Merge branch 'master' of /home/dm4/OpenFOAM/repositories/OpenFOAM-dev

Conflicts:
	doc/Doxygen/css/doxygen.css
This commit is contained in:
mattijs
2013-12-02 11:30:36 +00:00
147 changed files with 3845 additions and 1494 deletions

View File

@ -4,7 +4,8 @@
fvm::ddt(rho, U) fvm::ddt(rho, U)
+ fvm::div(phi, U) + fvm::div(phi, U)
+ turb.divDevRhoReff(U) + turb.divDevRhoReff(U)
+ fvOptions(rho, U) ==
fvOptions(rho, U)
); );
UEqn().relax(); UEqn().relax();

View File

@ -77,8 +77,6 @@ int main(int argc, char *argv[])
#include "setrDeltaT.H" #include "setrDeltaT.H"
tmp<surfaceScalarField> tphiAlpha;
// --- Pressure-velocity PIMPLE corrector loop // --- Pressure-velocity PIMPLE corrector loop
while (pimple.loop()) while (pimple.loop())
{ {
@ -91,8 +89,6 @@ int main(int argc, char *argv[])
#define LTSSOLVE #define LTSSOLVE
#include "alphaEqnSubCycle.H" #include "alphaEqnSubCycle.H"
#undef LTSSOLVE #undef LTSSOLVE
interface.correct();
} }
turbulence->correct(); turbulence->correct();

View File

@ -81,8 +81,6 @@ int main(int argc, char *argv[])
Info<< "Time = " << runTime.timeName() << nl << endl; Info<< "Time = " << runTime.timeName() << nl << endl;
tmp<surfaceScalarField> tphiAlpha;
// --- Pressure-velocity PIMPLE corrector loop // --- Pressure-velocity PIMPLE corrector loop
while (pimple.loop()) while (pimple.loop())
{ {

View File

@ -2,11 +2,30 @@
word alphaScheme("div(phi,alpha)"); word alphaScheme("div(phi,alpha)");
word alpharScheme("div(phirb,alpha)"); word alpharScheme("div(phirb,alpha)");
surfaceScalarField phic(mag(phi/mesh.magSf())); // Standard face-flux compression coefficient
phic = min(interface.cAlpha()*phic, max(phic)); surfaceScalarField phic(interface.cAlpha()*mag(phi/mesh.magSf()));
surfaceScalarField phir(phic*interface.nHatf());
// Add the optional isotropic compression contribution
if (icAlpha > 0)
{
phic *= (1.0 - icAlpha);
phic += (interface.cAlpha()*icAlpha)*fvc::interpolate(mag(U));
}
// Do not compress interface at non-coupled boundary faces
// (inlets, outlets etc.)
forAll(phic.boundaryField(), patchi)
{
fvsPatchScalarField& phicp = phic.boundaryField()[patchi];
if (!phicp.coupled())
{
phicp == 0;
}
}
tmp<surfaceScalarField> tphiAlpha;
//***HGW if (pimple.firstIter() && MULESCorr)
if (MULESCorr) if (MULESCorr)
{ {
fvScalarMatrix alpha1Eqn fvScalarMatrix alpha1Eqn
@ -32,12 +51,37 @@
<< " Max(alpha1) = " << max(alpha1).value() << " Max(alpha1) = " << max(alpha1).value()
<< endl; << endl;
tphiAlpha = alpha1Eqn.flux(); tmp<surfaceScalarField> tphiAlphaUD(alpha1Eqn.flux());
tphiAlpha = tmp<surfaceScalarField>
(
new surfaceScalarField(tphiAlphaUD())
);
if (alphaApplyPrevCorr && tphiAlphaCorr0.valid())
{
Info<< "Applying the previous iteration compression flux" << endl;
#ifdef LTSSOLVE
MULES::LTScorrect(alpha1, tphiAlpha(), tphiAlphaCorr0(), 1, 0);
#else
MULES::correct(alpha1, tphiAlpha(), tphiAlphaCorr0(), 1, 0);
#endif
tphiAlpha() += tphiAlphaCorr0();
}
// Cache the upwind-flux
tphiAlphaCorr0 = tphiAlphaUD;
alpha2 = 1.0 - alpha1;
interface.correct();
} }
for (int aCorr=0; aCorr<nAlphaCorr; aCorr++) for (int aCorr=0; aCorr<nAlphaCorr; aCorr++)
{ {
tmp<surfaceScalarField> tphiAlpha0 surfaceScalarField phir(phic*interface.nHatf());
tmp<surfaceScalarField> tphiAlphaUn
( (
fvc::flux fvc::flux
( (
@ -55,17 +99,29 @@
if (MULESCorr) if (MULESCorr)
{ {
tphiAlpha0() -= tphiAlpha(); tmp<surfaceScalarField> tphiAlphaCorr(tphiAlphaUn() - tphiAlpha());
volScalarField alpha10(alpha1);
#ifdef LTSSOLVE #ifdef LTSSOLVE
MULES::LTScorrect(alpha1, tphiAlpha0(), 1, 0); MULES::LTScorrect(alpha1, tphiAlphaUn(), tphiAlphaCorr(), 1, 0);
#else #else
MULES::correct(alpha1, tphiAlpha0(), 1, 0); MULES::correct(alpha1, tphiAlphaUn(), tphiAlphaCorr(), 1, 0);
#endif #endif
tphiAlpha() += tphiAlpha0();
// Under-relax the correction for more than 3 correctors
if (aCorr < 3)
{
tphiAlpha() += tphiAlphaCorr();
} }
else else
{ {
tphiAlpha = tphiAlpha0; alpha1 = 0.5*alpha1 + 0.5*alpha10;
tphiAlpha() += 0.5*tphiAlphaCorr();
}
}
else
{
tphiAlpha = tphiAlphaUn;
#ifdef LTSSOLVE #ifdef LTSSOLVE
MULES::explicitLTSSolve(alpha1, phi, tphiAlpha(), 1, 0); MULES::explicitLTSSolve(alpha1, phi, tphiAlpha(), 1, 0);
@ -75,10 +131,17 @@
} }
alpha2 = 1.0 - alpha1; alpha2 = 1.0 - alpha1;
interface.correct();
} }
rhoPhi = tphiAlpha()*(rho1 - rho2) + phi*rho2; rhoPhi = tphiAlpha()*(rho1 - rho2) + phi*rho2;
if (alphaApplyPrevCorr && MULESCorr)
{
tphiAlphaCorr0 = tphiAlpha() - tphiAlphaCorr0;
}
Info<< "Phase-1 volume fraction = " Info<< "Phase-1 volume fraction = "
<< alpha1.weightedAverage(mesh.Vsc()).value() << alpha1.weightedAverage(mesh.Vsc()).value()
<< " Min(alpha1) = " << min(alpha1).value() << " Min(alpha1) = " << min(alpha1).value()

View File

@ -135,3 +135,6 @@
} }
fv::IOoptionList fvOptions(mesh); fv::IOoptionList fvOptions(mesh);
tmp<surfaceScalarField> tphiAlphaCorr0;

View File

@ -77,8 +77,6 @@ int main(int argc, char *argv[])
Info<< "Time = " << runTime.timeName() << nl << endl; Info<< "Time = " << runTime.timeName() << nl << endl;
tmp<surfaceScalarField> tphiAlpha;
// --- Pressure-velocity PIMPLE corrector loop // --- Pressure-velocity PIMPLE corrector loop
while (pimple.loop()) while (pimple.loop())
{ {

View File

@ -80,8 +80,6 @@ int main(int argc, char *argv[])
Info<< "Time = " << runTime.timeName() << nl << endl; Info<< "Time = " << runTime.timeName() << nl << endl;
tmp<surfaceScalarField> tphiAlpha;
// --- Pressure-velocity PIMPLE corrector loop // --- Pressure-velocity PIMPLE corrector loop
while (pimple.loop()) while (pimple.loop())
{ {

View File

@ -74,8 +74,6 @@ int main(int argc, char *argv[])
Info<< "Time = " << runTime.timeName() << nl << endl; Info<< "Time = " << runTime.timeName() << nl << endl;
tmp<surfaceScalarField> tphiAlpha;
// --- Pressure-velocity PIMPLE corrector loop // --- Pressure-velocity PIMPLE corrector loop
while (pimple.loop()) while (pimple.loop())
{ {

View File

@ -83,8 +83,6 @@ int main(int argc, char *argv[])
Info<< "Time = " << runTime.timeName() << nl << endl; Info<< "Time = " << runTime.timeName() << nl << endl;
tmp<surfaceScalarField> tphiAlpha;
// --- Pressure-velocity PIMPLE corrector loop // --- Pressure-velocity PIMPLE corrector loop
while (pimple.loop()) while (pimple.loop())
{ {

View File

@ -71,6 +71,7 @@
( (
geometricOneField(), geometricOneField(),
alpha1, alpha1,
tphiAlpha(),
tphiAlphaCorr(), tphiAlphaCorr(),
vDotvmcAlphal, vDotvmcAlphal,
( (

View File

@ -110,7 +110,8 @@ Foam::OutputFilterFunctionObject<OutputFilter>::OutputFilterFunctionObject
storeFilter_(true), storeFilter_(true),
timeStart_(-VGREAT), timeStart_(-VGREAT),
timeEnd_(VGREAT), timeEnd_(VGREAT),
outputControl_(t, dict) outputControl_(t, dict, "output"),
evaluateControl_(t, dict, "evaluate")
{ {
readDict(); readDict();
} }
@ -159,7 +160,10 @@ bool Foam::OutputFilterFunctionObject<OutputFilter>::execute
allocateFilter(); allocateFilter();
} }
if (evaluateControl_.output())
{
ptr_->execute(); ptr_->execute();
}
if (forceWrite || outputControl_.output()) if (forceWrite || outputControl_.output())
{ {

View File

@ -98,6 +98,9 @@ class OutputFilterFunctionObject
//- Output controls //- Output controls
outputFilterOutputControl outputControl_; outputFilterOutputControl outputControl_;
//- Evaluate controls
outputFilterOutputControl evaluateControl_;
//- Pointer to the output filter //- Pointer to the output filter
autoPtr<OutputFilter> ptr_; autoPtr<OutputFilter> ptr_;

View File

@ -31,9 +31,18 @@ License
// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * // // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
const Foam::word Foam::functionObjectFile::outputPrefix = "postProcessing"; const Foam::word Foam::functionObjectFile::outputPrefix = "postProcessing";
Foam::label Foam::functionObjectFile::addChars = 7;
// * * * * * * * * * * * * Protected Member Functions * * * * * * * * * * * // // * * * * * * * * * * * * Protected Member Functions * * * * * * * * * * * //
void Foam::functionObjectFile::initStream(Ostream& os) const
{
os.setf(ios_base::scientific, ios_base::floatfield);
// os.precision(IOstream::defaultPrecision());
os.width(charWidth());
}
Foam::fileName Foam::functionObjectFile::baseFileDir() const Foam::fileName Foam::functionObjectFile::baseFileDir() const
{ {
fileName baseDir = obr_.time().path(); fileName baseDir = obr_.time().path();
@ -96,6 +105,8 @@ void Foam::functionObjectFile::createFiles()
filePtrs_.set(i, new OFstream(outputDir/(fName + ".dat"))); filePtrs_.set(i, new OFstream(outputDir/(fName + ".dat")));
initStream(filePtrs_[i]);
writeFileHeader(i); writeFileHeader(i);
i++; i++;
@ -147,6 +158,12 @@ void Foam::functionObjectFile::resetName(const word& name)
} }
Foam::Omanip<int> Foam::functionObjectFile::valueWidth(const label offset) const
{
return setw(IOstream::defaultPrecision() + addChars + offset);
}
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::functionObjectFile::functionObjectFile Foam::functionObjectFile::functionObjectFile
@ -289,4 +306,42 @@ Foam::OFstream& Foam::functionObjectFile::file(const label i)
} }
Foam::label Foam::functionObjectFile::charWidth() const
{
return IOstream::defaultPrecision() + addChars;
}
void Foam::functionObjectFile::writeCommented
(
Ostream& os,
const string& str
) const
{
os << setw(1) << "#" << setw(1) << ' '
<< setw(charWidth() - 2) << str.c_str();
}
void Foam::functionObjectFile::writeTabbed
(
Ostream& os,
const string& str
) const
{
os << tab << setw(charWidth()) << str.c_str();
}
void Foam::functionObjectFile::writeHeader
(
Ostream& os,
const string& str
) const
{
os << setw(1) << "#" << setw(1) << ' '
<< setf(ios_base::left) << setw(charWidth() - 2) << str.c_str() << nl;
}
// ************************************************************************* // // ************************************************************************* //

