffusionLimitedRate.H"
+#include "COxidationHurtMitchell.H"
 #include "COxidationMurphyShaddix.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@@ -43,6 +44,7 @@ License
         COxidationKineticDiffusionLimitedRate,                                \
         CloudType                                                             \
     );                                                                        \
+    makeSurfaceReactionModelType(COxidationHurtMitchell, CloudType);          \
     makeSurfaceReactionModelType(COxidationMurphyShaddix, CloudType);
 
 
diff --git a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationHurtMitchell/COxidationHurtMitchell.C b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationHurtMitchell/COxidationHurtMitchell.C
new file mode 100644
index 0000000000..c3ecbbffaf
--- /dev/null
+++ b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationHurtMitchell/COxidationHurtMitchell.C
@@ -0,0 +1,206 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "COxidationHurtMitchell.H"
+#include "mathematicalConstants.H"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::COxidationHurtMitchell<CloudType>::COxidationHurtMitchell
+(
+    const dictionary& dict,
+    CloudType& owner
+)
+:
+    SurfaceReactionModel<CloudType>(dict, owner, typeName),
+    Sb_(readScalar(this->coeffDict().lookup("Sb"))),
+    CsLocalId_(-1),
+    ashLocalId_(-1),
+    O2GlobalId_(owner.composition().globalCarrierId("O2")),
+    CO2GlobalId_(owner.composition().globalCarrierId("CO2")),
+    WC_(0.0),
+    WO2_(0.0),
+    HcCO2_(0.0),
+    heatOfReaction_(-1.0)
+{
+    // Determine Cs and ash ids
+    label idSolid = owner.composition().idSolid();
+    CsLocalId_ = owner.composition().localId(idSolid, "C");
+    ashLocalId_ = owner.composition().localId(idSolid, "ash", true);
+
+    // Set local copies of thermo properties
+    WO2_ = owner.thermo().carrier().W(O2GlobalId_);
+    const scalar WCO2 = owner.thermo().carrier().W(CO2GlobalId_);
+    WC_ = WCO2 - WO2_;
+
+    HcCO2_ = owner.thermo().carrier().Hc(CO2GlobalId_);
+
+    const scalar YCloc = owner.composition().Y0(idSolid)[CsLocalId_];
+    const scalar YSolidTot = owner.composition().YMixture0()[idSolid];
+    Info<< "    C(s): particle mass fraction = " << YCloc*YSolidTot << endl;
+
+    if (this->coeffDict().readIfPresent("heatOfReaction", heatOfReaction_))
+    {
+        Info<< "    Using user specified heat of reaction: "
+            << heatOfReaction_ << " [J/kg]" << endl;
+    }
+}
+
+
+template<class CloudType>
+Foam::COxidationHurtMitchell<CloudType>::COxidationHurtMitchell
+(
+    const COxidationHurtMitchell<CloudType>& srm
+)
+:
+    SurfaceReactionModel<CloudType>(srm),
+    Sb_(srm.Sb_),
+    CsLocalId_(srm.CsLocalId_),
+    ashLocalId_(srm.ashLocalId_),
+    O2GlobalId_(srm.O2GlobalId_),
+    CO2GlobalId_(srm.CO2GlobalId_),
+    WC_(srm.WC_),
+    WO2_(srm.WO2_),
+    HcCO2_(srm.HcCO2_),
+    heatOfReaction_(srm.heatOfReaction_)
+{}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::COxidationHurtMitchell<CloudType>::~COxidationHurtMitchell()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::scalar Foam::COxidationHurtMitchell<CloudType>::calculate
+(
+    const scalar dt,
+    const label cellI,
+    const scalar d,
+    const scalar T,
+    const scalar Tc,
+    const scalar pc,
+    const scalar rhoc,
+    const scalar mass,
+    const scalarField& YGas,
+    const scalarField& YLiquid,
+    const scalarField& YSolid,
+    const scalarField& YMixture,
+    const scalar N,
+    scalarField& dMassGas,
+    scalarField& dMassLiquid,
+    scalarField& dMassSolid,
+    scalarField& dMassSRCarrier
+) const
+{
+    const label idGas = CloudType::parcelType::GAS;
+    const label idSolid = CloudType::parcelType::SLD;
+    const scalar Ychar = YMixture[idSolid]*YSolid[CsLocalId_];
+
+    // Surface combustion until combustible fraction is consumed
+    if (Ychar < SMALL)
+    {
+        return 0.0;
+    }
+
+    const SLGThermo& thermo = this->owner().thermo();
+
+    // Local mass fraction of O2 in the carrier phase
+    const scalar YO2 = thermo.carrier().Y(O2GlobalId_)[cellI];
+
+    // No combustion if no oxygen present
+    if (YO2 < SMALL)
+    {
+        return 0.0;
+    }
+
+    // Conversion from [g/cm^2) to [kg/m^2]
+    const scalar convSI = 1000.0/10000.0;
+
+    // Universal gas constant in [kcal/mol/K]
+    const scalar RRcal = 1985.877534;
+
+    // Dry mass fraction
+    scalar Ydaf = YMixture[idGas] + YMixture[idSolid];
+    if (ashLocalId_ != -1)
+    {
+        Ydaf -= YMixture[idSolid]*YSolid[ashLocalId_];
+    }
+
+    // Char percentage
+    const scalar charPrc = Ychar/Ydaf*100.0;
+
+    // Particle surface area
+    const scalar Ap = constant::mathematical::pi*sqr(d);
+
+    // Far field partial pressure O2 [Pa]
+    // Note: Should really use the surface partial pressure
+    const scalar ppO2 = max(0.0, rhoc*YO2/WO2_*specie::RR*Tc);
+
+    // Activation energy [kcal/mol]
+    const scalar E = -5.94 + 0.355*charPrc;
+
+    // Pre-exponential factor [g/(cm^2.s.atm^0.5)]
+    const scalar lnK1750 = 2.8 - 0.0758*charPrc;
+    const scalar A = exp(lnK1750 + E/RRcal/1750.0);
+
+    // Kinetic rate of char oxidation [g/(cm^2.s.atm^0.5)]
+    const scalar Rk = A*exp(-E/(RRcal*T));
+
+    // Molar reaction rate per unit surface area [kmol/(m^2.s)]
+    const scalar qCsLim = mass*Ychar/(WC_*Ap*dt);
+    const scalar qCs = min(convSI*Rk*Foam::sqrt(ppO2/101325.0), qCsLim);
+
+    // Calculate the number of molar units reacted [kmol]
+    const scalar dOmega = qCs*Ap*dt;
+
+    // Add to carrier phase mass transfer
+    dMassSRCarrier[O2GlobalId_] += -dOmega*Sb_*WO2_;
+    dMassSRCarrier[CO2GlobalId_] += dOmega*(WC_ + Sb_*WO2_);
+
+    // Add to particle mass transfer
+    dMassSolid[CsLocalId_] += dOmega*WC_;
+
+
+    // Return the heat of reaction [J]
+    // note: carrier sensible enthalpy exchange handled via change in mass
+    if (heatOfReaction_ < 0)
+    {
+        const scalar HsC = thermo.solids().properties()[CsLocalId_].Hs(T);
+        return dOmega*(WC_*HsC - (WC_ + Sb_*WO2_)*HcCO2_);
+    }
+    else
+    {
+        return dOmega*WC_*heatOfReaction_;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationHurtMitchell/COxidationHurtMitchell.H b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationHurtMitchell/COxidationHurtMitchell.H
new file mode 100644
index 0000000000..cd7800328f
--- /dev/null
+++ b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationHurtMitchell/COxidationHurtMitchell.H
@@ -0,0 +1,184 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    COxidationHurtMitchell
+
+Description
+    Char oxidation model given by Hurt and Mitchell:
+
+    Based on the reference:
+        Hurt R. and Mitchell R., "Unified high-temperature char combustion
+        kinetics for a suite of coals of various rank", 24th Symposium in
+        Combustion, The Combustion Institute, 1992, p 1243-1250
+
+    Model specifies the rate of char combustion.
+
+        C(s) + Sb*O2 -> CO2
+
+    where Sb is the stoichiometry of the reaction
+
+    Model validity:
+        Gas temperature: Tc > 1500 K
+        Particle sizes:  75 um -> 200 um
+        Pox > 0.3 atm        
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef COxidationHurtMitchell_H
+#define COxidationHurtMitchell_H
+
+#include "SurfaceReactionModel.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// Forward class declarations
+template<class CloudType>
+class COxidationHurtMitchell;
+
+/*---------------------------------------------------------------------------*\
+                  Class COxidationHurtMitchell Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class CloudType>
+class COxidationHurtMitchell
+:
+    public SurfaceReactionModel<CloudType>
+{
+    // Private data
+
+        // Model constants
+
+            //- Stoichiometry of reaction
+            const scalar Sb_;
+
+
+        // Addressing
+
+            //- Cs position in global/local lists
+            label CsLocalId_;
+
+            //- Ash position in global/local lists
+            label ashLocalId_;
+
+            //- O2 position in global list
+            label O2GlobalId_;
+
+            //- CO2 positions in global list
+            label CO2GlobalId_;
+
+
+        // Local copies of thermo properties
+
+            //- Molecular weight of C [kg/kmol]
+            scalar WC_;
+
+            //- Molecular weight of O2 [kg/kmol]
+            scalar WO2_;
+
+            //- Formation enthalpy for CO2 [J/kg]
+            scalar HcCO2_;
+
+            //- Heat of reaction [J/kg] (optional)
+            scalar heatOfReaction_;
+
+
+public:
+
+    //- Runtime type information
+    TypeName("COxidationHurtMitchell");
+
+
+    // Constructors
+
+        //- Construct from dictionary
+        COxidationHurtMitchell
+        (
+            const dictionary& dict,
+            CloudType& owner
+        );
+
+        //- Construct copy
+        COxidationHurtMitchell
+        (
+            const COxidationHurtMitchell<CloudType>& srm
+        );
+
+        //- Construct and return a clone
+        virtual autoPtr<SurfaceReactionModel<CloudType> > clone() const
+        {
+            return autoPtr<SurfaceReactionModel<CloudType> >
+            (
+                new COxidationHurtMitchell<CloudType>(*this)
+            );
+        }
+
+
+    //- Destructor
+    virtual ~COxidationHurtMitchell();
+
+
+    // Member Functions
+
+        //- Update surface reactions
+        virtual scalar calculate
+        (
+            const scalar dt,
+            const label cellI,
+            const scalar d,
+            const scalar T,
+            const scalar Tc,
+            const scalar pc,
+            const scalar rhoc,
+            const scalar mass,
+            const scalarField& YGas,
+            const scalarField& YLiquid,
+            const scalarField& YSolid,
+            const scalarField& YMixture,
+            const scalar N,
+            scalarField& dMassGas,
+            scalarField& dMassLiquid,
+            scalarField& dMassSolid,
+            scalarField& dMassSRCarrier
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#ifdef NoRepository
+    #include "COxidationHurtMitchell.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/lagrangian/dsmc/submodels/BinaryCollisionModel/NoBinaryCollision/NoBinaryCollision.C b/src/lagrangian/dsmc/submodels/BinaryCollisionModel/NoBinaryCollision/NoBinaryCollision.C
index 867518e11b..f5fc9ec038 100644
--- a/src/lagrangian/dsmc/submodels/BinaryCollisionModel/NoBinaryCollision/NoBinaryCollision.C
+++ b/src/lagrangian/dsmc/submodels/BinaryCollisionModel/NoBinaryCollision/NoBinaryCollision.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -68,15 +68,13 @@ Foam::scalar Foam::NoBinaryCollision<CloudType>::sigmaTcR
     (
         "Foam::scalar Foam::NoBinaryCollision<CloudType>::sigmaTcR"
         "("
-            "label typeIdP,"
-            "label typeIdQ,"
-            "const vector& UP,"
-            "const vector& UQ"
+            "const typename CloudType::parcelType&, "
+            "const typename CloudType::parcelType"
         ") const"
     )
         << "sigmaTcR called on NoBinaryCollision model, this should "
         << "not happen, this is not an actual model." << nl
-        << "Enclose calls to sigmaTcR within a if(binaryCollision().active()) "
+        << "Enclose calls to sigmaTcR within a if (binaryCollision().active()) "
         << " check."
         << abort(FatalError);
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C
index b43c3fc690..3ca019fa4e 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C
@@ -661,7 +661,7 @@ void Foam::KinematicCloud<CloudType>::evolve()
 
 template<class CloudType>
 template<class TrackData>
-void  Foam::KinematicCloud<CloudType>::motion(TrackData& td)
+void Foam::KinematicCloud<CloudType>::motion(TrackData& td)
 {
     td.part() = TrackData::tpLinearTrack;
     CloudType::move(td,  solution_.trackTime());
@@ -670,6 +670,159 @@ void  Foam::KinematicCloud<CloudType>::motion(TrackData& td)
 }
 
 
+template<class CloudType>
+void Foam::KinematicCloud<CloudType>::patchData
+(
+    const parcelType& p,
+    const polyPatch& pp,
+    const scalar trackFraction,
+    const tetIndices& tetIs,
+    vector& nw,
+    vector& Up
+) const
+{
+    label patchI = pp.index();
+    label patchFaceI = pp.whichFace(p.face());
+
+    vector n = tetIs.faceTri(mesh_).normal();
+    n /= mag(n);
+
+    vector U = U_.boundaryField()[patchI][patchFaceI];
+
+    // Unless the face is rotating, the required normal is n;
+    nw = n;
+
+    if (!mesh_.moving())
+    {
+        // Only wall patches may have a non-zero wall velocity from
+        // the velocity field when the mesh is not moving.
+
+        if (isA<wallPolyPatch>(pp))
+        {
+            Up = U;
+        }
+        else
+        {
+            Up = vector::zero;
+        }
+    }
+    else
+    {
+        vector U00 = U_.oldTime().boundaryField()[patchI][patchFaceI];
+
+        vector n00 = tetIs.oldFaceTri(mesh_).normal();
+
+        // Difference in normal over timestep
+        vector dn = vector::zero;
+
+        if (mag(n00) > SMALL)
+        {
+            // If the old normal is zero (for example in layer
+            // addition) then use the current normal, meaning that the
+            // motion can only be translational, and dn remains zero,
+            // otherwise, calculate dn:
+
+            n00 /= mag(n00);
+
+            dn = n - n00;
+        }
+
+        // Total fraction through the timestep of the motion,
+        // including stepFraction before the current tracking step
+        // and the current trackFraction
+        // i.e.
+        // let s = stepFraction, t = trackFraction
+        // Motion of x in time:
+        // |-----------------|---------|---------|
+        // x00               x0        xi        x
+        //
+        // where xi is the correct value of x at the required
+        // tracking instant.
+        //
+        // x0 = x00 + s*(x - x00) = s*x + (1 - s)*x00
+        //
+        // i.e. the motion covered by previous tracking portions
+        // within this timestep, and
+        //
+        // xi = x0 + t*(x - x0)
+        //    = t*x + (1 - t)*x0
+        //    = t*x + (1 - t)*(s*x + (1 - s)*x00)
+        //    = (s + t - s*t)*x + (1 - (s + t - s*t))*x00
+        //
+        // let m = (s + t - s*t)
+        //
+        // xi = m*x + (1 - m)*x00 = x00 + m*(x - x00);
+        //
+        // In the same form as before.
+
+        scalar m =
+            p.stepFraction()
+          + trackFraction
+          - (p.stepFraction()*trackFraction);
+
+        // When the mesh is moving, the velocity field on wall patches
+        // will contain the velocity associated with the motion of the
+        // mesh, in which case it is interpolated in time using m.
+        // For other patches the face velocity will need to be
+        // reconstructed from the face centre motion.
+
+        const vector& Cf = mesh_.faceCentres()[p.face()];
+
+        vector Cf00 = mesh_.faces()[p.face()].centre(mesh_.oldPoints());
+
+        if (isA<wallPolyPatch>(pp))
+        {
+            Up = U00 + m*(U - U00);
+        }
+        else
+        {
+            Up = (Cf - Cf00)/mesh_.time().deltaTValue();
+        }
+
+        if (mag(dn) > SMALL)
+        {
+            // Rotational motion, nw requires interpolation and a
+            // rotational velocity around face centre correction to Up
+            // is required.
+
+            nw = n00 + m*dn;
+
+            // Cf at tracking instant
+            vector Cfi = Cf00 + m*(Cf - Cf00);
+
+            // Normal vector cross product
+            vector omega = (n00 ^ n);
+
+            scalar magOmega = mag(omega);
+
+            // magOmega = sin(angle between unit normals)
+            // Normalise omega vector by magOmega, then multiply by
+            // angle/dt to give the correct angular velocity vector.
+            omega *= Foam::asin(magOmega)/(magOmega*mesh_.time().deltaTValue());
+
+            // Project position onto face and calculate this position
+            // relative to the face centre.
+            vector facePos =
+                p.position()
+              - ((p.position() - Cfi) & nw)*nw
+              - Cfi;
+
+            Up += (omega ^ facePos);
+        }
+
+        // No further action is required if the motion is
+        // translational only, nw and Up have already been set.
+    }
+}
+
+
+template<class CloudType>
+void Foam::KinematicCloud<CloudType>::updateMesh()
+{
+    injectors_.updateMesh();
+}
+
+
 template<class CloudType>
 void Foam::KinematicCloud<CloudType>::autoMap(const mapPolyMesh& mapper)
 {
@@ -678,6 +831,8 @@ void Foam::KinematicCloud<CloudType>::autoMap(const mapPolyMesh& mapper)
     tdType td(*this);
 
     Cloud<parcelType>::template autoMap<tdType>(td, mapper);
+
+    updateMesh();
 }
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
index 4cd80923da..321fba33ad 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
@@ -554,9 +554,24 @@ public:
             template<class TrackData>
             void motion(TrackData& td);
 
+            //- Calculate the patch normal and velocity to interact with,
+            //  accounting for patch motion if required.
+            void patchData
+            (
+                const parcelType& p,
+                const polyPatch& pp,
+                const scalar trackFraction,
+                const tetIndices& tetIs,
+                vector& normal,
+                vector& Up
+            ) const;
+
 
         // Mapping
 
+            //- Update mesh
+            void updateMesh();
+
             //- Remap the cells of particles corresponding to the
             //  mesh topology change with a default tracking data object
             virtual void autoMap(const mapPolyMesh&);
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C
index 4a83808fa2..0f98e8b935 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C
@@ -87,8 +87,6 @@ void Foam::ReactingCloud<CloudType>::cloudReset(ReactingCloud<CloudType>& c)
 
     compositionModel_.reset(c.compositionModel_.ptr());
     phaseChangeModel_.reset(c.phaseChangeModel_.ptr());
-
-    dMassPhaseChange_ = c.dMassPhaseChange_;
 }
 
 
@@ -111,8 +109,7 @@ Foam::ReactingCloud<CloudType>::ReactingCloud
     constProps_(this->particleProperties(), this->solution().active()),
     compositionModel_(NULL),
     phaseChangeModel_(NULL),
-    rhoTrans_(thermo.carrier().species().size()),
-    dMassPhaseChange_(0.0)
+    rhoTrans_(thermo.carrier().species().size())
 {
     if (this->solution().active())
     {
@@ -167,8 +164,7 @@ Foam::ReactingCloud<CloudType>::ReactingCloud
     constProps_(c.constProps_),
     compositionModel_(c.compositionModel_->clone()),
     phaseChangeModel_(c.phaseChangeModel_->clone()),
-    rhoTrans_(c.rhoTrans_.size()),
-    dMassPhaseChange_(c.dMassPhaseChange_)
+    rhoTrans_(c.rhoTrans_.size())
 {
     forAll(c.rhoTrans_, i)
     {
@@ -209,8 +205,7 @@ Foam::ReactingCloud<CloudType>::ReactingCloud
     compositionModel_(c.compositionModel_->clone()),
 //    compositionModel_(NULL),
     phaseChangeModel_(NULL),
-    rhoTrans_(0),
-    dMassPhaseChange_(0.0)
+    rhoTrans_(0)
 {}
 
 
@@ -350,6 +345,8 @@ void Foam::ReactingCloud<CloudType>::autoMap(const mapPolyMesh& mapper)
     tdType td(*this);
 
     Cloud<parcelType>::template autoMap<tdType>(td, mapper);
+
+    this->updateMesh();
 }
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H
index a16f1255af..2797250cc3 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H
@@ -121,12 +121,6 @@ protected:
             PtrList<DimensionedField<scalar, volMesh> > rhoTrans_;
 
 
-        // Check
-
-            //- Total mass transferred to continuous phase via phase change
-            scalar dMassPhaseChange_;
-
-
     // Protected Member Functions
 
         // New parcel helper functions
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C
index 8cab7d3f85..31bc4c3222 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C
@@ -264,6 +264,8 @@ void Foam::ReactingMultiphaseCloud<CloudType>::autoMap
     tdType td(*this);
 
     Cloud<parcelType>::template autoMap<tdType>(td, mapper);
+
+    this->updateMesh();
 }
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C
index 9eaa877057..c7e5c9814d 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C
@@ -51,7 +51,69 @@ void Foam::ThermoCloud<CloudType>::setModels()
         ).ptr()
     );
 
-    this->subModelProperties().lookup("radiation") >> radiation_;
+    if (this->solution().coupled())
+    {
+        this->subModelProperties().lookup("radiation") >> radiation_;
+    }
+
+    if (radiation_)
+    {
+        radAreaP_.reset
+        (
+            new DimensionedField<scalar, volMesh>
+            (
+                IOobject
+                (
+                    this->name() + "::radAreaP",
+                    this->db().time().timeName(),
+                    this->db(),
+                    IOobject::READ_IF_PRESENT,
+                    IOobject::AUTO_WRITE
+                ),
+                this->mesh(),
+                dimensionedScalar("zero", dimArea, 0.0)
+            )
+        );
+
+        radT4_.reset
+        (
+            new DimensionedField<scalar, volMesh>
+            (
+                IOobject
+                (
+                    this->name() + "::radT4",
+                    this->db().time().timeName(),
+                    this->db(),
+                    IOobject::READ_IF_PRESENT,
+                    IOobject::AUTO_WRITE
+                ),
+                this->mesh(),
+                dimensionedScalar("zero", pow4(dimTemperature), 0.0)
+            )
+        );
+
+        radAreaPT4_.reset
+        (
+            new DimensionedField<scalar, volMesh>
+            (
+                IOobject
+                (
+                    this->name() + "::radAreaPT4",
+                    this->db().time().timeName(),
+                    this->db(),
+                    IOobject::READ_IF_PRESENT,
+                    IOobject::AUTO_WRITE
+                ),
+                this->mesh(),
+                dimensionedScalar
+                (
+                    "zero",
+                    sqr(dimLength)*pow4(dimTemperature),
+                    0.0
+                )
+            )
+        );
+    }
 }
 
 
@@ -98,13 +160,16 @@ Foam::ThermoCloud<CloudType>::ThermoCloud
     heatTransferModel_(NULL),
     TIntegrator_(NULL),
     radiation_(false),
+    radAreaP_(NULL),
+    radT4_(NULL),
+    radAreaPT4_(NULL),
     hsTrans_
     (
         new DimensionedField<scalar, volMesh>
         (
             IOobject
             (
-                this->name() + "hsTrans",
+                this->name() + "::hsTrans",
                 this->db().time().timeName(),
                 this->db(),
                 IOobject::READ_IF_PRESENT,
@@ -120,7 +185,7 @@ Foam::ThermoCloud<CloudType>::ThermoCloud
         (
             IOobject
             (
-                this->name() + "hsCoeff",
+                this->name() + "::hsCoeff",
                 this->db().time().timeName(),
                 this->db(),
                 IOobject::READ_IF_PRESENT,
@@ -165,13 +230,16 @@ Foam::ThermoCloud<CloudType>::ThermoCloud
     heatTransferModel_(c.heatTransferModel_->clone()),
     TIntegrator_(c.TIntegrator_->clone()),
     radiation_(c.radiation_),
+    radAreaP_(NULL),
+    radT4_(NULL),
+    radAreaPT4_(NULL),
     hsTrans_
     (
         new DimensionedField<scalar, volMesh>
         (
             IOobject
             (
-                this->name() + "hsTrans",
+                this->name() + "::hsTrans",
                 this->db().time().timeName(),
                 this->db(),
                 IOobject::NO_READ,
@@ -187,7 +255,7 @@ Foam::ThermoCloud<CloudType>::ThermoCloud
         (
             IOobject
             (
-                this->name() + "hsCoeff",
+                this->name() + "::hsCoeff",
                 this->db().time().timeName(),
                 this->db(),
                 IOobject::NO_READ,
@@ -197,7 +265,61 @@ Foam::ThermoCloud<CloudType>::ThermoCloud
             c.hsCoeff()
         )
     )
-{}
+{
+    if (radiation_)
+    {
+        radAreaP_.reset
+        (
+            new DimensionedField<scalar, volMesh>
+            (
+                IOobject
+                (
+                    this->name() + "::radAreaP",
+                    this->db().time().timeName(),
+                    this->db(),
+                    IOobject::NO_READ,
+                    IOobject::NO_WRITE,
+                    false
+                ),
+                c.radAreaP()
+            )
+        );
+
+        radT4_.reset
+        (
+            new DimensionedField<scalar, volMesh>
+            (
+                IOobject
+                (
+                    this->name() + "::radT4",
+                    this->db().time().timeName(),
+                    this->db(),
+                    IOobject::NO_READ,
+                    IOobject::NO_WRITE,
+                    false
+                ),
+                c.radT4()
+            )
+        );
+
+        radAreaPT4_.reset
+        (
+            new DimensionedField<scalar, volMesh>
+            (
+                IOobject
+                (
+                    this->name() + "::radAreaPT4",
+                    this->db().time().timeName(),
+                    this->db(),
+                    IOobject::NO_READ,
+                    IOobject::NO_WRITE,
+                    false
+                ),
+                c.radAreaPT4()
+            )
+        );
+    }
+}
 
 
 template<class CloudType>
@@ -218,6 +340,9 @@ Foam::ThermoCloud<CloudType>::ThermoCloud
     heatTransferModel_(NULL),
     TIntegrator_(NULL),
     radiation_(false),
+    radAreaP_(NULL),
+    radT4_(NULL),
+    radAreaPT4_(NULL),
     hsTrans_(NULL),
     hsCoeff_(NULL)
 {}
@@ -285,6 +410,13 @@ void Foam::ThermoCloud<CloudType>::resetSourceTerms()
     CloudType::resetSourceTerms();
     hsTrans_->field() = 0.0;
     hsCoeff_->field() = 0.0;
+
+    if (radiation_)
+    {
+        radAreaP_->field() = 0.0;
+        radT4_->field() = 0.0;
+        radAreaPT4_->field() = 0.0;
+    }
 }
 
 
@@ -298,6 +430,13 @@ void Foam::ThermoCloud<CloudType>::relaxSources
 
     this->relax(hsTrans_(), cloudOldTime.hsTrans(), "h");
     this->relax(hsCoeff_(), cloudOldTime.hsCoeff(), "h");
+
+    if (radiation_)
+    {
+        this->relax(radAreaP_(), cloudOldTime.radAreaP(), "radiation");
+        this->relax(radT4_(), cloudOldTime.radT4(), "radiation");
+        this->relax(radAreaPT4_(), cloudOldTime.radAreaPT4(), "radiation");
+    }
 }
 
 
@@ -308,6 +447,13 @@ void Foam::ThermoCloud<CloudType>::scaleSources()
 
     this->scale(hsTrans_(), "h");
     this->scale(hsCoeff_(), "h");
+
+    if (radiation_)
+    {
+        this->scale(radAreaP_(), "radiation");
+        this->scale(radT4_(), "radiation");
+        this->scale(radAreaPT4_(), "radiation");
+    }
 }
 
 
@@ -341,6 +487,8 @@ void Foam::ThermoCloud<CloudType>::autoMap(const mapPolyMesh& mapper)
     tdType td(*this);
 
     Cloud<parcelType>::template autoMap<tdType>(td, mapper);
+
+    this->updateMesh();
 }
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H
index 4acd251621..88cfde3172 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H
@@ -132,6 +132,15 @@ protected:
             //- Include radiation
             Switch radiation_;
 
+            //- Radiation sum of parcel projected areas
+            autoPtr<DimensionedField<scalar, volMesh> > radAreaP_;
+
+            //- Radiation sum of parcel temperature^4
+            autoPtr<DimensionedField<scalar, volMesh> > radT4_;
+
+            //- Radiation sum of parcel projected areas * temperature^4
+            autoPtr<DimensionedField<scalar, volMesh> > radAreaPT4_;
+
 
         // Sources
 
@@ -244,6 +253,26 @@ public:
                  //- Radiation flag
                 inline bool radiation() const;
 
+                //- Radiation sum of parcel projected areas [m2]
+                inline DimensionedField<scalar, volMesh>& radAreaP();
+
+                //- Radiation sum of parcel projected areas [m2]
+                inline const DimensionedField<scalar, volMesh>&
+                    radAreaP() const;
+
+                //- Radiation sum of parcel temperature^4 [K4]
+                inline DimensionedField<scalar, volMesh>& radT4();
+
+                //- Radiation sum of parcel temperature^4 [K4]
+                inline const DimensionedField<scalar, volMesh>& radT4() const;
+
+                //- Radiation sum of parcel projected area*temperature^4 [m2K4]
+                inline DimensionedField<scalar, volMesh>& radAreaPT4();
+
+                //- Radiation sum of parcel temperature^4 [m2K4]
+                inline const DimensionedField<scalar, volMesh>&
+                    radAreaPT4() const;
+
 
             // Sources
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloudI.H b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloudI.H
index bac95e49d5..764595fece 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloudI.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloudI.H
@@ -89,6 +89,114 @@ inline bool Foam::ThermoCloud<CloudType>::radiation() const
 }
 
 
+template<class CloudType>
+inline Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
+Foam::ThermoCloud<CloudType>::radAreaP()
+{
+    if (!radiation_)
+    {
+        FatalErrorIn
+        (
+            "inline Foam::DimensionedField<Foam::scalar, Foam::volMesh> "
+            "Foam::ThermoCloud<CloudType>::radAreaP()"
+        )   << "Radiation field requested, but radiation model not active"
+            << abort(FatalError);
+    }
+
+    return radAreaP_();
+}
+
+
+template<class CloudType>
+inline const Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
+Foam::ThermoCloud<CloudType>::radAreaP() const
+{
+    if (!radiation_)
+    {
+        FatalErrorIn
+        (
+            "inline Foam::DimensionedField<Foam::scalar, Foam::volMesh> "
+            "Foam::ThermoCloud<CloudType>::radAreaP()"
+        )   << "Radiation field requested, but radiation model not active"
+            << abort(FatalError);
+    }
+
+    return radAreaP_();
+}
+
+
+template<class CloudType>
+inline Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
+Foam::ThermoCloud<CloudType>::radT4()
+{
+    if (!radiation_)
+    {
+        FatalErrorIn
+        (
+            "inline Foam::DimensionedField<Foam::scalar, Foam::volMesh> "
+            "Foam::ThermoCloud<CloudType>::radT4()"
+        )   << "Radiation field requested, but radiation model not active"
+            << abort(FatalError);
+    }
+
+    return radT4_();
+}
+
+
+template<class CloudType>
+inline const Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
+Foam::ThermoCloud<CloudType>::radT4() const
+{
+    if (!radiation_)
+    {
+        FatalErrorIn
+        (
+            "inline Foam::DimensionedField<Foam::scalar, Foam::volMesh> "
+            "Foam::ThermoCloud<CloudType>::radT4()"
+        )   << "Radiation field requested, but radiation model not active"
+            << abort(FatalError);
+    }
+
+    return radT4_();
+}
+
+
+template<class CloudType>
+inline Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
+Foam::ThermoCloud<CloudType>::radAreaPT4()
+{
+    if (!radiation_)
+    {
+        FatalErrorIn
+        (
+            "inline Foam::DimensionedField<Foam::scalar, Foam::volMesh> "
+            "Foam::ThermoCloud<CloudType>::radAreaPT4()"
+        )   << "Radiation field requested, but radiation model not active"
+            << abort(FatalError);
+    }
+
+    return radAreaPT4_();
+}
+
+
+template<class CloudType>
+inline const Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
+Foam::ThermoCloud<CloudType>::radAreaPT4() const
+{
+    if (!radiation_)
+    {
+        FatalErrorIn
+        (
+            "inline Foam::DimensionedField<Foam::scalar, Foam::volMesh> "
+            "Foam::ThermoCloud<CloudType>::radAreaPT4()"
+        )   << "Radiation field requested, but radiation model not active"
+            << abort(FatalError);
+    }
+
+    return radAreaPT4_();
+}
+
+
 template<class CloudType>
 inline Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
 Foam::ThermoCloud<CloudType>::hsTrans()
@@ -182,21 +290,15 @@ inline Foam::tmp<Foam::volScalarField> Foam::ThermoCloud<CloudType>::Ep() const
         )
     );
 