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2012-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -43,6 +43,7 @@ SourceFiles
#include "OFstream.H" #include "OFstream.H"
#include "PtrList.H" #include "PtrList.H"
#include "HashSet.H" #include "HashSet.H"
#include "IOmanip.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@ -77,6 +78,9 @@ protected:
// Protected Member Functions // Protected Member Functions
//- Initialise the output stream for writing
virtual void initStream(Ostream& os) const;
//- Return the base directory for output //- Return the base directory for output
virtual fileName baseFileDir() const; virtual fileName baseFileDir() const;
@ -98,6 +102,9 @@ protected:
//- Reset the list of names to a single name entry //- Reset the list of names to a single name entry
virtual void resetName(const word& name); virtual void resetName(const word& name);
//- Return the value width when writing to stream with optional offset
virtual Omanip<int> valueWidth(const label offset = 0) const;
//- Disallow default bitwise copy construct //- Disallow default bitwise copy construct
functionObjectFile(const functionObjectFile&); functionObjectFile(const functionObjectFile&);
@ -110,6 +117,9 @@ public:
//- Folder prefix //- Folder prefix
static const word outputPrefix; static const word outputPrefix;
//- Additional characters for writing
static label addChars;
// Constructors // Constructors
//- Construct null //- Construct null
@ -149,6 +159,39 @@ public:
//- Return file 'i' //- Return file 'i'
OFstream& file(const label i); OFstream& file(const label i);
//- Write a commented string to stream
void writeCommented
(
Ostream& os,
const string& str
) const;
//- Write a tabbed string to stream
void writeTabbed
(
Ostream& os,
const string& str
) const;
//- Write a commented header to stream
void writeHeader
(
Ostream& os,
const string& str
) const;
//- Write a (commented) header property and value pair
template<class Type>
void writeHeaderValue
(
Ostream& os,
const string& property,
const Type& value
) const;
//- Return width of character stream output
label charWidth() const;
}; };
@ -158,6 +201,12 @@ public:
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#ifdef NoRepository
#include "functionObjectFileTemplates.C"
#endif
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif #endif
// ************************************************************************* // // ************************************************************************* //

View File

@ -0,0 +1,44 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "OStringStream.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
template<class Type>
void Foam::functionObjectFile::writeHeaderValue
(
Ostream& os,
const string& property,
const Type& value
) const
{
os << setw(1) << '#' << setw(1) << ' '
<< setw(charWidth() - 2) << setf(ios_base::left) << property.c_str()
<< setw(1) << ':' << setw(1) << ' ' << value << nl;
}
// ************************************************************************* //

View File

@ -31,7 +31,7 @@ License
namespace Foam namespace Foam
{ {
template<> template<>
const char* NamedEnum<outputFilterOutputControl::outputControls, 6>:: const char* NamedEnum<outputFilterOutputControl::outputControls, 7>::
names[] = names[] =
{ {
"timeStep", "timeStep",
@ -39,11 +39,12 @@ namespace Foam
"adjustableTime", "adjustableTime",
"runTime", "runTime",
"clockTime", "clockTime",
"cpuTime" "cpuTime",
"none"
}; };
} }
const Foam::NamedEnum<Foam::outputFilterOutputControl::outputControls, 6> const Foam::NamedEnum<Foam::outputFilterOutputControl::outputControls, 7>
Foam::outputFilterOutputControl::outputControlNames_; Foam::outputFilterOutputControl::outputControlNames_;
@ -52,10 +53,12 @@ const Foam::NamedEnum<Foam::outputFilterOutputControl::outputControls, 6>
Foam::outputFilterOutputControl::outputFilterOutputControl Foam::outputFilterOutputControl::outputFilterOutputControl
( (
const Time& t, const Time& t,
const dictionary& dict const dictionary& dict,
const word& prefix
) )
: :
time_(t), time_(t),
prefix_(prefix),
outputControl_(ocTimeStep), outputControl_(ocTimeStep),
outputInterval_(0), outputInterval_(0),
outputTimeLastDump_(0), outputTimeLastDump_(0),
@ -75,9 +78,12 @@ Foam::outputFilterOutputControl::~outputFilterOutputControl()
void Foam::outputFilterOutputControl::read(const dictionary& dict) void Foam::outputFilterOutputControl::read(const dictionary& dict)
{ {
if (dict.found("outputControl")) const word controlName(prefix_ + "Control");
const word intervalName(prefix_ + "Interval");
if (dict.found(controlName))
{ {
outputControl_ = outputControlNames_.read(dict.lookup("outputControl")); outputControl_ = outputControlNames_.read(dict.lookup(controlName));
} }
else else
{ {
@ -88,13 +94,13 @@ void Foam::outputFilterOutputControl::read(const dictionary& dict)
{ {
case ocTimeStep: case ocTimeStep:
{ {
outputInterval_ = dict.lookupOrDefault<label>("outputInterval", 0); outputInterval_ = dict.lookupOrDefault<label>(intervalName, 0);
break; break;
} }
case ocOutputTime: case ocOutputTime:
{ {
outputInterval_ = dict.lookupOrDefault<label>("outputInterval", 1); outputInterval_ = dict.lookupOrDefault<label>(intervalName, 1);
break; break;
} }
@ -190,6 +196,11 @@ bool Foam::outputFilterOutputControl::output()
break; break;
} }
case ocNone:
{
return false;
}
default: default:
{ {
// this error should not actually be possible // this error should not actually be possible

View File

@ -61,7 +61,8 @@ public:
ocAdjustableTime, /*!< Adjust time step for dumping */ ocAdjustableTime, /*!< Adjust time step for dumping */
ocRunTime, /*!< run time for dumping */ ocRunTime, /*!< run time for dumping */
ocClockTime, /*!< clock time for dumping */ ocClockTime, /*!< clock time for dumping */
ocCpuTime /*!< cpu time for dumping */ ocCpuTime, /*!< cpu time for dumping */
ocNone /*!< no output */
}; };
@ -72,8 +73,11 @@ private:
//- Time object //- Time object
const Time& time_; const Time& time_;
//- Prefix
const word prefix_;
//- String representation of outputControls enums //- String representation of outputControls enums
static const NamedEnum<outputControls, 6> outputControlNames_; static const NamedEnum<outputControls, 7> outputControlNames_;
//- Type of output //- Type of output
outputControls outputControl_; outputControls outputControl_;
@ -101,7 +105,12 @@ public:
// Constructors // Constructors
//- Construct from Time object and dictionary //- Construct from Time object and dictionary
outputFilterOutputControl(const Time&, const dictionary&); outputFilterOutputControl
(
const Time&,
const dictionary&,
const word& prefix
);
//- Destructor //- Destructor

View File

@ -32,7 +32,7 @@ Description
<entryName> csvFile; <entryName> csvFile;
csvFileCoeffs csvFileCoeffs
{ {
nHeaderLines 4; nHeaderLine 4;
refColumn 0; // reference column index refColumn 0; // reference column index
componentColumns (1 2 3); // component column indices componentColumns (1 2 3); // component column indices
separator ","; // optional (defaults to ",") separator ","; // optional (defaults to ",")

View File

@ -3185,7 +3185,8 @@ Foam::labelList Foam::hexRef8::consistentSlowRefinement2
forAll(refineCell, cellI) forAll(refineCell, cellI)
{ {
if (refineCell.get(cellI)) // if (refineCell.get(cellI))
if (refineCell[cellI])
{ {
nRefined++; nRefined++;
} }
@ -3196,7 +3197,8 @@ Foam::labelList Foam::hexRef8::consistentSlowRefinement2
forAll(refineCell, cellI) forAll(refineCell, cellI)
{ {
if (refineCell.get(cellI)) // if (refineCell.get(cellI))
if (refineCell[cellI])
{ {
newCellsToRefine[nRefined++] = cellI; newCellsToRefine[nRefined++] = cellI;
} }

View File

@ -189,9 +189,11 @@ $(derivedFvPatchFields)/uniformJumpAMI/uniformJumpAMIFvPatchFields.C
$(derivedFvPatchFields)/uniformTotalPressure/uniformTotalPressureFvPatchScalarField.C $(derivedFvPatchFields)/uniformTotalPressure/uniformTotalPressureFvPatchScalarField.C
$(derivedFvPatchFields)/variableHeightFlowRate/variableHeightFlowRateFvPatchField.C $(derivedFvPatchFields)/variableHeightFlowRate/variableHeightFlowRateFvPatchField.C
$(derivedFvPatchFields)/variableHeightFlowRateInletVelocity/variableHeightFlowRateInletVelocityFvPatchVectorField.C $(derivedFvPatchFields)/variableHeightFlowRateInletVelocity/variableHeightFlowRateInletVelocityFvPatchVectorField.C
$(derivedFvPatchFields)/outletPhaseMeanVelocity/outletPhaseMeanVelocityFvPatchVectorField.C
$(derivedFvPatchFields)/waveTransmissive/waveTransmissiveFvPatchFields.C $(derivedFvPatchFields)/waveTransmissive/waveTransmissiveFvPatchFields.C
$(derivedFvPatchFields)/waveSurfacePressure/waveSurfacePressureFvPatchScalarField.C $(derivedFvPatchFields)/waveSurfacePressure/waveSurfacePressureFvPatchScalarField.C
$(derivedFvPatchFields)/interstitialInletVelocity/interstitialInletVelocityFvPatchVectorField.C $(derivedFvPatchFields)/interstitialInletVelocity/interstitialInletVelocityFvPatchVectorField.C
$(derivedFvPatchFields)/prghPressure/prghPressureFvPatchScalarField.C
fvsPatchFields = fields/fvsPatchFields fvsPatchFields = fields/fvsPatchFields
$(fvsPatchFields)/fvsPatchField/fvsPatchFields.C $(fvsPatchFields)/fvsPatchField/fvsPatchFields.C
@ -376,6 +378,7 @@ $(laplacianSchemes)/gaussLaplacianScheme/gaussLaplacianSchemes.C
finiteVolume/fvc/fvcMeshPhi.C finiteVolume/fvc/fvcMeshPhi.C
finiteVolume/fvc/fvcSmooth/fvcSmooth.C finiteVolume/fvc/fvcSmooth/fvcSmooth.C
finiteVolume/fvc/fvcReconstructMag.C
general = cfdTools/general general = cfdTools/general
$(general)/findRefCell/findRefCell.C $(general)/findRefCell/findRefCell.C

View File

@ -10,3 +10,17 @@ bool alphaOuterCorrectors
( (
alphaControls.lookupOrDefault<Switch>("alphaOuterCorrectors", false) alphaControls.lookupOrDefault<Switch>("alphaOuterCorrectors", false)
); );
// Apply the compression correction from the previous iteration
// Improves efficiency for steady-simulations but can only be applied
// once the alpha field is reasonably steady, i.e. fully developed
bool alphaApplyPrevCorr
(
alphaControls.lookupOrDefault<Switch>("alphaApplyPrevCorr", false)
);
// Isotropic compression coefficient
scalar icAlpha
(
alphaControls.lookupOrDefault<scalar>("icAlpha", 0)
);

View File

@ -0,0 +1,188 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "outletPhaseMeanVelocityFvPatchVectorField.H"
#include "volFields.H"
#include "addToRunTimeSelectionTable.H"
#include "fvPatchFieldMapper.H"
#include "surfaceFields.H"
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::outletPhaseMeanVelocityFvPatchVectorField
::outletPhaseMeanVelocityFvPatchVectorField
(
const fvPatch& p,
const DimensionedField<vector, volMesh>& iF
)
:
mixedFvPatchField<vector>(p, iF),
Umean_(0),
alphaName_("none")
{
refValue() = vector::zero;
refGrad() = vector::zero;
valueFraction() = 0.0;
}
Foam::outletPhaseMeanVelocityFvPatchVectorField
::outletPhaseMeanVelocityFvPatchVectorField
(
const outletPhaseMeanVelocityFvPatchVectorField& ptf,
const fvPatch& p,
const DimensionedField<vector, volMesh>& iF,
const fvPatchFieldMapper& mapper
)
:
mixedFvPatchField<vector>(ptf, p, iF, mapper),
Umean_(ptf.Umean_),
alphaName_(ptf.alphaName_)
{}
Foam::outletPhaseMeanVelocityFvPatchVectorField
::outletPhaseMeanVelocityFvPatchVectorField
(
const fvPatch& p,
const DimensionedField<vector, volMesh>& iF,
const dictionary& dict
)
:
mixedFvPatchField<vector>(p, iF),
Umean_(readScalar(dict.lookup("Umean"))),
alphaName_(dict.lookup("alpha"))
{
refValue() = vector::zero;
refGrad() = vector::zero;
valueFraction() = 0.0;
if (dict.found("value"))
{
fvPatchVectorField::operator=
(
vectorField("value", dict, p.size())
);
}
else
{
fvPatchVectorField::operator=(patchInternalField());
}
}
Foam::outletPhaseMeanVelocityFvPatchVectorField
::outletPhaseMeanVelocityFvPatchVectorField
(
const outletPhaseMeanVelocityFvPatchVectorField& ptf
)
:
mixedFvPatchField<vector>(ptf),
Umean_(ptf.Umean_),
alphaName_(ptf.alphaName_)
{}
Foam::outletPhaseMeanVelocityFvPatchVectorField
::outletPhaseMeanVelocityFvPatchVectorField
(
const outletPhaseMeanVelocityFvPatchVectorField& ptf,
const DimensionedField<vector, volMesh>& iF
)
:
mixedFvPatchField<vector>(ptf, iF),
Umean_(ptf.Umean_),
alphaName_(ptf.alphaName_)
{}
// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * //
void Foam::outletPhaseMeanVelocityFvPatchVectorField::updateCoeffs()
{
if (updated())
{
return;
}
scalarField alphap =
patch().lookupPatchField<volScalarField, scalar>(alphaName_);
alphap = max(alphap, scalar(0));
alphap = min(alphap, scalar(1));
// Get the patchInternalField (zero-gradient field)
vectorField Uzg(patchInternalField());
// Calculate the phase mean zero-gradient velocity
scalar Uzgmean =
gSum(alphap*(patch().Sf() & Uzg))
/gSum(alphap*patch().magSf());
// Set the refValue and valueFraction to adjust the boundary field
// such that the phase mean is Umean_
if (Uzgmean >= Umean_)
{
refValue() = vector::zero;
valueFraction() = 1.0 - Umean_/Uzgmean;
}
else
{
refValue() = (Umean_ + Uzgmean)*patch().nf();
valueFraction() = 1.0 - Uzgmean/Umean_;
}
mixedFvPatchField<vector>::updateCoeffs();
}
void Foam::outletPhaseMeanVelocityFvPatchVectorField::write
(
Ostream& os
) const
{
fvPatchField<vector>::write(os);
os.writeKeyword("Umean") << Umean_
<< token::END_STATEMENT << nl;
os.writeKeyword("alpha") << alphaName_
<< token::END_STATEMENT << nl;
writeEntry("value", os);
}
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
makePatchTypeField
(
fvPatchVectorField,
outletPhaseMeanVelocityFvPatchVectorField
);
}
// ************************************************************************* //

View File

@ -0,0 +1,197 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
Class
Foam::outletPhaseMeanVelocityFvPatchVectorField
Group
grpOutletBoundaryConditions
Description
This boundary condition adjusts the velocity for the given phase to achieve
the specified mean thus causing the phase-fraction to adjust according to
the mass flow rate.
Typical usage is as the outlet condition for a towing-tank ship simulation
to maintain the outlet water level at the level as the inlet.
\heading Patch usage
\table
Property | Description | Required | Default value
Umean | mean velocity normal to the boundary [m/s] | yes |
alpha | phase-fraction field | yes |
\endtable
Example of the boundary condition specification:
\verbatim
myPatch
{
type outletPhaseMeanVelocity;
Umean 1.2;
alpha alpha.water;
value uniform (1.2 0 0);
}
\endverbatim
SeeAlso
Foam::mixedFvPatchField
Foam::variableHeightFlowRateInletVelocityFvPatchVectorField
SourceFiles
outletPhaseMeanVelocityFvPatchVectorField.C
\*---------------------------------------------------------------------------*/
#ifndef outletPhaseMeanVelocityFvPatchVectorField_H
#define outletPhaseMeanVelocityFvPatchVectorField_H
#include "mixedFvPatchFields.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
/*---------------------------------------------------------------------------*\
Class outletPhaseMeanVelocityFvPatchVectorField Declaration
\*---------------------------------------------------------------------------*/
class outletPhaseMeanVelocityFvPatchVectorField
:
public mixedFvPatchVectorField
{
// Private data
//- Inlet integral flow rate
scalar Umean_;
//- Name of the phase-fraction field
word alphaName_;
public:
//- Runtime type information
TypeName("outletPhaseMeanVelocity");
// Constructors
//- Construct from patch and internal field
outletPhaseMeanVelocityFvPatchVectorField
(
const fvPatch&,
const DimensionedField<vector, volMesh>&
);
//- Construct from patch, internal field and dictionary
outletPhaseMeanVelocityFvPatchVectorField
(
const fvPatch&,
const DimensionedField<vector, volMesh>&,
const dictionary&
);
//- Construct by mapping given
// outletPhaseMeanVelocityFvPatchVectorField
// onto a new patch
outletPhaseMeanVelocityFvPatchVectorField
(
const outletPhaseMeanVelocityFvPatchVectorField&,
const fvPatch&,
const DimensionedField<vector, volMesh>&,
const fvPatchFieldMapper&
);
//- Construct as copy
outletPhaseMeanVelocityFvPatchVectorField
(
const outletPhaseMeanVelocityFvPatchVectorField&
);
//- Construct and return a clone
virtual tmp<fvPatchVectorField> clone() const
{
return tmp<fvPatchVectorField>
(
new outletPhaseMeanVelocityFvPatchVectorField(*this)
);
}
//- Construct as copy setting internal field reference
outletPhaseMeanVelocityFvPatchVectorField
(
const outletPhaseMeanVelocityFvPatchVectorField&,
const DimensionedField<vector, volMesh>&
);
//- Construct and return a clone setting internal field reference
virtual tmp<fvPatchVectorField> clone
(
const DimensionedField<vector, volMesh>& iF
) const
{
return tmp<fvPatchVectorField>
(
new outletPhaseMeanVelocityFvPatchVectorField
(
*this,
iF
)
);
}
// Member functions
// Access
//- Return the flux
scalar Umean() const
{
return Umean_;
}
//- Return reference to the flux to allow adjustment
scalar& Umean()
{
return Umean_;
}
//- Update the coefficients associated with the patch field
virtual void updateCoeffs();
//- Write
virtual void write(Ostream&) const;
};
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif
// ************************************************************************* //

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011-2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -41,8 +41,7 @@ pressureInletOutletParSlipVelocityFvPatchVectorField
: :
mixedFvPatchVectorField(p, iF), mixedFvPatchVectorField(p, iF),
phiName_("phi"), phiName_("phi"),
rhoName_("rho"), rhoName_("rho")
UName_("U")
{ {
refValue() = *this; refValue() = *this;
refGrad() = vector::zero; refGrad() = vector::zero;
@ -61,8 +60,7 @@ pressureInletOutletParSlipVelocityFvPatchVectorField
: :
mixedFvPatchVectorField(ptf, p, iF, mapper), mixedFvPatchVectorField(ptf, p, iF, mapper),
phiName_(ptf.phiName_), phiName_(ptf.phiName_),
rhoName_(ptf.rhoName_), rhoName_(ptf.rhoName_)
UName_(ptf.UName_)
{} {}
@ -76,8 +74,7 @@ pressureInletOutletParSlipVelocityFvPatchVectorField
: :
mixedFvPatchVectorField(p, iF), mixedFvPatchVectorField(p, iF),
phiName_(dict.lookupOrDefault<word>("phi", "phi")), phiName_(dict.lookupOrDefault<word>("phi", "phi")),
rhoName_(dict.lookupOrDefault<word>("rho", "rho")), rhoName_(dict.lookupOrDefault<word>("rho", "rho"))
UName_(dict.lookupOrDefault<word>("U", "U"))
{ {
fvPatchVectorField::operator=(vectorField("value", dict, p.size())); fvPatchVectorField::operator=(vectorField("value", dict, p.size()));
refValue() = *this; refValue() = *this;
@ -94,8 +91,7 @@ pressureInletOutletParSlipVelocityFvPatchVectorField
: :
mixedFvPatchVectorField(pivpvf), mixedFvPatchVectorField(pivpvf),
phiName_(pivpvf.phiName_), phiName_(pivpvf.phiName_),
rhoName_(pivpvf.rhoName_), rhoName_(pivpvf.rhoName_)
UName_(pivpvf.UName_)
{} {}
@ -108,8 +104,7 @@ pressureInletOutletParSlipVelocityFvPatchVectorField
: :
mixedFvPatchVectorField(pivpvf, iF), mixedFvPatchVectorField(pivpvf, iF),
phiName_(pivpvf.phiName_), phiName_(pivpvf.phiName_),
rhoName_(pivpvf.rhoName_), rhoName_(pivpvf.rhoName_)
UName_(pivpvf.UName_)
{} {}
@ -122,8 +117,6 @@ void Foam::pressureInletOutletParSlipVelocityFvPatchVectorField::updateCoeffs()
return; return;
} }
const label patchI = patch().index();
const surfaceScalarField& phi = const surfaceScalarField& phi =
db().lookupObject<surfaceScalarField>(phiName_); db().lookupObject<surfaceScalarField>(phiName_);
@ -131,23 +124,22 @@ void Foam::pressureInletOutletParSlipVelocityFvPatchVectorField::updateCoeffs()
patch().patchField<surfaceScalarField, scalar>(phi); patch().patchField<surfaceScalarField, scalar>(phi);
tmp<vectorField> n = patch().nf(); tmp<vectorField> n = patch().nf();
const Field<scalar>& magS = patch().magSf(); const Field<scalar>& magSf = patch().magSf();
const volVectorField& U = db().lookupObject<volVectorField>(UName_); // Get the tangential component from the internalField (zero-gradient)
vectorField Ut(patchInternalField());
vectorField Uc(U.boundaryField()[patchI].patchInternalField()); Ut -= n()*(Ut & n());
Uc -= n()*(Uc & n());
if (phi.dimensions() == dimVelocity*dimArea) if (phi.dimensions() == dimVelocity*dimArea)
{ {
refValue() = Uc + n*phip/magS; refValue() = Ut + n*phip/magSf;
} }
else if (phi.dimensions() == dimDensity*dimVelocity*dimArea) else if (phi.dimensions() == dimDensity*dimVelocity*dimArea)
{ {
const fvPatchField<scalar>& rhop = const fvPatchField<scalar>& rhop =
patch().lookupPatchField<volScalarField, scalar>(rhoName_); patch().lookupPatchField<volScalarField, scalar>(rhoName_);
refValue() = Uc + n*phip/(rhop*magS); refValue() = Ut + n*phip/(rhop*magSf);
} }
else else
{ {
@ -176,7 +168,6 @@ void Foam::pressureInletOutletParSlipVelocityFvPatchVectorField::write
fvPatchVectorField::write(os); fvPatchVectorField::write(os);
writeEntryIfDifferent<word>(os, "phi", "phi", phiName_); writeEntryIfDifferent<word>(os, "phi", "phi", phiName_);
writeEntryIfDifferent<word>(os, "rho", "rho", rhoName_); writeEntryIfDifferent<word>(os, "rho", "rho", rhoName_);
writeEntryIfDifferent<word>(os, "U", "U", UName_);
writeEntry("value", os); writeEntry("value", os);
} }
@ -188,11 +179,7 @@ void Foam::pressureInletOutletParSlipVelocityFvPatchVectorField::operator=
const fvPatchField<vector>& pvf const fvPatchField<vector>& pvf
) )
{ {
fvPatchField<vector>::operator= fvPatchField<vector>::operator=(pvf);
(
valueFraction()*(patch().nf()*(patch().nf() & pvf))
+ (1 - valueFraction())*pvf
);
} }