-    // Need to check if coupled as field is created on-the-fly
-    if (radiation_ && this->solution().coupled())
+    if (radiation_)
     {
         scalarField& Ep = tEp().internalField();
+        const scalar dt = this->db().time().deltaTValue();
         const scalarField& V = this->mesh().V();
         const scalar epsilon = constProps_.epsilon0();
+        const scalarField& sumAreaPT4 = radAreaPT4_->field();
 
-        forAllConstIter(typename ThermoCloud<CloudType>, *this, iter)
-        {
-            const parcelType& p = iter();
-            const label cellI = p.cell();
-            Ep[cellI] += p.nParticle()*p.areaP()*pow4(p.T());
-        }
-
-        Ep *= epsilon*physicoChemical::sigma.value()/V;
+        Ep = sumAreaPT4*epsilon*physicoChemical::sigma.value()/V/dt;
     }
 
     return tEp;
@@ -224,21 +326,15 @@ inline Foam::tmp<Foam::volScalarField> Foam::ThermoCloud<CloudType>::ap() const
         )
     );
 
-    // Need to check if coupled as field is created on-the-fly
-    if (radiation_ && this->solution().coupled())
+    if (radiation_)
     {
         scalarField& ap = tap().internalField();
+        const scalar dt = this->db().time().deltaTValue();
         const scalarField& V = this->mesh().V();
         const scalar epsilon = constProps_.epsilon0();
+        const scalarField& sumAreaP = radAreaP_->field();
 
-        forAllConstIter(typename ThermoCloud<CloudType>, *this, iter)
-        {
-            const parcelType& p = iter();
-            const label cellI = p.cell();
-            ap[cellI] += p.nParticle()*p.areaP();
-        }
-
-        ap *= epsilon/V;
+        ap = sumAreaP*epsilon/V/dt;
     }
 
     return tap;
@@ -267,23 +363,16 @@ Foam::ThermoCloud<CloudType>::sigmap() const
         )
     );
 
-    // Need to check if coupled as field is created on-the-fly
-    if (radiation_ && this->solution().coupled())
+    if (radiation_)
     {
         scalarField& sigmap = tsigmap().internalField();
-
+        const scalar dt = this->db().time().deltaTValue();
         const scalarField& V = this->mesh().V();
         const scalar epsilon = constProps_.epsilon0();
         const scalar f = constProps_.f0();
+        const scalarField& sumAreaP = radAreaP_->field();
 
-        forAllConstIter(typename ThermoCloud<CloudType>, *this, iter)
-        {
-            const parcelType& p = iter();
-            const label cellI = p.cell();
-            sigmap[cellI] += p.nParticle()*p.areaP();
-        }
-
-        sigmap *= (1.0 - f)*(1.0 - epsilon)/V;
+        sigmap *= sumAreaP*(1.0 - f)*(1.0 - epsilon)/V/dt;
     }
 
     return tsigmap;
diff --git a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C
index 9ae6b2f5b9..8fa42ac0ec 100644
--- a/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/KinematicParcel/KinematicParcel.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -363,7 +363,7 @@ bool Foam::KinematicParcel<ParcelType>::hitPatch
         static_cast<typename TrackData::cloudType::parcelType&>(*this);
 
     // Invoke post-processing model
-    td.cloud().functions().postPatch(p, patchI, pp.whichFace(p.face()));
+    td.cloud().functions().postPatch(p, pp, trackFraction, tetIs);
 
     // Invoke surface film model
     if (td.cloud().surfaceFilm().transferParcel(p, pp, td.keepParticle))
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
index 4be1fcdd12..84942b0349 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
@@ -268,12 +268,15 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calc
     (
         td,
         dt,
+        this->age_,
         Ts,
         d0,
         T0,
         mass0,
         this->mass0_,
         YMix[GAS]*YGas_,
+        YMix[LIQ]*YLiquid_,
+        YMix[SLD]*YSolid_,
         canCombust_,
         dMassDV,
         Sh,
@@ -466,6 +469,16 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calc
         // Update sensible enthalpy transfer
         td.cloud().hsTrans()[cellI] += np0*dhsTrans;
         td.cloud().hsCoeff()[cellI] += np0*Sph;
+
+        // Update radiation fields
+        if (td.cloud().radiation())
+        {
+            const scalar ap = this->areaP();
+            const scalar T4 = pow4(this->T_);
+            td.cloud().radAreaP()[cellI] += dt*np0*ap;
+            td.cloud().radT4()[cellI] += dt*np0*T4;
+            td.cloud().radAreaP()[cellI] += dt*np0*ap*T4;
+        }
     }
 }
 
@@ -476,12 +489,15 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calcDevolatilisation
 (
     TrackData& td,
     const scalar dt,
+    const scalar age,
     const scalar Ts,
     const scalar d,
     const scalar T,
     const scalar mass,
     const scalar mass0,
     const scalarField& YGasEff,
+    const scalarField& YLiquidEff,
+    const scalarField& YSolidEff,
     bool& canCombust,
     scalarField& dMassDV,
     scalar& Sh,
@@ -510,10 +526,13 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calcDevolatilisation
     td.cloud().devolatilisation().calculate
     (
         dt,
+        age,
         mass0,
         mass,
         T,
         YGasEff,
+        YLiquidEff,
+        YSolidEff,
         canCombust,
         dMassDV
     );
@@ -638,7 +657,8 @@ Foam::ReactingMultiphaseParcel<ParcelType>::ReactingMultiphaseParcel
     ParcelType(p),
     YGas_(p.YGas_),
     YLiquid_(p.YLiquid_),
-    YSolid_(p.YSolid_)
+    YSolid_(p.YSolid_),
+    canCombust_(p.canCombust_)
 {}
 
 
@@ -652,7 +672,8 @@ Foam::ReactingMultiphaseParcel<ParcelType>::ReactingMultiphaseParcel
     ParcelType(p, mesh),
     YGas_(p.YGas_),
     YLiquid_(p.YLiquid_),
-    YSolid_(p.YSolid_)
+    YSolid_(p.YSolid_),
+    canCombust_(p.canCombust_)
 {}
 
 
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.H b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.H
index 6707b2a52d..db20b8d9c7 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.H
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.H
@@ -196,12 +196,15 @@ protected:
         (
             TrackData& td,
             const scalar dt,           // timestep
-            const scalar Ts,           // Surface temperature
+            const scalar age,          // age
+            const scalar Ts,           // surface temperature
             const scalar d,            // diameter
             const scalar T,            // temperature
             const scalar mass,         // mass
             const scalar mass0,        // mass (initial on injection)
-            const scalarField& YGasEff,// Gas component mass fractions
+            const scalarField& YGasEff,// gas component mass fractions
+            const scalarField& YLiquidEff,// liquid component mass fractions
+            const scalarField& YSolidEff,// solid component mass fractions
             bool& canCombust,          // 'can combust' flag
             scalarField& dMassDV,      // mass transfer - local to particle
             scalar& Sh,                // explicit particle enthalpy source
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
index cfd21ceed0..e9bc815304 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
@@ -458,6 +458,16 @@ void Foam::ReactingParcel<ParcelType>::calc
         // Update sensible enthalpy transfer
         td.cloud().hsTrans()[cellI] += np0*dhsTrans;
         td.cloud().hsCoeff()[cellI] += np0*Sph;
+
+        // Update radiation fields
+        if (td.cloud().radiation())
+        {
+            const scalar ap = this->areaP();
+            const scalar T4 = pow4(this->T_);
+            td.cloud().radAreaP()[cellI] += dt*np0*ap;
+            td.cloud().radT4()[cellI] += dt*np0*T4;
+            td.cloud().radAreaP()[cellI] += dt*np0*ap*T4;
+        }
     }
 }
 
diff --git a/src/lagrangian/intermediate/parcels/Templates/ThermoParcel/ThermoParcel.C b/src/lagrangian/intermediate/parcels/Templates/ThermoParcel/ThermoParcel.C
index b64b1e8f99..cb9b714204 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ThermoParcel/ThermoParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ThermoParcel/ThermoParcel.C
@@ -144,7 +144,7 @@ void Foam::ThermoParcel<ParcelType>::calcSurfaceValues
         Ts = td.cloud().constProps().TMin();
     }
 
-    // Assuming thermo props vary linearly with T for small dT
+    // Assuming thermo props vary linearly with T for small d(T)
     const scalar TRatio = Tc_/Ts;
 
     rhos = this->rhoc_*TRatio;
@@ -252,6 +252,16 @@ void Foam::ThermoParcel<ParcelType>::calc
 
         // Update sensible enthalpy coefficient
         td.cloud().hsCoeff()[cellI] += np0*Sph;
+
+        // Update radiation fields
+        if (td.cloud().radiation())
+        {
+            const scalar ap = this->areaP();
+            const scalar T4 = pow4(this->T_);
+            td.cloud().radAreaP()[cellI] += dt*np0*ap;
+            td.cloud().radT4()[cellI] += dt*np0*T4;
+            td.cloud().radAreaP()[cellI] += dt*np0*ap*T4;
+        }
     }
 }
 
diff --git a/src/lagrangian/intermediate/parcels/include/makeParcelInjectionModels.H b/src/lagrangian/intermediate/parcels/include/makeParcelInjectionModels.H
index cd5a78f81c..07b00f8d93 100644
--- a/src/lagrangian/intermediate/parcels/include/makeParcelInjectionModels.H
+++ b/src/lagrangian/intermediate/parcels/include/makeParcelInjectionModels.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -37,7 +37,7 @@ License
 #include "ManualInjection.H"
 #include "NoInjection.H"
 #include "PatchInjection.H"
-
+#include "PatchFlowRateInjection.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -53,7 +53,8 @@ License
     makeInjectionModelType(KinematicLookupTableInjection, CloudType);         \
     makeInjectionModelType(ManualInjection, CloudType);                       \
     makeInjectionModelType(NoInjection, CloudType);                           \
-    makeInjectionModelType(PatchInjection, CloudType);
+    makeInjectionModelType(PatchInjection, CloudType);                        \
+    makeInjectionModelType(PatchFlowRateInjection, CloudType);
 
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
diff --git a/src/lagrangian/intermediate/parcels/include/makeReactingMultiphaseParcelInjectionModels.H b/src/lagrangian/intermediate/parcels/include/makeReactingMultiphaseParcelInjectionModels.H
index 126f8a8512..711f88459f 100644
--- a/src/lagrangian/intermediate/parcels/include/makeReactingMultiphaseParcelInjectionModels.H
+++ b/src/lagrangian/intermediate/parcels/include/makeReactingMultiphaseParcelInjectionModels.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -35,6 +35,7 @@ License
 #include "ManualInjection.H"
 #include "NoInjection.H"
 #include "PatchInjection.H"
+#include "PatchFlowRateInjection.H"
 #include "ReactingMultiphaseLookupTableInjection.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@@ -49,6 +50,7 @@ License
     makeInjectionModelType(ManualInjection, CloudType);                       \
     makeInjectionModelType(NoInjection, CloudType);                           \
     makeInjectionModelType(PatchInjection, CloudType);                        \
+    makeInjectionModelType(PatchFlowRateInjection, CloudType);                \
     makeInjectionModelType(ReactingMultiphaseLookupTableInjection, CloudType);
 
 
diff --git a/src/lagrangian/intermediate/parcels/include/makeReactingParcelInjectionModels.H b/src/lagrangian/intermediate/parcels/include/makeReactingParcelInjectionModels.H
index 34fddbb50d..5fb4c6d562 100644
--- a/src/lagrangian/intermediate/parcels/include/makeReactingParcelInjectionModels.H
+++ b/src/lagrangian/intermediate/parcels/include/makeReactingParcelInjectionModels.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -35,6 +35,7 @@ License
 #include "ManualInjection.H"
 #include "NoInjection.H"
 #include "PatchInjection.H"
+#include "PatchFlowRateInjection.H"
 #include "ReactingLookupTableInjection.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@@ -49,6 +50,7 @@ License
     makeInjectionModelType(ManualInjection, CloudType);                       \
     makeInjectionModelType(NoInjection, CloudType);                           \
     makeInjectionModelType(PatchInjection, CloudType);                        \
+    makeInjectionModelType(PatchFlowRateInjection, CloudType);                \
     makeInjectionModelType(ReactingLookupTableInjection, CloudType);
 
 
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C
index b8409231ff..dbc359ae9a 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -107,8 +107,9 @@ template<class CloudType>
 void Foam::CloudFunctionObject<CloudType>::postPatch
 (
     const typename CloudType::parcelType&,
-    const label,
-    const label
+    const polyPatch&,
+    const scalar,
+    const tetIndices&
 )
 {
     // do nothing
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H
index b0818aa708..5baf0f7ae9 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -141,8 +141,9 @@ public:
             virtual void postPatch
             (
                 const typename CloudType::parcelType& p,
-                const label patchI,
-                const label patchFaceI
+                const polyPatch& pp,
+                const scalar trackFraction,
+                const tetIndices& testIs
             );
 
             //- Post-face hook
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.C b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.C
index 556c72908c..2f97468e36 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.C
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -146,13 +146,14 @@ template<class CloudType>
 void Foam::CloudFunctionObjectList<CloudType>::postPatch
 (
     const typename CloudType::parcelType& p,
-    const label patchI,
-    const label patchFaceI
+    const polyPatch& pp,
+    const scalar trackFraction,
+    const tetIndices& tetIs
 )
 {
     forAll(*this, i)
     {
-        this->operator[](i).postPatch(p, patchI, patchFaceI);
+        this->operator[](i).postPatch(p, pp, trackFraction, tetIs);
     }
 }
 
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.H b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.H
index b8b296fe21..5daeab9f29 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.H
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObjectList/CloudFunctionObjectList.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -121,8 +121,9 @@ public:
             virtual void postPatch
             (
                 const typename CloudType::parcelType& p,
-                const label patchI,
-                const label patchFaceI
+                const polyPatch& pp,
+                const scalar trackFraction,
+                const tetIndices& tetIs
             );
 
             //- Post-face hook
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.C b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.C
index 87d03eade7..81772debfe 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.C
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.C
@@ -166,29 +166,32 @@ template<class CloudType>
 void Foam::ParticleErosion<CloudType>::postPatch
 (
     const parcelType& p,
-    const label patchI,
-    const label patchFaceI
+    const polyPatch& pp,
+    const scalar trackFraction,
+    const tetIndices& tetIs
 )
 {
+    const label patchI = pp.index();
+
     const label localPatchI = applyToPatch(patchI);
 
     if (localPatchI != -1)
     {
-        const fvMesh& mesh = this->owner().mesh();
+        vector nw;
+        vector Up;
 
         // patch-normal direction
-        vector nw = p.currentTetIndices().faceTri(mesh).normal();
+        this->owner().patchData(p, pp, trackFraction, tetIs, nw, Up);
 
-        // particle direction of travel
-        const vector& U = p.U();
+        // particle velocity reletive to patch
+        const vector& U = p.U() - Up;
 
         // quick reject if particle travelling away from the patch
-        if ((-nw & U) < 0)
+        if ((nw & U) < 0)
         {
             return;
         }
 
-        nw /= mag(nw);
         const scalar magU = mag(U);
         const vector Udir = U/magU;
 
@@ -197,6 +200,7 @@ void Foam::ParticleErosion<CloudType>::postPatch
 
         const scalar coeff = p.nParticle()*p.mass()*sqr(magU)/(p_*psi_*K_);
 
+        const label patchFaceI = pp.whichFace(p.face());
         scalar& Q = QPtr_->boundaryField()[patchI][patchFaceI];
         if (tan(alpha) < K_/6.0)
         {
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.H b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.H
index c23dfc4c40..c741bd4004 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.H
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/ParticleErosion/ParticleErosion.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -126,8 +126,9 @@ public:
             virtual void postPatch
             (
                 const parcelType& p,
-                const label patchI,
-                const label patchFaceI
+                const polyPatch& pp,
+                const scalar trackFraction,
+                const tetIndices& tetIs
             );
 };
 
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.C b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.C
index afbd9bfbd9..f66a872cfc 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.C
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -218,11 +218,14 @@ template<class CloudType>
 void Foam::PatchPostProcessing<CloudType>::postPatch
 (
     const parcelType& p,
-    const label patchI,
-    const label
+    const polyPatch& pp,
+    const scalar,
+    const tetIndices& tetIs
 )
 {
+    const label patchI = pp.index();
     const label localPatchI = applyToPatch(patchI);
+
     if (localPatchI != -1 && patchData_[localPatchI].size() < maxStoredParcels_)
     {
         times_[localPatchI].append(this->owner().time().value());
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.H b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.H
index 9945d24b58..f7d618e6ce 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.H
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/PatchPostProcessing/PatchPostProcessing.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -127,8 +127,9 @@ public:
             virtual void postPatch
             (
                 const parcelType& p,
-                const label patchI,
-                const label patchFaceI
+                const polyPatch& pp,
+                const scalar trackFraction,
+                const tetIndices& tetIs
             );
 };
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C
index 5319b75b27..6315eac827 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/PairCollision/PairCollision.C
@@ -306,8 +306,9 @@ void Foam::PairCollision<CloudType>::wallInteraction()
                         this->owner().functions().postPatch
                         (
                             p,
-                            patchI,
-                            patchFaceI
+                            mesh.boundaryMesh()[patchI],
+                            1.0,
+                            p.currentTetIndices()
                         );
                      }
                 }
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.C
index 8ae15bab76..ec9f1c0139 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.C
@@ -77,7 +77,7 @@ void Foam::CellZoneInjection<CloudType>::setPositions
         for (label tetI = 1; tetI < cellTetIs.size() - 1; tetI++)
         {
             cTetVFrac[tetI] =
-                (cTetVFrac[tetI-1] + cellTetIs[tetI].tet(mesh).mag())/V[cellI];
+                cTetVFrac[tetI-1] + cellTetIs[tetI].tet(mesh).mag()/V[cellI];
         }
         cTetVFrac.last() = 1.0;
 
@@ -185,60 +185,7 @@ Foam::CellZoneInjection<CloudType>::CellZoneInjection
         )
     )
 {
-    const fvMesh& mesh = owner.mesh();
-    const label zoneI = mesh.cellZones().findZoneID(cellZoneName_);
-
-    if (zoneI < 0)
-    {
-        FatalErrorIn
-        (
-            "Foam::CellZoneInjection<CloudType>::CellZoneInjection"
-            "("
-                "const dictionary&, "
-                "CloudType&"
-            ")"
-        )   << "Unknown cell zone name: " << cellZoneName_
-            << ". Valid cell zones are: " << mesh.cellZones().names()
-            << nl << exit(FatalError);
-    }
-
-    const labelList& cellZoneCells = mesh.cellZones()[zoneI];
-    const label nCells = cellZoneCells.size();
-    const scalar nCellsTotal = returnReduce(nCells, sumOp<label>());
-    const scalar VCells = sum(scalarField(mesh.V(), cellZoneCells));
-    const scalar VCellsTotal = returnReduce(VCells, sumOp<scalar>());
-    Info<< "    cell zone size      = " << nCellsTotal << endl;
-    Info<< "    cell zone volume    = " << VCellsTotal << endl;
-
-    if ((nCells == 0) || (VCellsTotal*numberDensity_ < 1))
-    {
-        WarningIn
-        (
-            "Foam::CellZoneInjection<CloudType>::CellZoneInjection"
-            "("
-                "const dictionary&, "
-                "CloudType&"
-            ")"
-        )   << "Number of particles to be added to cellZone " << cellZoneName_
-            << " is zero" << endl;
-    }
-    else
-    {
-        setPositions(cellZoneCells);
-
-        Info<< "    number density      = " << numberDensity_ << nl
-            << "    number of particles = " << positions_.size() << endl;
-
-        // Construct parcel diameters
-        diameters_.setSize(positions_.size());
-        forAll(diameters_, i)
-        {
-            diameters_[i] = sizeDistribution_->sample();
-        }
-    }
-
-    // Determine volume of particles to inject
-    this->volumeTotal_ = sum(pow3(diameters_))*constant::mathematical::pi/6.0;
+    updateMesh();
 }
 
 
@@ -270,6 +217,55 @@ Foam::CellZoneInjection<CloudType>::~CellZoneInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::CellZoneInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    const fvMesh& mesh = this->owner().mesh();
+    const label zoneI = mesh.cellZones().findZoneID(cellZoneName_);
+
+    if (zoneI < 0)
+    {
+        FatalErrorIn("Foam::CellZoneInjection<CloudType>::updateMesh()")
+            << "Unknown cell zone name: " << cellZoneName_
+            << ". Valid cell zones are: " << mesh.cellZones().names()
+            << nl << exit(FatalError);
+    }
+
+    const labelList& cellZoneCells = mesh.cellZones()[zoneI];
+    const label nCells = cellZoneCells.size();
+    const scalar nCellsTotal = returnReduce(nCells, sumOp<label>());
+    const scalar VCells = sum(scalarField(mesh.V(), cellZoneCells));
+    const scalar VCellsTotal = returnReduce(VCells, sumOp<scalar>());
+    Info<< "    cell zone size      = " << nCellsTotal << endl;
+    Info<< "    cell zone volume    = " << VCellsTotal << endl;
+
+    if ((nCells == 0) || (VCellsTotal*numberDensity_ < 1))
+    {
+        WarningIn("Foam::CellZoneInjection<CloudType>::updateMesh()")
+            << "Number of particles to be added to cellZone " << cellZoneName_
+            << " is zero" << endl;
+    }
+    else
+    {
+        setPositions(cellZoneCells);
+
+        Info<< "    number density      = " << numberDensity_ << nl
+            << "    number of particles = " << positions_.size() << endl;
+
+        // Construct parcel diameters
+        diameters_.setSize(positions_.size());
+        forAll(diameters_, i)
+        {
+            diameters_[i] = sizeDistribution_->sample();
+        }
+    }
+
+    // Determine volume of particles to inject
+    this->volumeTotal_ = sum(pow3(diameters_))*constant::mathematical::pi/6.0;
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::CellZoneInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.H
index 85bb877cf5..9edd88736e 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/CellZoneInjection/CellZoneInjection.H
@@ -130,6 +130,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.C
index 6ccdd586f7..d71e1b070e 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.C
@@ -126,17 +126,7 @@ Foam::ConeInjection<CloudType>::ConeInjection
     // Set total volume to inject
     this->volumeTotal_ = flowRateProfile_.integrate(0.0, duration_);
 
-    // Set/cache the injector cells
-    forAll(positionAxis_, i)
-    {
-        this->findCellAtPosition
-        (
-            injectorCells_[i],
-            injectorTetFaces_[i],
-            injectorTetPts_[i],
-            positionAxis_[i].first()
-        );
-    }
+    updateMesh();
 }
 
 
@@ -173,6 +163,23 @@ Foam::ConeInjection<CloudType>::~ConeInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::ConeInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    forAll(positionAxis_, i)
+    {
+        this->findCellAtPosition
+        (
+            injectorCells_[i],
+            injectorTetFaces_[i],
+            injectorTetPts_[i],
+            positionAxis_[i].first()
+        );
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::ConeInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.H
index 24af84cd9d..0e72be57c4 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeInjection/ConeInjection.H
@@ -144,6 +144,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.C
index 06222a2914..cebed76580 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.C
@@ -201,6 +201,8 @@ Foam::ConeNozzleInjection<CloudType>::ConeNozzleInjection
 
     // Set total volume to inject
     this->volumeTotal_ = flowRateProfile_.integrate(0.0, duration_);
+
+    updateMesh();
 }
 
 
@@ -244,6 +246,30 @@ Foam::ConeNozzleInjection<CloudType>::~ConeNozzleInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::ConeNozzleInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    switch (injectionMethod_)
+    {
+        case imPoint:
+        {
+            this->findCellAtPosition
+            (
+                injectorCell_,
+                tetFaceI_,
+                tetPtI_,
+                position_
+            );
+        }
+        default:
+        {
+            // do nothing
+        }
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::ConeNozzleInjection<CloudType>::timeEnd() const
 {
@@ -342,6 +368,7 @@ void Foam::ConeNozzleInjection<CloudType>::setPositionAndCell
                     "const label, "
                     "const scalar, "
                     "vector&, "
+                    "label&, "
                     "label&"
                 ")"
             )<< "Unknown injectionMethod type" << nl
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.H
index e536fbd4d9..87ca3fc8c1 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ConeNozzleInjection/ConeNozzleInjection.H
@@ -212,6 +212,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.C
index 39c9c5f77c..d6b59b9043 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.C
@@ -96,17 +96,7 @@ Foam::FieldActivatedInjection<CloudType>::FieldActivatedInjection
     this->volumeTotal_ =
         nParcelsPerInjector_*sum(pow3(diameters_))*pi/6.0;
 
-    // Set/cache the injector cells
-    forAll(positions_, i)
-    {
-        this->findCellAtPosition
-        (
-            injectorCells_[i],
-            injectorTetFaces_[i],
-            injectorTetPts_[i],
-            positions_[i]
-        );
-    }
+    updateMesh();
 }
 
 
@@ -142,6 +132,23 @@ Foam::FieldActivatedInjection<CloudType>::~FieldActivatedInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::FieldActivatedInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    forAll(positions_, i)
+    {
+        this->findCellAtPosition
+        (
+            injectorCells_[i],
+            injectorTetFaces_[i],
+            injectorTetPts_[i],
+            positions_[i]
+        );
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::FieldActivatedInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.H
index 548403d234..704345d8f5 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/FieldActivatedInjection/FieldActivatedInjection.H
@@ -150,6 +150,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.C
index a8f3741fa2..3b732df8fd 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.C
@@ -153,6 +153,13 @@ Foam::InflationInjection<CloudType>::~InflationInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::InflationInjection<CloudType>::updateMesh()
+{
+    // do nothing
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::InflationInjection<CloudType>::timeEnd() const
 {
@@ -234,8 +241,8 @@ Foam::label Foam::InflationInjection<CloudType>::parcelsToInject
                 "Foam::label "
                 "Foam::InflationInjection<CloudType>::parcelsToInject"
                 "("
-                    "const scalar time0, "
-                    "const scalar time1"
+                    "const scalar, "
+                    "const scalar"
                 ")"
             )
                 << "Maximum particle split iterations ("
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.H
index 8d01778031..8d3dd8dcc7 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InflationInjection/InflationInjection.H
@@ -146,6 +146,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C
index 1c10870726..a16de448b3 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C
@@ -45,7 +45,7 @@ bool Foam::InjectionModel<CloudType>::validInjection(const label parcelI)
 
 
 template<class CloudType>
-void Foam::InjectionModel<CloudType>::prepareForNextTimeStep
+bool Foam::InjectionModel<CloudType>::prepareForNextTimeStep
 (
     const scalar time,
     label& newParcels,
@@ -55,12 +55,13 @@ void Foam::InjectionModel<CloudType>::prepareForNextTimeStep
     // Initialise values
     newParcels = 0;
     newVolume = 0.0;
+    bool validInjection = false;
 
     // Return if not started injection event
     if (time < SOI_)
     {
         timeStep0_ = time;
-        return;
+        return validInjection;
     }
 
     // Make times relative to SOI
@@ -73,16 +74,27 @@ void Foam::InjectionModel<CloudType>::prepareForNextTimeStep
     // Volume of parcels to inject
     newVolume = this->volumeToInject(t0, t1);
 
-    // Hold previous time if no parcels, but non-zero volume fraction
-    if ((newParcels == 0) && (newVolume > 0.0))
+    if (newVolume > 0)
     {
-        // hold value of timeStep0_
+        if (newParcels > 0)
+        {
+            timeStep0_ = time;
+            validInjection = true;
+        }
+        else
+        {
+            // injection should have started, but not sufficient volume to
+            // produce (at least) 1 parcel - hold value of timeStep0_
+            validInjection = false;
+        }
     }
     else
     {
-        // advance value of timeStep0_
         timeStep0_ = time;
+        validInjection = false;
     }
+
+    return validInjection;
 }
 
 
@@ -272,6 +284,7 @@ Foam::InjectionModel<CloudType>::InjectionModel(CloudType& owner)
     SOI_(0.0),
     volumeTotal_(0.0),
     massTotal_(0.0),
+    massFlowRate_(owner.db().time(), "massFlowRate"),
     massInjected_(this->template getModelProperty<scalar>("massInjected")),
     nInjections_(this->template getModelProperty<label>("nInjections")),
     parcelsAddedTotal_
@@ -298,6 +311,7 @@ Foam::InjectionModel<CloudType>::InjectionModel
     SOI_(0.0),
     volumeTotal_(0.0),
     massTotal_(0.0),
+    massFlowRate_(owner.db().time(), "massFlowRate"),
     massInjected_(this->template getModelProperty<scalar>("massInjected")),
     nInjections_(this->template getModelProperty<scalar>("nInjections")),
     parcelsAddedTotal_
@@ -323,7 +337,8 @@ Foam::InjectionModel<CloudType>::InjectionModel
     }
     else
     {
-        this->coeffDict().lookup("massFlowRate") >> massTotal_;
+        massFlowRate_.reset(this->coeffDict());
+        massTotal_ = massFlowRate_.value(owner.db().time().value());
     }
 
     const word parcelBasisType = this->coeffDict().lookup("parcelBasisType");
@@ -372,6 +387,7 @@ Foam::InjectionModel<CloudType>::InjectionModel
     SOI_(im.SOI_),
     volumeTotal_(im.volumeTotal_),
     massTotal_(im.massTotal_),
+    massFlowRate_(im.massFlowRate_),
     massInjected_(im.massInjected_),
     nInjections_(im.nInjections_),
     parcelsAddedTotal_(im.parcelsAddedTotal_),
@@ -391,6 +407,13 @@ Foam::InjectionModel<CloudType>::~InjectionModel()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::InjectionModel<CloudType>::updateMesh()
+{
+    // do nothing
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::InjectionModel<CloudType>::timeEnd() const
 {
@@ -416,7 +439,7 @@ Foam::label Foam::InjectionModel<CloudType>::parcelsToInject
         "("
             "const scalar, "
             "const scalar"
-        ") const"
+        ")"
     );
 
     return 0;
@@ -436,7 +459,7 @@ Foam::scalar Foam::InjectionModel<CloudType>::volumeToInject
         "("
             "const scalar, "
             "const scalar"
-        ") const"
+        ")"
     );
 
     return 0.0;
@@ -446,7 +469,16 @@ Foam::scalar Foam::InjectionModel<CloudType>::volumeToInject
 template<class CloudType>
 Foam::scalar Foam::InjectionModel<CloudType>::averageParcelMass()
 {
-    label nTotal = parcelsToInject(0.0, timeEnd() - timeStart());
+    label nTotal = 0.0;
+    if (this->owner().solution().transient())
+    {
+        nTotal = parcelsToInject(0.0, timeEnd() - timeStart());
+    }
+    else
+    {
+        nTotal = parcelsToInject(0.0, 1.0);
+    }
+
     return massTotal_/nTotal;
 }
 
@@ -461,9 +493,6 @@ void Foam::InjectionModel<CloudType>::inject(TrackData& td)
     }
 
     const scalar time = this->owner().db().time().value();
-    const scalar trackTime = this->owner().solution().trackTime();
-    const polyMesh& mesh = this->owner().mesh();
-    typename TrackData::cloudType& cloud = td.cloud();
 
     // Prepare for next time step
     label parcelsAdded = 0;
@@ -471,96 +500,95 @@ void Foam::InjectionModel<CloudType>::inject(TrackData& td)
     label newParcels = 0;
     scalar newVolume = 0.0;
 
-    prepareForNextTimeStep(time, newParcels, newVolume);
-
-    // Duration of injection period during this timestep
-    const scalar deltaT =
-        max(0.0, min(trackTime, min(time - SOI_, timeEnd() - time0_)));
-
-    // Pad injection time if injection starts during this timestep
-    const scalar padTime = max(0.0, SOI_ - time0_);
-
-    // Introduce new parcels linearly across carrier phase timestep
-    for (label parcelI = 0; parcelI < newParcels; parcelI++)
+    if (prepareForNextTimeStep(time, newParcels, newVolume))
     {
-        if (validInjection(parcelI))
+        const scalar trackTime = this->owner().solution().trackTime();
+        const polyMesh& mesh = this->owner().mesh();
+        typename TrackData::cloudType& cloud = td.cloud();
+
+        // Duration of injection period during this timestep
+        const scalar deltaT =
+            max(0.0, min(trackTime, min(time - SOI_, timeEnd() - time0_)));
+
+        // Pad injection time if injection starts during this timestep
+        const scalar padTime = max(0.0, SOI_ - time0_);
+
+        // Introduce new parcels linearly across carrier phase timestep
+        for (label parcelI = 0; parcelI < newParcels; parcelI++)
         {
-            // Calculate the pseudo time of injection for parcel 'parcelI'
-            scalar timeInj = time0_ + padTime + deltaT*parcelI/newParcels;
-
-            // Determine the injection position and owner cell,
-            // tetFace and tetPt
-            label cellI = -1;
-            label tetFaceI = -1;
-            label tetPtI = -1;
-
-            vector pos = vector::zero;
-
-            setPositionAndCell
-            (
-                parcelI,
-                newParcels,
-                timeInj,
-                pos,
-                cellI,
-                tetFaceI,
-                tetPtI
-            );
-
-            if (cellI > -1)
+            if (validInjection(parcelI))
             {
-                // Lagrangian timestep
-                scalar dt = time - timeInj;
+                // Calculate the pseudo time of injection for parcel 'parcelI'
+                scalar timeInj = time0_ + padTime + deltaT*parcelI/newParcels;
 
-                // Apply corrections to position for 2-D cases
-                meshTools::constrainToMeshCentre(mesh, pos);
+                // Determine the injection position and owner cell,
+                // tetFace and tetPt
+                label cellI = -1;
+                label tetFaceI = -1;
+                label tetPtI = -1;
 
-                // Create a new parcel
-                parcelType* pPtr = new parcelType
+                vector pos = vector::zero;
+
+                setPositionAndCell
                 (
-                    td.cloud().pMesh(),
+                    parcelI,
+                    newParcels,
+                    timeInj,
                     pos,
                     cellI,
                     tetFaceI,
                     tetPtI
                 );
 
-                // Check/set new parcel thermo properties
-                cloud.setParcelThermoProperties(*pPtr, dt);
+                if (cellI > -1)
+                {
+                    // Lagrangian timestep
+                    scalar dt = time - timeInj;
 
-                // Assign new parcel properties in injection model
-                setProperties(parcelI, newParcels, timeInj, *pPtr);
+                    // Apply corrections to position for 2-D cases
+                    meshTools::constrainToMeshCentre(mesh, pos);
 
-                // Check/set new parcel injection properties
-                cloud.checkParcelProperties(*pPtr, dt, fullyDescribed());
+                    // Create a new parcel
+                    parcelType* pPtr =
+                        new parcelType(mesh, pos, cellI, tetFaceI, tetPtI);
 
-                // Apply correction to velocity for 2-D cases
-                meshTools::constrainDirection
-                (
-                    mesh,
-                    mesh.solutionD(),
-                    pPtr->U()
-                );
+                    // Check/set new parcel thermo properties
+                    cloud.setParcelThermoProperties(*pPtr, dt);
 
-                // Number of particles per parcel
-                pPtr->nParticle() =
-                    setNumberOfParticles
+                    // Assign new parcel properties in injection model
+                    setProperties(parcelI, newParcels, timeInj, *pPtr);
+
+                    // Check/set new parcel injection properties
+                    cloud.checkParcelProperties(*pPtr, dt, fullyDescribed());
+
+                    // Apply correction to velocity for 2-D cases
+                    meshTools::constrainDirection
                     (
-                        newParcels,
-                        newVolume,
-                        pPtr->d(),
-                        pPtr->rho()
+                        mesh,
+                        mesh.solutionD(),
+                        pPtr->U()
                     );
 
-                if (pPtr->move(td, dt))
-                {
-                    td.cloud().addParticle(pPtr);
-                    massAdded += pPtr->nParticle()*pPtr->mass();
-                    parcelsAdded++;
-                }
-                else
-                {
-                    delete pPtr;
+                    // Number of particles per parcel
+                    pPtr->nParticle() =
+                        setNumberOfParticles
+                        (
+                            newParcels,
+                            newVolume,
+                            pPtr->d(),
+                            pPtr->rho()
+                        );
+
+                    if (pPtr->move(td, dt))
+                    {
+                        td.cloud().addParticle(pPtr);
+                        massAdded += pPtr->nParticle()*pPtr->mass();
+                        parcelsAdded++;
+                    }
+                    else
+                    {
+                        delete pPtr;
+                    }
                 }
             }
         }
@@ -586,6 +614,8 @@ void Foam::InjectionModel<CloudType>::injectSteadyState
     const polyMesh& mesh = this->owner().mesh();
     typename TrackData::cloudType& cloud = td.cloud();
 
+    massTotal_ = massFlowRate_.value(mesh.time().value());
+
     // Reset counters
     time0_ = 0.0;
     label parcelsAdded = 0;
@@ -625,14 +655,8 @@ void Foam::InjectionModel<CloudType>::injectSteadyState
             meshTools::constrainToMeshCentre(mesh, pos);
 
             // Create a new parcel
-            parcelType* pPtr = new parcelType
-            (
-                td.cloud().pMesh(),
-                pos,
-                cellI,
-                tetFaceI,
-                tetPtI
-            );
+            parcelType* pPtr =
+                new parcelType(mesh, pos, cellI, tetFaceI, tetPtI);
 
             // Check/set new parcel thermo properties
             cloud.setParcelThermoProperties(*pPtr, 0.0);
@@ -644,12 +668,7 @@ void Foam::InjectionModel<CloudType>::injectSteadyState
             cloud.checkParcelProperties(*pPtr, 0.0, fullyDescribed());
 
             // Apply correction to velocity for 2-D cases
-            meshTools::constrainDirection
-            (
-                mesh,
-                mesh.solutionD(),
-                pPtr->U()
-            );
+            meshTools::constrainDirection(mesh, mesh.solutionD(), pPtr->U());
 
             // Number of particles per parcel
             pPtr->nParticle() =
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H
index 30a2c97b16..37e5909245 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H
@@ -53,6 +53,7 @@ SourceFiles
 #include "runTimeSelectionTables.H"
 #include "SubModelBase.H"
 #include "vector.H"
+#include "TimeDataEntry.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -102,6 +103,9 @@ protected:
             //- Total mass to inject [kg]
             scalar massTotal_;
 
+            //- Mass flow rate profile for steady calculations
+            TimeDataEntry<scalar> massFlowRate_;
+
             //- Total mass injected to date [kg]
             scalar massInjected_;
 
@@ -138,7 +142,7 @@ protected:
         virtual bool validInjection(const label parcelI);
 
         //- Determine properties for next time step/injection interval
-        virtual void prepareForNextTimeStep
+        virtual bool prepareForNextTimeStep
         (
             const scalar time,
             label& newParcels,
@@ -246,6 +250,12 @@ public:
 
     // Member Functions
 
+        // Mapping
+
+            //- Update mesh
+            virtual void updateMesh();
+
+
         // Global information
 
             //- Return the start-of-injection time
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.C
index 072addac22..ff7f3bdec3 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.C
@@ -168,6 +168,16 @@ Foam::scalar Foam::InjectionModelList<CloudType>::averageParcelMass()
 }
 
 
+template<class CloudType>
+void Foam::InjectionModelList<CloudType>::updateMesh()
+{
+    forAll(*this, i)
+    {
+        this->operator[](i).updateMesh();
+    }
+}
+
+
 template<class CloudType>
 template<class TrackData>
 void Foam::InjectionModelList<CloudType>::inject(TrackData& td)
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.H
index 1d67801e7d..22213e2090 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModelList.H
@@ -97,6 +97,12 @@ public:
             scalar averageParcelMass();
 
 
+        // Edit
+
+            //- Set injector locations when mesh is updated
+            void updateMesh();
+
+
         // Per-injection event functions
 
             //- Main injection loop
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.C
index 8d971e80a7..c40a95fbac 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.C
@@ -65,16 +65,7 @@ Foam::KinematicLookupTableInjection<CloudType>::KinematicLookupTableInjection
     injectorTetFaces_.setSize(injectors_.size());
     injectorTetPts_.setSize(injectors_.size());
 
-    forAll(injectors_, i)
-    {
-        this->findCellAtPosition
-        (
-            injectorCells_[i],
-            injectorTetFaces_[i],
-            injectorTetPts_[i],
-            injectors_[i].x()
-        );
-    }
+    updateMesh();
 
     // Determine volume of particles to inject
     this->volumeTotal_ = 0.0;
@@ -112,6 +103,23 @@ Foam::KinematicLookupTableInjection<CloudType>::~KinematicLookupTableInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::KinematicLookupTableInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    forAll(injectors_, i)
+    {
+        this->findCellAtPosition
+        (
+            injectorCells_[i],
+            injectorTetFaces_[i],
+            injectorTetPts_[i],
+            injectors_[i].x()
+        );
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::KinematicLookupTableInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.H
index 334a9b5bf0..d156f4793a 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/KinematicLookupTableInjection/KinematicLookupTableInjection.H
@@ -129,6 +129,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C
index 59a2a7d066..5317d03204 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.C
@@ -26,7 +26,6 @@ License
 #include "ManualInjection.H"
 #include "mathematicalConstants.H"
 #include "PackedBoolList.H"
-#include "Switch.H"
 
 using namespace Foam::constant::mathematical;
 
@@ -65,48 +64,13 @@ Foam::ManualInjection<CloudType>::ManualInjection
             this->coeffDict().subDict("sizeDistribution"),
             owner.rndGen()
         )
-    )
-{
-    Switch ignoreOutOfBounds
+    ),
+    ignoreOutOfBounds_
     (
         this->coeffDict().lookupOrDefault("ignoreOutOfBounds", false)
-    );
-
-    label nRejected = 0;
-
-    PackedBoolList keep(positions_.size(), true);
-
-    forAll(positions_, pI)
-    {
-        if
-        (
-            !this->findCellAtPosition
-            (
-                injectorCells_[pI],
-                injectorTetFaces_[pI],
-                injectorTetPts_[pI],
-                positions_[pI],
-                !ignoreOutOfBounds
-            )
-        )
-        {
-            keep[pI] = false;
-
-            nRejected++;
-        }
-    }
-
-    if (nRejected > 0)
-    {
-        inplaceSubset(keep, positions_);
-        inplaceSubset(keep, diameters_);
-        inplaceSubset(keep, injectorCells_);
-        inplaceSubset(keep, injectorTetFaces_);
-        inplaceSubset(keep, injectorTetPts_);
-
-        Info<< "    " << nRejected
-            << " particles ignored, out of bounds." << endl;
-    }
+    )
+{
+    updateMesh();
 
     // Construct parcel diameters
     forAll(diameters_, i)
@@ -133,7 +97,8 @@ Foam::ManualInjection<CloudType>::ManualInjection
     injectorTetFaces_(im.injectorTetFaces_),
     injectorTetPts_(im.injectorTetPts_),
     U0_(im.U0_),
-    sizeDistribution_(im.sizeDistribution_().clone().ptr())
+    sizeDistribution_(im.sizeDistribution_().clone().ptr()),
+    ignoreOutOfBounds_(im.ignoreOutOfBounds_)
 {}
 
 
@@ -146,6 +111,46 @@ Foam::ManualInjection<CloudType>::~ManualInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::ManualInjection<CloudType>::updateMesh()
+{
+    label nRejected = 0;
+
+    PackedBoolList keep(positions_.size(), true);
+
+    forAll(positions_, pI)
+    {
+        if
+        (
+            !this->findCellAtPosition
+            (
+                injectorCells_[pI],
+                injectorTetFaces_[pI],
+                injectorTetPts_[pI],
+                positions_[pI],
+                !ignoreOutOfBounds_
+            )
+        )
+        {
+            keep[pI] = false;
+            nRejected++;
+        }
+    }
+
+    if (nRejected > 0)
+    {
+        inplaceSubset(keep, positions_);
+        inplaceSubset(keep, diameters_);
+        inplaceSubset(keep, injectorCells_);
+        inplaceSubset(keep, injectorTetFaces_);
+        inplaceSubset(keep, injectorTetPts_);
+
+        Info<< "    " << nRejected
+            << " particles ignored, out of bounds" << endl;
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::ManualInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H
index 47e6c64a12..bbadab5409 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/ManualInjection/ManualInjection.H
@@ -43,6 +43,7 @@ SourceFiles
 
 #include "InjectionModel.H"
 #include "distributionModel.H"
+#include "Switch.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -50,7 +51,7 @@ namespace Foam
 {
 
 /*---------------------------------------------------------------------------*\
-                          Class ManualInjection Declaration
+                       Class ManualInjection Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -84,6 +85,9 @@ class ManualInjection
         //- Parcel size distribution model
         const autoPtr<distributionModels::distributionModel> sizeDistribution_;
 
+        //- Flag to suppress errors if particle injection site is out-of-bounds
+        Switch ignoreOutOfBounds_;
+
 
 public:
 
@@ -120,6 +124,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchFlowRateInjection/PatchFlowRateInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchFlowRateInjection/PatchFlowRateInjection.C
new file mode 100644
index 0000000000..af9fd37d03
--- /dev/null
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchFlowRateInjection/PatchFlowRateInjection.C
@@ -0,0 +1,325 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "PatchFlowRateInjection.H"
+#include "TimeDataEntry.H"
+#include "distributionModel.H"
+#include "mathematicalConstants.H"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::PatchFlowRateInjection<CloudType>::PatchFlowRateInjection
+(
+    const dictionary& dict,
+    CloudType& owner,
+    const word& modelName
+)
+:
+    InjectionModel<CloudType>(dict, owner, modelName,typeName),
+    patchName_(this->coeffDict().lookup("patchName")),
+    patchId_(owner.mesh().boundaryMesh().findPatchID(patchName_)),
+    patchArea_(0.0),
+    patchNormal_(vector::zero),
+    phiName_(this->coeffDict().template lookupOrDefault<word>("phi", "phi")),
+    rhoName_(this->coeffDict().template lookupOrDefault<word>("rho", "rho")),
+    duration_(readScalar(this->coeffDict().lookup("duration"))),
+    concentration_(readScalar(this->coeffDict().lookup("concentration"))),
+    parcelsPerSecond_
+    (
+        readScalar(this->coeffDict().lookup("parcelsPerSecond"))
+    ),
+    U0_(vector::zero),
+    sizeDistribution_
+    (
+        distributionModels::distributionModel::New
+        (
+            this->coeffDict().subDict("sizeDistribution"),
+            owner.rndGen()
+        )
+    ),
+    cellOwners_(),
+    fraction_(1.0),
+    pMeanVolume_(0.0)
+{
+    if (patchId_ < 0)
+    {
+        FatalErrorIn
+        (
+            "PatchFlowRateInjection<CloudType>::PatchFlowRateInjection"
+            "("
+                "const dictionary&, "
+                "CloudType&"
+            ")"
+        )   << "Requested patch " << patchName_ << " not found" << nl
+            << "Available patches are: " << owner.mesh().boundaryMesh().names()
+            << nl << exit(FatalError);
+    }
+
+    const polyPatch& patch = owner.mesh().boundaryMesh()[patchId_];
+
+    duration_ = owner.db().time().userTimeToTime(duration_);
+
+    updateMesh();
+
+    // TODO: retrieve mean diameter from distrution model
+    scalar pMeanDiameter =
+        readScalar(this->coeffDict().lookup("meanParticleDiameter"));
+    pMeanVolume_ = constant::mathematical::pi*pow3(pMeanDiameter)/6.0;
+
+    // patch geometry
+    label patchSize = cellOwners_.size();
+    label totalPatchSize = patchSize;
+    reduce(totalPatchSize, sumOp<label>());
+    fraction_ = scalar(patchSize)/totalPatchSize;
+
+    patchArea_ = gSum(mag(patch.faceAreas()));
+    patchNormal_ = gSum(patch.faceNormals())/totalPatchSize;
+    patchNormal_ /= mag(patchNormal_);
+
+    // Re-initialise total mass/volume to inject to zero
+    // - will be reset during each injection
+    this->volumeTotal_ = 0.0;
+    this->massTotal_ = 0.0;
+}
+
+
+template<class CloudType>
+Foam::PatchFlowRateInjection<CloudType>::PatchFlowRateInjection
+(
+    const PatchFlowRateInjection<CloudType>& im
+)
+:
+    InjectionModel<CloudType>(im),
+    patchName_(im.patchName_),
+    patchId_(im.patchId_),
+    patchArea_(im.patchArea_),
+    patchNormal_(im.patchNormal_),
+    phiName_(im.phiName_),
+    rhoName_(im.rhoName_),
+    duration_(im.duration_),
+    concentration_(im.concentration_),
+    parcelsPerSecond_(im.parcelsPerSecond_),
+    U0_(im.U0_),
+    sizeDistribution_(im.sizeDistribution_().clone().ptr()),
+    cellOwners_(im.cellOwners_),
+    fraction_(im.fraction_),
+    pMeanVolume_(im.pMeanVolume_)
+{}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::PatchFlowRateInjection<CloudType>::~PatchFlowRateInjection()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+template<class CloudType>
+void Foam::PatchFlowRateInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    const polyPatch& patch = this->owner().mesh().boundaryMesh()[patchId_];
+    cellOwners_ = patch.faceCells();
+}
+
+
+template<class CloudType>
+Foam::scalar Foam::PatchFlowRateInjection<CloudType>::timeEnd() const
+{
+    return this->SOI_ + duration_;
+}
+
+
+template<class CloudType>
+Foam::label Foam::PatchFlowRateInjection<CloudType>::parcelsToInject
+(
+    const scalar time0,
+    const scalar time1
+)
+{
+    if ((time0 >= 0.0) && (time0 < duration_))
+    {
+        scalar nParcels = fraction_*(time1 - time0)*parcelsPerSecond_;
+
+        cachedRandom& rnd = this->owner().rndGen();
+
+        label nParcelsToInject = floor(nParcels);
+
+        // Inject an additional parcel with a probability based on the
+        // remainder after the floor function
+        if
+        (
+            nParcelsToInject > 0
+         && (
+               nParcels - scalar(nParcelsToInject)
+             > rnd.position(scalar(0), scalar(1))
+            )
+        )
+        {
+            ++nParcelsToInject;
+        }
+
+        return nParcelsToInject;
+    }
+    else
+    {
+        return 0;
+    }
+}
+
+
+template<class CloudType>
+Foam::scalar Foam::PatchFlowRateInjection<CloudType>::volumeToInject
+(
+    const scalar time0,
+    const scalar time1
+)
+{
+    scalar volume = 0.0;
+
+    if ((time0 >= 0.0) && (time0 < duration_))
+    {
+        const polyMesh& mesh = this->owner().mesh();
+
+        const surfaceScalarField& phi =
+            mesh.lookupObject<surfaceScalarField>(phiName_);
+
+        const scalarField& phip = phi.boundaryField()[patchId_];
+
+        scalar carrierVolume = 0.0;
+        if (phi.dimensions() == dimVelocity*dimArea)
+        {
+            const scalar flowRateIn = max(0.0, -sum(phip));
+            U0_ = -patchNormal_*flowRateIn/patchArea_;
+            carrierVolume = (time1 - time0)*flowRateIn;
+        }
+        else
+        {
+            const volScalarField& rho =
+                mesh.lookupObject<volScalarField>(rhoName_);
+            const scalarField& rhop = rho.boundaryField()[patchId_];
+
+            const scalar flowRateIn = max(0.0, -sum(phip/rhop));
+            U0_ = -patchNormal_*flowRateIn/patchArea_;
+            carrierVolume = (time1 - time0)*flowRateIn;
+        }
+
+        const scalar newParticles = concentration_*carrierVolume;
+
+        volume = pMeanVolume_*newParticles;
+    }
+
+    reduce(volume, sumOp<scalar>());
+
+    this->volumeTotal_ = volume;
+    this->massTotal_ = volume*this->owner().constProps().rho0();
+
+    return fraction_*volume;
+}
+
+
+template<class CloudType>
+void Foam::PatchFlowRateInjection<CloudType>::setPositionAndCell
+(
+    const label,
+    const label,
+    const scalar,
+    vector& position,
+    label& cellOwner,
+    label& tetFaceI,
+    label& tetPtI
+)
+{
+    if (cellOwners_.size() > 0)
+    {
+        cachedRandom& rnd = this->owner().rndGen();
+
+        label cellI = rnd.position<label>(0, cellOwners_.size() - 1);
+
+        cellOwner = cellOwners_[cellI];
+
+        // The position is between the face and cell centre, which could be
+        // in any tet of the decomposed cell, so arbitrarily choose the first
+        // face of the cell as the tetFace and the first point after the base
+        // point on the face as the tetPt.  The tracking will pick the cell
+        // consistent with the motion in the firsttracking step.
+        tetFaceI = this->owner().mesh().cells()[cellOwner][0];
+        tetPtI = 1;
+
+        // position perturbed between cell and patch face centres
+        const vector& pc = this->owner().mesh().C()[cellOwner];
+        const vector& pf =
+            this->owner().mesh().Cf().boundaryField()[patchId_][cellI];
+
+        const scalar a = rnd.sample01<scalar>();
+        const vector d = pf - pc;
+        position = pc + 0.5*a*d;
+    }
+    else
+    {
+        cellOwner = -1;
+        tetFaceI = -1;
+        tetPtI = -1;
+        // dummy position
+        position = pTraits<vector>::max;
+    }
+}
+
+
+template<class CloudType>
+void Foam::PatchFlowRateInjection<CloudType>::setProperties
+(
+    const label,
+    const label,
+    const scalar,
+    typename CloudType::parcelType& parcel
+)
+{
+    // set particle velocity
+    parcel.U() = U0_;
+
+    // set particle diameter
+    parcel.d() = sizeDistribution_->sample();
+}
+
+
+template<class CloudType>
+bool Foam::PatchFlowRateInjection<CloudType>::fullyDescribed() const
+{
+    return false;
+}
+
+
+template<class CloudType>
+bool Foam::PatchFlowRateInjection<CloudType>::validInjection(const label)
+{
+    return true;
+}
+
+
+// ************************************************************************* //
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchFlowRateInjection/PatchFlowRateInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchFlowRateInjection/PatchFlowRateInjection.H
new file mode 100644
index 0000000000..e6822a76d7
--- /dev/null
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchFlowRateInjection/PatchFlowRateInjection.H
@@ -0,0 +1,207 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::PatchFlowRateInjection
+
+Description
+    Patch injection
+    - uses patch flow rate to determine concentration and velociy
+
+    - User specifies
+      - Total mass to inject
+      - Name of patch
+      - Injection duration
+      - Initial parcel velocity
+      - Injection target concentration/carrier volume flow rate
+    - Parcel diameters obtained by distribution model
+    - Parcels injected at cell centres adjacent to patch
+
+SourceFiles
+    PatchFlowRateInjection.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef PatchFlowRateInjection_H
+#define PatchFlowRateInjection_H
+
+#include "InjectionModel.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+template<class Type>
+class TimeDataEntry;
+
+class distributionModel;
+
+/*---------------------------------------------------------------------------*\
+                   Class PatchFlowRateInjection Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class CloudType>
+class PatchFlowRateInjection
+:
+    public InjectionModel<CloudType>
+{
+    // Private data
+
+        //- Name of patch
+        const word patchName_;
+
+        //- Id of patch
+        const label patchId_;
+
+        //- Patch area
+        scalar patchArea_;
+
+        //- Patch normal direction
+        vector patchNormal_;
+
+        //- Name of carrier (mass or volume) flux field
+        const word phiName_;
+
+        //- Name of carrier density field
+        const word rhoName_;
+
+        //- Injection duration [s]
+        scalar duration_;
+
+        //- Concentration of particles to carrier [] (particles/m3)
+        const scalar concentration_;
+
+        //- Number of parcels to introduce per second []
+        const label parcelsPerSecond_;
+
+        //- Initial parcel velocity [m/s]
+        vector U0_;
+
+        //- Parcel size distribution model
+        const autoPtr<distributionModels::distributionModel> sizeDistribution_;
+
+        //- List of cell labels corresponding to injector positions
+        labelList cellOwners_;
+
+        //- Fraction of injection controlled by this processor
+        scalar fraction_;
+
+        //- Mean particle volume TODO: temporary measure - return from PDF
+        scalar pMeanVolume_;
+
+
+public:
+
+    //- Runtime type information
+    TypeName("patchFlowRateInjection");
+
+
+    // Constructors
+
+        //- Construct from dictionary
+        PatchFlowRateInjection
+        (
+            const dictionary& dict,
+            CloudType& owner,
+            const word& modelName
+        );
+
+        //- Construct copy
+        PatchFlowRateInjection(const PatchFlowRateInjection<CloudType>& im);
+
+        //- Construct and return a clone
+        virtual autoPtr<InjectionModel<CloudType> > clone() const
+        {
+            return autoPtr<InjectionModel<CloudType> >
+            (
+                new PatchFlowRateInjection<CloudType>(*this)
+            );
+        }
+
+
+    //- Destructor
+    virtual ~PatchFlowRateInjection();
+
+
+    // Member Functions
+
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
+        //- Return the end-of-injection time
+        scalar timeEnd() const;
+
+        //- Number of parcels to introduce relative to SOI
+        virtual label parcelsToInject(const scalar time0, const scalar time1);
+
+        //- Volume of parcels to introduce relative to SOI
+        virtual scalar volumeToInject(const scalar time0, const scalar time1);
+
+
+        // Injection geometry
+
+            //- Set the injection position and owner cell, tetFace and tetPt
+            virtual void setPositionAndCell
+            (
+                const label parcelI,
+                const label nParcels,
+                const scalar time,
+                vector& position,
+                label& cellOwner,
+                label& tetFaceI,
+                label& tetPtI
+            );
+
+            virtual void setProperties
+            (
+                const label parcelI,
+                const label nParcels,
+                const scalar time,
+                typename CloudType::parcelType& parcel
+            );
+
+            //- Flag to identify whether model fully describes the parcel
+            virtual bool fullyDescribed() const;
+
+            //- Return flag to identify whether or not injection of parcelI is
+            //  permitted
+            virtual bool validInjection(const label parcelI);
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#ifdef NoRepository
+#   include "PatchFlowRateInjection.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.C
index aae52b8e22..9744364ca1 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.C
@@ -80,11 +80,9 @@ Foam::PatchInjection<CloudType>::PatchInjection
             << nl << exit(FatalError);
     }
 
-    const polyPatch& patch = owner.mesh().boundaryMesh()[patchId_];
-
     duration_ = owner.db().time().userTimeToTime(duration_);
 
-    cellOwners_ = patch.faceCells();
+    updateMesh();
 
     label patchSize = cellOwners_.size();
     label totalPatchSize = patchSize;
@@ -125,6 +123,15 @@ Foam::PatchInjection<CloudType>::~PatchInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::PatchInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    const polyPatch& patch = this->owner().mesh().boundaryMesh()[patchId_];
+    cellOwners_ = patch.faceCells();
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::PatchInjection<CloudType>::timeEnd() const
 {
@@ -141,7 +148,7 @@ Foam::label Foam::PatchInjection<CloudType>::parcelsToInject
 {
     if ((time0 >= 0.0) && (time0 < duration_))
     {
-        scalar nParcels =fraction_*(time1 - time0)*parcelsPerSecond_;
+        scalar nParcels = fraction_*(time1 - time0)*parcelsPerSecond_;
 
         cachedRandom& rnd = this->owner().rndGen();
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.H
index 15874727d8..a9d5d60a36 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/PatchInjection/PatchInjection.H
@@ -129,6 +129,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C
index c1ce95e215..8ffae4f75f 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C
@@ -39,8 +39,26 @@ Foam::LocalInteraction<CloudType>::LocalInteraction
     nEscape_(patchData_.size(), 0),
     massEscape_(patchData_.size(), 0.0),
     nStick_(patchData_.size(), 0),
-    massStick_(patchData_.size(), 0.0)
+    massStick_(patchData_.size(), 0.0),
+    writeFields_(this->coeffDict().lookupOrDefault("writeFields", false)),
+    massEscapePtr_(NULL),
+    massStickPtr_(NULL)
 {
+    if (writeFields_)
+    {
+        word massEscapeName(this->owner().name() + "::massEscape");
+        word massStickName(this->owner().name() + "::massStick");
+        Info<< "    Interaction fields will be written to " << massEscapeName
+            << " and " << massStickName << endl;
+
+        (void)massEscape();
+        (void)massStick();
+    }
+    else
+    {
+        Info<< "    Interaction fields will not be written" << endl;
+    }
+
     // check that interactions are valid/specified
     forAll(patchData_, patchI)
     {
@@ -74,7 +92,10 @@ Foam::LocalInteraction<CloudType>::LocalInteraction
     nEscape_(pim.nEscape_),
     massEscape_(pim.massEscape_),
     nStick_(pim.nStick_),
-    massStick_(pim.massStick_)
+    massStick_(pim.massStick_),
+    writeFields_(pim.writeFields_),
+    massEscapePtr_(NULL),
+    massStickPtr_(NULL)
 {}
 
 
@@ -87,6 +108,64 @@ Foam::LocalInteraction<CloudType>::~LocalInteraction()
 
 // * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * * //
 
+template<class CloudType>
+Foam::volScalarField& Foam::LocalInteraction<CloudType>::massEscape()
+{
+    if (!massEscapePtr_.valid())
+    {
+        const fvMesh& mesh = this->owner().mesh();
+
+        massEscapePtr_.reset
+        (
+            new volScalarField
+            (
+                IOobject
+                (
+                    this->owner().name() + "::massEscape",
+                    mesh.time().timeName(),
+                    mesh,
+                    IOobject::READ_IF_PRESENT,
+                    IOobject::AUTO_WRITE
+                ),
+                mesh,
+                dimensionedScalar("zero", dimMass, 0.0)
+            )
+        );
+    }
+
+    return massEscapePtr_();
+}
+
+
+template<class CloudType>
+Foam::volScalarField& Foam::LocalInteraction<CloudType>::massStick()
+{
+    if (!massStickPtr_.valid())
+    {
+        const fvMesh& mesh = this->owner().mesh();
+
+        massStickPtr_.reset
+        (
+            new volScalarField
+            (
+                IOobject
+                (
+                    this->owner().name() + "::massStick",
+                    mesh.time().timeName(),
+                    mesh,
+                    IOobject::READ_IF_PRESENT,
+                    IOobject::AUTO_WRITE
+                ),
+                mesh,
+                dimensionedScalar("zero", dimMass, 0.0)
+            )
+        );
+    }
+
+    return massStickPtr_();
+}
+
+
 template<class CloudType>
 bool Foam::LocalInteraction<CloudType>::correct
 (
@@ -97,14 +176,13 @@ bool Foam::LocalInteraction<CloudType>::correct
     const tetIndices& tetIs
 )
 {
-    vector& U = p.U();
-
-    bool& active = p.active();
-
     label patchI = patchData_.applyToPatch(pp.index());
 
     if (patchI >= 0)
     {
+        vector& U = p.U();
+        bool& active = p.active();
+
         typename PatchInteractionModel<CloudType>::interactionType it =
             this->wordToInteractionType
             (
@@ -115,20 +193,36 @@ bool Foam::LocalInteraction<CloudType>::correct
         {
             case PatchInteractionModel<CloudType>::itEscape:
             {
+                scalar dm = p.mass()*p.nParticle();
+
                 keepParticle = false;
                 active = false;
                 U = vector::zero;
                 nEscape_[patchI]++;
-                massEscape_[patchI] += p.mass()*p.nParticle();
+                massEscape_[patchI] += dm;
+                if (writeFields_)
+                {
+                    label pI = pp.index();
+                    label fI = pp.whichFace(p.face());
+                    massEscape().boundaryField()[pI][fI] += dm;
+                }
                 break;
             }
             case PatchInteractionModel<CloudType>::itStick:
             {
+                scalar dm = p.mass()*p.nParticle();
+
                 keepParticle = true;
                 active = false;
                 U = vector::zero;
                 nStick_[patchI]++;
-                massStick_[patchI] += p.mass()*p.nParticle();
+                massStick_[patchI] += dm;
+                if (writeFields_)
+                {
+                    label pI = pp.index();
+                    label fI = pp.whichFace(p.face());
+                    massStick().boundaryField()[pI][fI] += dm;
+                }
                 break;
             }
             case PatchInteractionModel<CloudType>::itRebound:
@@ -139,7 +233,7 @@ bool Foam::LocalInteraction<CloudType>::correct
                 vector nw;
                 vector Up;
 
-                this->patchData(p, pp, trackFraction, tetIs, nw, Up);
+                this->owner().patchData(p, pp, trackFraction, tetIs, nw, Up);
 
                 // Calculate motion relative to patch velocity
                 U -= Up;
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H
index a3a28121f0..3a8c776776 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H
@@ -34,6 +34,7 @@ Description
 
 #include "PatchInteractionModel.H"
 #include "patchInteractionDataList.H"
+#include "Switch.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -69,6 +70,16 @@ class LocalInteraction
             List<scalar> massStick_;
 