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011-2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -41,7 +41,6 @@ Description
Property | Description | Required | Default value Property | Description | Required | Default value
phi | flux field name | no | phi phi | flux field name | no | phi
rho | density field name | no | rho rho | density field name | no | rho
U | velocity field name | no | U
\endtable \endtable
Example of the boundary condition specification: Example of the boundary condition specification:
@ -95,9 +94,6 @@ class pressureInletOutletParSlipVelocityFvPatchVectorField
//- Density field name //- Density field name
word rhoName_; word rhoName_;
//- Velocity field name
word UName_;
public: public:

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -25,10 +25,10 @@ License
#include "pressureInletOutletVelocityFvPatchVectorField.H" #include "pressureInletOutletVelocityFvPatchVectorField.H"
#include "addToRunTimeSelectionTable.H" #include "addToRunTimeSelectionTable.H"
#include "fvPatchFieldMapper.H"
#include "volFields.H" #include "volFields.H"
#include "surfaceFields.H" #include "surfaceFields.H"
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::pressureInletOutletVelocityFvPatchVectorField:: Foam::pressureInletOutletVelocityFvPatchVectorField::
@ -38,12 +38,14 @@ pressureInletOutletVelocityFvPatchVectorField
const DimensionedField<vector, volMesh>& iF const DimensionedField<vector, volMesh>& iF
) )
: :
directionMixedFvPatchVectorField(p, iF), mixedFvPatchVectorField(p, iF),
phiName_("phi") phiName_("phi"),
rhoName_("rho"),
applyTangentialVelocity_(false)
{ {
refValue() = vector::zero; refValue() = *this;
refGrad() = vector::zero; refGrad() = vector::zero;
valueFraction() = symmTensor::zero; valueFraction() = 0.0;
} }
@ -56,10 +58,12 @@ pressureInletOutletVelocityFvPatchVectorField
const fvPatchFieldMapper& mapper const fvPatchFieldMapper& mapper
) )
: :
directionMixedFvPatchVectorField(ptf, p, iF, mapper), mixedFvPatchVectorField(ptf, p, iF, mapper),
phiName_(ptf.phiName_) phiName_(ptf.phiName_),
rhoName_(ptf.rhoName_),
applyTangentialVelocity_(ptf.applyTangentialVelocity_)
{ {
if (ptf.tangentialVelocity_.size()) if (applyTangentialVelocity_)
{ {
tangentialVelocity_ = mapper(ptf.tangentialVelocity_); tangentialVelocity_ = mapper(ptf.tangentialVelocity_);
} }
@ -74,25 +78,26 @@ pressureInletOutletVelocityFvPatchVectorField
const dictionary& dict const dictionary& dict
) )
: :
directionMixedFvPatchVectorField(p, iF), mixedFvPatchVectorField(p, iF),
phiName_(dict.lookupOrDefault<word>("phi", "phi")) phiName_(dict.lookupOrDefault<word>("phi", "phi")),
rhoName_(dict.lookupOrDefault<word>("rho", "rho")),
applyTangentialVelocity_(false)
{ {
fvPatchVectorField::operator=(vectorField("value", dict, p.size())); fvPatchVectorField::operator=(vectorField("value", dict, p.size()));
if (dict.found("tangentialVelocity")) if (dict.found("tangentialVelocity"))
{ {
applyTangentialVelocity_ = true;
setTangentialVelocity setTangentialVelocity
( (
vectorField("tangentialVelocity", dict, p.size()) vectorField("tangentialVelocity", dict, p.size())
); );
} }
else
{
refValue() = vector::zero;
}
refValue() = *this;
refGrad() = vector::zero; refGrad() = vector::zero;
valueFraction() = symmTensor::zero; valueFraction() = 0.0;
} }
@ -102,9 +107,11 @@ pressureInletOutletVelocityFvPatchVectorField
const pressureInletOutletVelocityFvPatchVectorField& pivpvf const pressureInletOutletVelocityFvPatchVectorField& pivpvf
) )
: :
directionMixedFvPatchVectorField(pivpvf), mixedFvPatchVectorField(pivpvf),
phiName_(pivpvf.phiName_), phiName_(pivpvf.phiName_),
tangentialVelocity_(pivpvf.tangentialVelocity_) rhoName_(pivpvf.rhoName_),
tangentialVelocity_(pivpvf.tangentialVelocity_),
applyTangentialVelocity_(pivpvf.applyTangentialVelocity_)
{} {}
@ -115,9 +122,11 @@ pressureInletOutletVelocityFvPatchVectorField
const DimensionedField<vector, volMesh>& iF const DimensionedField<vector, volMesh>& iF
) )
: :
directionMixedFvPatchVectorField(pivpvf, iF), mixedFvPatchVectorField(pivpvf, iF),
phiName_(pivpvf.phiName_), phiName_(pivpvf.phiName_),
tangentialVelocity_(pivpvf.tangentialVelocity_) rhoName_(pivpvf.rhoName_),
tangentialVelocity_(pivpvf.tangentialVelocity_),
applyTangentialVelocity_(pivpvf.applyTangentialVelocity_)
{} {}
@ -126,9 +135,10 @@ pressureInletOutletVelocityFvPatchVectorField
void Foam::pressureInletOutletVelocityFvPatchVectorField:: void Foam::pressureInletOutletVelocityFvPatchVectorField::
setTangentialVelocity(const vectorField& tangentialVelocity) setTangentialVelocity(const vectorField& tangentialVelocity)
{ {
applyTangentialVelocity_ = true;
tangentialVelocity_ = tangentialVelocity; tangentialVelocity_ = tangentialVelocity;
const vectorField n(patch().nf()); vectorField n(patch().nf());
refValue() = tangentialVelocity_ - n*(n & tangentialVelocity_); tangentialVelocity_ -= n*(n & tangentialVelocity_);
} }
@ -137,8 +147,8 @@ void Foam::pressureInletOutletVelocityFvPatchVectorField::autoMap
const fvPatchFieldMapper& m const fvPatchFieldMapper& m
) )
{ {
directionMixedFvPatchVectorField::autoMap(m); mixedFvPatchVectorField::autoMap(m);
if (tangentialVelocity_.size()) if (applyTangentialVelocity_)
{ {
tangentialVelocity_.autoMap(m); tangentialVelocity_.autoMap(m);
} }
@ -151,9 +161,9 @@ void Foam::pressureInletOutletVelocityFvPatchVectorField::rmap
const labelList& addr const labelList& addr
) )
{ {
directionMixedFvPatchVectorField::rmap(ptf, addr); mixedFvPatchVectorField::rmap(ptf, addr);
if (tangentialVelocity_.size()) if (applyTangentialVelocity_)
{ {
const pressureInletOutletVelocityFvPatchVectorField& tiptf = const pressureInletOutletVelocityFvPatchVectorField& tiptf =
refCast<const pressureInletOutletVelocityFvPatchVectorField>(ptf); refCast<const pressureInletOutletVelocityFvPatchVectorField>(ptf);
@ -170,25 +180,67 @@ void Foam::pressureInletOutletVelocityFvPatchVectorField::updateCoeffs()
return; return;
} }
const surfaceScalarField& phi =
db().lookupObject<surfaceScalarField>(phiName_);
const fvsPatchField<scalar>& phip = const fvsPatchField<scalar>& phip =
patch().lookupPatchField<surfaceScalarField, scalar>(phiName_); patch().patchField<surfaceScalarField, scalar>(phi);
valueFraction() = neg(phip)*(I - sqr(patch().nf())); vectorField n(patch().nf());
const Field<scalar>& magSf = patch().magSf();
directionMixedFvPatchVectorField::updateCoeffs(); if (phi.dimensions() == dimVelocity*dimArea)
directionMixedFvPatchVectorField::evaluate(); {
refValue() = n*phip/magSf;
}
else if (phi.dimensions() == dimDensity*dimVelocity*dimArea)
{
const fvPatchField<scalar>& rhop =
patch().lookupPatchField<volScalarField, scalar>(rhoName_);
refValue() = n*phip/(rhop*magSf);
}
else
{
FatalErrorIn
(
"pressureInletOutletVelocityFvPatchVectorField::"
"updateCoeffs()"
) << "dimensions of phi are not correct" << nl
<< " on patch " << this->patch().name()
<< " of field " << this->dimensionedInternalField().name()
<< " in file " << this->dimensionedInternalField().objectPath()
<< exit(FatalError);
}
if (applyTangentialVelocity_)
{
// Adjust the tangential velocity to conserve kinetic energy
// of the entrained fluid
// scalarField magSqrUt(magSqr(tangentialVelocity_));
// scalarField scale
// (
// sqrt(max(magSqrUt - magSqr(refValue()), scalar(0))/magSqrUt)
// );
// refValue() += scale*tangentialVelocity_;
refValue() += tangentialVelocity_;
}
valueFraction() = 1.0 - pos(phip);
mixedFvPatchVectorField::updateCoeffs();
} }
void Foam::pressureInletOutletVelocityFvPatchVectorField::write void Foam::pressureInletOutletVelocityFvPatchVectorField::write
( (
Ostream& os Ostream& os
) ) const
const
{ {
fvPatchVectorField::write(os); fvPatchVectorField::write(os);
writeEntryIfDifferent<word>(os, "phi", "phi", phiName_); writeEntryIfDifferent<word>(os, "phi", "phi", phiName_);
if (tangentialVelocity_.size()) writeEntryIfDifferent<word>(os, "rho", "rho", rhoName_);
if (applyTangentialVelocity_)
{ {
tangentialVelocity_.writeEntry("tangentialVelocity", os); tangentialVelocity_.writeEntry("tangentialVelocity", os);
} }
@ -203,9 +255,7 @@ void Foam::pressureInletOutletVelocityFvPatchVectorField::operator=
const fvPatchField<vector>& pvf const fvPatchField<vector>& pvf
) )
{ {
tmp<vectorField> normalValue = transform(valueFraction(), refValue()); fvPatchField<vector>::operator=(pvf);
tmp<vectorField> transformGradValue = transform(I - valueFraction(), pvf);
fvPatchField<vector>::operator=(normalValue + transformGradValue);
} }