 
+        //- Flag to output data as fields
+        Switch writeFields_;
+
+        //- Mass escape field
+        autoPtr<volScalarField> massEscapePtr_;
+
+        //- Mass stick field
+        autoPtr<volScalarField> massStickPtr_;
+
+
 public:
 
     //- Runtime type information
@@ -99,6 +110,12 @@ public:
 
     // Member Functions
 
+        //- Return access to the massEscape field
+        volScalarField& massEscape();
+
+        //- Return access to the massStick field
+        volScalarField& massStick();
+
         //- Apply velocity correction
         //  Returns true if particle remains in same cell
         virtual bool correct
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C
index 9d2566ab36..6ffabc3715 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -179,159 +179,6 @@ bool Foam::PatchInteractionModel<CloudType>::correct
 }
 
 
-template<class CloudType>
-void Foam::PatchInteractionModel<CloudType>::patchData
-(
-    typename CloudType::parcelType& p,
-    const polyPatch& pp,
-    const scalar trackFraction,
-    const tetIndices& tetIs,
-    vector& nw,
-    vector& Up
-) const
-{
-    const fvMesh& mesh = this->owner().mesh();
-
-    const volVectorField& Ufield =
-        mesh.objectRegistry::lookupObject<volVectorField>(UName_);
-
-    label patchI = pp.index();
-    label patchFaceI = pp.whichFace(p.face());
-
-    vector n = tetIs.faceTri(mesh).normal();
-    n /= mag(n);
-
-    vector U = Ufield.boundaryField()[patchI][patchFaceI];
-
-    // Unless the face is rotating, the required normal is n;
-    nw = n;
-
-    if (!mesh.moving())
-    {
-        // Only wall patches may have a non-zero wall velocity from
-        // the velocity field when the mesh is not moving.
-
-        if (isA<wallPolyPatch>(pp))
-        {
-            Up = U;
-        }
-        else
-        {
-            Up = vector::zero;
-        }
-    }
-    else
-    {
-        vector U00 = Ufield.oldTime().boundaryField()[patchI][patchFaceI];
-
-        vector n00 = tetIs.oldFaceTri(mesh).normal();
-
-        // Difference in normal over timestep
-        vector dn = vector::zero;
-
-        if (mag(n00) > SMALL)
-        {
-            // If the old normal is zero (for example in layer
-            // addition) then use the current normal, meaning that the
-            // motion can only be translational, and dn remains zero,
-            // otherwise, calculate dn:
-
-            n00 /= mag(n00);
-
-            dn = n - n00;
-        }
-
-        // Total fraction thought the timestep of the motion,
-        // including stepFraction before the current tracking step
-        // and the current trackFraction
-        // i.e.
-        // let s = stepFraction, t = trackFraction
-        // Motion of x in time:
-        // |-----------------|---------|---------|
-        // x00               x0        xi        x
-        //
-        // where xi is the correct value of x at the required
-        // tracking instant.
-        //
-        // x0 = x00 + s*(x - x00) = s*x + (1 - s)*x00
-        //
-        // i.e. the motion covered by previous tracking portions
-        // within this timestep, and
-        //
-        // xi = x0 + t*(x - x0)
-        //    = t*x + (1 - t)*x0
-        //    = t*x + (1 - t)*(s*x + (1 - s)*x00)
-        //    = (s + t - s*t)*x + (1 - (s + t - s*t))*x00
-        //
-        // let m = (s + t - s*t)
-        //
-        // xi = m*x + (1 - m)*x00 = x00 + m*(x - x00);
-        //
-        // In the same form as before.
-
-        scalar m =
-            p.stepFraction()
-          + trackFraction
-          - (p.stepFraction()*trackFraction);
-
-        // When the mesh is moving, the velocity field on wall patches
-        // will contain the velocity associated with the motion of the
-        // mesh, in which case it is interpolated in time using m.
-        // For other patches the face velocity will need to be
-        // reconstructed from the face centre motion.
-
-        const vector& Cf = mesh.faceCentres()[p.face()];
-
-        vector Cf00 = mesh.faces()[p.face()].centre(mesh.oldPoints());
-
-        if (isA<wallPolyPatch>(pp))
-        {
-            Up = U00 + m*(U - U00);
-        }
-        else
-        {
-            Up = (Cf - Cf00)/this->owner().time().deltaTValue();
-        }
-
-        if (mag(dn) > SMALL)
-        {
-            // Rotational motion, nw requires interpolation and a
-            // rotational velocity around face centre correction to Up
-            // is required.
-
-            nw = n00 + m*dn;
-
-            // Cf at tracking instant
-            vector Cfi = Cf00 + m*(Cf - Cf00);
-
-            // Normal vector cross product
-            vector omega = (n00 ^ n);
-
-            scalar magOmega = mag(omega);
-
-            // magOmega = sin(angle between unit normals)
-            // Normalise omega vector by magOmega, then multiply by
-            // angle/dt to give the correct angular velocity vector.
-            omega *=
-                Foam::asin(magOmega)
-               /(magOmega*this->owner().time().deltaTValue());
-
-            // Project position onto face and calculate this position
-            // relative to the face centre.
-            vector facePos =
-                p.position()
-              - ((p.position() - Cfi) & nw)*nw
-              - Cfi;
-
-            Up += (omega ^ facePos);
-        }
-
-        // No further action is required if the motion is
-        // translational only, nw and Up have already been set.
-    }
-}
-
-
 template<class CloudType>
 void Foam::PatchInteractionModel<CloudType>::info(Ostream& os)
 {
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H
index 293d2cdb45..7f3ea38198 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -164,18 +164,6 @@ public:
             const tetIndices& tetIs
         );
 
-        //- Calculate the patch normal and velocity to interact with,
-        //  accounting for patch motion if required.
-        void patchData
-        (
-            typename CloudType::parcelType& p,
-            const polyPatch& pp,
-            const scalar trackFraction,
-            const tetIndices& tetIs,
-            vector& normal,
-            vector& Up
-        ) const;
-
 
         // I-O
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/Rebound/Rebound.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/Rebound/Rebound.C
index 147408204b..f6c1fda460 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/Rebound/Rebound.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/Rebound/Rebound.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -74,7 +74,7 @@ bool Foam::Rebound<CloudType>::correct
     vector nw;
     vector Up;
 
-    this->patchData(p, pp, trackFraction, tetIs, nw, Up);
+    this->owner().patchData(p, pp, trackFraction, tetIs, nw, Up);
 
     // Calculate motion relative to patch velocity
     U -= Up;
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C
index b3052a4ec2..d9b38daccf 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C
@@ -148,7 +148,7 @@ bool Foam::StandardWallInteraction<CloudType>::correct
                 vector nw;
                 vector Up;
 
-                this->patchData(p, pp, trackFraction, tetIs, nw, Up);
+                this->owner().patchData(p, pp, trackFraction, tetIs, nw, Up);
 
                 // Calculate motion relative to patch velocity
                 U -= Up;
diff --git a/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C b/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C
index 76a22ffe44..72e56bf884 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C
@@ -156,18 +156,20 @@ Foam::CompositionModel<CloudType>::componentNames(const label phaseI) const
 template<class CloudType>
 Foam::label Foam::CompositionModel<CloudType>::globalCarrierId
 (
-    const word& cmptName
+    const word& cmptName,
+    const bool allowNotFound
 ) const
 {
     label id = thermo_.carrierId(cmptName);
 
-    if (id < 0)
+    if (id < 0 && !allowNotFound)
     {
         FatalErrorIn
         (
             "Foam::label Foam::CompositionModel<CloudType>::globalCarrierId"
             "("
-                "const word&"
+                "const word&, "
+                "const bool"
             ") const"
         )   << "Unable to determine global id for requested component "
             << cmptName << ". Available components are " << nl
@@ -182,19 +184,21 @@ template<class CloudType>
 Foam::label Foam::CompositionModel<CloudType>::globalId
 (
     const label phaseI,
-    const word& cmptName
+    const word& cmptName,
+    const bool allowNotFound
 ) const
 {
     label id = phaseProps_[phaseI].globalId(cmptName);
 
-    if (id < 0)
+    if (id < 0 && !allowNotFound)
     {
         FatalErrorIn
         (
             "Foam::label Foam::CompositionModel<CloudType>::globalId"
             "("
                 "const label, "
-                "const word&"
+                "const word&, "
+                "const bool"
             ") const"
         )   << "Unable to determine global id for requested component "
             << cmptName << abort(FatalError);
@@ -218,19 +222,21 @@ template<class CloudType>
 Foam::label Foam::CompositionModel<CloudType>::localId
 (
     const label phaseI,
-    const word& cmptName
+    const word& cmptName,
+    const bool allowNotFound
 ) const
 {
     label id = phaseProps_[phaseI].id(cmptName);
 
-    if (id < 0)
+    if (id < 0 && !allowNotFound)
     {
         FatalErrorIn
         (
             "Foam::label Foam::CompositionModel<CloudType>::localId"
             "("
                 "const label, "
-                "const word&"
+                "const word&, "
+                "const bool"
             ") const"
         )   << "Unable to determine local id for component " << cmptName
             << abort(FatalError);
@@ -244,12 +250,13 @@ template<class CloudType>
 Foam::label Foam::CompositionModel<CloudType>::localToGlobalCarrierId
 (
     const label phaseI,
-    const label id
+    const label id,
+    const bool allowNotFound
 ) const
 {
     label gid = phaseProps_[phaseI].globalCarrierIds()[id];
 
-    if (gid < 0)
+    if (gid < 0 && !allowNotFound)
     {
         FatalErrorIn
         (
@@ -257,7 +264,8 @@ Foam::label Foam::CompositionModel<CloudType>::localToGlobalCarrierId
             "Foam::CompositionModel<CloudType>::localToGlobalCarrierId"
             "("
                 "const label, "
-                "const label"
+                "const label, "
+                "const bool"
             ") const"
         )   << "Unable to determine global carrier id for phase "
             << phaseI << " with local id " << id
diff --git a/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.H b/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.H
index 724354902c..cabdd91eac 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.H
+++ b/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -166,22 +166,37 @@ public:
                 const wordList& componentNames(const label phaseI) const;
 
                 //- Return global id of component cmptName in carrier thermo
-                label globalCarrierId(const word& cmptName) const;
+                label globalCarrierId
+                (
+                    const word& cmptName,
+                    const bool allowNotFound = false
+                ) const;
 
                 //- Return global id of component cmptName in phase phaseI
-                label globalId(const label phaseI, const word& cmptName) const;
+                label globalId
+                (
+                    const label phaseI,
+                    const word& cmptName,
+                    const bool allowNotFound = false
+                ) const;
 
                 //- Return global ids of for phase phaseI
                 const labelList& globalIds(const label phaseI) const;
 
                 //- Return local id of component cmptName in phase phaseI
-                label localId(const label phaseI, const word& cmptName) const;
+                label localId
+                (
+                    const label phaseI,
+                    const word& cmptName,
+                    const bool allowNotFound = false
+                ) const;
 
                 //- Return global carrier id of component given local id
                 label localToGlobalCarrierId
                 (
                     const label phaseI,
-                    const label id
+                    const label id,
+                    const bool allowNotFound = false
                 ) const;
 
                 //- Return the list of phase phaseI mass fractions
diff --git a/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.C b/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.C
index 46dafd52e6..711b3cec7a 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.C
@@ -64,16 +64,7 @@ Foam::ReactingLookupTableInjection<CloudType>::ReactingLookupTableInjection
     injectorTetFaces_.setSize(injectors_.size());
     injectorTetPts_.setSize(injectors_.size());
 
-    forAll(injectors_, i)
-    {
-        this->findCellAtPosition
-        (
-            injectorCells_[i],
-            injectorTetFaces_[i],
-            injectorTetPts_[i],
-            injectors_[i].x()
-        );
-    }
+    updateMesh();
 
     // Determine volume of particles to inject
     this->volumeTotal_ = 0.0;
@@ -111,6 +102,23 @@ Foam::ReactingLookupTableInjection<CloudType>::~ReactingLookupTableInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::ReactingLookupTableInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    forAll(injectors_, i)
+    {
+        this->findCellAtPosition
+        (
+            injectorCells_[i],
+            injectorTetFaces_[i],
+            injectorTetPts_[i],
+            injectors_[i].x()
+        );
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::ReactingLookupTableInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.H b/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.H
index ece4b5fb19..ef062fd72b 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.H
+++ b/src/lagrangian/intermediate/submodels/Reacting/InjectionModel/ReactingLookupTableInjection/ReactingLookupTableInjection.H
@@ -132,6 +132,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.C
index eb4cfe6efe..0de0772381 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -102,10 +102,13 @@ template<class CloudType>
 void Foam::ConstantRateDevolatilisation<CloudType>::calculate
 (
     const scalar dt,
+    const scalar age,
     const scalar mass0,
     const scalar mass,
     const scalar T,
     const scalarField& YGasEff,
+    const scalarField& YLiquidEff,
+    const scalarField& YSolidEff,
     bool& canCombust,
     scalarField& dMassDV
 ) const
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.H
index d84810e81e..7faffb990d 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/ConstantRateDevolatilisation/ConstantRateDevolatilisation.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -104,10 +104,13 @@ public:
         virtual void calculate
         (
             const scalar dt,
+            const scalar age,
             const scalar mass0,
             const scalar mass,
             const scalar T,
             const scalarField& YGasEff,
+            const scalarField& YLiquidEff,
+            const scalarField& YSolidEff,
             bool& canCombust,
             scalarField& dMassDV
         ) const;
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C
index 331ae8d78e..6b4325db4f 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C
@@ -78,6 +78,9 @@ void Foam::DevolatilisationModel<CloudType>::calculate
     const scalar,
     const scalar,
     const scalar,
+    const scalar,
+    const scalarField&,
+    const scalarField&,
     const scalarField&,
     bool&,
     scalarField&
@@ -91,6 +94,9 @@ void Foam::DevolatilisationModel<CloudType>::calculate
             "const scalar, "
             "const scalar, "
             "const scalar, "
+            "const scalar, "
+            "const scalarField&, "
+            "const scalarField&, "
             "const scalarField&, "
             "bool&, "
             "scalarField&"
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H
index 5b72c0a36d..7cff8d426a 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -47,7 +47,7 @@ namespace Foam
 {
 
 /*---------------------------------------------------------------------------*\
-                      Class DevolatilisationModel Declaration
+                    Class DevolatilisationModel Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -126,10 +126,13 @@ public:
         virtual void calculate
         (
             const scalar dt,
+            const scalar age,
             const scalar mass0,
             const scalar mass,
             const scalar T,
             const scalarField& YGasEff,
+            const scalarField& YLiquidEff,
+            const scalarField& YSolidEff,
             bool& canCombust,
             scalarField& dMassDV
         ) const;
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.C
index f2b5819715..238cb4a02e 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -71,6 +71,9 @@ void Foam::NoDevolatilisation<CloudType>::calculate
     const scalar,
     const scalar,
     const scalar,
+    const scalar,
+    const scalarField&,
+    const scalarField&,
     const scalarField&,
     bool& canCombust,
     scalarField&
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.H
index 1b905d42fd..b3a617ba86 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/NoDevolatilisation/NoDevolatilisation.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -85,10 +85,13 @@ public:
         virtual void calculate
         (
             const scalar dt,
+            const scalar age,
             const scalar mass0,
             const scalar mass,
             const scalar T,
             const scalarField& YGasEff,
+            const scalarField& YLiquidEff,
+            const scalarField& YSolidEff,
             bool& canCombust,
             scalarField& dMassDV
         ) const;
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.C
index fd0f1429e3..fe4b856cfb 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -105,10 +105,13 @@ template<class CloudType>
 void Foam::SingleKineticRateDevolatilisation<CloudType>::calculate
 (
     const scalar dt,
+    const scalar age,
     const scalar mass0,
     const scalar mass,
     const scalar T,
     const scalarField& YGasEff,
+    const scalarField& YLiquidEff,
+    const scalarField& YSolidEff,
     bool& canCombust,
     scalarField& dMassDV
 ) const
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.H
index 535c7dfe1d..d9c3064ce9 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/SingleKineticRateDevolatilisation/SingleKineticRateDevolatilisation.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -229,10 +229,13 @@ public:
         virtual void calculate
         (
             const scalar dt,
+            const scalar age,
             const scalar mass0,
             const scalar mass,
             const scalar T,
             const scalarField& YGasEff,
+            const scalarField& YLiquidEff,
+            const scalarField& YSolidEff,
             bool& canCombust,
             scalarField& dMassDV
         ) const;
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.C
index 192f2a5572..bd630d879d 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.C
@@ -65,16 +65,7 @@ ReactingMultiphaseLookupTableInjection
     injectorTetFaces_.setSize(injectors_.size());
     injectorTetPts_.setSize(injectors_.size());
 
-    forAll(injectors_, i)
-    {
-        this->findCellAtPosition
-        (
-            injectorCells_[i],
-            injectorTetFaces_[i],
-            injectorTetPts_[i],
-            injectors_[i].x()
-        );
-    }
+    updateMesh();
 
     // Determine volume of particles to inject
     this->volumeTotal_ = 0.0;
@@ -114,6 +105,23 @@ Foam::ReactingMultiphaseLookupTableInjection<CloudType>::
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::ReactingMultiphaseLookupTableInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    forAll(injectors_, i)
+    {
+        this->findCellAtPosition
+        (
+            injectorCells_[i],
+            injectorTetFaces_[i],
+            injectorTetPts_[i],
+            injectors_[i].x()
+        );
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar
 Foam::ReactingMultiphaseLookupTableInjection<CloudType>::timeEnd() const
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.H
index 6ee4b576c3..7e6c328558 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/InjectionModel/ReactingMultiphaseLookupTableInjection/ReactingMultiphaseLookupTableInjection.H
@@ -135,6 +135,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.C b/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.C
index 78a7d0725d..fdc0a3b4a3 100644
--- a/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.C
+++ b/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.C
@@ -65,16 +65,7 @@ Foam::ThermoLookupTableInjection<CloudType>::ThermoLookupTableInjection
     injectorTetFaces_.setSize(injectors_.size());
     injectorTetPts_.setSize(injectors_.size());
 
-    forAll(injectors_, i)
-    {
-        this->findCellAtPosition
-        (
-            injectorCells_[i],
-            injectorTetFaces_[i],
-            injectorTetPts_[i],
-            injectors_[i].x()
-        );
-    }
+    updateMesh();
 
     // Determine volume of particles to inject
     this->volumeTotal_ = 0.0;
@@ -112,6 +103,23 @@ Foam::ThermoLookupTableInjection<CloudType>::~ThermoLookupTableInjection()
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
+template<class CloudType>
+void Foam::ThermoLookupTableInjection<CloudType>::updateMesh()
+{
+    // Set/cache the injector cells
+    forAll(injectors_, i)
+    {
+        this->findCellAtPosition
+        (
+            injectorCells_[i],
+            injectorTetFaces_[i],
+            injectorTetPts_[i],
+            injectors_[i].x()
+        );
+    }
+}
+
+
 template<class CloudType>
 Foam::scalar Foam::ThermoLookupTableInjection<CloudType>::timeEnd() const
 {
diff --git a/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.H b/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.H
index 61df05a112..efb83c3614 100644
--- a/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.H
+++ b/src/lagrangian/intermediate/submodels/Thermodynamic/InjectionModel/ThermoLookupTableInjection/ThermoLookupTableInjection.H
@@ -132,6 +132,9 @@ public:
 
     // Member Functions
 
+        //- Set injector locations when mesh is updated
+        virtual void updateMesh();
+
         //- Return the end-of-injection time
         scalar timeEnd() const;
 
diff --git a/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C b/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
index 3381bbc087..9bbd82d21f 100644
--- a/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
+++ b/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
@@ -404,7 +404,7 @@ void Foam::SprayParcel<ParcelType>::solveTABEq
     // oscillation frequency (squared)
     scalar omega2 = TABComega*sigma/(rho*r3) - rtd*rtd;
 
-    if(omega2 > 0)
+    if (omega2 > 0)
     {
         scalar omega = sqrt(omega2);
         scalar rhoc = this->rhoc();
diff --git a/src/lagrangian/spray/parcels/include/makeSprayParcelInjectionModels.H b/src/lagrangian/spray/parcels/include/makeSprayParcelInjectionModels.H
index dc5bd6225e..dba5fa2e2d 100644
--- a/src/lagrangian/spray/parcels/include/makeSprayParcelInjectionModels.H
+++ b/src/lagrangian/spray/parcels/include/makeSprayParcelInjectionModels.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -36,6 +36,7 @@ License
 #include "ManualInjection.H"
 #include "NoInjection.H"
 #include "PatchInjection.H"
+#include "PatchFlowRateInjection.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -50,6 +51,7 @@ License
     makeInjectionModelType(InflationInjection, CloudType);                    \
     makeInjectionModelType(ManualInjection, CloudType);                       \
     makeInjectionModelType(NoInjection, CloudType);                           \
+    makeInjectionModelType(PatchFlowRateInjection, CloudType);                \
     makeInjectionModelType(PatchInjection, CloudType);
 
 
diff --git a/src/lagrangian/spray/submodels/AtomizationModel/LISAAtomization/LISASMDCalcMethod1.H b/src/lagrangian/spray/submodels/AtomizationModel/LISAAtomization/LISASMDCalcMethod1.H
index a153b5a0ca..b17798dd6f 100644
--- a/src/lagrangian/spray/submodels/AtomizationModel/LISAAtomization/LISASMDCalcMethod1.H
+++ b/src/lagrangian/spray/submodels/AtomizationModel/LISAAtomization/LISASMDCalcMethod1.H
@@ -4,7 +4,7 @@
     scalar minValue = min(d, dD/10.0);
     scalar maxValue = dD;
 
-    if(maxValue - minValue < SMALL)
+    if (maxValue - minValue < SMALL)
     {
         minValue = d/10.0;
     }
diff --git a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
index fc34d0c224..a5816c8f99 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -176,11 +176,11 @@ bool Foam::SHF<CloudType>::update
 
     if (weGas > weConst_)
     {
-        if(weGas < weCrit1_)
+        if (weGas < weCrit1_)
         {
             tCharSecond = c1_*pow((weGas - weConst_), cExp1_);
         }
-        else if(weGas >= weCrit1_ && weGas <= weCrit2_)
+        else if (weGas >= weCrit1_ && weGas <= weCrit2_)
         {
             tCharSecond = c2_*pow((weGas - weConst_), cExp2_);
         }
diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
index 0b0e3800f7..7e85e6723e 100644
--- a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
@@ -25,7 +25,6 @@ License
 
 #include "AMIInterpolation.H"
 #include "meshTools.H"
-#include "mergePoints.H"
 #include "mapDistribute.H"
 
 // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
@@ -204,455 +203,6 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::resetTree
 }
 
 
-template<class SourcePatch, class TargetPatch>
-Foam::label Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcDistribution
-(
-    const SourcePatch& srcPatch,
-    const TargetPatch& tgtPatch
-) const
-{
-    label procI = 0;
-
-    if (Pstream::parRun())
-    {
-        List<label> facesPresentOnProc(Pstream::nProcs(), 0);
-        if ((srcPatch.size() > 0) || (tgtPatch.size() > 0))
-        {
-            facesPresentOnProc[Pstream::myProcNo()] = 1;
-        }
-        else
-        {
-            facesPresentOnProc[Pstream::myProcNo()] = 0;
-        }
-
-        Pstream::gatherList(facesPresentOnProc);
-        Pstream::scatterList(facesPresentOnProc);
-
-        label nHaveFaces = sum(facesPresentOnProc);
-
-        if (nHaveFaces > 1)
-        {
-            procI = -1;
-            if (debug)
-            {
-                Info<< "AMIInterpolation::calcDistribution: "
-                    << "AMI split across multiple processors" << endl;
-            }
-        }
-        else if (nHaveFaces == 1)
-        {
-            procI = findIndex(facesPresentOnProc, 1);
-            if (debug)
-            {
-                Info<< "AMIInterpolation::calcDistribution: "
-                    << "AMI local to processor" << procI << endl;
-            }
-        }
-    }
-
-
-    // Either not parallel or no faces on any processor
-    return procI;
-}
-
-
-template<class SourcePatch, class TargetPatch>
-Foam::label
-Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcOverlappingProcs
-(
-    const List<treeBoundBoxList>& procBb,
-    const treeBoundBox& bb,
-    boolList& overlaps
-) const
-{
-    overlaps.setSize(procBb.size());
-    overlaps = false;
-
-    label nOverlaps = 0;
-
-    forAll(procBb, procI)
-    {
-        const List<treeBoundBox>& bbs = procBb[procI];
-
-        forAll(bbs, bbI)
-        {
-            if (bbs[bbI].overlaps(bb))
-            {
-                overlaps[procI] = true;
-                nOverlaps++;
-                break;
-            }
-        }
-    }
-    return nOverlaps;
-}
-
-
-template<class SourcePatch, class TargetPatch>
-void Foam::AMIInterpolation<SourcePatch, TargetPatch>::distributePatches
-(
-    const mapDistribute& map,
-    const TargetPatch& pp,
-    const globalIndex& gi,
-    List<faceList>& faces,
-    List<pointField>& points,
-    List<labelList>& faceIDs
-) const
-{
-    PstreamBuffers pBufs(Pstream::nonBlocking);
-
-    for (label domain = 0; domain < Pstream::nProcs(); domain++)
-    {
-        const labelList& sendElems = map.subMap()[domain];
-
-        if (domain != Pstream::myProcNo() && sendElems.size())
-        {
-            labelList globalElems(sendElems.size());
-            forAll(sendElems, i)
-            {
-                globalElems[i] = gi.toGlobal(sendElems[i]);
-            }
-
-            faceList subFaces(UIndirectList<face>(pp, sendElems));
-            primitivePatch subPatch
-            (
-                SubList<face>(subFaces, subFaces.size()),
-                pp.points()
-            );
-
-            if (debug & 2)
-            {
-                Pout<< "distributePatches: to processor " << domain
-                    << " sending faces " << subPatch.faceCentres() << endl;
-            }
-
-            UOPstream toDomain(domain, pBufs);
-            toDomain
-                << subPatch.localFaces() << subPatch.localPoints()
-                << globalElems;
-        }
-    }
-
-    // Start receiving
-    pBufs.finishedSends();
-
-    faces.setSize(Pstream::nProcs());
-    points.setSize(Pstream::nProcs());
-    faceIDs.setSize(Pstream::nProcs());
-
-    {
-        // Set up 'send' to myself
-        const labelList& sendElems = map.subMap()[Pstream::myProcNo()];
-        faceList subFaces(UIndirectList<face>(pp, sendElems));
-        primitivePatch subPatch
-        (
-            SubList<face>(subFaces, subFaces.size()),
-            pp.points()
-        );
-
-        // Receive
-        if (debug & 2)
-        {
-            Pout<< "distributePatches: to processor " << Pstream::myProcNo()
-                << " sending faces " << subPatch.faceCentres() << endl;
-        }
-
-        faces[Pstream::myProcNo()] = subPatch.localFaces();
-        points[Pstream::myProcNo()] = subPatch.localPoints();
-
-        faceIDs[Pstream::myProcNo()].setSize(sendElems.size());
-        forAll(sendElems, i)
-        {
-            faceIDs[Pstream::myProcNo()][i] = gi.toGlobal(sendElems[i]);
-        }
-    }
-
-    // Consume
-    for (label domain = 0; domain < Pstream::nProcs(); domain++)
-    {
-        const labelList& recvElems = map.constructMap()[domain];
-
-        if (domain != Pstream::myProcNo() && recvElems.size())
-        {
-            UIPstream str(domain, pBufs);
-
-            str >> faces[domain]
-                >> points[domain]
-                >> faceIDs[domain];
-        }
-    }
-}
-
-
-template<class SourcePatch, class TargetPatch>
-void Foam::AMIInterpolation<SourcePatch, TargetPatch>::
-distributeAndMergePatches
-(
-    const mapDistribute& map,
-    const TargetPatch& tgtPatch,
-    const globalIndex& gi,
-    faceList& tgtFaces,
-    pointField& tgtPoints,
-    labelList& tgtFaceIDs
-) const
-{
-    // Exchange per-processor data
-    List<faceList> allFaces;
-    List<pointField> allPoints;
-    List<labelList> allTgtFaceIDs;
-    distributePatches(map, tgtPatch, gi, allFaces, allPoints, allTgtFaceIDs);
-
-    // Renumber and flatten
-    label nFaces = 0;
-    label nPoints = 0;
-    forAll(allFaces, procI)
-    {
-        nFaces += allFaces[procI].size();
-        nPoints += allPoints[procI].size();
-    }
-
-    tgtFaces.setSize(nFaces);
-    tgtPoints.setSize(nPoints);
-    tgtFaceIDs.setSize(nFaces);
-
-    nFaces = 0;
-    nPoints = 0;
-
-    // My own data first
-    {
-        const labelList& faceIDs = allTgtFaceIDs[Pstream::myProcNo()];
-        SubList<label>(tgtFaceIDs, faceIDs.size()).assign(faceIDs);
-
-        const faceList& fcs = allFaces[Pstream::myProcNo()];
-        forAll(fcs, i)
-        {
-            const face& f = fcs[i];
-            face& newF = tgtFaces[nFaces++];
-            newF.setSize(f.size());
-            forAll(f, fp)
-            {
-                newF[fp] = f[fp] + nPoints;
-            }
-        }
-
-        const pointField& pts = allPoints[Pstream::myProcNo()];
-        forAll(pts, i)
-        {
-            tgtPoints[nPoints++] = pts[i];
-        }
-    }
-
-
-    // Other proc data follows
-    forAll(allFaces, procI)
-    {
-        if (procI != Pstream::myProcNo())
-        {
-            const labelList& faceIDs = allTgtFaceIDs[procI];
-            SubList<label>(tgtFaceIDs, faceIDs.size(), nFaces).assign(faceIDs);
-
-            const faceList& fcs = allFaces[procI];
-            forAll(fcs, i)
-            {
-                const face& f = fcs[i];
-                face& newF = tgtFaces[nFaces++];
-                newF.setSize(f.size());
-                forAll(f, fp)
-                {
-                    newF[fp] = f[fp] + nPoints;
-                }
-            }
-
-            const pointField& pts = allPoints[procI];
-            forAll(pts, i)
-            {
-                tgtPoints[nPoints++] = pts[i];
-            }
-        }
-    }
-
-    // Merge
-    labelList oldToNew;
-    pointField newTgtPoints;
-    bool hasMerged = mergePoints
-    (
-        tgtPoints,
-        SMALL,
-        false,
-        oldToNew,
-        newTgtPoints
-    );
-
-    if (hasMerged)
-    {
-        if (debug)
-        {
-            Pout<< "Merged from " << tgtPoints.size()
-                << " down to " << newTgtPoints.size() << " points" << endl;
-        }
-
-        tgtPoints.transfer(newTgtPoints);
-        forAll(tgtFaces, i)
-        {
-            inplaceRenumber(oldToNew, tgtFaces[i]);
-        }
-    }
-}
-
-
-template<class SourcePatch, class TargetPatch>
-Foam::autoPtr<Foam::mapDistribute>
-Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcProcMap
-(
-    const SourcePatch& srcPatch,
-    const TargetPatch& tgtPatch
-) const
-{
-    // Get decomposition of patch
-    List<treeBoundBoxList> procBb(Pstream::nProcs());
-
-    if (srcPatch.size())
-    {
-        procBb[Pstream::myProcNo()] = treeBoundBoxList
-        (
-            1,  // For now single bounding box per proc
-            treeBoundBox
-            (
-                srcPatch.points(),
-                srcPatch.meshPoints()
-            )
-        );
-    }
-    else
-    {
-        procBb[Pstream::myProcNo()] = treeBoundBoxList();
-    }
-
-    // slightly increase size of bounding boxes to allow for cases where
-    // bounding boxes are perfectly alligned
-    forAll(procBb[Pstream::myProcNo()], bbI)
-    {
-        treeBoundBox& bb = procBb[Pstream::myProcNo()][bbI];
-        bb.inflate(0.01);
-    }
-
-    Pstream::gatherList(procBb);
-    Pstream::scatterList(procBb);
-
-
-    if (debug)
-    {
-        Info<< "Determining extent of srcPatch per processor:" << nl
-            << "\tproc\tbb" << endl;
-        forAll(procBb, procI)
-        {
-            Info<< '\t' << procI << '\t' << procBb[procI] << endl;
-        }
-    }
-
-
-    // Determine which faces of tgtPatch overlaps srcPatch per proc
-    const faceList& faces = tgtPatch.localFaces();
-    const pointField& points = tgtPatch.localPoints();
-
-    labelListList sendMap;
-
-    {
-        // Per processor indices into all segments to send
-        List<DynamicList<label> > dynSendMap(Pstream::nProcs());
-
-        // Work array - whether processor bb overlaps the face bounds
-        boolList procBbOverlaps(Pstream::nProcs());
-
-        forAll(faces, faceI)
-        {
-            if (faces[faceI].size())
-            {
-                treeBoundBox faceBb(points, faces[faceI]);
-
-                // Find the processor this face overlaps
-                calcOverlappingProcs(procBb, faceBb, procBbOverlaps);
-
-                forAll(procBbOverlaps, procI)
-                {
-                    if (procBbOverlaps[procI])
-                    {
-                        dynSendMap[procI].append(faceI);
-                    }
-                }
-            }
-        }
-
-        // Convert dynamicList to labelList
-        sendMap.setSize(Pstream::nProcs());
-        forAll(sendMap, procI)
-        {
-            sendMap[procI].transfer(dynSendMap[procI]);
-        }
-    }
-
-    // Debug printing
-    if (debug)
-    {
-        Pout<< "Of my " << faces.size() << " I need to send to:" << nl
-            << "\tproc\tfaces" << endl;
-        forAll(sendMap, procI)
-        {
-            Pout<< '\t' << procI << '\t' << sendMap[procI].size() << endl;
-        }
-    }
-
-
-    // Send over how many faces I need to receive
-    labelListList sendSizes(Pstream::nProcs());
-    sendSizes[Pstream::myProcNo()].setSize(Pstream::nProcs());
-    forAll(sendMap, procI)
-    {
-        sendSizes[Pstream::myProcNo()][procI] = sendMap[procI].size();
-    }
-    Pstream::gatherList(sendSizes);
-    Pstream::scatterList(sendSizes);
-
-
-    // Determine order of receiving
-    labelListList constructMap(Pstream::nProcs());
-
-    // My local segment first
-    constructMap[Pstream::myProcNo()] = identity
-    (
-        sendMap[Pstream::myProcNo()].size()
-    );
-
-    label segmentI = constructMap[Pstream::myProcNo()].size();
-    forAll(constructMap, procI)
-    {
-        if (procI != Pstream::myProcNo())
-        {
-            // What I need to receive is what other processor is sending to me
-            label nRecv = sendSizes[procI][Pstream::myProcNo()];
-            constructMap[procI].setSize(nRecv);
-
-            for (label i = 0; i < nRecv; i++)
-            {
-                constructMap[procI][i] = segmentI++;
-            }
-        }
-    }
-
-    autoPtr<mapDistribute> mapPtr
-    (
-        new mapDistribute
-        (
-            segmentI,       // size after construction
-            sendMap.xfer(),
-            constructMap.xfer()
-        )
-    );
-
-    return mapPtr;
-}
-
-
 template<class SourcePatch, class TargetPatch>
 void Foam::AMIInterpolation<SourcePatch, TargetPatch>::projectPointsToSurface
 (
diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
index 5b91afc38a..abf4523afd 100644
--- a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
@@ -554,6 +554,7 @@ public:
 
 #ifdef NoRepository
 #   include "AMIInterpolation.C"
+#   include "AMIInterpolationParallelOps.C"
 #endif
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolationParallelOps.C b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolationParallelOps.C
new file mode 100644
index 0000000000..5abe0778eb
--- /dev/null
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolationParallelOps.C
@@ -0,0 +1,481 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "AMIInterpolation.H"
+#include "mergePoints.H"
+#include "mapDistribute.H"
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+template<class SourcePatch, class TargetPatch>
+Foam::label Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcDistribution
+(
+    const SourcePatch& srcPatch,
+    const TargetPatch& tgtPatch
+) const
+{
+    label procI = 0;
+
+    if (Pstream::parRun())
+    {
+        List<label> facesPresentOnProc(Pstream::nProcs(), 0);
+        if ((srcPatch.size() > 0) || (tgtPatch.size() > 0))
+        {
+            facesPresentOnProc[Pstream::myProcNo()] = 1;
+        }
+        else
+        {
+            facesPresentOnProc[Pstream::myProcNo()] = 0;
+        }
+
+        Pstream::gatherList(facesPresentOnProc);
+        Pstream::scatterList(facesPresentOnProc);
+
+        label nHaveFaces = sum(facesPresentOnProc);
+
+        if (nHaveFaces > 1)
+        {
+            procI = -1;
+            if (debug)
+            {
+                Info<< "AMIInterpolation::calcDistribution: "
+                    << "AMI split across multiple processors" << endl;
+            }
+        }
+        else if (nHaveFaces == 1)
+        {
+            procI = findIndex(facesPresentOnProc, 1);
+            if (debug)
+            {
+                Info<< "AMIInterpolation::calcDistribution: "
+                    << "AMI local to processor" << procI << endl;
+            }
+        }
+    }
+
+
+    // Either not parallel or no faces on any processor
+    return procI;
+}
+
+
+template<class SourcePatch, class TargetPatch>
+Foam::label
+Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcOverlappingProcs
+(
+    const List<treeBoundBoxList>& procBb,
+    const treeBoundBox& bb,
+    boolList& overlaps
+) const
+{
+    overlaps.setSize(procBb.size());
+    overlaps = false;
+
+    label nOverlaps = 0;
+
+    forAll(procBb, procI)
+    {
+        const List<treeBoundBox>& bbs = procBb[procI];
+
+        forAll(bbs, bbI)
+        {
+            if (bbs[bbI].overlaps(bb))
+            {
+                overlaps[procI] = true;
+                nOverlaps++;
+                break;
+            }
+        }
+    }
+    return nOverlaps;
+}
+
+
+template<class SourcePatch, class TargetPatch>
+void Foam::AMIInterpolation<SourcePatch, TargetPatch>::distributePatches
+(
+    const mapDistribute& map,
+    const TargetPatch& pp,
+    const globalIndex& gi,
+    List<faceList>& faces,
+    List<pointField>& points,
+    List<labelList>& faceIDs
+) const
+{
+    PstreamBuffers pBufs(Pstream::nonBlocking);
+
+    for (label domain = 0; domain < Pstream::nProcs(); domain++)
+    {
+        const labelList& sendElems = map.subMap()[domain];
+
+        if (domain != Pstream::myProcNo() && sendElems.size())
+        {
+            labelList globalElems(sendElems.size());
+            forAll(sendElems, i)
+            {
+                globalElems[i] = gi.toGlobal(sendElems[i]);
+            }
+
+            faceList subFaces(UIndirectList<face>(pp, sendElems));
+            primitivePatch subPatch
+            (
+                SubList<face>(subFaces, subFaces.size()),
+                pp.points()
+            );
+
+            if (debug & 2)
+            {
+                Pout<< "distributePatches: to processor " << domain
+                    << " sending faces " << subPatch.faceCentres() << endl;
+            }
+
+            UOPstream toDomain(domain, pBufs);
+            toDomain
+                << subPatch.localFaces() << subPatch.localPoints()
+                << globalElems;
+        }
+    }
+
+    // Start receiving
+    pBufs.finishedSends();
+
+    faces.setSize(Pstream::nProcs());
+    points.setSize(Pstream::nProcs());
+    faceIDs.setSize(Pstream::nProcs());
+
+    {
+        // Set up 'send' to myself
+        const labelList& sendElems = map.subMap()[Pstream::myProcNo()];
+        faceList subFaces(UIndirectList<face>(pp, sendElems));
+        primitivePatch subPatch
+        (
+            SubList<face>(subFaces, subFaces.size()),
+            pp.points()
+        );
+
+        // Receive
+        if (debug & 2)
+        {
+            Pout<< "distributePatches: to processor " << Pstream::myProcNo()
+                << " sending faces " << subPatch.faceCentres() << endl;
+        }
+
+        faces[Pstream::myProcNo()] = subPatch.localFaces();
+        points[Pstream::myProcNo()] = subPatch.localPoints();
+
+        faceIDs[Pstream::myProcNo()].setSize(sendElems.size());
+        forAll(sendElems, i)
+        {
+            faceIDs[Pstream::myProcNo()][i] = gi.toGlobal(sendElems[i]);
+        }
+    }
+
+    // Consume
+    for (label domain = 0; domain < Pstream::nProcs(); domain++)
+    {
+        const labelList& recvElems = map.constructMap()[domain];
+
+        if (domain != Pstream::myProcNo() && recvElems.size())
+        {
+            UIPstream str(domain, pBufs);
+
+            str >> faces[domain]
+                >> points[domain]
+                >> faceIDs[domain];
+        }
+    }
+}
+
+
+template<class SourcePatch, class TargetPatch>
+void Foam::AMIInterpolation<SourcePatch, TargetPatch>::
+distributeAndMergePatches
+(
+    const mapDistribute& map,
+    const TargetPatch& tgtPatch,
+    const globalIndex& gi,
+    faceList& tgtFaces,
+    pointField& tgtPoints,
+    labelList& tgtFaceIDs
+) const
+{
+    // Exchange per-processor data
+    List<faceList> allFaces;
+    List<pointField> allPoints;
+    List<labelList> allTgtFaceIDs;
+    distributePatches(map, tgtPatch, gi, allFaces, allPoints, allTgtFaceIDs);
+
+    // Renumber and flatten
+    label nFaces = 0;
+    label nPoints = 0;
+    forAll(allFaces, procI)
+    {
+        nFaces += allFaces[procI].size();
+        nPoints += allPoints[procI].size();
+    }
+
+    tgtFaces.setSize(nFaces);
+    tgtPoints.setSize(nPoints);
+    tgtFaceIDs.setSize(nFaces);
+
+    nFaces = 0;
+    nPoints = 0;
+
+    // My own data first
+    {
+        const labelList& faceIDs = allTgtFaceIDs[Pstream::myProcNo()];
+        SubList<label>(tgtFaceIDs, faceIDs.size()).assign(faceIDs);
+
+        const faceList& fcs = allFaces[Pstream::myProcNo()];
+        forAll(fcs, i)
+        {
+            const face& f = fcs[i];
+            face& newF = tgtFaces[nFaces++];
+            newF.setSize(f.size());
+            forAll(f, fp)
+            {
+                newF[fp] = f[fp] + nPoints;
+            }
+        }
+
+        const pointField& pts = allPoints[Pstream::myProcNo()];
+        forAll(pts, i)
+        {
+            tgtPoints[nPoints++] = pts[i];
+        }
+    }
+
+
+    // Other proc data follows
+    forAll(allFaces, procI)
+    {
+        if (procI != Pstream::myProcNo())
+        {
+            const labelList& faceIDs = allTgtFaceIDs[procI];
+            SubList<label>(tgtFaceIDs, faceIDs.size(), nFaces).assign(faceIDs);
+
+            const faceList& fcs = allFaces[procI];
+            forAll(fcs, i)
+            {
+                const face& f = fcs[i];
+                face& newF = tgtFaces[nFaces++];
+                newF.setSize(f.size());
+                forAll(f, fp)
+                {
+                    newF[fp] = f[fp] + nPoints;
+                }
+            }
+
+            const pointField& pts = allPoints[procI];
+            forAll(pts, i)
+            {
+                tgtPoints[nPoints++] = pts[i];
+            }
+        }
+    }
+
+    // Merge
+    labelList oldToNew;
+    pointField newTgtPoints;
+    bool hasMerged = mergePoints
+    (
+        tgtPoints,
+        SMALL,
+        false,
+        oldToNew,
+        newTgtPoints
+    );
+
+    if (hasMerged)
+    {
+        if (debug)
+        {
+            Pout<< "Merged from " << tgtPoints.size()
+                << " down to " << newTgtPoints.size() << " points" << endl;
+        }
+
+        tgtPoints.transfer(newTgtPoints);
+        forAll(tgtFaces, i)
+        {
+            inplaceRenumber(oldToNew, tgtFaces[i]);
+        }
+    }
+}
+
+
+template<class SourcePatch, class TargetPatch>
+Foam::autoPtr<Foam::mapDistribute>
+Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcProcMap
+(
+    const SourcePatch& srcPatch,
+    const TargetPatch& tgtPatch
+) const
+{
+    // Get decomposition of patch
+    List<treeBoundBoxList> procBb(Pstream::nProcs());
+
+    if (srcPatch.size())
+    {
+        procBb[Pstream::myProcNo()] = treeBoundBoxList
+        (
+            1,  // For now single bounding box per proc
+            treeBoundBox
+            (
+                srcPatch.points(),
+                srcPatch.meshPoints()
+            )
+        );
+    }
+    else
+    {
+        procBb[Pstream::myProcNo()] = treeBoundBoxList();
+    }
+
+    // slightly increase size of bounding boxes to allow for cases where
+    // bounding boxes are perfectly alligned
+    forAll(procBb[Pstream::myProcNo()], bbI)
+    {
+        treeBoundBox& bb = procBb[Pstream::myProcNo()][bbI];
+        bb.inflate(0.01);
+    }
+
+    Pstream::gatherList(procBb);
+    Pstream::scatterList(procBb);
+
+
+    if (debug)
+    {
+        Info<< "Determining extent of srcPatch per processor:" << nl
+            << "\tproc\tbb" << endl;
+        forAll(procBb, procI)
+        {
+            Info<< '\t' << procI << '\t' << procBb[procI] << endl;
+        }
+    }
+
+
+    // Determine which faces of tgtPatch overlaps srcPatch per proc
+    const faceList& faces = tgtPatch.localFaces();
+    const pointField& points = tgtPatch.localPoints();
+
+    labelListList sendMap;
+
+    {
+        // Per processor indices into all segments to send
+        List<DynamicList<label> > dynSendMap(Pstream::nProcs());
+
+        // Work array - whether processor bb overlaps the face bounds
+        boolList procBbOverlaps(Pstream::nProcs());
+
+        forAll(faces, faceI)
+        {
+            if (faces[faceI].size())
+            {
+                treeBoundBox faceBb(points, faces[faceI]);
+
+                // Find the processor this face overlaps
+                calcOverlappingProcs(procBb, faceBb, procBbOverlaps);
+
+                forAll(procBbOverlaps, procI)
+                {
+                    if (procBbOverlaps[procI])
+                    {
+                        dynSendMap[procI].append(faceI);
+                    }
+                }
+            }
+        }
+
+        // Convert dynamicList to labelList
+        sendMap.setSize(Pstream::nProcs());
+        forAll(sendMap, procI)
+        {
+            sendMap[procI].transfer(dynSendMap[procI]);
+        }
+    }
+
+    // Debug printing
+    if (debug)
+    {
+        Pout<< "Of my " << faces.size() << " I need to send to:" << nl
+            << "\tproc\tfaces" << endl;
+        forAll(sendMap, procI)
+        {
+            Pout<< '\t' << procI << '\t' << sendMap[procI].size() << endl;
+        }
+    }
+
+
+    // Send over how many faces I need to receive
+    labelListList sendSizes(Pstream::nProcs());
+    sendSizes[Pstream::myProcNo()].setSize(Pstream::nProcs());
+    forAll(sendMap, procI)
+    {
+        sendSizes[Pstream::myProcNo()][procI] = sendMap[procI].size();
+    }
+    Pstream::gatherList(sendSizes);
+    Pstream::scatterList(sendSizes);
+
+
+    // Determine order of receiving
+    labelListList constructMap(Pstream::nProcs());
+
+    // My local segment first
+    constructMap[Pstream::myProcNo()] = identity
+    (
+        sendMap[Pstream::myProcNo()].size()
+    );
+
+    label segmentI = constructMap[Pstream::myProcNo()].size();
+    forAll(constructMap, procI)
+    {
+        if (procI != Pstream::myProcNo())
+        {
+            // What I need to receive is what other processor is sending to me
+            label nRecv = sendSizes[procI][Pstream::myProcNo()];
+            constructMap[procI].setSize(nRecv);
+
+            for (label i = 0; i < nRecv; i++)
+            {
+                constructMap[procI][i] = segmentI++;
+            }
+        }
+    }
+
+    autoPtr<mapDistribute> mapPtr
+    (
+        new mapDistribute
+        (
+            segmentI,       // size after construction
+            sendMap.xfer(),
+            constructMap.xfer()
+        )
+    );
+
+    return mapPtr;
+}
+
+
+// ************************************************************************* //
diff --git a/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.C b/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.C
index c64c29e1e6..a80688a184 100644
--- a/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.C
+++ b/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.C
@@ -27,6 +27,7 @@ License
 #include "polyMesh.H"
 #include "globalMeshData.H"
 #include "plane.H"
+#include "cellSet.H"
 
 #include "addToRunTimeSelectionTable.H"
 
@@ -74,6 +75,7 @@ Foam::scalar Foam::targetVolumeToCell::volumeOfSet
 Foam::label Foam::targetVolumeToCell::selectCells
 (
     const scalar normalComp,
+    const PackedBoolList& maskSet,
     PackedBoolList& selected
 ) const
 {
@@ -86,7 +88,7 @@ Foam::label Foam::targetVolumeToCell::selectCells
     {
         const point& cc = mesh_.cellCentres()[cellI];
 
-        if ((cc&n_) < normalComp)
+        if (maskSet[cellI] && ((cc&n_) < normalComp))
         {
             selected[cellI] = true;
             nSelected++;
@@ -103,14 +105,25 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
         // Select no cells
         return;
     }
-    else if (gSum(mesh_.cellVolumes()) < vol_)
+
+
+    PackedBoolList maskSet(mesh_.nCells(), 1);
+    label nTotCells = mesh_.globalData().nTotalCells();
+    if (maskSetName_.size())
     {
-        // Select all cells
-        forAll(mesh_.cellVolumes(), cellI)
+        // Read cellSet
+        Info<< "    Operating on subset defined by cellSet " << maskSetName_
+            << endl;
+
+        maskSet = 0;
+        cellSet subset(mesh_, maskSetName_);
+
+        forAllConstIter(cellSet, subset, iter)
         {
-            addOrDelete(set, cellI, add);
+            maskSet[iter.key()] = 1;
         }
-        return;
+
+        nTotCells = returnReduce(subset.size(), sumOp<label>());
     }
 
 
@@ -144,16 +157,16 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
         }
 
         PackedBoolList maxSelected(mesh_.nCells());
-        maxCells = selectCells(maxComp, maxSelected);
+        maxCells = selectCells(maxComp, maskSet, maxSelected);
         maxVol = volumeOfSet(maxSelected);
 
         // Check that maxPoint indeed selects all cells
-        if (maxCells != mesh_.globalData().nTotalCells())
+        if (maxCells != nTotCells)
         {
             WarningIn("targetVolumeToCell::combine(topoSet&, const bool) const")
                 << "Plane " << plane(points[maxPointI], n_)
                 << " selects " << maxCells
-                << " cells instead of all " << mesh_.globalData().nTotalCells()
+                << " cells instead of all " << nTotCells
                 << " cells. Results might be wrong." << endl;
         }
     }
@@ -178,7 +191,7 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
     {
         scalar mid = 0.5*(low + high);
 
-        nSelected = selectCells(mid, selected);
+        nSelected = selectCells(mid, maskSet, selected);
         selectedVol = volumeOfSet(selected);
 
         //Pout<< "High:" << high << " low:" << low << " mid:" << mid << nl
@@ -191,7 +204,7 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
             low = mid;
 
             PackedBoolList highSelected(mesh_.nCells());
-            label nHigh = selectCells(high, selected);
+            label nHigh = selectCells(high, maskSet, selected);
             if (nSelected == nHigh)
             {
                 break;
@@ -202,7 +215,7 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
             high = mid;
 
             PackedBoolList lowSelected(mesh_.nCells());
-            label nLow = selectCells(low, selected);
+            label nLow = selectCells(low, maskSet, selected);
             if (nSelected == nLow)
             {
                 break;
@@ -210,7 +223,7 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
         }
     }
 
-    nSelected = selectCells(high, selected);
+    nSelected = selectCells(high, maskSet, selected);
     selectedVol = volumeOfSet(selected);
 
     if (selectedVol < vol_)
@@ -219,7 +232,7 @@ void Foam::targetVolumeToCell::combine(topoSet& set, const bool add) const
     }
     else
     {
-        nSelected = selectCells(low, selected);
+        nSelected = selectCells(low, maskSet, selected);
         selectedVol = volumeOfSet(selected);
 
         if (selectedVol < vol_)
@@ -278,7 +291,8 @@ Foam::targetVolumeToCell::targetVolumeToCell
 :
     topoSetSource(mesh),
     vol_(readScalar(dict.lookup("volume"))),
-    n_(dict.lookup("normal"))
+    n_(dict.lookup("normal")),
+    maskSetName_(dict.lookupOrDefault<word>("set", ""))
 {}
 
 
diff --git a/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.H b/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.H
index 398e49c9f9..076f15e8aa 100644
--- a/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.H
+++ b/src/meshTools/sets/cellSources/targetVolumeToCell/targetVolumeToCell.H
@@ -37,7 +37,6 @@ SourceFiles
 #define targetVolumeToCell_H
 
 #include "topoSetSource.H"
-//#include "plane.H"
 #include "PackedBoolList.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@@ -63,8 +62,10 @@ class targetVolumeToCell
         const scalar vol_;
 
         //- Normal of plane to sweep
-        vector n_;
-        //plane pl_;
+        const vector n_;
+
+        //- Optional name of cellSet to calculate volume in
+        const word maskSetName_;
 
 
     // Private Member Functions
@@ -74,6 +75,7 @@ class targetVolumeToCell
         label selectCells
         (
             const scalar normalComp,
+            const PackedBoolList&,
             PackedBoolList& selected
         ) const;
 
@@ -92,7 +94,6 @@ public:
         (
             const polyMesh& mesh,
             const scalar vol,
-            //const plane&
             const vector&
         );
 
diff --git a/src/parallel/reconstruct/reconstruct/reconstructLagrangianFields.C b/src/parallel/reconstruct/reconstruct/reconstructLagrangianFields.C
index d80c77b65c..3c72a5399d 100644
--- a/src/parallel/reconstruct/reconstruct/reconstructLagrangianFields.C
+++ b/src/parallel/reconstruct/reconstruct/reconstructLagrangianFields.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -163,7 +163,7 @@ void Foam::reconstructLagrangianFields
 
     IOobjectList fields = objects.lookupClass(fieldClassName);
 
-    if(fields.size())
+    if (fields.size())
     {
         Info<< "    Reconstructing lagrangian "
             << fieldClassName << "s\n" << endl;
diff --git a/src/postProcessing/foamCalcFunctions/field/magSqr/magSqr.C b/src/postProcessing/foamCalcFunctions/field/magSqr/magSqr.C
index 084f87de4b..a608ade6bf 100644
--- a/src/postProcessing/foamCalcFunctions/field/magSqr/magSqr.C
+++ b/src/postProcessing/foamCalcFunctions/field/magSqr/magSqr.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -56,7 +56,7 @@ Foam::calcTypes::magSqr::~magSqr()
 
 void Foam::calcTypes::magSqr::init()
 {
-    Foam::argList::validArgs.append("magSqr");
+    argList::validArgs.append("magSqr");
     argList::validArgs.append("fieldName");
 }
 
diff --git a/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.C b/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.C
index b3aaac0dbf..4aa1596b5a 100644
--- a/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.C
+++ b/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.C
@@ -27,8 +27,8 @@ License
 #include "volFields.H"
 #include "regionSplit.H"
 #include "fvcVolumeIntegrate.H"
-#include "Histogram.H"
 #include "mathematicalConstants.H"
+#include "stringListOps.H"
 
 // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
 
@@ -56,6 +56,281 @@ namespace Foam
 }
 
 
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+void Foam::regionSizeDistribution::writeGraph
+(
+    const coordSet& coords,
+    const word& valueName,
+    const scalarField& values
+) const
+{
+    const fvMesh& mesh = refCast<const fvMesh>(obr_);
+
+    const wordList valNames(1, valueName);
+
+    fileName outputPath;
+    if (Pstream::parRun())
+    {
+        outputPath = mesh.time().path()/".."/name_;
+    }
+    else
+    {
+        outputPath = mesh.time().path()/name_;
+    }
+
+    if (mesh.name() != fvMesh::defaultRegion)
+    {
+        outputPath = outputPath/mesh.name();
+    }
+
+    mkDir(outputPath/mesh.time().timeName());
+    OFstream str
+    (
+        outputPath
+      / mesh.time().timeName()
+      / formatterPtr_().getFileName(coords, valNames)
+    );
+    Info<< "Writing distribution of " << valueName << " to " << str.name()
+        << endl;
+
+    List<const scalarField*> valPtrs(1);
+    valPtrs[0] = &values;
+    formatterPtr_().write(coords, valNames, valPtrs, str);
+}
+
+
+void Foam::regionSizeDistribution::writeAlphaFields
+(
+    const regionSplit& regions,
+    const Map<label>& patchRegions,
+    const Map<scalar>& regionVolume,
+    const volScalarField& alpha
+) const
+{
+    const scalar maxDropletVol = 1.0/6.0*pow(maxDiam_, 3);
+
+    // Split alpha field
+    // ~~~~~~~~~~~~~~~~~
+    // Split into
+    //  - liquidCore            : region connected to inlet patches
+    //  - per region a volume   : for all other regions
+    //  - backgroundAlpha       : remaining alpha
+
+
+    // Construct field
+    volScalarField liquidCore
+    (
+        IOobject
+        (
+            alphaName_ + "_liquidCore",
+            obr_.time().timeName(),
+            obr_,
+            IOobject::NO_READ
+        ),
+        alpha,
+        fvPatchField<scalar>::calculatedType()
+    );
+
+    volScalarField backgroundAlpha
+    (
+        IOobject
+        (
+            alphaName_ + "_background",
+            obr_.time().timeName(),
+            obr_,
+            IOobject::NO_READ
+        ),
+        alpha,
+        fvPatchField<scalar>::calculatedType()
+    );
+
+
+    // Knock out any cell not in patchRegions
+    forAll(liquidCore, cellI)
+    {
+        label regionI = regions[cellI];
+        if (patchRegions.found(regionI))
+        {
+            backgroundAlpha[cellI] = 0;
+        }
+        else
+        {
+            liquidCore[cellI] = 0;
+
+            scalar regionVol = regionVolume[regionI];
+            if (regionVol < maxDropletVol)
+            {
+                backgroundAlpha[cellI] = 0;
+            }
+        }
+    }
+    liquidCore.correctBoundaryConditions();
+    backgroundAlpha.correctBoundaryConditions();
+
+    Info<< "Volume of liquid-core = "
+        << fvc::domainIntegrate(liquidCore).value()
+        << endl;
+    Info<< "Volume of background  = "
+        << fvc::domainIntegrate(backgroundAlpha).value()
+        << endl;
+
+    Info<< "Writing liquid-core field to " << liquidCore.name() << endl;
+    liquidCore.write();
+    Info<< "Writing background field to " << backgroundAlpha.name() << endl;
+    backgroundAlpha.write();
+}
+
+
+Foam::Map<Foam::label> Foam::regionSizeDistribution::findPatchRegions
+(
+    const polyMesh& mesh,
+    const regionSplit& regions
+) const
+{
+    // Mark all regions starting at patches
+    // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+    // Count number of patch faces (just for initial sizing)
+    const labelHashSet patchIDs(mesh.boundaryMesh().patchSet(patchNames_));
+
+    label nPatchFaces = 0;
+    forAllConstIter(labelHashSet, patchIDs, iter)
+    {
+        nPatchFaces += mesh.boundaryMesh()[iter.key()].size();
+    }
+
+
+    Map<label> patchRegions(nPatchFaces);
+    forAllConstIter(labelHashSet, patchIDs, iter)
+    {
+        const polyPatch& pp = mesh.boundaryMesh()[iter.key()];
+
+        // Collect all regions on the patch
+        const labelList& faceCells = pp.faceCells();
+
+        forAll(faceCells, i)
+        {
+            patchRegions.insert
+            (
+                regions[faceCells[i]],
+                Pstream::myProcNo()     // dummy value
+            );
+        }
+    }
+
+
+    // Make sure all the processors have the same set of regions
+    Pstream::mapCombineGather(patchRegions, minEqOp<label>());
+    Pstream::mapCombineScatter(patchRegions);
+
+    return patchRegions;
+}
+
+
+Foam::tmp<Foam::scalarField> Foam::regionSizeDistribution::divide
+(
+    const scalarField& num,
+    const scalarField& denom
+)
+{
+    tmp<scalarField> tresult(new scalarField(num.size()));
+    scalarField& result = tresult();
+
+    forAll(denom, i)
+    {
+        if (denom[i] != 0)
+        {
+            result[i] = num[i]/denom[i];
+        }
+        else
+        {
+            result[i] = 0.0;
+        }
+    }
+    return tresult;
+}
+
+
+void Foam::regionSizeDistribution::writeGraphs
+(
+    const word& fieldName,              // name of field
+    const labelList& indices,           // index of bin for each region
+    const scalarField& sortedField,     // per region field data
+    const scalarField& binCount,        // per bin number of regions
+    const coordSet& coords              // graph data for bins
+) const
+{
+    if (Pstream::master())
+    {
+        // Calculate per-bin average
+        scalarField binSum(nBins_, 0.0);
+        forAll(sortedField, i)
+        {
+            binSum[indices[i]] += sortedField[i];
+        }
+
+        scalarField binAvg(divide(binSum, binCount));
+
+        // Per bin deviation
+        scalarField binSqrSum(nBins_, 0.0);
+        forAll(sortedField, i)
+        {
+            binSqrSum[indices[i]] += Foam::sqr(sortedField[i]);
+        }
+        scalarField binDev
+        (
+            sqrt(divide(binSqrSum, binCount) - Foam::sqr(binAvg))
+        );
+
+        // Write average
+        writeGraph(coords, fieldName + "_sum", binSum);
+        // Write average
+        writeGraph(coords, fieldName + "_avg", binAvg);
+        // Write deviation
+        writeGraph(coords, fieldName + "_dev", binDev);
+    }
+}
+
+
+void Foam::regionSizeDistribution::writeGraphs
+(
+    const word& fieldName,              // name of field
+    const scalarField& cellField,       // per cell field data
+    const regionSplit& regions,         // per cell the region(=droplet)
+    const labelList& sortedRegions,     // valid regions in sorted order
+    const scalarField& sortedNormalisation,
+
+    const labelList& indices,           // per region index of bin
+    const scalarField& binCount,        // per bin number of regions
+    const coordSet& coords              // graph data for bins
+) const
+{
+    // Sum on a per-region basis. Parallel reduced.
+    Map<scalar> regionField(regionSum(regions, cellField));
+
+    // Extract in region order
+    scalarField sortedField
+    (
+        sortedNormalisation
+      * extractData
+        (
+            sortedRegions,
+            regionField
+        )
+    );
+
+    writeGraphs
+    (
+        fieldName,      // name of field
+        indices,        // index of bin for each region
+        sortedField,    // per region field data
+        binCount,       // per bin number of regions
+        coords          // graph data for bins
+    );
+}
+
+
 // * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
 
 Foam::regionSizeDistribution::regionSizeDistribution
@@ -103,8 +378,11 @@ void Foam::regionSizeDistribution::read(const dictionary& dict)
         dict.lookup("field") >> alphaName_;
         dict.lookup("patches") >> patchNames_;
         dict.lookup("threshold") >> threshold_;
-        dict.lookup("volFraction") >> volFraction_;
+        dict.lookup("maxDiameter") >> maxDiam_;
+        minDiam_ = 0.0;
+        dict.readIfPresent("minDiameter", minDiam_);
         dict.lookup("nBins") >> nBins_;
+        dict.lookup("fields") >> fields_;
 
         word format(dict.lookup("setFormat"));
         formatterPtr_ = writer<scalar>::New(format);
@@ -163,14 +441,17 @@ void Foam::regionSizeDistribution::write()
            : obr_.lookupObject<volScalarField>(alphaName_)
         );
 
-        Info<< "Volume of alpha = "
+        Info<< "Volume of alpha          = "
             << fvc::domainIntegrate(alpha).value()
             << endl;
 
         const scalar meshVol = gSum(mesh.V());
-        Info<< "Mesh volume = " << meshVol << endl;
-        Info<< "Background region volume limit = " << volFraction_*meshVol
-            << endl;
+        const scalar maxDropletVol = 1.0/6.0*pow(maxDiam_, 3);
+        const scalar delta = (maxDiam_-minDiam_)/nBins_;
+
+        Info<< "Mesh volume              = " << meshVol << endl;
+        Info<< "Maximum droplet diameter = " << maxDiam_ << endl;
+        Info<< "Maximum droplet volume   = " << maxDropletVol << endl;
 
 
         // Determine blocked faces
@@ -260,138 +541,115 @@ void Foam::regionSizeDistribution::write()
         }
 