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation \\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -25,21 +25,21 @@ Class
Foam::pressureInletOutletVelocityFvPatchVectorField Foam::pressureInletOutletVelocityFvPatchVectorField
Group Group
grpInletletBoundaryConditions grpOutletBoundaryConditions grpInletBoundaryConditions grpOutletBoundaryConditions
Description Description
This velocity inlet/outlet boundary condition is applied to pressure This velocity inlet/outlet boundary condition is applied to pressure
boundaries where the pressure is specified. A zero-gradient condition is boundaries where the pressure is specified. A zero-gradient condition is
applied for outflow (as defined by the flux); for inflow, the velocity is applied for outflow (as defined by the flux); for inflow, the velocity is
obtained from the patch-face normal component of the internal-cell value. obtained from the patch-face normal component of the internal-cell value and
the tangential patch velocity can be optionally specified.
The tangential patch velocity can be optionally specified.
\heading Patch usage \heading Patch usage
\table \table
Property | Description | Required | Default value Property | Description | Required | Default value
phi | flux field name | no | phi phi | flux field name | no | phi
rho | density field name | no | rho
tangentialVelocity | tangential velocity field | no | tangentialVelocity | tangential velocity field | no |
\endtable \endtable
@ -49,6 +49,7 @@ Description
{ {
type pressureInletOutletVelocity; type pressureInletOutletVelocity;
phi phi; phi phi;
rho rho;
tangentialVelocity uniform (0 0 0); tangentialVelocity uniform (0 0 0);
value uniform 0; value uniform 0;
} }
@ -69,7 +70,7 @@ SourceFiles
#define pressureInletOutletVelocityFvPatchVectorField_H #define pressureInletOutletVelocityFvPatchVectorField_H
#include "fvPatchFields.H" #include "fvPatchFields.H"
#include "directionMixedFvPatchFields.H" #include "mixedFvPatchFields.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
@ -82,16 +83,24 @@ namespace Foam
class pressureInletOutletVelocityFvPatchVectorField class pressureInletOutletVelocityFvPatchVectorField
: :
public directionMixedFvPatchVectorField public mixedFvPatchVectorField
{ {
// Private data // Private data
//- Flux field name //- Flux field name
word phiName_; word phiName_;
//- Density field name
word rhoName_;
protected:
//- Optional tangential velocity component //- Optional tangential velocity component
vectorField tangentialVelocity_; vectorField tangentialVelocity_;
bool applyTangentialVelocity_;
public: public:
@ -108,16 +117,9 @@ public:
const DimensionedField<vector, volMesh>& const DimensionedField<vector, volMesh>&
); );
//- Construct from patch, internal field and dictionary
pressureInletOutletVelocityFvPatchVectorField
(
const fvPatch&,
const DimensionedField<vector, volMesh>&,
const dictionary&
);
//- Construct by mapping given //- Construct by mapping given
// pressureInletOutletVelocityFvPatchVectorField onto a new patch // pressureInletOutletVelocityFvPatchVectorField
// onto a new patch
pressureInletOutletVelocityFvPatchVectorField pressureInletOutletVelocityFvPatchVectorField
( (
const pressureInletOutletVelocityFvPatchVectorField&, const pressureInletOutletVelocityFvPatchVectorField&,
@ -126,6 +128,14 @@ public:
const fvPatchFieldMapper& const fvPatchFieldMapper&
); );
//- Construct from patch, internal field and dictionary
pressureInletOutletVelocityFvPatchVectorField
(
const fvPatch&,
const DimensionedField<vector, volMesh>&,
const dictionary&
);
//- Construct as copy //- Construct as copy
pressureInletOutletVelocityFvPatchVectorField pressureInletOutletVelocityFvPatchVectorField
( (
@ -137,7 +147,10 @@ public:
{ {
return tmp<fvPatchVectorField> return tmp<fvPatchVectorField>
( (
new pressureInletOutletVelocityFvPatchVectorField(*this) new pressureInletOutletVelocityFvPatchVectorField
(
*this
)
); );
} }
@ -156,7 +169,11 @@ public:
{ {
return tmp<fvPatchVectorField> return tmp<fvPatchVectorField>
( (
new pressureInletOutletVelocityFvPatchVectorField(*this, iF) new pressureInletOutletVelocityFvPatchVectorField
(
*this,
iF
)
); );
} }
@ -177,6 +194,18 @@ public:
return phiName_; return phiName_;
} }
//- Return the name of rho
const word& rhoName() const
{
return rhoName_;
}
//- Return reference to the name of rho to allow adjustment
word& rhoName()
{
return rhoName_;
}
//- Return the tangential velocity //- Return the tangential velocity
const vectorField& tangentialVelocity() const const vectorField& tangentialVelocity() const
{ {

View File

@ -0,0 +1,185 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "prghPressureFvPatchScalarField.H"
#include "addToRunTimeSelectionTable.H"
#include "fvPatchFieldMapper.H"
#include "volFields.H"
#include "uniformDimensionedFields.H"
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::prghPressureFvPatchScalarField::
prghPressureFvPatchScalarField
(
const fvPatch& p,
const DimensionedField<scalar, volMesh>& iF
)
:
fixedValueFvPatchScalarField(p, iF),
rhoName_("rho"),
p_(p.size(), 0.0)
{}
Foam::prghPressureFvPatchScalarField::
prghPressureFvPatchScalarField
(
const fvPatch& p,
const DimensionedField<scalar, volMesh>& iF,
const dictionary& dict
)
:
fixedValueFvPatchScalarField(p, iF),
rhoName_(dict.lookupOrDefault<word>("rhoName", "rho")),
p_("p", dict, p.size())
{
if (dict.found("value"))
{
fvPatchScalarField::operator=
(
scalarField("value", dict, p.size())
);
}
else
{
fvPatchField<scalar>::operator=(p_);
}
}
Foam::prghPressureFvPatchScalarField::
prghPressureFvPatchScalarField
(
const prghPressureFvPatchScalarField& ptf,
const fvPatch& p,
const DimensionedField<scalar, volMesh>& iF,
const fvPatchFieldMapper& mapper
)
:
fixedValueFvPatchScalarField(ptf, p, iF, mapper),
rhoName_(ptf.rhoName_),
p_(ptf.p_, mapper)
{}
Foam::prghPressureFvPatchScalarField::
prghPressureFvPatchScalarField
(
const prghPressureFvPatchScalarField& ptf
)
:
fixedValueFvPatchScalarField(ptf),
rhoName_(ptf.rhoName_),
p_(ptf.p_)
{}
Foam::prghPressureFvPatchScalarField::
prghPressureFvPatchScalarField
(
const prghPressureFvPatchScalarField& ptf,
const DimensionedField<scalar, volMesh>& iF
)
:
fixedValueFvPatchScalarField(ptf, iF),
rhoName_(ptf.rhoName_),
p_(ptf.p_)
{}
// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * //
void Foam::prghPressureFvPatchScalarField::autoMap
(
const fvPatchFieldMapper& m
)
{
fixedValueFvPatchScalarField::autoMap(m);
p_.autoMap(m);
}
void Foam::prghPressureFvPatchScalarField::rmap
(
const fvPatchScalarField& ptf,
const labelList& addr
)
{
fixedValueFvPatchScalarField::rmap(ptf, addr);
const prghPressureFvPatchScalarField& tiptf =
refCast<const prghPressureFvPatchScalarField>(ptf);
p_.rmap(tiptf.p_, addr);
}
void Foam::prghPressureFvPatchScalarField::updateCoeffs()
{
if (updated())
{
return;
}
const scalarField& rhop = patch().lookupPatchField<volScalarField, scalar>
(
rhoName_
);
const uniformDimensionedVectorField& g =
db().lookupObject<uniformDimensionedVectorField>("g");
operator==(p_ - rhop*((g.value() & patch().Cf())));
fixedValueFvPatchScalarField::updateCoeffs();
}
void Foam::prghPressureFvPatchScalarField::write(Ostream& os) const
{
fvPatchScalarField::write(os);
if (rhoName_ != "rho")
{
os.writeKeyword("rhoName")
<< rhoName_ << token::END_STATEMENT << nl;
}
p_.writeEntry("p", os);
writeEntry("value", os);
}
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
makePatchTypeField
(
fvPatchScalarField,
prghPressureFvPatchScalarField
);
}
// ************************************************************************* //

View File

@ -0,0 +1,236 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
Class
Foam::prghPressureFvPatchScalarField
Group
grpGenericBoundaryConditions
Description
This boundary condition provides static pressure condition for p_rgh,
calculated as:
\f[
p_rgh = p - \rho g h
\f]
where
\vartable
p_rgh | Pseudo hydrostatic pressure [Pa]
p | Static pressure [Pa]
h | Height in the opposite direction to gravity
\rho | density
g | acceleration due to gravity [m/s2]
\endtable
\heading Patch usage
\table
Property | Description | Required | Default value
rhoName | rho field name | no | rho
p | static pressure | yes |
\endtable
Example of the boundary condition specification:
\verbatim
myPatch
{
type prghPressure;
rhoName rho;
p uniform 0;
value uniform 0; // optional initial value
}
\endverbatim
SeeAlso
Foam::fixedValueFvPatchScalarField
SourceFiles
prghPressureFvPatchScalarField.C
\*---------------------------------------------------------------------------*/
#ifndef prghPressureFvPatchScalarField_H
#define prghPressureFvPatchScalarField_H
#include "fixedValueFvPatchFields.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
/*---------------------------------------------------------------------------*\
Class prghPressureFvPatchScalarField Declaration
\*---------------------------------------------------------------------------*/
class prghPressureFvPatchScalarField
:
public fixedValueFvPatchScalarField
{
protected:
// Protected data
//- Name of phase-fraction field
word rhoName_;
//- Static pressure
scalarField p_;
public:
//- Runtime type information
TypeName("prghPressure");
// Constructors
//- Construct from patch and internal field
prghPressureFvPatchScalarField
(
const fvPatch&,
const DimensionedField<scalar, volMesh>&
);
//- Construct from patch, internal field and dictionary
prghPressureFvPatchScalarField
(
const fvPatch&,
const DimensionedField<scalar, volMesh>&,
const dictionary&
);
//- Construct by mapping given
// prghPressureFvPatchScalarField onto a new patch
prghPressureFvPatchScalarField
(
const prghPressureFvPatchScalarField&,
const fvPatch&,
const DimensionedField<scalar, volMesh>&,
const fvPatchFieldMapper&
);
//- Construct as copy
prghPressureFvPatchScalarField
(
const prghPressureFvPatchScalarField&
);
//- Construct and return a clone
virtual tmp<fvPatchScalarField> clone() const
{
return tmp<fvPatchScalarField >
(
new prghPressureFvPatchScalarField(*this)
);
}
//- Construct as copy setting internal field reference
prghPressureFvPatchScalarField
(
const prghPressureFvPatchScalarField&,
const DimensionedField<scalar, volMesh>&
);
//- Construct and return a clone setting internal field reference
virtual tmp<fvPatchScalarField> clone
(
const DimensionedField<scalar, volMesh>& iF
) const
{
return tmp<fvPatchScalarField>
(
new prghPressureFvPatchScalarField(*this, iF)
);
}
// Member functions
// Access
//- Return the rhoName
const word& rhoName() const
{
return rhoName_;
}
//- Return reference to the rhoName to allow adjustment
word& rhoName()
{
return rhoName_;
}
//- Return the static pressure
const scalarField& p() const
{
return p_;
}
//- Return reference to the static pressure to allow adjustment
scalarField& p()
{
return p_;
}
// Mapping functions
//- Map (and resize as needed) from self given a mapping object
virtual void autoMap
(
const fvPatchFieldMapper&
);
//- Reverse map the given fvPatchField onto this fvPatchField
virtual void rmap
(
const fvPatchScalarField&,
const labelList&
);
// Evaluation functions
//- Update the coefficients associated with the patch field
virtual void updateCoeffs();
//- Write
virtual void write(Ostream&) const;
};
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif
// ************************************************************************* //

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -33,17 +33,17 @@ License
void Foam::rotatingPressureInletOutletVelocityFvPatchVectorField:: void Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::
calcTangentialVelocity() calcTangentialVelocity()
{ {
applyTangentialVelocity_ = true;
const scalar t = this->db().time().timeOutputValue(); const scalar t = this->db().time().timeOutputValue();
vector om = omega_->value(t); vector om = omega_->value(t);
vector axisHat = om/mag(om); vector axisHat = om/mag(om);
const vectorField tangentialVelocity tangentialVelocity_ =
( (-om) ^ (patch().Cf() - axisHat*(axisHat & patch().Cf()));
(-om) ^ (patch().Cf() - axisHat*(axisHat & patch().Cf()))
);
const vectorField n(patch().nf()); const vectorField n(patch().nf());
refValue() = tangentialVelocity - n*(n & tangentialVelocity); tangentialVelocity_ -= n*(n & tangentialVelocity_);
} }
@ -72,9 +72,7 @@ rotatingPressureInletOutletVelocityFvPatchVectorField
: :
pressureInletOutletVelocityFvPatchVectorField(ptf, p, iF, mapper), pressureInletOutletVelocityFvPatchVectorField(ptf, p, iF, mapper),
omega_(ptf.omega_().clone().ptr()) omega_(ptf.omega_().clone().ptr())
{ {}
calcTangentialVelocity();
}
Foam::rotatingPressureInletOutletVelocityFvPatchVectorField:: Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::
@ -87,9 +85,7 @@ rotatingPressureInletOutletVelocityFvPatchVectorField
: :
pressureInletOutletVelocityFvPatchVectorField(p, iF, dict), pressureInletOutletVelocityFvPatchVectorField(p, iF, dict),
omega_(DataEntry<vector>::New("omega", dict)) omega_(DataEntry<vector>::New("omega", dict))
{ {}
calcTangentialVelocity();
}
Foam::rotatingPressureInletOutletVelocityFvPatchVectorField:: Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::
@ -100,9 +96,7 @@ rotatingPressureInletOutletVelocityFvPatchVectorField
: :
pressureInletOutletVelocityFvPatchVectorField(rppvf), pressureInletOutletVelocityFvPatchVectorField(rppvf),
omega_(rppvf.omega_().clone().ptr()) omega_(rppvf.omega_().clone().ptr())
{ {}
calcTangentialVelocity();
}
Foam::rotatingPressureInletOutletVelocityFvPatchVectorField:: Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::
@ -114,13 +108,24 @@ rotatingPressureInletOutletVelocityFvPatchVectorField
: :
pressureInletOutletVelocityFvPatchVectorField(rppvf, iF), pressureInletOutletVelocityFvPatchVectorField(rppvf, iF),
omega_(rppvf.omega_().clone().ptr()) omega_(rppvf.omega_().clone().ptr())
{ {}
calcTangentialVelocity();
}
// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * //
void Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::updateCoeffs()
{
if (updated())
{
return;
}
calcTangentialVelocity();
pressureInletOutletVelocityFvPatchVectorField::updateCoeffs();
}
void Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::write void Foam::rotatingPressureInletOutletVelocityFvPatchVectorField::write
( (
Ostream& os Ostream& os

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011-2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -177,6 +177,9 @@ public:
// Member functions // Member functions
//- Update the coefficients associated with the patch field
virtual void updateCoeffs();
//- Write //- Write
virtual void write(Ostream&) const; virtual void write(Ostream&) const;
}; };

View File

@ -33,47 +33,47 @@ Description
1. incompressible subsonic: 1. incompressible subsonic:
\f[ \f[
p_T = p_0 + 0.5 |U|^2 p_p = p_0 - 0.5 |U|^2
\f] \f]
where where
\vartable \vartable
p_T | incompressible total pressure [m2/s2] p_p | incompressible pressure at patch [m2/s2]
p_0 | incompressible reference pressure [m2/s2] p_0 | incompressible total pressure [m2/s2]
U | velocity U | velocity
\endvartable \endvartable
2. compressible subsonic: 2. compressible subsonic:
\f[ \f[
p_T = p_0 + 0.5 \rho |U|^2 p_p = p_0 - 0.5 \rho |U|^2
\f] \f]
where where
\vartable \vartable
p_T | total pressure [Pa] p_p | pressure at patch [Pa]
p_0 | reference pressure [Pa] p_0 | total pressure [Pa]
\rho | density [kg/m3] \rho | density [kg/m3]
U | velocity U | velocity
\endvartable \endvartable
3. compressible transonic (\gamma <= 1): 3. compressible transonic (\gamma <= 1):
\f[ \f[
p_T = \frac{p_0}{1 + 0.5 \psi |U|^2} p_p = \frac{p_0}{1 + 0.5 \psi |U|^2}
\f] \f]
where where
\vartable \vartable
p_T | total pressure [Pa] p_p | pressure at patch [Pa]
p_0 | reference pressure [Pa] p_0 | total pressure [Pa]
G | coefficient given by \f$\frac{\gamma}{1-\gamma}\f$ G | coefficient given by \f$\frac{\gamma}{1-\gamma}\f$
\endvartable \endvartable
4. compressible supersonic (\gamma > 1): 4. compressible supersonic (\gamma > 1):
\f[ \f[
p_T = \frac{p_0}{(1 + 0.5 \psi G |U|^2)^{\frac{1}{G}}} p_p = \frac{p_0}{(1 + 0.5 \psi G |U|^2)^{\frac{1}{G}}}
\f] \f]
where where
\vartable \vartable
p_p | pressure at patch [Pa]
p_0 | total pressure [Pa]
\gamma | ratio of specific heats (Cp/Cv) \gamma | ratio of specific heats (Cp/Cv)
p_T | total pressure [Pa]
p_0 | reference pressure [Pa]
\psi | compressibility [m2/s2] \psi | compressibility [m2/s2]
G | coefficient given by \f$\frac{\gamma}{1-\gamma}\f$ G | coefficient given by \f$\frac{\gamma}{1-\gamma}\f$
\endvartable \endvartable
@ -98,7 +98,7 @@ Description
rho | density field name | no | none rho | density field name | no | none
psi | compressibility field name | no | none psi | compressibility field name | no | none
gamma | ratio of specific heats (Cp/Cv) | yes | gamma | ratio of specific heats (Cp/Cv) | yes |
p0 | static pressure reference | yes | p0 | total pressure | yes |
\endtable \endtable
Example of the boundary condition specification: Example of the boundary condition specification:

View File

@ -25,6 +25,9 @@ License
#include "fvcReconstruct.H" #include "fvcReconstruct.H"
#include "fvMesh.H" #include "fvMesh.H"
#include "volFields.H"
#include "surfaceFields.H"
#include "fvcSurfaceIntegrate.H"
#include "zeroGradientFvPatchFields.H" #include "zeroGradientFvPatchFields.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -69,6 +69,9 @@ namespace fvc
( (
const tmp<GeometricField<Type, fvsPatchField, surfaceMesh> >& const tmp<GeometricField<Type, fvsPatchField, surfaceMesh> >&
); );
tmp<volScalarField> reconstructMag(const surfaceScalarField&);
tmp<volScalarField> reconstructMag(const tmp<surfaceScalarField>&);
} }

View File

@ -0,0 +1,137 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "fvcReconstruct.H"
#include "fvMesh.H"
#include "volFields.H"
#include "surfaceFields.H"
#include "zeroGradientFvPatchFields.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace fvc
{
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
tmp<volScalarField> reconstructMag(const surfaceScalarField& ssf)
{
const fvMesh& mesh = ssf.mesh();
const labelUList& owner = mesh.owner();
const labelUList& neighbour = mesh.neighbour();
const volVectorField& C = mesh.C();
const surfaceVectorField& Cf = mesh.Cf();
const surfaceVectorField& Sf = mesh.Sf();
const surfaceScalarField& magSf = mesh.magSf();
tmp<volScalarField> treconField
(
new volScalarField
(
IOobject
(
"reconstruct("+ssf.name()+')',
ssf.instance(),
mesh,
IOobject::NO_READ,
IOobject::NO_WRITE
),
mesh,
dimensionedScalar
(
"0",
ssf.dimensions()/dimArea,
scalar(0)
),
zeroGradientFvPatchScalarField::typeName
)
);
scalarField& rf = treconField();
forAll(owner, facei)
{
label own = owner[facei];
label nei = neighbour[facei];
rf[own] += (Sf[facei] & (Cf[facei] - C[own]))*ssf[facei]/magSf[facei];
rf[nei] -= (Sf[facei] & (Cf[facei] - C[nei]))*ssf[facei]/magSf[facei];
}
const surfaceScalarField::GeometricBoundaryField& bsf = ssf.boundaryField();
forAll(bsf, patchi)
{
const fvsPatchScalarField& psf = bsf[patchi];
const labelUList& pOwner = mesh.boundary()[patchi].faceCells();
const vectorField& pCf = Cf.boundaryField()[patchi];
const vectorField& pSf = Sf.boundaryField()[patchi];
const scalarField& pMagSf = magSf.boundaryField()[patchi];
forAll(pOwner, pFacei)
{
label own = pOwner[pFacei];
rf[own] +=
(pSf[pFacei] & (pCf[pFacei] - C[own]))
*psf[pFacei]/pMagSf[pFacei];
}
}
rf /= mesh.V();
treconField().correctBoundaryConditions();
return treconField;
}
tmp<volScalarField> reconstructMag(const tmp<surfaceScalarField>& tssf)
{
tmp<volScalarField> tvf
(
fvc::reconstructMag(tssf())
);
tssf.clear();
return tvf;
}
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace fvc
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
// ************************************************************************* //

View File

@ -30,6 +30,7 @@ License
void Foam::MULES::correct void Foam::MULES::correct
( (
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiPsiCorr, surfaceScalarField& phiPsiCorr,
const scalar psiMax, const scalar psiMax,
const scalar psiMin const scalar psiMin
@ -39,6 +40,7 @@ void Foam::MULES::correct
( (
geometricOneField(), geometricOneField(),
psi, psi,
phi,
phiPsiCorr, phiPsiCorr,
zeroField(), zeroField(), zeroField(), zeroField(),
psiMax, psiMin psiMax, psiMin
@ -49,6 +51,7 @@ void Foam::MULES::correct
void Foam::MULES::LTScorrect void Foam::MULES::LTScorrect
( (
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiPsiCorr, surfaceScalarField& phiPsiCorr,
const scalar psiMax, const scalar psiMax,
const scalar psiMin const scalar psiMin
@ -58,6 +61,7 @@ void Foam::MULES::LTScorrect
( (
geometricOneField(), geometricOneField(),
psi, psi,
phi,
phiPsiCorr, phiPsiCorr,
zeroField(), zeroField(), zeroField(), zeroField(),
psiMax, psiMin psiMax, psiMin