 
+        // Determine regions connected to supplied patches
+        Map<label> patchRegions(findPatchRegions(mesh, regions));
+
+
+
         // Sum all regions
-        Map<Pair<scalar> > regionVolume(regions.nRegions()/Pstream::nProcs());
-        forAll(alpha, cellI)
-        {
-            scalar cellVol = mesh.V()[cellI];
-            scalar alphaVol = alpha[cellI]*cellVol;
-
-            label regionI = regions[cellI];
-
-            Map<Pair<scalar> >::iterator fnd = regionVolume.find(regionI);
-            if (fnd == regionVolume.end())
-            {
-                regionVolume.insert
-                (
-                    regionI,
-                    Pair<scalar>(cellVol, alphaVol)
-                );
-            }
-            else
-            {
-                fnd().first() += cellVol;
-                fnd().second() += alphaVol;
-            }
-        }
-        Pstream::mapCombineGather(regionVolume, ListPlusEqOp<scalar, 2>());
-        Pstream::mapCombineScatter(regionVolume);
-
+        const scalarField alphaVol(alpha.internalField()*mesh.V());
+        Map<scalar> allRegionVolume(regionSum(regions, mesh.V()));
+        Map<scalar> allRegionAlphaVolume(regionSum(regions, alphaVol));
+        Map<label> allRegionNumCells
+        (
+            regionSum
+            (
+                regions,
+                labelField(mesh.nCells(), 1.0)
+            )
+        );
 
         if (debug)
         {
             Info<< token::TAB << "Region"
                 << token::TAB << "Volume(mesh)"
                 << token::TAB << "Volume(" << alpha.name() << "):"
+                << token::TAB << "nCells"
                 << endl;
             scalar meshSumVol = 0.0;
             scalar alphaSumVol = 0.0;
+            label nCells = 0;
 
-            forAllConstIter(Map<Pair<scalar> >, regionVolume, iter)
+            Map<scalar>::const_iterator vIter = allRegionVolume.begin();
+            Map<scalar>::const_iterator aIter = allRegionAlphaVolume.begin();
+            Map<label>::const_iterator numIter = allRegionNumCells.begin();
+            for
+            (
+                ;
+                vIter != allRegionVolume.end()
+             && aIter != allRegionAlphaVolume.end();
+                ++vIter, ++aIter, ++numIter
+            )
             {
-                Info<< token::TAB << iter.key()
-                    << token::TAB << iter().first()
-                    << token::TAB << iter().second() << endl;
+                Info<< token::TAB << vIter.key()
+                    << token::TAB << vIter()
+                    << token::TAB << aIter()
+                    << token::TAB << numIter()
+                    << endl;
 
-                meshSumVol += iter().first();
-                alphaSumVol += iter().second();
+                meshSumVol += vIter();
+                alphaSumVol += aIter();
+                nCells += numIter();
             }
             Info<< token::TAB << "Total:"
                 << token::TAB << meshSumVol
-                << token::TAB << alphaSumVol << endl;
+                << token::TAB << alphaSumVol
+                << token::TAB << nCells
+                << endl;
             Info<< endl;
         }
 
 
 
-        // Mark all regions starting at patches
-        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
 
-        // Count number of patch faces (just for initial sizing)
-        label nPatchFaces = 0;
-        forAll(patchNames_, i)
         {
-            const word& pName = patchNames_[i];
-            label patchI = mesh.boundaryMesh().findPatchID(pName);
-            if (patchI == -1)
+            Info<< "Patch connected regions (liquid core):" << endl;
+            Info<< token::TAB << "Region"
+                << token::TAB << "Volume(mesh)"
+                << token::TAB << "Volume(" << alpha.name() << "):"
+                << endl;
+            forAllConstIter(Map<label>, patchRegions, iter)
             {
-                WarningIn("regionSizeDistribution::write()")
-                    << "Cannot find patch " << pName << ". Valid patches are "
-                    << mesh.boundaryMesh().names()
-                    << endl;
-            }
-            else
-            {
-                nPatchFaces += mesh.boundaryMesh()[patchI].size();
+                label regionI = iter.key();
+                Info<< token::TAB << iter.key()
+                    << token::TAB << allRegionVolume[regionI]
+                    << token::TAB << allRegionAlphaVolume[regionI] << endl;
+
             }
+            Info<< endl;
         }
 
-        Map<label> keepRegions(nPatchFaces);
-        forAll(patchNames_, i)
         {
-            const word& pName = patchNames_[i];
+            Info<< "Background regions:" << endl;
+            Info<< token::TAB << "Region"
+                << token::TAB << "Volume(mesh)"
+                << token::TAB << "Volume(" << alpha.name() << "):"
+                << endl;
+            Map<scalar>::const_iterator vIter = allRegionVolume.begin();
+            Map<scalar>::const_iterator aIter = allRegionAlphaVolume.begin();
 
-            label patchI = mesh.boundaryMesh().findPatchID(pName);
-            if (patchI != -1)
-            {
-                const polyPatch& pp = mesh.boundaryMesh()[patchI];
-
-                // Collect all regions on the patch
-                const labelList& faceCells = pp.faceCells();
-
-                forAll(faceCells, i)
-                {
-                    keepRegions.insert
-                    (
-                        regions[faceCells[i]],
-                        Pstream::myProcNo()
-                    );
-                }
-            }
-        }
-
-
-        // Make sure all the processors have the same set of regions
-        Pstream::mapCombineGather(keepRegions, minEqOp<label>());
-        Pstream::mapCombineScatter(keepRegions);
-
-        Info<< "Patch connected regions (liquid core):" << endl;
-        forAllConstIter(Map<label>, keepRegions, iter)
-        {
-            label regionI = iter.key();
-            Pair<scalar>& vols = regionVolume[regionI];
-            Info<< token::TAB << iter.key()
-                << token::TAB << vols.first()
-                << token::TAB << vols.second() << endl;
-
-        }
-        Info<< endl;
-
-        Info<< "Background regions:" << endl;
-        forAllConstIter(Map<Pair<scalar> >, regionVolume, iter)
-        {
-            if
+            for
             (
-               !keepRegions.found(iter.key())
-             && iter().first() >= volFraction_*meshVol
+                ;
+                vIter != allRegionVolume.end()
+             && aIter != allRegionAlphaVolume.end();
+                ++vIter, ++aIter
             )
             {
-                Info<< token::TAB << iter.key()
-                    << token::TAB << iter().first()
-                    << token::TAB << iter().second() << endl;
+                if
+                (
+                   !patchRegions.found(vIter.key())
+                 && vIter() >= maxDropletVol
+                )
+                {
+                    Info<< token::TAB << vIter.key()
+                        << token::TAB << vIter()
+                        << token::TAB << aIter() << endl;
+                }
             }
+            Info<< endl;
         }
-        Info<< endl;
+
 
 
         // Split alpha field
@@ -400,185 +658,197 @@ void Foam::regionSizeDistribution::write()
         //  - liquidCore            : region connected to inlet patches
         //  - per region a volume   : for all other regions
         //  - backgroundAlpha       : remaining alpha
+        writeAlphaFields(regions, patchRegions, allRegionVolume, alpha);
 
 
-        // Construct field
-        volScalarField liquidCore
-        (
-            IOobject
-            (
-                alphaName_ + "_liquidCore",
-                obr_.time().timeName(),
-                obr_,
-                IOobject::NO_READ
-            ),
-            alpha,
-            fvPatchField<scalar>::calculatedType()
-        );
-
-        volScalarField backgroundAlpha
-        (
-            IOobject
-            (
-                alphaName_ + "_background",
-                obr_.time().timeName(),
-                obr_,
-                IOobject::NO_READ
-            ),
-            alpha,
-            fvPatchField<scalar>::calculatedType()
-        );
-
-
-        // Knock out any cell not in keepRegions
-        forAll(liquidCore, cellI)
+        // Extract droplet-only allRegionVolume, i.e. delete liquid core
+        // (patchRegions) and background regions from maps.
+        // Note that we have to use mesh volume (allRegionVolume) and not
+        // allRegionAlphaVolume since background might not have alpha in it.
+        forAllIter(Map<scalar>, allRegionVolume, vIter)
         {
-            label regionI = regions[cellI];
-            if (keepRegions.found(regionI))
+            label regionI = vIter.key();
+            if
+            (
+                patchRegions.found(regionI)
+             || vIter() >= maxDropletVol
+            )
             {
-                backgroundAlpha[cellI] = 0;
-            }
-            else
-            {
-                liquidCore[cellI] = 0;
-
-                scalar regionVol = regionVolume[regionI].first();
-                if (regionVol < volFraction_*meshVol)
-                {
-                    backgroundAlpha[cellI] = 0;
-                }
+                allRegionVolume.erase(vIter);
+                allRegionAlphaVolume.erase(regionI);
+                allRegionNumCells.erase(regionI);
             }
         }
-        liquidCore.correctBoundaryConditions();
-        backgroundAlpha.correctBoundaryConditions();
 
-        Info<< "Volume of liquid-core = "
-            << fvc::domainIntegrate(liquidCore).value()
-            << endl;
-
-        Info<< "Writing liquid-core field to " << liquidCore.name() << endl;
-        liquidCore.write();
-
-        Info<< "Volume of background = "
-            << fvc::domainIntegrate(backgroundAlpha).value()
-            << endl;
-
-        Info<< "Writing background field to " << backgroundAlpha.name() << endl;
-        backgroundAlpha.write();
-
-
-
-        // Collect histogram
-        if (Pstream::master())
+        if (allRegionVolume.size())
         {
-            DynamicList<scalar> diameters(regionVolume.size());
-            forAllConstIter(Map<Pair<scalar> >, regionVolume, iter)
+            // Construct mids of bins for plotting
+            pointField xBin(nBins_);
+
+            scalar x = 0.5*delta;
+            forAll(xBin, i)
             {
-                if (!keepRegions.found(iter.key()))
-                {
-                    if (iter().first() < volFraction_*meshVol)
-                    {
-                        scalar v = iter().second();
-                      //scalar diam = Foam::cbrt(v*6/mathematicalConstant::pi);
-                        scalar diam =
-                            Foam::cbrt(v*6/constant::mathematical::pi);
-                        diameters.append(diam);
-                    }
-                }
+                xBin[i] = point(x, 0, 0);
+                x += delta;
             }
 
-            if (diameters.size())
+            const coordSet coords("diameter", "x", xBin, mag(xBin));
+
+
+            // Get in region order the alpha*volume and diameter
+            // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+            const labelList sortedRegions = allRegionAlphaVolume.sortedToc();
+
+            scalarField sortedVols
+            (
+                extractData
+                (
+                    sortedRegions,
+                    allRegionAlphaVolume
+                )
+            );
+
+            // Calculate the diameters
+            scalarField sortedDiameters(sortedVols.size());
+            forAll(sortedDiameters, i)
             {
-                scalar maxDiam = max(diameters);
-                scalar minDiam = 0.0;
-
-                Info<< "Maximum diameter:" << maxDiam << endl;
-
-                Histogram<List<scalar> > bins
+                sortedDiameters[i] = Foam::cbrt
                 (
-                    minDiam,
-                    maxDiam,
-                    nBins_,
-                    diameters
+                    sortedVols[i]
+                   *6/constant::mathematical::pi
                 );
+            }
 
-                /* 1.7.x
-                scalarField xBin(nBins_);
+            // Determine the bin index for all the diameters
+            labelList indices(sortedDiameters.size());
+            forAll(sortedDiameters, i)
+            {
+                indices[i] = (sortedDiameters[i]-minDiam_)/delta;
+            }
 
-                scalar dx = (maxDiam-minDiam)/nBins_;
-                scalar x = 0.5*dx;
-                forAll(bins.counts(), i)
+            // Calculate the counts per diameter bin
+            scalarField binCount(nBins_, 0.0);
+            forAll(sortedDiameters, i)
+            {
+                binCount[indices[i]] += 1.0;
+            }
+
+            // Write counts
+            if (Pstream::master())
+            {
+                writeGraph(coords, "count", binCount);
+            }
+
+            // Write to screen
+            {
+                Info<< "Bins:" << endl;
+                Info<< token::TAB << "Bin"
+                    << token::TAB << "Min diameter"
+                    << token::TAB << "Count:"
+                    << endl;
+
+                scalar diam = 0.0;
+                forAll(binCount, binI)
                 {
-                    xBin[i] = x;
-                    x += dx;
+                    Info<< token::TAB << binI
+                        << token::TAB << diam
+                        << token::TAB << binCount[binI] << endl;
+                    diam += delta;
                 }
+                Info<< endl;
+            }
 
-                scalarField normalisedCount(bins.counts().size());
-                forAll(bins.counts(), i)
+
+            // Write average and deviation of droplet volume.
+            writeGraphs
+            (
+                "volume",           // name of field
+                indices,            // per region the bin index
+                sortedVols,         // per region field data
+                binCount,           // per bin number of regions
+                coords              // graph data for bins
+            );
+
+            // Collect some more field
+            {
+                wordList scalarNames(obr_.names(volScalarField::typeName));
+                labelList selected = findStrings(fields_, scalarNames);
+
+                forAll(selected, i)
                 {
-                    normalisedCount[i] = 1.0*bins.counts()[i];
+                    const word& fldName = scalarNames[selected[i]];
+                    Info<< "Scalar field " << fldName << endl;
+
+                    const scalarField& fld = obr_.lookupObject
+                    <
+                        volScalarField
+                    >(fldName).internalField();
+
+                    writeGraphs
+                    (
+                        fldName,            // name of field
+                        alphaVol*fld,       // per cell field data
+
+                        regions,            // per cell the region(=droplet)
+                        sortedRegions,      // valid regions in sorted order
+                        1.0/sortedVols,     // per region normalisation
+
+                        indices,            // index of bin for each region
+                        binCount,           // per bin number of regions
+                        coords              // graph data for bins
+                    );
                 }
+            }
+            {
+                wordList vectorNames(obr_.names(volVectorField::typeName));
+                labelList selected = findStrings(fields_, vectorNames);
 
-                const coordSet coords
-                (
-                    "diameter",
-                    "x",
-                    xBin
-                );
-                */
-
-                pointField xBin(nBins_);
-                scalar dx = (maxDiam - minDiam)/nBins_;
-                scalar x = 0.5*dx;
-                forAll(bins.counts(), i)
+                forAll(selected, i)
                 {
-                    xBin[i] = point(x, 0, 0);
-                    x += dx;
+                    const word& fldName = vectorNames[selected[i]];
+                    Info<< "Vector field " << fldName << endl;
+
+                    const vectorField& fld = obr_.lookupObject
+                    <
+                        volVectorField
+                    >(fldName).internalField();
+
+
+                    // Components
+
+                    for (direction cmp = 0; cmp < vector::nComponents; cmp++)
+                    {
+                        writeGraphs
+                        (
+                            fldName + vector::componentNames[cmp],
+                            alphaVol*fld.component(cmp),// per cell field data
+
+                            regions,        // per cell the region(=droplet)
+                            sortedRegions,  // valid regions in sorted order
+                            1.0/sortedVols, // per region normalisation
+
+                            indices,        // index of bin for each region
+                            binCount,       // per bin number of regions
+                            coords          // graph data for bins
+                        );
+                    }
+
+                    // Magnitude
+                    writeGraphs
+                    (
+                        fldName + "mag",    // name of field
+                        alphaVol*mag(fld),  // per cell field data
+
+                        regions,            // per cell the region(=droplet)
+                        sortedRegions,      // valid regions in sorted order
+                        1.0/sortedVols,     // per region normalisation
+
+                        indices,            // index of bin for each region
+                        binCount,           // per bin number of regions
+                        coords              // graph data for bins
+                    );
                 }
-
-                scalarField normalisedCount(bins.counts().size());
-                forAll(bins.counts(), i)
-                {
-                    normalisedCount[i] = 1.0*bins.counts()[i];
-                }
-
-                const coordSet coords
-                (
-                    "diameter",
-                    "x",
-                    xBin,
-                    mag(xBin)
-                );
-                const wordList valNames(1, "count");
-
-
-                fileName outputPath;
-                if (Pstream::parRun())
-                {
-                    outputPath = mesh.time().path()/".."/name_;
-                }
-                else
-                {
-                    outputPath = mesh.time().path()/name_;
-                }
-
-                if (mesh.name() != fvMesh::defaultRegion)
-                {
-                    outputPath = outputPath/mesh.name();
-                }
-
-                mkDir(outputPath/mesh.time().timeName());
-                OFstream str
-                (
-                    outputPath
-                  / mesh.time().timeName()
-                  / formatterPtr_().getFileName(coords, valNames)
-                );
-                Info<< "Writing distribution to " << str.name() << endl;
-
-                List<const scalarField*> valPtrs(1);
-                valPtrs[0] = &normalisedCount;
-                formatterPtr_().write(coords, valNames, valPtrs, str);
             }
         }
     }
diff --git a/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.H b/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.H
index 033b5f9aec..7802733249 100644
--- a/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.H
+++ b/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistribution.H
@@ -25,11 +25,67 @@ Class
     Foam::regionSizeDistribution
 
 Description
-    Looks up a field, interpolates it to the faces and determines a connected
-    region from a patch where the field is above a certain value.
-    - Writes a field containing all regions starting at given patch
-      ('liquid core')
-    - All other regions are summed for volume and a histogram is calculated.
+    Droplet size distribution calculation.
+
+    Looks up a void-fraction (alpha) field and splits the mesh into regions
+    based on where the field is below the threshold value. These
+    regions ("droplets") can now be analysed.
+
+    Regions:
+    - (debug) write regions as a volScalarField
+    - (debug) print for all regions the sum of volume and alpha*volume
+    - print the regions connected to a user-defined set of patches.
+      (in spray calculation these form the liquid core)
+    - print the regions with too large volume. These are the 'background'
+      regions.
+
+    Fields:
+    - write volScalarField alpha_liquidCore : alpha with outside liquid core
+                                              set to 0.
+                           alpha_background : alpha with outside background
+                                              set to 0.
+
+    Histogram:
+    - determine histogram of diameter (given minDiameter, maxDiameter, nBins)
+    - write graph of number of droplets per bin
+    - write graph of sum, average and deviation of droplet volume per bin
+    - write graph of sum, average and deviation of user-defined fields. For
+      volVectorFields these are those of the 3 components and the magnitude.
+
+    Sample input:
+
+    functions
+    {
+        regionSizeDistribution
+        {
+            type            regionSizeDistribution;
+
+            outputControl   timeStep;
+            outputInterval  1;
+
+            // Field to determine regions from
+            field           alpha;
+            // Patches that provide the liquid core
+            patches         (inlet);
+            // Delimit alpha regions
+            threshold       0.4;
+
+            // Fields to sample (no need to include alpha)
+            fields          (p U);
+
+            // Number of bins for histogram
+            nBins           100;
+            // Max droplet diameter
+            maxDiameter     0.5e-4;
+            //// Min droplet diameter (default is 0)
+            //minDiameter     0;
+
+            // Writing format
+            setFormat       gnuplot;
+        }
+    }
+
+
 
 SourceFiles
     regionSizeDistribution.C
@@ -41,6 +97,9 @@ SourceFiles
 
 #include "pointFieldFwd.H"
 #include "writer.H"
+#include "Map.H"
+#include "volFieldsFwd.H"
+#include "wordReList.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -51,6 +110,8 @@ namespace Foam
 class objectRegistry;
 class dictionary;
 class mapPolyMesh;
+class regionSplit;
+class polyMesh;
 
 /*---------------------------------------------------------------------------*\
                            Class regionSizeDistribution Declaration
@@ -72,23 +133,85 @@ class regionSizeDistribution
         word alphaName_;
 
         //- Patches to walk from
-        wordList patchNames_;
+        wordReList patchNames_;
 
         //- Clip value
         scalar threshold_;
 
-        //- Background region volFraction
-        scalar volFraction_;
+        //- Maximum droplet diameter
+        scalar maxDiam_;
+
+        //- Minimum droplet diameter
+        scalar minDiam_;
 
         //- Mumber of bins
         label nBins_;
 
+        //- Names of fields to sample on regions
+        wordReList fields_;
+
         //- Output formatter to write
         autoPtr<writer<scalar> > formatterPtr_;
 
 
     // Private Member Functions
 
+        template<class Type>
+        Map<Type> regionSum(const regionSplit&, const Field<Type>&) const;
+
+        //- Get data in order
+        template<class Type>
+        List<Type> extractData(const UList<label>& keys, const Map<Type>&)
+        const;
+
+        void writeGraph
+        (
+            const coordSet& coords,
+            const word& valueName,
+            const scalarField& values
+        ) const;
+
+        //- Write volfields with the parts of alpha which are not
+        //  droplets (liquidCore, backGround)
+        void writeAlphaFields
+        (
+            const regionSplit& regions,
+            const Map<label>& keepRegions,
+            const Map<scalar>& regionVolume,
+            const volScalarField& alpha
+        ) const;
+
+        //- Mark all regions starting at patches
+        Map<label> findPatchRegions(const polyMesh&, const regionSplit&) const;
+
+        //- Helper: divide if denom != 0
+        static tmp<scalarField> divide(const scalarField&, const scalarField&);
+
+        //- Given per-region data calculate per-bin average/deviation and graph
+        void writeGraphs
+        (
+            const word& fieldName,              // name of field
+            const labelList& indices,           // index of bin for each region
+            const scalarField& sortedField,     // per region field data
+            const scalarField& binCount,        // per bin number of regions
+            const coordSet& coords              // graph data for bins
+        ) const;
+
+        //- Given per-cell data calculate per-bin average/deviation and graph
+        void writeGraphs
+        (
+            const word& fieldName,              // name of field
+            const scalarField& cellField,       // per cell field data
+
+            const regionSplit& regions,         // per cell the region(=droplet)
+            const labelList& sortedRegions,     // valid regions in sorted order
+            const scalarField& sortedNormalisation,
+
+            const labelList& indices,           // index of bin for each region
+            const scalarField& binCount,        // per bin number of regions
+            const coordSet& coords              // graph data for bins
+        ) const;
+
         //- Disallow default bitwise copy construct
         regionSizeDistribution(const regionSizeDistribution&);
 
@@ -156,6 +279,12 @@ public:
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
+#ifdef NoRepository
+#   include "regionSizeDistributionTemplates.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
 #endif
 
 // ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistributionTemplates.C b/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistributionTemplates.C
new file mode 100644
index 0000000000..2f55434315
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/regionSizeDistribution/regionSizeDistributionTemplates.C
@@ -0,0 +1,81 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2012 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "regionSizeDistribution.H"
+#include "regionSplit.H"
+#include "volFields.H"
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+template<class Type>
+Foam::Map<Type> Foam::regionSizeDistribution::regionSum
+(
+    const regionSplit& regions,
+    const Field<Type>& fld
+) const
+{
+    // Per region the sum of fld
+    Map<Type> regionToSum(regions.nRegions()/Pstream::nProcs());
+
+    forAll(fld, cellI)
+    {
+        label regionI = regions[cellI];
+
+        typename Map<Type>::iterator fnd = regionToSum.find(regionI);
+        if (fnd == regionToSum.end())
+        {
+            regionToSum.insert(regionI, fld[cellI]);
+        }
+        else
+        {
+            fnd() += fld[cellI];
+        }
+    }
+    Pstream::mapCombineGather(regionToSum, plusEqOp<Type>());
+    Pstream::mapCombineScatter(regionToSum);
+
+    return regionToSum;
+}
+
+
+// Get data in sortedToc order
+template<class Type>
+Foam::List<Type> Foam::regionSizeDistribution::extractData
+(
+    const UList<label>& keys,
+    const Map<Type>& regionData
+) const
+{
+    List<Type> sortedData(keys.size());
+
+    forAll(keys, i)
+    {
+        sortedData[i] = regionData[keys[i]];
+    }
+    return sortedData;
+}
+
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/forces/forces/forces.C b/src/postProcessing/functionObjects/forces/forces/forces.C
index 1dd26906b7..ff9ba3a4e3 100644
--- a/src/postProcessing/functionObjects/forces/forces/forces.C
+++ b/src/postProcessing/functionObjects/forces/forces/forces.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -66,14 +66,14 @@ Foam::tmp<Foam::volSymmTensorField> Foam::forces::devRhoReff() const
         const compressible::LESModel& les =
         obr_.lookupObject<compressible::LESModel>("LESProperties");
 
-        return les.devRhoBeff();
+        return les.devRhoReff();
     }
     else if (obr_.foundObject<incompressible::LESModel>("LESProperties"))
     {
         const incompressible::LESModel& les
             = obr_.lookupObject<incompressible::LESModel>("LESProperties");
 
-        return rho()*les.devBeff();
+        return rho()*les.devReff();
     }
     else if (obr_.foundObject<basicThermo>("thermophysicalProperties"))
     {
diff --git a/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotion.C b/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotion.C
index 3c45e36761..ad2f2d8954 100644
--- a/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotion.C
+++ b/src/postProcessing/functionObjects/forces/pointPatchFields/derived/sixDoFRigidBodyMotion/sixDoFRigidBodyMotion.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -129,8 +129,7 @@ void Foam::sixDoFRigidBodyMotion::applyConstraints(scalar deltaT)
         {
             FatalErrorIn
             (
-                "Foam::sixDoFRigidBodyMotion::applyConstraints"
-                "(scalar deltaT)"
+                "Foam::sixDoFRigidBodyMotion::applyConstraints(scalar)"
             )
                 << nl << "Maximum number of sixDoFRigidBodyMotion constraint "
                 << "iterations ("
@@ -391,8 +390,8 @@ void Foam::sixDoFRigidBodyMotion::updatePosition
             (
                 "void Foam::sixDoFRigidBodyMotion::updatePosition"
                 "("
-                    "scalar deltaT, "
-                    "scalar deltaT0"
+                    "scalar, "
+                    "scalar"
                 ")"
             )
                 << "Limited acceleration " << a()
@@ -449,9 +448,9 @@ void Foam::sixDoFRigidBodyMotion::updateForce
             (
                 "void Foam::sixDoFRigidBodyMotion::updateForce"
                 "("
-                    "const vector& fGlobal, "
-                    "const vector& tauGlobal, "
-                    "scalar deltaT"
+                    "const vector&, "
+                    "const vector&, "
+                    "scalar"
                 ")"
             )
                 << "Limited acceleration " << a()
@@ -463,7 +462,7 @@ void Foam::sixDoFRigidBodyMotion::updateForce
 
         pi() += 0.5*(1 - cDamp_)*deltaT*tau();
 
-        if(report_)
+        if (report_)
         {
             status();
         }
diff --git a/src/sampling/sampledSurface/writers/vtk/vtkSurfaceWriter.C b/src/sampling/sampledSurface/writers/vtk/vtkSurfaceWriter.C
index a512419c50..5e6c38045b 100644
--- a/src/sampling/sampledSurface/writers/vtk/vtkSurfaceWriter.C
+++ b/src/sampling/sampledSurface/writers/vtk/vtkSurfaceWriter.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -170,6 +170,7 @@ namespace Foam
         {
             const symmTensor& v = values[elemI];
             os  << float(v[0]) << ' ' << float(v[1]) << ' ' << float(v[2])
+                << ' '
                 << float(v[3]) << ' ' << float(v[4]) << ' ' << float(v[5])
                 << nl;
 
@@ -190,7 +191,9 @@ namespace Foam
         {
             const tensor& v = values[elemI];
             os  << float(v[0]) << ' ' << float(v[1]) << ' ' << float(v[2])
+                << ' '
                 << float(v[3]) << ' ' << float(v[4]) << ' ' << float(v[5])
+                << ' '
                 << float(v[6]) << ' ' << float(v[7]) << ' ' << float(v[8])
                 << nl;
         }
diff --git a/src/thermophysicalModels/basic/heThermo/heThermo.C b/src/thermophysicalModels/basic/heThermo/heThermo.C
index b57ea9df98..4cace54980 100644
--- a/src/thermophysicalModels/basic/heThermo/heThermo.C
+++ b/src/thermophysicalModels/basic/heThermo/heThermo.C
@@ -55,7 +55,7 @@ Foam::wordList Foam::heThermo<BasicThermo, MixtureType>::heBoundaryTypes()
         {
             hbt[patchi] = gradientEnergyFvPatchScalarField::typeName;
         }
-        else if(isA<mixedFvPatchScalarField>(tbf[patchi]))
+        else if (isA<mixedFvPatchScalarField>(tbf[patchi]))
         {
             hbt[patchi] = mixedEnergyFvPatchScalarField::typeName;
         }
diff --git a/src/thermophysicalModels/radiationModels/derivedFvPatchFields/radiationCoupledBase/radiationCoupledBase.C b/src/thermophysicalModels/radiationModels/derivedFvPatchFields/radiationCoupledBase/radiationCoupledBase.C
index ec9676940a..aaa301f345 100644
--- a/src/thermophysicalModels/radiationModels/derivedFvPatchFields/radiationCoupledBase/radiationCoupledBase.C
+++ b/src/thermophysicalModels/radiationModels/derivedFvPatchFields/radiationCoupledBase/radiationCoupledBase.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -102,7 +102,7 @@ Foam::radiationCoupledBase::radiationCoupledBase
 
         case LOOKUP:
         {
-            if(!dict.found("emissivity"))
+            if (!dict.found("emissivity"))
             {
                 FatalIOErrorIn
                 (
diff --git a/src/thermophysicalModels/reactionThermo/mixtures/singleStepReactingMixture/singleStepReactingMixture.C b/src/thermophysicalModels/reactionThermo/mixtures/singleStepReactingMixture/singleStepReactingMixture.C
index a0d87a6081..69e87fe518 100644
--- a/src/thermophysicalModels/reactionThermo/mixtures/singleStepReactingMixture/singleStepReactingMixture.C
+++ b/src/thermophysicalModels/reactionThermo/mixtures/singleStepReactingMixture/singleStepReactingMixture.C
@@ -108,7 +108,14 @@ void Foam::singleStepReactingMixture<ThermoType>::calculateMaxProducts()
         Yprod0_[specieI] =  this->speciesData()[specieI].W()/Wm*Xi[i];
     }
 
-    Info << "Maximum products mass concentrations :" << Yprod0_<< endl;
+    Info << "Maximum products mass concentrations:" << nl;
+    forAll(Yprod0_, i)
+    {
+        if (Yprod0_[i] > 0)
+        {
+            Info<< "    " << this->species()[i] << ": " << Yprod0_[i] << nl;
+        }
+    }
 
     // Normalize the stoichiometric coeff to mass
     forAll(specieStoichCoeffs_, i)
diff --git a/src/thermophysicalModels/solid/reaction/Reactions/solidReaction/solidReaction.C b/src/thermophysicalModels/solid/reaction/Reactions/solidReaction/solidReaction.C
index b2fa34d726..5e351cff4a 100644
--- a/src/thermophysicalModels/solid/reaction/Reactions/solidReaction/solidReaction.C
+++ b/src/thermophysicalModels/solid/reaction/Reactions/solidReaction/solidReaction.C
@@ -161,7 +161,7 @@ void Foam::solidReaction::setLRhs(Istream& is)
             {
                 if (t == token::ADD)
                 {
-                    if(isGas)
+                    if (isGas)
                     {
                         grhs_ = dlsrhs.shrink();
                         dlsrhs.clear();
@@ -177,7 +177,7 @@ void Foam::solidReaction::setLRhs(Istream& is)
                 }
                 else if (t == token::ASSIGN)
                 {
-                    if(isGas)
+                    if (isGas)
                     {
                         Info << "Pyrolysis Gases should appear on lhs of the"
                                 "reaction" << endl;
@@ -188,7 +188,7 @@ void Foam::solidReaction::setLRhs(Istream& is)
                         dlsrhs.clear();
                     }
                 }
-                else if(isGas)
+                else if (isGas)
                 {
                     grhs_ = dlsrhs.shrink();
                     is.putBack(t);
@@ -201,7 +201,7 @@ void Foam::solidReaction::setLRhs(Istream& is)
                     return;
                 }
             }
-            else if(isGas)
+            else if (isGas)
             {
                 grhs_ = dlsrhs.shrink();
                 is.putBack(t);
diff --git a/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.C b/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.C
index 0c905a91ce..69795c56d7 100644
--- a/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.C
+++ b/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -87,17 +87,34 @@ tmp<volSymmTensorField> GenEddyVisc::B() const
 }
 
 
-tmp<volSymmTensorField> GenEddyVisc::devBeff() const
+tmp<volSymmTensorField> GenEddyVisc::devReff() const
 {
     return -nuEff()*dev(twoSymm(fvc::grad(U())));
 }
 