View File

@ -66,6 +66,7 @@ void correct
const RdeltaTType& rDeltaT, const RdeltaTType& rDeltaT,
const RhoType& rho, const RhoType& rho,
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
const surfaceScalarField& phiCorr, const surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su const SuType& Su
@ -76,6 +77,7 @@ void correct
( (
const RhoType& rho, const RhoType& rho,
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -86,6 +88,7 @@ void correct
void correct void correct
( (
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const scalar psiMax, const scalar psiMax,
const scalar psiMin const scalar psiMin
@ -96,6 +99,7 @@ void LTScorrect
( (
const RhoType& rho, const RhoType& rho,
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -106,6 +110,7 @@ void LTScorrect
void LTScorrect void LTScorrect
( (
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const scalar psiMax, const scalar psiMax,
const scalar psiMin const scalar psiMin
@ -119,6 +124,7 @@ void limiterCorr
const RdeltaTType& rDeltaT, const RdeltaTType& rDeltaT,
const RhoType& rho, const RhoType& rho,
const volScalarField& psi, const volScalarField& psi,
const surfaceScalarField& phi,
const surfaceScalarField& phiCorr, const surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -133,6 +139,7 @@ void limitCorr
const RdeltaTType& rDeltaT, const RdeltaTType& rDeltaT,
const RhoType& rho, const RhoType& rho,
const volScalarField& psi, const volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,

View File

@ -37,6 +37,7 @@ void Foam::MULES::correct
const RdeltaTType& rDeltaT, const RdeltaTType& rDeltaT,
const RhoType& rho, const RhoType& rho,
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
const surfaceScalarField& phiCorr, const surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su const SuType& Su
@ -77,6 +78,7 @@ void Foam::MULES::correct
( (
const RhoType& rho, const RhoType& rho,
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -94,8 +96,18 @@ void Foam::MULES::correct
readLabel(MULEScontrols.lookup("nLimiterIter")) readLabel(MULEScontrols.lookup("nLimiterIter"))
); );
limitCorr(rDeltaT, rho, psi, phiCorr, Sp, Su, psiMax, psiMin, nLimiterIter); limitCorr
correct(rDeltaT, rho, psi, phiCorr, Sp, Su); (
rDeltaT,
rho,
psi,
phi,
phiCorr,
Sp, Su,
psiMax, psiMin,
nLimiterIter
);
correct(rDeltaT, rho, psi, phi, phiCorr, Sp, Su);
} }
@ -104,6 +116,7 @@ void Foam::MULES::LTScorrect
( (
const RhoType& rho, const RhoType& rho,
volScalarField& psi, volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -123,8 +136,18 @@ void Foam::MULES::LTScorrect
readLabel(MULEScontrols.lookup("nLimiterIter")) readLabel(MULEScontrols.lookup("nLimiterIter"))
); );
limitCorr(rDeltaT, rho, psi, phiCorr, Sp, Su, psiMax, psiMin, nLimiterIter); limitCorr
correct(rDeltaT, rho, psi, phiCorr, Sp, Su); (
rDeltaT,
rho,
psi,
phi,
phiCorr,
Sp, Su,
psiMax, psiMin,
nLimiterIter
);
correct(rDeltaT, rho, psi, phi, phiCorr, Sp, Su);
} }
@ -135,6 +158,7 @@ void Foam::MULES::limiterCorr
const RdeltaTType& rDeltaT, const RdeltaTType& rDeltaT,
const RhoType& rho, const RhoType& rho,
const volScalarField& psi, const volScalarField& psi,
const surfaceScalarField& phi,
const surfaceScalarField& phiCorr, const surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -153,6 +177,9 @@ void Foam::MULES::limiterCorr
tmp<volScalarField::DimensionedInternalField> tVsc = mesh.Vsc(); tmp<volScalarField::DimensionedInternalField> tVsc = mesh.Vsc();
const scalarField& V = tVsc(); const scalarField& V = tVsc();
const surfaceScalarField::GeometricBoundaryField& phiBf =
phi.boundaryField();
const scalarField& phiCorrIf = phiCorr; const scalarField& phiCorrIf = phiCorr;
const surfaceScalarField::GeometricBoundaryField& phiCorrBf = const surfaceScalarField::GeometricBoundaryField& phiCorrBf =
phiCorr.boundaryField(); phiCorr.boundaryField();
@ -408,12 +435,12 @@ void Foam::MULES::limiterCorr
{ {
const labelList& pFaceCells = const labelList& pFaceCells =
mesh.boundary()[patchi].faceCells(); mesh.boundary()[patchi].faceCells();
const scalarField& phiCorrPf = phiCorrBf[patchi]; const scalarField& phiPf = phiBf[patchi];
forAll(lambdaPf, pFacei) forAll(lambdaPf, pFacei)
{ {
// Limit outlet faces only // Limit outlet faces only
if (phiCorrPf[pFacei] > SMALL*SMALL) if (phiPf[pFacei] > SMALL*SMALL)
{ {
label pfCelli = pFaceCells[pFacei]; label pfCelli = pFaceCells[pFacei];
@ -443,6 +470,7 @@ void Foam::MULES::limitCorr
const RdeltaTType& rDeltaT, const RdeltaTType& rDeltaT,
const RhoType& rho, const RhoType& rho,
const volScalarField& psi, const volScalarField& psi,
const surfaceScalarField& phi,
surfaceScalarField& phiCorr, surfaceScalarField& phiCorr,
const SpType& Sp, const SpType& Sp,
const SuType& Su, const SuType& Su,
@ -478,6 +506,7 @@ void Foam::MULES::limitCorr
rDeltaT, rDeltaT,
rho, rho,
psi, psi,
phi,
phiCorr, phiCorr,
Sp, Sp,
Su, Su,

View File

@ -173,10 +173,55 @@ void Foam::fv::interRegionExplicitPorositySource::addSup
if (eqn.dimensions() == dimForce) if (eqn.dimensions() == dimForce)
{ {
const volScalarField& rhoNbr = volScalarField rhoNbr
nbrMesh.lookupObject<volScalarField>(rhoName_); (
const volScalarField& muNbr = IOobject
nbrMesh.lookupObject<volScalarField>(muName_); (
"rho:UNbr",
nbrMesh.time().timeName(),
nbrMesh,
IOobject::NO_READ,
IOobject::NO_WRITE
),
nbrMesh,
dimensionedScalar("zero", dimDensity, 0.0)
);
volScalarField muNbr
(
IOobject
(
"mu:UNbr",
nbrMesh.time().timeName(),
nbrMesh,
IOobject::NO_READ,
IOobject::NO_WRITE
),
nbrMesh,
dimensionedScalar("zero", dimViscosity, 0.0)
);
const volScalarField& rho =
mesh_.lookupObject<volScalarField>(rhoName_);
const volScalarField& mu =
mesh_.lookupObject<volScalarField>(muName_);
// map local rho onto neighbour region
meshInterp().mapSrcToTgt
(
rho.internalField(),
plusEqOp<scalar>(),
rhoNbr.internalField()
);
// map local mu onto neighbour region
meshInterp().mapSrcToTgt
(
mu.internalField(),
plusEqOp<scalar>(),
muNbr.internalField()
);
porosityPtr_->addResistance(nbrEqn, rhoNbr, muNbr); porosityPtr_->addResistance(nbrEqn, rhoNbr, muNbr);
} }

View File

@ -424,7 +424,7 @@ Foam::scalar Foam::particle::trackToFace
( (
position_, position_,
endPosition, endPosition,
triI, tI,
tetAreas[tI], tetAreas[tI],
tetPlaneBasePtIs[tI], tetPlaneBasePtIs[tI],
cellI_, cellI_,

View File

@ -90,16 +90,16 @@ void Foam::cyclicACMIPolyPatch::resetAMI
AMIPatchToPatchInterpolation::imPartialFaceAreaWeight AMIPatchToPatchInterpolation::imPartialFaceAreaWeight
); );
const scalarField& srcWeightSum = AMI().srcWeightsSum(); srcMask_ =
min(1.0 - tolerance_, max(tolerance_, AMI().srcWeightsSum()));
tgtMask_ =
min(1.0 - tolerance_, max(tolerance_, AMI().tgtWeightsSum()));
// set patch face areas based on sum of AMI weights per face
forAll(Sf, faceI) forAll(Sf, faceI)
{ {
scalar w = srcWeightSum[faceI]; Sf[faceI] *= srcMask_[faceI];
w = min(1.0 - tolerance_, max(tolerance_, w)); noSf[faceI] *= 1.0 - srcMask_[faceI];
Sf[faceI] *= w;
noSf[faceI] *= 1.0 - w;
} }
setNeighbourFaceAreas(); setNeighbourFaceAreas();
@ -116,8 +116,6 @@ void Foam::cyclicACMIPolyPatch::setNeighbourFaceAreas() const
refCast<const cyclicACMIPolyPatch>(this->neighbPatch()); refCast<const cyclicACMIPolyPatch>(this->neighbPatch());
const polyPatch& pp = cp.nonOverlapPatch(); const polyPatch& pp = cp.nonOverlapPatch();
const scalarField& tgtWeightSum = AMI().tgtWeightsSum();
const vectorField& faceAreas0 = cp.faceAreas0(); const vectorField& faceAreas0 = cp.faceAreas0();
vectorField::subField Sf = cp.faceAreas(); vectorField::subField Sf = cp.faceAreas();
@ -125,11 +123,8 @@ void Foam::cyclicACMIPolyPatch::setNeighbourFaceAreas() const
forAll(Sf, faceI) forAll(Sf, faceI)
{ {
scalar w = tgtWeightSum[faceI]; Sf[faceI] = tgtMask_[faceI]*faceAreas0[faceI];
w = min(1.0 - tolerance_, max(tolerance_, w)); noSf[faceI] = (1.0 - tgtMask_[faceI])*faceAreas0[faceI];
Sf[faceI] = w*faceAreas0[faceI];
noSf[faceI] = (1.0 - w)*faceAreas0[faceI];
} }
} }
@ -184,6 +179,18 @@ void Foam::cyclicACMIPolyPatch::clearGeom()
} }
const Foam::scalarField& Foam::cyclicACMIPolyPatch::srcMask() const
{
return srcMask_;
}
const Foam::scalarField& Foam::cyclicACMIPolyPatch::tgtMask() const
{
return tgtMask_;
}
// * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * * * //
Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch
@ -201,6 +208,8 @@ Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch
faceAreas0_(), faceAreas0_(),
nonOverlapPatchName_(word::null), nonOverlapPatchName_(word::null),
nonOverlapPatchID_(-1), nonOverlapPatchID_(-1),
srcMask_(),
tgtMask_(),
updated_(false) updated_(false)
{ {
// Non-overlapping patch might not be valid yet so cannot determine // Non-overlapping patch might not be valid yet so cannot determine
@ -221,6 +230,8 @@ Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch
faceAreas0_(), faceAreas0_(),
nonOverlapPatchName_(dict.lookup("nonOverlapPatch")), nonOverlapPatchName_(dict.lookup("nonOverlapPatch")),
nonOverlapPatchID_(-1), nonOverlapPatchID_(-1),
srcMask_(),
tgtMask_(),
updated_(false) updated_(false)
{ {
if (nonOverlapPatchName_ == name) if (nonOverlapPatchName_ == name)
@ -256,6 +267,8 @@ Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch
faceAreas0_(), faceAreas0_(),
nonOverlapPatchName_(pp.nonOverlapPatchName_), nonOverlapPatchName_(pp.nonOverlapPatchName_),
nonOverlapPatchID_(-1), nonOverlapPatchID_(-1),
srcMask_(),
tgtMask_(),
updated_(false) updated_(false)
{ {
// Non-overlapping patch might not be valid yet so cannot determine // Non-overlapping patch might not be valid yet so cannot determine
@ -278,6 +291,8 @@ Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch
faceAreas0_(), faceAreas0_(),
nonOverlapPatchName_(nonOverlapPatchName), nonOverlapPatchName_(nonOverlapPatchName),
nonOverlapPatchID_(-1), nonOverlapPatchID_(-1),
srcMask_(),
tgtMask_(),
updated_(false) updated_(false)
{ {
if (nonOverlapPatchName_ == name()) if (nonOverlapPatchName_ == name())
@ -314,6 +329,8 @@ Foam::cyclicACMIPolyPatch::cyclicACMIPolyPatch
faceAreas0_(), faceAreas0_(),
nonOverlapPatchName_(pp.nonOverlapPatchName_), nonOverlapPatchName_(pp.nonOverlapPatchName_),
nonOverlapPatchID_(-1), nonOverlapPatchID_(-1),
srcMask_(),
tgtMask_(),
updated_(false) updated_(false)
{} {}
@ -326,6 +343,13 @@ Foam::cyclicACMIPolyPatch::~cyclicACMIPolyPatch()
// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * //
const Foam::cyclicACMIPolyPatch& Foam::cyclicACMIPolyPatch::neighbPatch() const
{
const polyPatch& pp = this->boundaryMesh()[neighbPatchID()];
return refCast<const cyclicACMIPolyPatch>(pp);
}
Foam::label Foam::cyclicACMIPolyPatch::nonOverlapPatchID() const Foam::label Foam::cyclicACMIPolyPatch::nonOverlapPatchID() const
{ {
if (nonOverlapPatchID_ == -1) if (nonOverlapPatchID_ == -1)