 
-tmp<fvVectorMatrix> GenEddyVisc::divDevBeff(volVectorField& U) const
+tmp<fvVectorMatrix> GenEddyVisc::divDevReff(volVectorField& U) const
 {
     return
     (
-      - fvm::laplacian(nuEff(), U) - fvc::div(nuEff()*dev(T(fvc::grad(U))))
+      - fvm::laplacian(nuEff(), U)
+      - fvc::div(nuEff()*dev(T(fvc::grad(U))))
+    );
+}
+
+
+tmp<fvVectorMatrix> GenEddyVisc::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
     );
 }
 
diff --git a/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.H b/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.H
index 0746377eb7..62c216ee3e 100644
--- a/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.H
+++ b/src/turbulenceModels/incompressible/LES/GenEddyVisc/GenEddyVisc.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -118,11 +118,19 @@ public:
 
         //- Return the effective sub-grid turbulence stress tensor
         //  including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<volSymmTensorField> devReff() const;
 
         //- Return the deviatoric part of the effective sub-grid
         //  turbulence stress tensor including the laminar stress
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
+
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Correct Eddy-Viscosity and related properties
         virtual void correct(const tmp<volTensorField>& gradU);
diff --git a/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.C b/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.C
index 9d385c21eb..1618fb7f3b 100644
--- a/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.C
+++ b/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -115,7 +115,7 @@ GenSGSStress::GenSGSStress
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
-tmp<volSymmTensorField> GenSGSStress::devBeff() const
+tmp<volSymmTensorField> GenSGSStress::devReff() const
 {
     return tmp<volSymmTensorField>
     (
@@ -135,7 +135,7 @@ tmp<volSymmTensorField> GenSGSStress::devBeff() const
 }
 
 
-tmp<fvVectorMatrix> GenSGSStress::divDevBeff
+tmp<fvVectorMatrix> GenSGSStress::divDevReff
 (
     volVectorField& U
 ) const
@@ -164,6 +164,38 @@ tmp<fvVectorMatrix> GenSGSStress::divDevBeff
 }
 
 
+tmp<fvVectorMatrix> GenSGSStress::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    if (couplingFactor_.value() > 0.0)
+    {
+        return
+        (
+            fvc::div(rho*B_ + couplingFactor_*rho*nuSgs_*fvc::grad(U))
+          + fvc::laplacian
+            (
+                (1.0 - couplingFactor_)*rho*nuSgs_, U, "laplacian(muEff,U)"
+            )
+          - fvm::laplacian(muEff, U)
+        );
+    }
+    else
+    {
+        return
+        (
+            fvc::div(rho*B_)
+          + fvc::laplacian(rho*nuSgs_, U, "laplacian(muEff,U)")
+          - fvm::laplacian(muEff, U)
+        );
+    }
+}
+
+
 bool GenSGSStress::read()
 {
     if (LESModel::read())
diff --git a/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.H b/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.H
index 36d84f9c77..0456d69a71 100644
--- a/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.H
+++ b/src/turbulenceModels/incompressible/LES/GenSGSStress/GenSGSStress.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -128,11 +128,19 @@ public:
 
         //- Return the effective sub-grid turbulence stress tensor
         //  including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<volSymmTensorField> devReff() const;
 
-        //- Returns div(B).
-        // This is the additional term due to the filtering of the NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
+
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Read LESProperties dictionary
         virtual bool read();
diff --git a/src/turbulenceModels/incompressible/LES/LESModel/LESModel.H b/src/turbulenceModels/incompressible/LES/LESModel/LESModel.H
index deca26e793..3688cb8dec 100644
--- a/src/turbulenceModels/incompressible/LES/LESModel/LESModel.H
+++ b/src/turbulenceModels/incompressible/LES/LESModel/LESModel.H
@@ -202,14 +202,6 @@ public:
         //- Return the sub-grid stress tensor.
         virtual tmp<volSymmTensorField> B() const = 0;
 
-        //- Return the deviatoric part of the effective sub-grid
-        //  turbulence stress tensor including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const = 0;
-
-        //- Returns div(dev(Beff)).
-        //  This is the additional term due to the filtering of the NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const = 0;
-
 
         // RAS compatibility functions for the turbulenceModel base class
 
@@ -225,18 +217,6 @@ public:
                 return B();
             }
 
-            //- Return the effective stress tensor including the laminar stress
-            virtual tmp<volSymmTensorField> devReff() const
-            {
-                return devBeff();
-            }
-
-            //- Return the source term for the momentum equation
-            virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const
-            {
-                return divDevBeff(U);
-            }
-
 
         //- Correct Eddy-Viscosity and related properties.
         //  This calls correct(const tmp<volTensorField>& gradU) by supplying
diff --git a/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.C b/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.C
index 97d32bce9d..84fc1fc7be 100644
--- a/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.C
+++ b/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -81,7 +81,7 @@ tmp<volSymmTensorField> Smagorinsky2::B() const
 }
 
 
-tmp<fvVectorMatrix> Smagorinsky2::divDevBeff
+tmp<fvVectorMatrix> Smagorinsky2::divDevReff
 (
     volVectorField& U
 ) const
@@ -101,6 +101,28 @@ tmp<fvVectorMatrix> Smagorinsky2::divDevBeff
 }
 
 
+tmp<fvVectorMatrix> Smagorinsky2::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volTensorField gradU(fvc::grad(U));
+
+    volSymmTensorField aniMuEff
+    (
+        "muEff",
+        I*(rho*nuEff()) + (cD2_*rho*delta())*symm(gradU)
+    );
+
+    return
+    (
+      - fvm::laplacian(aniMuEff, U)
+      - fvc::div(rho*nuEff()*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool Smagorinsky2::read()
 {
     if (Smagorinsky::read())
diff --git a/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.H b/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.H
index 89c77912cd..c9133e4e87 100644
--- a/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.H
+++ b/src/turbulenceModels/incompressible/LES/Smagorinsky2/Smagorinsky2.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -109,9 +109,17 @@ public:
         //- Return B.
         virtual tmp<volSymmTensorField> B() const;
 
-        //- Returns div(B).
-        // This is the additional term due to the filtering of the NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
+
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Read LESProperties dictionary
         virtual bool read();
diff --git a/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.C b/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.C
index 6a34f90892..da8ab55e07 100644
--- a/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.C
+++ b/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -338,17 +338,34 @@ tmp<volSymmTensorField> SpalartAllmaras::B() const
 }
 
 
-tmp<volSymmTensorField> SpalartAllmaras::devBeff() const
+tmp<volSymmTensorField> SpalartAllmaras::devReff() const
 {
     return -nuEff()*dev(twoSymm(fvc::grad(U())));
 }
 
 
-tmp<fvVectorMatrix> SpalartAllmaras::divDevBeff(volVectorField& U) const
+tmp<fvVectorMatrix> SpalartAllmaras::divDevReff(volVectorField& U) const
 {
     return
     (
-      - fvm::laplacian(nuEff(), U) - fvc::div(nuEff()*dev(T(fvc::grad(U))))
+      - fvm::laplacian(nuEff(), U)
+      - fvc::div(nuEff()*dev(T(fvc::grad(U))))
+    );
+}
+
+
+tmp<fvVectorMatrix> SpalartAllmaras::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
     );
 }
 
diff --git a/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.H b/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.H
index 7ed507712a..68e5ef4c73 100644
--- a/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.H
+++ b/src/turbulenceModels/incompressible/LES/SpalartAllmaras/SpalartAllmaras.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -172,11 +172,19 @@ public:
 
         //- Return the effective sub-grid turbulence stress tensor
         //  including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<volSymmTensorField> devReff() const;
 
-        //- Return the deviatoric part of the divergence of Beff
-        //  i.e. the additional term in the filtered NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
+
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Correct nuTilda and related properties
         virtual void correct(const tmp<volTensorField>& gradU);
diff --git a/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.C b/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.C
index 2ab771ac73..12a6f1b3d1 100644
--- a/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.C
+++ b/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -425,17 +425,34 @@ tmp<volSymmTensorField> kOmegaSSTSAS::B() const
 }
 
 
-tmp<volSymmTensorField> kOmegaSSTSAS::devBeff() const
+tmp<volSymmTensorField> kOmegaSSTSAS::devReff() const
 {
     return -nuEff()*dev(twoSymm(fvc::grad(U())));
 }
 
 
-tmp<fvVectorMatrix> kOmegaSSTSAS::divDevBeff(volVectorField& U) const
+tmp<fvVectorMatrix> kOmegaSSTSAS::divDevReff(volVectorField& U) const
 {
     return
     (
-      - fvm::laplacian(nuEff(), U) - fvc::div(nuEff()*dev(T(fvc::grad(U))))
+      - fvm::laplacian(nuEff(), U)
+      - fvc::div(nuEff()*dev(T(fvc::grad(U))))
+    );
+}
+
+
+tmp<fvVectorMatrix> kOmegaSSTSAS::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
     );
 }
 
diff --git a/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.H b/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.H
index 2ca98380af..e61156f9c9 100644
--- a/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.H
+++ b/src/turbulenceModels/incompressible/LES/kOmegaSSTSAS/kOmegaSSTSAS.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -249,11 +249,19 @@ public:
 
         //- Return the effective sub-grid turbulence stress tensor
         //  including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<volSymmTensorField> devReff() const;
 
-        //- Return the deviatoric part of the divergence of Beff
-        //  i.e. the additional term in the filtered NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
+
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Solve the turbulence equations (k-w) and correct the turbulence
         //  viscosity
diff --git a/src/turbulenceModels/incompressible/LES/laminar/laminar.C b/src/turbulenceModels/incompressible/LES/laminar/laminar.C
index c88ff32beb..5a78c213ee 100644
--- a/src/turbulenceModels/incompressible/LES/laminar/laminar.C
+++ b/src/turbulenceModels/incompressible/LES/laminar/laminar.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -136,17 +136,34 @@ tmp<volSymmTensorField> laminar::B() const
 }
 
 
-tmp<volSymmTensorField> laminar::devBeff() const
+tmp<volSymmTensorField> laminar::devReff() const
 {
     return -nu()*dev(twoSymm(fvc::grad(U())));
 }
 
 
-tmp<fvVectorMatrix> laminar::divDevBeff(volVectorField& U) const
+tmp<fvVectorMatrix> laminar::divDevReff(volVectorField& U) const
 {
     return
     (
-      - fvm::laplacian(nu(), U) - fvc::div(nu()*dev(T(fvc::grad(U))))
+      - fvm::laplacian(nu(), U)
+      - fvc::div(nu()*dev(T(fvc::grad(U))))
+    );
+}
+
+
+tmp<fvVectorMatrix> laminar::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
     );
 }
 
diff --git a/src/turbulenceModels/incompressible/LES/laminar/laminar.H b/src/turbulenceModels/incompressible/LES/laminar/laminar.H
index 14de7a142a..777a9228a7 100644
--- a/src/turbulenceModels/incompressible/LES/laminar/laminar.H
+++ b/src/turbulenceModels/incompressible/LES/laminar/laminar.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -104,13 +104,21 @@ public:
         //- Return the sub-grid stress tensor B.
         virtual tmp<volSymmTensorField> B() const;
 
+        //- Return the effective sub-grid turbulence stress tensor
+        //  including the laminar stress
+        virtual tmp<volSymmTensorField> devReff() const;
+
         //- Return the deviatoric part of the effective sub-grid
         //  turbulence stress tensor including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
-        //- Return the deviatoric part of the divergence of Beff
-        //  i.e. the additional term in the filtered NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Read LESProperties dictionary
         bool read();
diff --git a/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.C b/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.C
index 4f2804577f..b17f4ea572 100644
--- a/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.C
+++ b/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -91,25 +91,39 @@ tmp<volSymmTensorField> mixedSmagorinsky::B() const
 }
 
 
-tmp<volSymmTensorField> mixedSmagorinsky::devBeff() const
+tmp<volSymmTensorField> mixedSmagorinsky::devReff() const
 {
     return
     (
-        scaleSimilarity::devBeff()
-      + Smagorinsky::devBeff()
+        scaleSimilarity::devReff()
+      + Smagorinsky::devReff()
     );
 }
 
 
-tmp<fvVectorMatrix> mixedSmagorinsky::divDevBeff
+tmp<fvVectorMatrix> mixedSmagorinsky::divDevReff
 (
     volVectorField& U
 ) const
 {
     return
     (
-        scaleSimilarity::divDevBeff(U)
-      + Smagorinsky::divDevBeff(U)
+        scaleSimilarity::divDevReff(U)
+      + Smagorinsky::divDevReff(U)
+    );
+}
+
+
+tmp<fvVectorMatrix> mixedSmagorinsky::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    return
+    (
+        scaleSimilarity::divDevRhoReff(rho, U)
+      + Smagorinsky::divDevRhoReff(rho, U)
     );
 }
 
diff --git a/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.H b/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.H
index c8557db239..72dca5d354 100644
--- a/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.H
+++ b/src/turbulenceModels/incompressible/LES/mixedSmagorinsky/mixedSmagorinsky.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -129,11 +129,19 @@ public:
 
         //- Return the effective sub-grid turbulence stress tensor
         //  including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<volSymmTensorField> devReff() const;
 
-        //- Implementation of div(B). This is necessary to override
-        // (and include) the div(B) terms from both the parent classes.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
+
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Correct Eddy-Viscosity and related properties
         virtual void correct(const tmp<volTensorField>& gradU);
diff --git a/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.C b/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.C
index b253573be1..61322de356 100644
--- a/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.C
+++ b/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -79,15 +79,25 @@ tmp<volSymmTensorField> scaleSimilarity::B() const
 }
 
 
-tmp<volSymmTensorField> scaleSimilarity::devBeff() const
+tmp<volSymmTensorField> scaleSimilarity::devReff() const
 {
     return dev(B());
 }
 
 
-tmp<fvVectorMatrix> scaleSimilarity::divDevBeff(volVectorField& U) const
+tmp<fvVectorMatrix> scaleSimilarity::divDevReff(volVectorField& U) const
 {
-    return fvm::Su(fvc::div(devBeff()), U);
+    return fvm::Su(fvc::div(devReff()), U);
+}
+
+
+tmp<fvVectorMatrix> scaleSimilarity::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    return fvm::Su(fvc::div(rho*devReff()), U);
 }
 
 
diff --git a/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.H b/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.H
index 0dff31d87e..c757a8165e 100644
--- a/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.H
+++ b/src/turbulenceModels/incompressible/LES/scaleSimilarity/scaleSimilarity.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -106,13 +106,21 @@ public:
         //- Return the sub-grid stress tensor.
         virtual tmp<volSymmTensorField> B() const;
 
+        //- Return the effective sub-grid turbulence stress tensor
+        //  including the laminar stress
+        virtual tmp<volSymmTensorField> devReff() const;
+
         //- Return the deviatoric part of the effective sub-grid
         //  turbulence stress tensor including the laminar stress
-        virtual tmp<volSymmTensorField> devBeff() const;
+        virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
-        //- Return the deviatoric part of the divergence of Beff
-        //  i.e. the additional term in the filtered NSE.
-        virtual tmp<fvVectorMatrix> divDevBeff(volVectorField& U) const;
+        //- Return the deviatoric part of the effective sub-grid
+        //  turbulence stress tensor including the laminar stress
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
 
         //- Correct Eddy-Viscosity and related properties
         virtual void correct(const tmp<volTensorField>&);
diff --git a/src/turbulenceModels/incompressible/RAS/LRR/LRR.C b/src/turbulenceModels/incompressible/RAS/LRR/LRR.C
index 30afa63ce9..c2c7e5efbe 100644
--- a/src/turbulenceModels/incompressible/RAS/LRR/LRR.C
+++ b/src/turbulenceModels/incompressible/RAS/LRR/LRR.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -259,6 +259,44 @@ tmp<fvVectorMatrix> LRR::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> LRR::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    if (couplingFactor_.value() > 0.0)
+    {
+        return
+        (
+            fvc::div
+            (
+                rho*R_ + couplingFactor_*(rho*nut_)*fvc::grad(U),
+                "div((rho*R))"
+            )
+          + fvc::laplacian
+            (
+                (1.0 - couplingFactor_)*rho*nut_,
+                U,
+                "laplacian(muEff,U)"
+            )
+          - fvm::laplacian(muEff, U)
+        );
+    }
+    else
+    {
+        return
+        (
+            fvc::div(rho*R_)
+          + fvc::laplacian(rho*nut_, U, "laplacian(muEff,U)")
+          - fvm::laplacian(muEff, U)
+        );
+    }
+}
+
+
 bool LRR::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LRR/LRR.H b/src/turbulenceModels/incompressible/RAS/LRR/LRR.H
index 2f1a119b9c..e787356008 100644
--- a/src/turbulenceModels/incompressible/RAS/LRR/LRR.H
+++ b/src/turbulenceModels/incompressible/RAS/LRR/LRR.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -173,6 +173,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.C b/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.C
index 1671c625a0..10de46f587 100644
--- a/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.C
+++ b/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -204,6 +204,22 @@ tmp<fvVectorMatrix> LamBremhorstKE::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> LamBremhorstKE::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool LamBremhorstKE::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.H b/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.H
index 449055f4c5..3ae7cfda29 100644
--- a/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.H
+++ b/src/turbulenceModels/incompressible/RAS/LamBremhorstKE/LamBremhorstKE.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -147,6 +147,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.C b/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.C
index aafa62af19..49326b1ff5 100644
--- a/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.C
+++ b/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -276,7 +276,12 @@ tmp<fvVectorMatrix> LaunderGibsonRSTM::divDevReff(volVectorField& U) const
         return
         (
             fvc::div(R_ + couplingFactor_*nut_*fvc::grad(U), "div(R)")
-          + fvc::laplacian((1.0-couplingFactor_)*nut_, U, "laplacian(nuEff,U)")
+          + fvc::laplacian
+            (
+                (1.0 - couplingFactor_)*nut_,
+                U,
+                "laplacian(nuEff,U)"
+            )
           - fvm::laplacian(nuEff(), U)
         );
     }
@@ -292,6 +297,44 @@ tmp<fvVectorMatrix> LaunderGibsonRSTM::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> LaunderGibsonRSTM::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    if (couplingFactor_.value() > 0.0)
+    {
+        return
+        (
+            fvc::div
+            (
+                rho*R_ + couplingFactor_*(rho*nut_)*fvc::grad(U),
+                "div((rho*R))"
+            )
+          + fvc::laplacian
+            (
+                (1.0 - couplingFactor_)*rho*nut_,
+                U,
+                "laplacian(muEff,U)"
+            )
+          - fvm::laplacian(muEff, U)
+        );
+    }
+    else
+    {
+        return
+        (
+            fvc::div(rho*R_)
+          + fvc::laplacian(rho*nut_, U, "laplacian(muEff,U)")
+          - fvm::laplacian(muEff, U)
+        );
+    }
+}
+
+
 bool LaunderGibsonRSTM::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.H b/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.H
index 0b6fc91b4b..528a7dd5d6 100644
--- a/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.H
+++ b/src/turbulenceModels/incompressible/RAS/LaunderGibsonRSTM/LaunderGibsonRSTM.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -184,6 +184,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.C b/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.C
index f0fa6e60c8..c514a378e2 100644
--- a/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.C
+++ b/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -210,6 +210,22 @@ tmp<fvVectorMatrix> LaunderSharmaKE::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> LaunderSharmaKE::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool LaunderSharmaKE::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.H b/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.H
index 3f2338e18e..5e4ae36f5a 100644
--- a/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.H
+++ b/src/turbulenceModels/incompressible/RAS/LaunderSharmaKE/LaunderSharmaKE.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -164,6 +164,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.C b/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.C
index 03e1e5aa1a..20d8dee951 100644
--- a/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.C
+++ b/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.C
@@ -298,6 +298,23 @@ tmp<fvVectorMatrix> LienCubicKE::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> LienCubicKE::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+        fvc::div(rho*nonlinearStress_)
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool LienCubicKE::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.H b/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.H
index ebe7c373d8..56696f4253 100644
--- a/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.H
+++ b/src/turbulenceModels/incompressible/RAS/LienCubicKE/LienCubicKE.H
@@ -159,6 +159,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.C b/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.C
index e0bd0f0df9..da81b66edd 100644
--- a/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.C
+++ b/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.C
@@ -365,6 +365,23 @@ tmp<fvVectorMatrix> LienCubicKELowRe::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> LienCubicKELowRe::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+        fvc::div(rho*nonlinearStress_)
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool LienCubicKELowRe::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.H b/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.H
index 0efd63a454..8794af1fc4 100644
--- a/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.H
+++ b/src/turbulenceModels/incompressible/RAS/LienCubicKELowRe/LienCubicKELowRe.H
@@ -186,6 +186,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.C b/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.C
index 91e288f104..15296cdf5b 100644
--- a/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.C
+++ b/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -243,12 +243,27 @@ tmp<fvVectorMatrix> LienLeschzinerLowRe::divDevReff(volVectorField& U) const
     return
     (
       - fvm::laplacian(nuEff(), U)
-    //- (fvc::grad(U) & fvc::grad(nuEff()))
       - fvc::div(nuEff()*T(fvc::grad(U)))
     );
 }
 
 
+tmp<fvVectorMatrix> LienLeschzinerLowRe::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool LienLeschzinerLowRe::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.H b/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.H
index 3fa1c790fe..5aebe9ea50 100644
--- a/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.H
+++ b/src/turbulenceModels/incompressible/RAS/LienLeschzinerLowRe/LienLeschzinerLowRe.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -156,6 +156,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.C b/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.C
index 33cc03edac..4dbb7b7b68 100644
--- a/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.C
+++ b/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.C
@@ -287,6 +287,23 @@ tmp<fvVectorMatrix> NonlinearKEShih::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> NonlinearKEShih::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+        fvc::div(rho*nonlinearStress_)
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool NonlinearKEShih::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.H b/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.H
index c7ad8a3713..f63f0c6565 100644
--- a/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.H
+++ b/src/turbulenceModels/incompressible/RAS/NonlinearKEShih/NonlinearKEShih.H
@@ -162,6 +162,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.C b/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.C
index 794d9f9b07..460a6609ac 100644
--- a/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.C
+++ b/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -220,6 +220,22 @@ tmp<fvVectorMatrix> RNGkEpsilon::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> RNGkEpsilon::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool RNGkEpsilon::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.H b/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.H
index 62b60b9804..2d06ee9ec1 100644
--- a/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.H
+++ b/src/turbulenceModels/incompressible/RAS/RNGkEpsilon/RNGkEpsilon.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -161,6 +161,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.C b/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.C
index 1804ba5b01..4105cb1876 100644
--- a/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.C
+++ b/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.C
@@ -337,6 +337,22 @@ tmp<fvVectorMatrix> SpalartAllmaras::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> SpalartAllmaras::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool SpalartAllmaras::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.H b/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.H
index fbd1248181..4190fc7d80 100644
--- a/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.H
+++ b/src/turbulenceModels/incompressible/RAS/SpalartAllmaras/SpalartAllmaras.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -184,6 +184,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.C b/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.C
index 99b4188cc0..029b9f9db7 100644
--- a/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.C
+++ b/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -192,6 +192,22 @@ tmp<fvVectorMatrix> kEpsilon::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> kEpsilon::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool kEpsilon::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.H b/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.H
index a3baf20513..89c94fe42f 100644
--- a/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.H
+++ b/src/turbulenceModels/incompressible/RAS/kEpsilon/kEpsilon.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -155,6 +155,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.C b/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.C
index 7106c0ea2c..51e1fbd491 100644
--- a/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.C
+++ b/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -201,6 +201,22 @@ tmp<fvVectorMatrix> kOmega::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> kOmega::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool kOmega::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.H b/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.H
index 10729f334e..1e63fd2eca 100644
--- a/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.H
+++ b/src/turbulenceModels/incompressible/RAS/kOmega/kOmega.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -188,6 +188,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.C b/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.C
index c025076baa..e6c49db1c8 100644
--- a/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.C
+++ b/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -308,6 +308,22 @@ tmp<fvVectorMatrix> kOmegaSST::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> kOmegaSST::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool kOmegaSST::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.H b/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.H
index bd4b3742b5..60f2775b1b 100644
--- a/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.H
+++ b/src/turbulenceModels/incompressible/RAS/kOmegaSST/kOmegaSST.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -258,6 +258,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.C b/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.C
index abf9b29cde..45f4f69d13 100644
--- a/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.C
+++ b/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.C
@@ -570,6 +570,22 @@ tmp<fvVectorMatrix> kkLOmega::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> kkLOmega::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool kkLOmega::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.H b/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.H
index 83db5f82d5..dbd5ce0832 100644
--- a/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.H
+++ b/src/turbulenceModels/incompressible/RAS/kkLOmega/kkLOmega.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -276,6 +276,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/laminar/laminar.C b/src/turbulenceModels/incompressible/RAS/laminar/laminar.C
index 68adca77b3..f0597b58da 100644
--- a/src/turbulenceModels/incompressible/RAS/laminar/laminar.C
+++ b/src/turbulenceModels/incompressible/RAS/laminar/laminar.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -177,6 +177,22 @@ tmp<fvVectorMatrix> laminar::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> laminar::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool laminar::read()
 {
     return RASModel::read();
diff --git a/src/turbulenceModels/incompressible/RAS/laminar/laminar.H b/src/turbulenceModels/incompressible/RAS/laminar/laminar.H
index 90afadff13..ccebe774ed 100644
--- a/src/turbulenceModels/incompressible/RAS/laminar/laminar.H
+++ b/src/turbulenceModels/incompressible/RAS/laminar/laminar.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -105,6 +105,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Correct the laminar viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.C b/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.C
index 25940abb9e..1fd761b1d7 100644
--- a/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.C
+++ b/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -262,6 +262,22 @@ tmp<fvVectorMatrix> qZeta::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> qZeta::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool qZeta::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.H b/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.H
index ba8dc1b413..9347998a2e 100644
--- a/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.H
+++ b/src/turbulenceModels/incompressible/RAS/qZeta/qZeta.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -211,6 +211,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.C b/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.C
index 71058caa7d..495b8930df 100644
--- a/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.C
+++ b/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -246,6 +246,22 @@ tmp<fvVectorMatrix> realizableKE::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> realizableKE::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 bool realizableKE::read()
 {
     if (RASModel::read())
diff --git a/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.H b/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.H
index 045f333390..ed2bc4841e 100644
--- a/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.H
+++ b/src/turbulenceModels/incompressible/RAS/realizableKE/realizableKE.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -180,6 +180,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.C b/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.C
index c102b52cb1..a633c7a70e 100644
--- a/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.C
+++ b/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.C
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -203,6 +203,22 @@ tmp<fvVectorMatrix> laminar::divDevReff(volVectorField& U) const
 }
 
 
+tmp<fvVectorMatrix> laminar::divDevRhoReff
+(
+    const volScalarField& rho,
+    volVectorField& U
+) const
+{
+    volScalarField muEff("muEff", rho*nuEff());
+
+    return
+    (
+      - fvm::laplacian(muEff, U)
+      - fvc::div(muEff*dev(T(fvc::grad(U))))
+    );
+}
+
+
 void laminar::correct()
 {
     turbulenceModel::correct();
diff --git a/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.H b/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.H
index 72994e90fb..5b79ecd485 100644
--- a/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.H
+++ b/src/turbulenceModels/incompressible/turbulenceModel/laminar/laminar.H
@@ -2,7 +2,7 @@
   =========                 |
   \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
    \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+    \\  /    A nd           | Copyright (C) 2011-2012 OpenFOAM Foundation
      \\/     M anipulation  |
 -------------------------------------------------------------------------------
 License
@@ -111,6 +111,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const;
+
         //- Correct the laminar viscosity
         virtual void correct();
 
diff --git a/src/turbulenceModels/incompressible/turbulenceModel/turbulenceModel.H b/src/turbulenceModels/incompressible/turbulenceModel/turbulenceModel.H
index 405cfef0bf..c2eacdaf39 100644
--- a/src/turbulenceModels/incompressible/turbulenceModel/turbulenceModel.H
+++ b/src/turbulenceModels/incompressible/turbulenceModel/turbulenceModel.H
@@ -204,6 +204,13 @@ public:
         //- Return the source term for the momentum equation
         virtual tmp<fvVectorMatrix> divDevReff(volVectorField& U) const = 0;
 
+        //- Return the source term for the momentum equation
+        virtual tmp<fvVectorMatrix> divDevRhoReff
+        (
+            const volScalarField& rho,
+            volVectorField& U
+        ) const = 0;
+
         //- Solve the turbulence equations and correct the turbulence viscosity
         virtual void correct() = 0;
 
diff --git a/tutorials/combustion/fireFoam/les/oppositeBurningPanels/constant/reactingCloud1Properties b/tutorials/combustion/fireFoam/les/oppositeBurningPanels/constant/reactingCloud1Properties
index fb38fc764b..f1fec22f39 100644
--- a/tutorials/combustion/fireFoam/les/oppositeBurningPanels/constant/reactingCloud1Properties
+++ b/tutorials/combustion/fireFoam/les/oppositeBurningPanels/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/reactingCloud1Properties b/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/reactingCloud1Properties
index fb38fc764b..f1fec22f39 100644
--- a/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/reactingCloud1Properties
+++ b/tutorials/combustion/fireFoam/les/smallPoolFire2D/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/combustion/fireFoam/les/smallPoolFire3D/constant/reactingCloud1Properties b/tutorials/combustion/fireFoam/les/smallPoolFire3D/constant/reactingCloud1Properties
index fb38fc764b..f1fec22f39 100644
--- a/tutorials/combustion/fireFoam/les/smallPoolFire3D/constant/reactingCloud1Properties
+++ b/tutorials/combustion/fireFoam/les/smallPoolFire3D/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/compressible/rhoPimpleFoam/les/pitzDaily/0/B b/tutorials/compressible/rhoPimpleFoam/les/pitzDaily/0/B
deleted file mode 100644
index 39354d72f9..0000000000
--- a/tutorials/compressible/rhoPimpleFoam/les/pitzDaily/0/B
+++ /dev/null
@@ -1,52 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volTensorField;
-    object      B;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0 0 0 0);
-
-boundaryField
-{
-    inlet
-    {
-        type            fixedValue;
-        value           uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    outlet
-    {
-        type            inletOutlet;
-        inletValue      uniform (0 0 0 0 0 0 0 0 0);
-        value           uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    upperWall
-    {
-        type            zeroGradient;
-    }
-
-    lowerWall
-    {
-        type            zeroGradient;
-    }
-
-    frontAndBack
-    {
-        type            empty;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/compressible/rhoPimpleFoam/ras/cavity/0/R b/tutorials/compressible/rhoPimpleFoam/ras/cavity/0/R
deleted file mode 100644
index be21f26a9e..0000000000
--- a/tutorials/compressible/rhoPimpleFoam/ras/cavity/0/R
+++ /dev/null
@@ -1,43 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volSymmTensorField;
-    location    "0";
-    object      R;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [ 0 2 -2 0 0 0 0 ];
-
-internalField   uniform ( 0 0 0 0 0 0 );
-
-boundaryField
-{
-    movingWall
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    fixedWalls
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    frontAndBack
-    {
-        type            empty;
-    }
-}
-
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R b/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R
deleted file mode 100644
index d51cd49b93..0000000000
--- a/tutorials/incompressible/boundaryFoam/boundaryLaunderSharma/0/R
+++ /dev/null
@@ -1,49 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volSymmTensorField;
-    location    "0";
-    object      R;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [ 0 2 -2 0 0 0 0 ];
-
-internalField   uniform ( 0 0 0 0 0 0 );
-
-boundaryField
-{
-    lowerWall
-    {
-        type            fixedValue;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-    upperWall
-    {
-        type            fixedValue;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-    front
-    {
-        type            cyclic;
-    }
-    back
-    {
-        type            cyclic;
-    }
-    defaultFaces
-    {
-        type            empty;
-    }
-}
-
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R b/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R
deleted file mode 100644
index 7d963a944e..0000000000
--- a/tutorials/incompressible/boundaryFoam/boundaryWallFunctions/0/R
+++ /dev/null
@@ -1,47 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volSymmTensorField;
-    location    "0";
-    object      R;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [ 0 2 -2 0 0 0 0 ];
-
-internalField   uniform ( 0 0 0 0 0 0 );
-
-boundaryField
-{
-    lowerWall
-    {
-        type            zeroGradient;
-    }
-    upperWall
-    {
-        type            zeroGradient;
-    }
-    front
-    {
-        type            cyclic;
-    }
-    back
-    {
-        type            cyclic;
-    }
-    defaultFaces
-    {
-        type            empty;
-    }
-}
-
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/pimpleDyMFoam/propeller/Allclean b/tutorials/incompressible/pimpleDyMFoam/propeller/Allclean
index f87f062960..7be04a3bab 100755
--- a/tutorials/incompressible/pimpleDyMFoam/propeller/Allclean
+++ b/tutorials/incompressible/pimpleDyMFoam/propeller/Allclean
@@ -4,9 +4,11 @@ cd ${0%/*} || exit 1    # run from this directory
 # Source tutorial clean functions
 . $WM_PROJECT_DIR/bin/tools/CleanFunctions
 
+# remove surface
+\rm -f constant/triSurface/propellerTip.obj.gz
+
 cleanCase
 
 \rm -rf 0
 \rm -rf constant/extendedFeatureEdgeMesh/
 \rm -f constant/triSurface/*.eMesh*
-
diff --git a/tutorials/incompressible/pimpleFoam/channel395/0.org/B b/tutorials/incompressible/pimpleFoam/channel395/0.org/B
deleted file mode 100644
index 78d2540b2e..0000000000
--- a/tutorials/incompressible/pimpleFoam/channel395/0.org/B
+++ /dev/null
@@ -1,67 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volTensorField;
-    location    "1";
-    object      B;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [ 0 2 -2 0 0 0 0 ];
-
-internalField   uniform ( 0 0 0 0 0 0 0 0 0 );
-
-boundaryField
-{
-    bottomWall
-    {
-        type            zeroGradient;
-    }
-    topWall
-    {
-        type            zeroGradient;
-    }
-    sides1_half0
-    {
-        type            cyclic;
-    }
-    sides2_half0
-    {
-        type            cyclic;
-    }
-    inout1_half0
-    {
-        type            cyclic;
-    }
-    inout2_half0
-    {
-        type            cyclic;
-    }
-    sides2_half1
-    {
-        type            cyclic;
-    }
-    sides1_half1
-    {
-        type            cyclic;
-    }
-    inout1_half1
-    {
-        type            cyclic;
-    }
-    inout2_half1
-    {
-        type            cyclic;
-    }
-}
-
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/LESProperties b/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/LESProperties
index 9d0f065bf4..197e16d126 100644
--- a/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/LESProperties
+++ b/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/LESProperties
@@ -10,6 +10,7 @@ FoamFile
     version     2.0;
     format      ascii;
     class       dictionary;
+    location    "constant";
     object      LESProperties;
 }
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@@ -20,125 +21,6 @@ delta               cubeRootVol;
 
 printCoeffs         on;
 
-laminarCoeffs
-{
-}
-
-oneEqEddyCoeffs
-{
-    ck               0.07;
-    ce               1.05;
-}
-
-dynOneEqEddyCoeffs
-{
-    ce               1.05;
-    filter          simple;
-}
-
-locDynOneEqEddyCoeffs
-{
-    ce               1.05;
-    filter          simple;
-}
-
-SmagorinskyCoeffs
-{
-    ce               1.05;
-    ck               0.07;
-}
-
-Smagorinsky2Coeffs
-{
-    ce               1.05;
-    ck               0.07;
-    cD2              0.02;
-}
-
-spectEddyViscCoeffs
-{
-    ce               1.05;
-    cB               8.22;
-    cK1              0.83;
-    cK2              1.03;
-    cK3              4.75;
-    cK4              2.55;
-}
-
-dynSmagorinskyCoeffs
-{
-    ce               1.05;
-    filter          simple;
-}
-
-mixedSmagorinskyCoeffs
-{
-    ce               1.05;
-    ck               0.07;
-    filter          simple;
-}
-
-dynMixedSmagorinskyCoeffs
-{
-    ce               1.05;
-    filter          simple;
-}
-
-LRRDiffStressCoeffs
-{
-    ce               1.05;
-    ck               0.09;
-    c1               1.8;
-    c2               0.6;
-}
-
-DeardorffDiffStressCoeffs
-{
-    ce               1.05;
-    ck               0.09;
-    cm               4.13;
-}
-
-SpalartAllmarasCoeffs
-{
-    alphaNut         1.5;
-    Cb1              0.1355;
-    Cb2              0.622;
-    Cw2              0.3;
-    Cw3              2;
-    Cv1              7.1;
-    Cv2              5.0;
-    CDES             0.65;
-    ck               0.07;
-}
-
-SpalartAllmarasDDESCoeffs
-{
-    alphaNut         1.5;
-    Cb1              0.1355;
-    Cb2              0.622;
-    Cw2              0.3;
-    Cw3              2.0;
-    Cv1              7.1;
-    Cv2              5.0;
-    CDES             0.65;
-    ck               0.07;
-}
-
-SpalartAllmarasIDDESCoeffs
-{
-    alphaNut         1.5;
-    kappa            0.4187;
-    Cb1              0.1355;
-    Cb2              0.622;
-    Cw2              0.3;
-    Cw3              2.0;
-    Cv1              7.1;
-    Cv2              5.0;
-    CDES             0.65;
-    ck               0.07;
-}
-
 cubeRootVolCoeffs
 {
     deltaCoeff      1;
@@ -193,11 +75,5 @@ smoothCoeffs
     maxDeltaRatio   1.1;
 }
 
-kappa            0.4187;
-
-wallFunctionCoeffs
-{
-    E                9;
-}
 
 // ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/turbulenceProperties b/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/turbulenceProperties
index 0000f87e43..ab998a16d7 100644
--- a/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/turbulenceProperties
+++ b/tutorials/incompressible/pisoFoam/les/motorBike/lesFiles/turbulenceProperties
@@ -10,166 +10,11 @@ FoamFile
     version     2.0;
     format      ascii;
     class       dictionary;
+    location    "constant";
     object      turbulenceProperties;
 }
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 simulationType  LESModel;
 
-turbulenceModel SpalartAllmaras; //kEpsilon;
-
-turbulence      on;
-
-laminarCoeffs
-{
-}
-
-kEpsilonCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-}
-
-RNGkEpsilonCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.0845;
-    C1              C1 [0 0 0 0 0 0 0] 1.42;
-    C2              C2 [0 0 0 0 0 0 0] 1.68;
-    alphak          alphaK [0 0 0 0 0 0 0] 1.39;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 1.39;
-    eta0            eta0 [0 0 0 0 0 0 0] 4.38;
-    beta            beta [0 0 0 0 0 0 0] 0.012;
-}
-
-NonlinearKEShihCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphak          alphak [0 0 0 0 0 0 0] 1;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76932;
-    A1              A1 [0 0 0 0 0 0 0] 1.25;
-    A2              A2 [0 0 0 0 0 0 0] 1000;
-    Ctau1           Ctau1 [0 0 0 0 0 0 0] -4;
-    Ctau2           Ctau2 [0 0 0 0 0 0 0] 13;
-    Ctau3           Ctau3 [0 0 0 0 0 0 0] -2;
-    alphaKsi        alphaKsi [0 0 0 0 0 0 0] 0.9;
-}
-
-LienCubicKECoeffs
-{
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphak          alphak [0 0 0 0 0 0 0] 1;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-    A1              A1 [0 0 0 0 0 0 0] 1.25;
-    A2              A2 [0 0 0 0 0 0 0] 1000;
-    Ctau1           Ctau1 [0 0 0 0 0 0 0] -4;
-    Ctau2           Ctau2 [0 0 0 0 0 0 0] 13;
-    Ctau3           Ctau3 [0 0 0 0 0 0 0] -2;
-    alphaKsi        alphaKsi [0 0 0 0 0 0 0] 0.9;
-}
-
-QZetaCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphaZeta       alphaZeta [0 0 0 0 0 0 0] 0.76923;
-    anisotropic     no;
-}
-
-LaunderSharmaKECoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-}
-
-LamBremhorstKECoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-}
-
-LienCubicKELowReCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphak          alphak [0 0 0 0 0 0 0] 1;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-    A1              A1 [0 0 0 0 0 0 0] 1.25;
-    A2              A2 [0 0 0 0 0 0 0] 1000;
-    Ctau1           Ctau1 [0 0 0 0 0 0 0] -4;
-    Ctau2           Ctau2 [0 0 0 0 0 0 0] 13;
-    Ctau3           Ctau3 [0 0 0 0 0 0 0] -2;
-    alphaKsi        alphaKsi [0 0 0 0 0 0 0] 0.9;
-    Am              Am [0 0 0 0 0 0 0] 0.016;
-    Aepsilon        Aepsilon [0 0 0 0 0 0 0] 0.263;
-    Amu             Amu [0 0 0 0 0 0 0] 0.00222;
-}
-
-LienLeschzinerLowReCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    alphak          alphak [0 0 0 0 0 0 0] 1;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-    Am              Am [0 0 0 0 0 0 0] 0.016;
-    Aepsilon        Aepsilon [0 0 0 0 0 0 0] 0.263;
-    Amu             Amu [0 0 0 0 0 0 0] 0.00222;
-}
-
-LRRCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    Clrr1           Clrr1 [0 0 0 0 0 0 0] 1.8;
-    Clrr2           Clrr2 [0 0 0 0 0 0 0] 0.6;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    Cs              Cs [0 0 0 0 0 0 0] 0.25;
-    Ceps            Ceps [0 0 0 0 0 0 0] 0.15;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-}
-
-LaunderGibsonRSTMCoeffs
-{
-    Cmu             Cmu [0 0 0 0 0 0 0] 0.09;
-    Clg1            Clg1 [0 0 0 0 0 0 0] 1.8;
-    Clg2            Clg2 [0 0 0 0 0 0 0] 0.6;
-    C1              C1 [0 0 0 0 0 0 0] 1.44;
-    C2              C2 [0 0 0 0 0 0 0] 1.92;
-    C1Ref           C1Ref [0 0 0 0 0 0 0] 0.5;
-    C2Ref           C2Ref [0 0 0 0 0 0 0] 0.3;
-    Cs              Cs [0 0 0 0 0 0 0] 0.25;
-    Ceps            Ceps [0 0 0 0 0 0 0] 0.15;
-    alphaEps        alphaEps [0 0 0 0 0 0 0] 0.76923;
-    alphaR          alphaR [0 0 0 0 0 0 0] 1.22;
-}
-
-SpalartAllmarasCoeffs
-{
-    alphaNut        alphaNut [0 0 0 0 0 0 0] 1.5;
-    Cb1             Cb1 [0 0 0 0 0 0 0] 0.1355;
-    Cb2             Cb2 [0 0 0 0 0 0 0] 0.622;
-    Cw2             Cw2 [0 0 0 0 0 0 0] 0.3;
-    Cw3             Cw3 [0 0 0 0 0 0 0] 2;
-    Cv1             Cv1 [0 0 0 0 0 0 0] 7.1;
-	//Next line Modified vorticity factor by Ashford 1996
-	Cv2             Cv2 [0 0 0 0 0 0 0] 5.0;
-}
-
-wallFunctionCoeffs
-{
-    kappa           kappa [0 0 0 0 0 0 0] 0.4187;
-    E               E [0 0 0 0 0 0 0] 9;
-}
-
 // ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/les/pitzDaily/0/B b/tutorials/incompressible/pisoFoam/les/pitzDaily/0/B
deleted file mode 100644
index 39354d72f9..0000000000
--- a/tutorials/incompressible/pisoFoam/les/pitzDaily/0/B
+++ /dev/null
@@ -1,52 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volTensorField;
-    object      B;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0 0 0 0);
-
-boundaryField
-{
-    inlet
-    {
-        type            fixedValue;
-        value           uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    outlet
-    {
-        type            inletOutlet;
-        inletValue      uniform (0 0 0 0 0 0 0 0 0);
-        value           uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    upperWall
-    {
-        type            zeroGradient;
-    }
-
-    lowerWall
-    {
-        type            zeroGradient;
-    }
-
-    frontAndBack
-    {
-        type            empty;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/les/pitzDaily/constant/turbulenceProperties b/tutorials/incompressible/pisoFoam/les/pitzDaily/constant/turbulenceProperties
index a925d3cc2b..ab998a16d7 100644
--- a/tutorials/incompressible/pisoFoam/les/pitzDaily/constant/turbulenceProperties
+++ b/tutorials/incompressible/pisoFoam/les/pitzDaily/constant/turbulenceProperties
@@ -17,5 +17,4 @@ FoamFile
 
 simulationType  LESModel;
 
-
 // ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/les/pitzDailyMapped/0/B b/tutorials/incompressible/pisoFoam/les/pitzDailyMapped/0/B
deleted file mode 100644
index 3cca215a87..0000000000
--- a/tutorials/incompressible/pisoFoam/les/pitzDailyMapped/0/B
+++ /dev/null
@@ -1,55 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volTensorField;
-    object      B;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0 0 0 0);
-
-boundaryField
-{
-    inlet
-    {
-        type                mapped;
-        value               uniform (0 0 0 0 0 0 0 0 0);
-        interpolationScheme cell;
-        setAverage          false;
-        average             (0 0 0 0 0 0 0 0 0);
-    }
-
-    outlet
-    {
-        type                inletOutlet;
-        inletValue          uniform (0 0 0 0 0 0 0 0 0);
-        value               uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    upperWall
-    {
-        type                zeroGradient;
-    }
-
-    lowerWall
-    {
-        type                zeroGradient;
-    }
-
-    frontAndBack
-    {
-        type                empty;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/ras/cavity/0/R b/tutorials/incompressible/pisoFoam/ras/cavity/0/R
deleted file mode 100644
index 8b8fd01091..0000000000
--- a/tutorials/incompressible/pisoFoam/ras/cavity/0/R
+++ /dev/null
@@ -1,41 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volSymmTensorField;
-    object      R;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0);
-
-boundaryField
-{
-    movingWall
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    fixedWalls
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    frontAndBack
-    {
-        type            empty;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/simpleFoam/pitzDaily/0/R b/tutorials/incompressible/simpleFoam/pitzDaily/0/R
deleted file mode 100644
index da397ebfb3..0000000000
--- a/tutorials/incompressible/simpleFoam/pitzDaily/0/R
+++ /dev/null
@@ -1,52 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volSymmTensorField;
-    object      R;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0);
-
-boundaryField
-{
-    inlet
-    {
-        type            fixedValue;
-        value           uniform (0 0 0 0 0 0);
-    }
-
-    outlet
-    {
-        type            zeroGradient;
-    }
-
-    upperWall
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    lowerWall
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    frontAndBack
-    {
-        type            empty;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/0/R b/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/0/R
deleted file mode 100644
index da397ebfb3..0000000000
--- a/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/0/R
+++ /dev/null
@@ -1,52 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volSymmTensorField;
-    object      R;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0);
-
-boundaryField
-{
-    inlet
-    {
-        type            fixedValue;
-        value           uniform (0 0 0 0 0 0);
-    }
-
-    outlet
-    {
-        type            zeroGradient;
-    }
-
-    upperWall
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    lowerWall
-    {
-        type            kqRWallFunction;
-        value           uniform ( 0 0 0 0 0 0 );
-    }
-
-    frontAndBack
-    {
-        type            empty;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties b/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties
index d395197f98..c155594c01 100644
--- a/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties
@@ -36,6 +36,7 @@ solution
             U               semiImplicit 1;
             Yi              semiImplicit 1;
             h               semiImplicit 1;
+            radiation       semiImplicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties
index 515ff9908a..8f07ac40e7 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               semiImplicit 1;
             Yi              semiImplicit 1;
             h               semiImplicit 1;
+            radiation       semiImplicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/limestoneCloud1Properties b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/limestoneCloud1Properties
index f82e81837e..f149873427 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/limestoneCloud1Properties
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/limestoneCloud1Properties
@@ -28,6 +28,7 @@ solution
         {
             U               explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties
index fe1b09453b..36af7910eb 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/reactingCloud1Properties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/reactingCloud1Properties
index 2545b74976..c2fb9a550b 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties
index 9b5ca04fcb..c05dc6a728 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/reactingCloud1Properties b/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/reactingCloud1Properties
index 848a471ba9..4b520415a0 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/reactingCloud1Properties b/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/reactingCloud1Properties
index 412945dbcd..adef8f34d4 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/reactingCloud1Properties b/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/reactingCloud1Properties
index b763043e31..6c2f59c4b4 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/reactingCloud1Properties b/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/reactingCloud1Properties
index 4cae4e5161..778983882a 100644
--- a/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/reactingCloud1Properties
+++ b/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/reactingCloud1Properties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties b/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties
index b3072a5363..9dee39da64 100644
--- a/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties
+++ b/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties
@@ -30,6 +30,7 @@ solution
             U               explicit 1;
             Yi              explicit 1;
             h               explicit 1;
+            radiation       explicit 1;
         }
     }
 
diff --git a/tutorials/multiphase/LTSInterFoam/wigleyHull/system/fvSchemes b/tutorials/multiphase/LTSInterFoam/wigleyHull/system/fvSchemes
index 22366f437b..7018c5eaa7 100644
--- a/tutorials/multiphase/LTSInterFoam/wigleyHull/system/fvSchemes
+++ b/tutorials/multiphase/LTSInterFoam/wigleyHull/system/fvSchemes
@@ -32,6 +32,7 @@ divSchemes
     div(phirb,alpha) Gauss interfaceCompression;
     div(phi,k)      Gauss upwind;
     div(phi,omega)  Gauss upwind;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/MRFInterFoam/mixerVessel2D/system/fvSchemes b/tutorials/multiphase/MRFInterFoam/mixerVessel2D/system/fvSchemes
index 41159c5be6..3827ac6548 100644
--- a/tutorials/multiphase/MRFInterFoam/mixerVessel2D/system/fvSchemes
+++ b/tutorials/multiphase/MRFInterFoam/mixerVessel2D/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss linear;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/MRFMultiphaseInterFoam/mixerVessel2D/system/fvSchemes b/tutorials/multiphase/MRFMultiphaseInterFoam/mixerVessel2D/system/fvSchemes
index b4ad45237d..d1ed26cae3 100644
--- a/tutorials/multiphase/MRFMultiphaseInterFoam/mixerVessel2D/system/fvSchemes
+++ b/tutorials/multiphase/MRFMultiphaseInterFoam/mixerVessel2D/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss limitedLinearV 1;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/cavitatingFoam/les/throttle/system/fvSchemes b/tutorials/multiphase/cavitatingFoam/les/throttle/system/fvSchemes
index 0c8bf54bb5..3d506aa1d7 100644
--- a/tutorials/multiphase/cavitatingFoam/les/throttle/system/fvSchemes
+++ b/tutorials/multiphase/cavitatingFoam/les/throttle/system/fvSchemes
@@ -31,6 +31,7 @@ divSchemes
     div(phiv,rho)   Gauss limitedLinear 0.2;
     div(phi,U)      Gauss filteredLinear2V 0.2 0;
     div(phiv,k)     Gauss filteredLinear2 0.2 0;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 gradSchemes
diff --git a/tutorials/multiphase/cavitatingFoam/les/throttle3D/system/fvSchemes b/tutorials/multiphase/cavitatingFoam/les/throttle3D/system/fvSchemes
index 0c8bf54bb5..3d506aa1d7 100644
--- a/tutorials/multiphase/cavitatingFoam/les/throttle3D/system/fvSchemes
+++ b/tutorials/multiphase/cavitatingFoam/les/throttle3D/system/fvSchemes
@@ -31,6 +31,7 @@ divSchemes
     div(phiv,rho)   Gauss limitedLinear 0.2;
     div(phi,U)      Gauss filteredLinear2V 0.2 0;
     div(phiv,k)     Gauss filteredLinear2 0.2 0;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 gradSchemes
diff --git a/tutorials/multiphase/cavitatingFoam/ras/throttle/system/fvSchemes b/tutorials/multiphase/cavitatingFoam/ras/throttle/system/fvSchemes
index 633e4a749e..32379fb2c2 100644
--- a/tutorials/multiphase/cavitatingFoam/ras/throttle/system/fvSchemes
+++ b/tutorials/multiphase/cavitatingFoam/ras/throttle/system/fvSchemes
@@ -32,6 +32,7 @@ divSchemes
     div(phi,U)      Gauss limitedLinearV 1;
     div(phiv,omega) Gauss limitedLinear 1;
     div(phiv,k)     Gauss limitedLinear 1;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 gradSchemes
diff --git a/tutorials/multiphase/compressibleInterFoam/les/depthCharge2D/system/fvSchemes b/tutorials/multiphase/compressibleInterFoam/les/depthCharge2D/system/fvSchemes
index c35af6cc4f..903d94d30c 100644
--- a/tutorials/multiphase/compressibleInterFoam/les/depthCharge2D/system/fvSchemes
+++ b/tutorials/multiphase/compressibleInterFoam/les/depthCharge2D/system/fvSchemes
@@ -34,7 +34,7 @@ divSchemes
     div(phid2,p_rgh) Gauss upwind;
     div(rho*phi,T)  Gauss upwind;
     div(phi,k)      Gauss vanLeer;
-    div((nuEff*dev(T(grad(U))))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/compressibleInterFoam/les/depthCharge3D/system/fvSchemes b/tutorials/multiphase/compressibleInterFoam/les/depthCharge3D/system/fvSchemes
index c35af6cc4f..903d94d30c 100644
--- a/tutorials/multiphase/compressibleInterFoam/les/depthCharge3D/system/fvSchemes
+++ b/tutorials/multiphase/compressibleInterFoam/les/depthCharge3D/system/fvSchemes
@@ -34,7 +34,7 @@ divSchemes
     div(phid2,p_rgh) Gauss upwind;
     div(rho*phi,T)  Gauss upwind;
     div(phi,k)      Gauss vanLeer;
-    div((nuEff*dev(T(grad(U))))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/0.org/p_rgh b/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/0.org/p_rgh
index 5c911a0345..e4a0e7e87a 100644
--- a/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/0.org/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/0.org/p_rgh
@@ -23,12 +23,14 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 
     obstacle
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 
diff --git a/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/system/fvSchemes
index fa6ef27c43..ba444728e1 100644
--- a/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/damBreakWithObstacle/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss upwind;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/floatingObject/0.org/p_rgh b/tutorials/multiphase/interDyMFoam/ras/floatingObject/0.org/p_rgh
index 825a15d6dc..dc6376bc69 100644
--- a/tutorials/multiphase/interDyMFoam/ras/floatingObject/0.org/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/floatingObject/0.org/p_rgh
@@ -23,6 +23,7 @@ boundaryField
     stationaryWalls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
     atmosphere
@@ -39,6 +40,7 @@ boundaryField
     floatingObject
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/floatingObject/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/floatingObject/system/fvSchemes
index 5ce6b8ee17..852f5e0c74 100644
--- a/tutorials/multiphase/interDyMFoam/ras/floatingObject/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/floatingObject/system/fvSchemes
@@ -32,6 +32,7 @@ divSchemes
     div(phirb,alpha) Gauss interfaceCompression;
     div(phi,k)      Gauss upwind;
     div(phi,epsilon) Gauss upwind;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/0/p_rgh b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/0/p_rgh
index 5c0b4be6fd..dafcfc526a 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/0/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/0/p_rgh
@@ -31,6 +31,7 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/system/fvSchemes
index a0a60315bd..b2c0af769d 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss vanLeerV;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss vanLeer;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/0/p_rgh b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/0/p_rgh
index 5c0b4be6fd..dafcfc526a 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/0/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/0/p_rgh
@@ -31,6 +31,7 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/system/fvSchemes
index a0a60315bd..b2c0af769d 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank2D3DoF/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss vanLeerV;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss vanLeer;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/0/p_rgh b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/0/p_rgh
index 29202adadb..5e7bcfb8bc 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/0/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/0/p_rgh
@@ -23,6 +23,7 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/system/fvSchemes
index a0a60315bd..b2c0af769d 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss vanLeerV;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss vanLeer;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/0/p_rgh b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/0/p_rgh
index 29202adadb..5e7bcfb8bc 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/0/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/0/p_rgh
@@ -23,6 +23,7 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/system/fvSchemes
index a0a60315bd..b2c0af769d 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D3DoF/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss vanLeerV;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss vanLeer;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/0/p_rgh b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/0/p_rgh
index 29202adadb..5e7bcfb8bc 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/0/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/0/p_rgh
@@ -23,6 +23,7 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/system/fvSchemes
index a0a60315bd..b2c0af769d 100644
--- a/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/sloshingTank3D6DoF/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss vanLeerV;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss vanLeer;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/0/p_rgh b/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/0/p_rgh
index 29202adadb..5e7bcfb8bc 100644
--- a/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/0/p_rgh
+++ b/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/0/p_rgh
@@ -23,6 +23,7 @@ boundaryField
     walls
     {
         type            fixedFluxPressure;
+        phi             phiAbs;
         value           uniform 0;
     }
 }
diff --git a/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/system/fvSchemes b/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/system/fvSchemes
index a0a60315bd..b2c0af769d 100644
--- a/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/system/fvSchemes
+++ b/tutorials/multiphase/interDyMFoam/ras/testTubeMixer/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss vanLeerV;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss vanLeer;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/laminar/capillaryRise/system/fvSchemes b/tutorials/multiphase/interFoam/laminar/capillaryRise/system/fvSchemes
index c2c563142c..2a580ed9eb 100644
--- a/tutorials/multiphase/interFoam/laminar/capillaryRise/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/laminar/capillaryRise/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss upwind;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/laminar/damBreak/system/fvSchemes b/tutorials/multiphase/interFoam/laminar/damBreak/system/fvSchemes
index 7bb78c013c..986a20eebe 100644
--- a/tutorials/multiphase/interFoam/laminar/damBreak/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/laminar/damBreak/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss limitedLinearV 1;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/les/nozzleFlow2D/0/B b/tutorials/multiphase/interFoam/les/nozzleFlow2D/0/B
deleted file mode 100644
index d84b782054..0000000000
--- a/tutorials/multiphase/interFoam/les/nozzleFlow2D/0/B
+++ /dev/null
@@ -1,57 +0,0 @@
-/*--------------------------------*- C++ -*----------------------------------*\
-| =========                 |                                                 |
-| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
-|  \\    /   O peration     | Version:  dev                                   |
-|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
-|    \\/     M anipulation  |                                                 |
-\*---------------------------------------------------------------------------*/
-FoamFile
-{
-    version     2.0;
-    format      ascii;
-    class       volTensorField;
-    object      B;
-}
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-dimensions      [0 2 -2 0 0 0 0];
-
-internalField   uniform (0 0 0 0 0 0 0 0 0);
-
-boundaryField
-{
-    axis
-    {
-        type            empty;
-    }
-
-    inlet
-    {
-        type            fixedValue;
-        value           uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    wall
-    {
-        type            zeroGradient;
-    }
-
-    atmosphere
-    {
-        type            inletOutlet;
-        inletValue      uniform (0 0 0 0 0 0 0 0 0);
-        value           uniform (0 0 0 0 0 0 0 0 0);
-    }
-
-    front
-    {
-        type            wedge;
-    }
-
-    back
-    {
-        type            wedge;
-    }
-}
-
-// ************************************************************************* //
diff --git a/tutorials/multiphase/interFoam/les/nozzleFlow2D/system/fvSchemes b/tutorials/multiphase/interFoam/les/nozzleFlow2D/system/fvSchemes
index be6806ad73..26e06a656b 100644
--- a/tutorials/multiphase/interFoam/les/nozzleFlow2D/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/les/nozzleFlow2D/system/fvSchemes
@@ -34,7 +34,7 @@ divSchemes
     div(phi,B)      Gauss limitedLinear 1;
     div(B)          Gauss linear;
     div(phi,nuTilda) Gauss limitedLinear 1;
-    div((nuEff*dev(T(grad(U))))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/ras/damBreak/system/fvSchemes b/tutorials/multiphase/interFoam/ras/damBreak/system/fvSchemes
index 28b3d7d20a..8ed8e03cc0 100644
--- a/tutorials/multiphase/interFoam/ras/damBreak/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/ras/damBreak/system/fvSchemes
@@ -35,7 +35,7 @@ divSchemes
     div(phi,R)      Gauss upwind;
     div(R)          Gauss linear;
     div(phi,nuTilda) Gauss upwind;
-    div((nuEff*dev(T(grad(U))))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/ras/damBreakPorousBaffle/system/fvSchemes b/tutorials/multiphase/interFoam/ras/damBreakPorousBaffle/system/fvSchemes
index 28b3d7d20a..8ed8e03cc0 100644
--- a/tutorials/multiphase/interFoam/ras/damBreakPorousBaffle/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/ras/damBreakPorousBaffle/system/fvSchemes
@@ -35,7 +35,7 @@ divSchemes
     div(phi,R)      Gauss upwind;
     div(R)          Gauss linear;
     div(phi,nuTilda) Gauss upwind;
-    div((nuEff*dev(T(grad(U))))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/ras/waterChannel/LTSInterFoam/system/fvSchemes b/tutorials/multiphase/interFoam/ras/waterChannel/LTSInterFoam/system/fvSchemes
index 22366f437b..7018c5eaa7 100644
--- a/tutorials/multiphase/interFoam/ras/waterChannel/LTSInterFoam/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/ras/waterChannel/LTSInterFoam/system/fvSchemes
@@ -32,6 +32,7 @@ divSchemes
     div(phirb,alpha) Gauss interfaceCompression;
     div(phi,k)      Gauss upwind;
     div(phi,omega)  Gauss upwind;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/ras/waterChannel/system/fvSchemes b/tutorials/multiphase/interFoam/ras/waterChannel/system/fvSchemes
index 43847dd841..bb536c017c 100644
--- a/tutorials/multiphase/interFoam/ras/waterChannel/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/ras/waterChannel/system/fvSchemes
@@ -33,6 +33,7 @@ divSchemes
 
     div(phi,k)      Gauss upwind;
     div(phi,omega)  $div(phi,k);
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interFoam/ras/weirOverflow/system/fvSchemes b/tutorials/multiphase/interFoam/ras/weirOverflow/system/fvSchemes
index 28b3d7d20a..8ed8e03cc0 100644
--- a/tutorials/multiphase/interFoam/ras/weirOverflow/system/fvSchemes
+++ b/tutorials/multiphase/interFoam/ras/weirOverflow/system/fvSchemes
@@ -35,7 +35,7 @@ divSchemes
     div(phi,R)      Gauss upwind;
     div(R)          Gauss linear;
     div(phi,nuTilda) Gauss upwind;
-    div((nuEff*dev(T(grad(U))))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interMixingFoam/laminar/damBreak/system/fvSchemes b/tutorials/multiphase/interMixingFoam/laminar/damBreak/system/fvSchemes
index ed937573ff..c80ccb314e 100644
--- a/tutorials/multiphase/interMixingFoam/laminar/damBreak/system/fvSchemes
+++ b/tutorials/multiphase/interMixingFoam/laminar/damBreak/system/fvSchemes
@@ -30,6 +30,7 @@ divSchemes
     div(rho*phi,U)  Gauss limitedLinearV 1;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/interPhaseChangeFoam/cavitatingBullet/system/fvSchemes b/tutorials/multiphase/interPhaseChangeFoam/cavitatingBullet/system/fvSchemes
index c1b7f71206..44313d502d 100644
--- a/tutorials/multiphase/interPhaseChangeFoam/cavitatingBullet/system/fvSchemes
+++ b/tutorials/multiphase/interPhaseChangeFoam/cavitatingBullet/system/fvSchemes
@@ -30,9 +30,9 @@ divSchemes
     div(rhoPhi,U)        Gauss linearUpwind grad(U);
     div(phi,omega)       Gauss linearUpwind grad(omega);
     div(phi,k)           Gauss linearUpwind grad(k);
-
     div(phi,alpha)       Gauss vanLeer;
     div(phirb,alpha)     Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 gradSchemes
diff --git a/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phase/system/fvSchemes b/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phase/system/fvSchemes
index 6e3d6f1b84..e1436932da 100644
--- a/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phase/system/fvSchemes
+++ b/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phase/system/fvSchemes
@@ -32,6 +32,7 @@ divSchemes
     div(rho*phi,U)  Gauss upwind;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/fvSchemes b/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/fvSchemes
index 6e3d6f1b84..e1436932da 100644
--- a/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/fvSchemes
+++ b/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/fvSchemes
@@ -32,6 +32,7 @@ divSchemes
     div(rho*phi,U)  Gauss upwind;
     div(phi,alpha)  Gauss vanLeer;
     div(phirb,alpha) Gauss interfaceCompression;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes
diff --git a/tutorials/multiphase/twoLiquidMixingFoam/lockExchange/system/fvSchemes b/tutorials/multiphase/twoLiquidMixingFoam/lockExchange/system/fvSchemes
index 4bb0230588..35930b9203 100644
--- a/tutorials/multiphase/twoLiquidMixingFoam/lockExchange/system/fvSchemes
+++ b/tutorials/multiphase/twoLiquidMixingFoam/lockExchange/system/fvSchemes
@@ -33,7 +33,7 @@ divSchemes
     div(rho*phi,U)  Gauss linear;
     div(phi,alpha1) Gauss vanLeer;
     div(phi,k)      Gauss limitedLinear 1;
-    div(((rho*nuEff)*dev(grad(U).T()))) Gauss linear;
+    div((muEff*dev(T(grad(U))))) Gauss linear;
 }
 
 laplacianSchemes