View File

@ -66,6 +66,12 @@ private:
//- Index of non-overlapping patch //- Index of non-overlapping patch
mutable label nonOverlapPatchID_; mutable label nonOverlapPatchID_;
//- Mask/weighting for source patch
mutable scalarField srcMask_;
//- Mask/weighting for target patch
mutable scalarField tgtMask_;
//- Flag to indicate that AMI has been updated //- Flag to indicate that AMI has been updated
mutable bool updated_; mutable bool updated_;
@ -111,6 +117,12 @@ protected:
//- Clear geometry //- Clear geometry
virtual void clearGeom(); virtual void clearGeom();
//- Return the mask/weighting for the source patch
virtual const scalarField& srcMask() const;
//- Return the mask/weighting for the target patch
virtual const scalarField& tgtMask() const;
public: public:
@ -245,6 +257,9 @@ public:
//- Return access to the original patch face areas //- Return access to the original patch face areas
inline const vectorField& faceAreas0() const; inline const vectorField& faceAreas0() const;
//- Return a reference to the neighbour patch
virtual const cyclicACMIPolyPatch& neighbPatch() const;
//- Non-overlapping patch name //- Non-overlapping patch name
inline const word& nonOverlapPatchName() const; inline const word& nonOverlapPatchName() const;

View File

@ -71,11 +71,11 @@ inline const Foam::scalarField& Foam::cyclicACMIPolyPatch::mask() const
{ {
if (owner()) if (owner())
{ {
return AMI().srcWeightsSum(); return srcMask_;
} }
else else
{ {
return neighbPatch().AMI().tgtWeightsSum(); return neighbPatch().tgtMask();
} }
} }

View File

@ -34,7 +34,7 @@ Foam::tmp<Foam::Field<Type> > Foam::cyclicACMIPolyPatch::interpolate
{ {
if (owner()) if (owner())
{ {
const scalarField& w = AMI().srcWeightsSum(); const scalarField& w = srcMask_;
return return
w*AMI().interpolateToSource(fldCouple) w*AMI().interpolateToSource(fldCouple)
@ -42,7 +42,7 @@ Foam::tmp<Foam::Field<Type> > Foam::cyclicACMIPolyPatch::interpolate
} }
else else
{ {
const scalarField& w = neighbPatch().AMI().tgtWeightsSum(); const scalarField& w = neighbPatch().tgtMask();
return return
w*neighbPatch().AMI().interpolateToTarget(fldCouple) w*neighbPatch().AMI().interpolateToTarget(fldCouple)
@ -73,14 +73,14 @@ void Foam::cyclicACMIPolyPatch::interpolate
{ {
if (owner()) if (owner())
{ {
const scalarField& w = AMI().srcWeightsSum(); const scalarField& w = srcMask_;
AMI().interpolateToSource(fldCouple, cop, result); AMI().interpolateToSource(fldCouple, cop, result);
result = w*result + (1.0 - w)*fldNonOverlap; result = w*result + (1.0 - w)*fldNonOverlap;
} }
else else
{ {
const scalarField& w = neighbPatch().AMI().tgtWeightsSum(); const scalarField& w = neighbPatch().tgtMask();
neighbPatch().AMI().interpolateToTarget(fldCouple, cop, result); neighbPatch().AMI().interpolateToTarget(fldCouple, cop, result);
result = w*result + (1.0 - w)*fldNonOverlap; result = w*result + (1.0 - w)*fldNonOverlap;

View File

@ -642,6 +642,13 @@ bool Foam::cyclicAMIPolyPatch::owner() const
} }
const Foam::cyclicAMIPolyPatch& Foam::cyclicAMIPolyPatch::neighbPatch() const
{
const polyPatch& pp = this->boundaryMesh()[neighbPatchID()];
return refCast<const cyclicAMIPolyPatch>(pp);
}
const Foam::autoPtr<Foam::searchableSurface>& const Foam::autoPtr<Foam::searchableSurface>&
Foam::cyclicAMIPolyPatch::surfPtr() const Foam::cyclicAMIPolyPatch::surfPtr() const
{ {

View File

@ -284,7 +284,7 @@ public:
virtual bool owner() const; virtual bool owner() const;
//- Return a reference to the neighbour patch //- Return a reference to the neighbour patch
inline const cyclicAMIPolyPatch& neighbPatch() const; virtual const cyclicAMIPolyPatch& neighbPatch() const;
//- Return a reference to the projection surface //- Return a reference to the projection surface
const autoPtr<searchableSurface>& surfPtr() const; const autoPtr<searchableSurface>& surfPtr() const;

View File

@ -38,14 +38,6 @@ inline const Foam::word& Foam::cyclicAMIPolyPatch::neighbPatchName() const
} }
inline const Foam::cyclicAMIPolyPatch&
Foam::cyclicAMIPolyPatch::neighbPatch() const
{
const polyPatch& pp = this->boundaryMesh()[neighbPatchID()];
return refCast<const cyclicAMIPolyPatch>(pp);
}
inline const Foam::vector& Foam::cyclicAMIPolyPatch::rotationAxis() const inline const Foam::vector& Foam::cyclicAMIPolyPatch::rotationAxis() const
{ {
return rotationAxis_; return rotationAxis_;

View File

@ -203,7 +203,7 @@ void Foam::mappedPatchBase::findSamples
{ {
case NEARESTCELL: case NEARESTCELL:
{ {
if (samplePatch().size() && samplePatch() != "none") if (samplePatch_.size() && samplePatch_ != "none")
{ {
FatalErrorIn FatalErrorIn
( (
@ -495,7 +495,6 @@ void Foam::mappedPatchBase::findSamples
void Foam::mappedPatchBase::calcMapping() const void Foam::mappedPatchBase::calcMapping() const
{ {
static bool hasWarned = false; static bool hasWarned = false;
if (mapPtr_.valid()) if (mapPtr_.valid())
{ {
FatalErrorIn("mappedPatchBase::calcMapping() const") FatalErrorIn("mappedPatchBase::calcMapping() const")
@ -509,10 +508,8 @@ void Foam::mappedPatchBase::calcMapping() const
// Get offsetted points // Get offsetted points
const pointField offsettedPoints(samplePoints(patchPoints())); const pointField offsettedPoints(samplePoints(patchPoints()));
// Do a sanity check - am I sampling my own patch?
// Do a sanity check // This only makes sense for a non-zero offset.
// Am I sampling my own patch? This only makes sense for a non-zero
// offset.
bool sampleMyself = bool sampleMyself =
( (
mode_ == NEARESTPATCHFACE mode_ == NEARESTPATCHFACE
@ -550,7 +547,6 @@ void Foam::mappedPatchBase::calcMapping() const
<< "offsetMode_:" << offsetModeNames_[offsetMode_] << endl; << "offsetMode_:" << offsetModeNames_[offsetMode_] << endl;
} }
// Get global list of all samples and the processor and face they come from. // Get global list of all samples and the processor and face they come from.
pointField samples; pointField samples;
labelList patchFaceProcs; labelList patchFaceProcs;
@ -565,7 +561,6 @@ void Foam::mappedPatchBase::calcMapping() const
patchFc patchFc
); );
// Find processor and cell/face samples are in and actual location. // Find processor and cell/face samples are in and actual location.
labelList sampleProcs; labelList sampleProcs;
labelList sampleIndices; labelList sampleIndices;
@ -641,7 +636,6 @@ void Foam::mappedPatchBase::calcMapping() const
} }
} }
// Now we have all the data we need: // Now we have all the data we need:
// - where sample originates from (so destination when mapping): // - where sample originates from (so destination when mapping):
// patchFaces, patchFaceProcs. // patchFaces, patchFaceProcs.
@ -688,7 +682,6 @@ void Foam::mappedPatchBase::calcMapping() const
} }
} }
// Determine schedule. // Determine schedule.
mapPtr_.reset(new mapDistribute(sampleProcs, patchFaceProcs)); mapPtr_.reset(new mapDistribute(sampleProcs, patchFaceProcs));
@ -806,17 +799,15 @@ void Foam::mappedPatchBase::calcAMI() const
} }
AMIPtr_.clear(); AMIPtr_.clear();
/*
const polyPatch& nbr = samplePolyPatch();
// pointField nbrPoints(offsettedPoints());
pointField nbrPoints(nbr.localPoints());
if (debug) if (debug)
{ {
const polyPatch& nbr = samplePolyPatch();
pointField nbrPoints(nbr.localPoints());
OFstream os(patch_.name() + "_neighbourPatch-org.obj"); OFstream os(patch_.name() + "_neighbourPatch-org.obj");
meshTools::writeOBJ(os, samplePolyPatch().localFaces(), nbrPoints); meshTools::writeOBJ(os, samplePolyPatch().localFaces(), nbrPoints);
}
// transform neighbour patch to local system // transform neighbour patch to local system
primitivePatch nbrPatch0 primitivePatch nbrPatch0
@ -829,15 +820,13 @@ void Foam::mappedPatchBase::calcAMI() const
nbrPoints nbrPoints
); );
if (debug)
{
OFstream osN(patch_.name() + "_neighbourPatch-trans.obj"); OFstream osN(patch_.name() + "_neighbourPatch-trans.obj");
meshTools::writeOBJ(osN, nbrPatch0, nbrPoints); meshTools::writeOBJ(osN, nbrPatch0, nbrPoints);
OFstream osO(patch_.name() + "_ownerPatch.obj"); OFstream osO(patch_.name() + "_ownerPatch.obj");
meshTools::writeOBJ(osO, patch_.localFaces(), patch_.localPoints()); meshTools::writeOBJ(osO, patch_.localFaces(), patch_.localPoints());
} }
*/
// Construct/apply AMI interpolation to determine addressing and weights // Construct/apply AMI interpolation to determine addressing and weights
AMIPtr_.reset AMIPtr_.reset
( (

View File

@ -392,6 +392,7 @@ public:
//- Get the patch on the region //- Get the patch on the region
const polyPatch& samplePolyPatch() const; const polyPatch& samplePolyPatch() const;
// Helpers // Helpers
//- Get the sample points //- Get the sample points

View File

@ -39,7 +39,10 @@ defineTypeNameAndDebug(cloudInfo, 0);
void Foam::cloudInfo::writeFileHeader(const label i) void Foam::cloudInfo::writeFileHeader(const label i)
{ {
file(i) << "# Time" << tab << "nParcels" << tab << "mass" << endl; writeHeader(file(), "Cloud information");
writeCommented(file(), "Time");
writeTabbed(file(), "nParcels");
writeTabbed(file(), "mass");
} }

View File

@ -335,7 +335,6 @@ void Foam::fieldAverage::write()
{ {
if (active_) if (active_)
{ {
calcAverages();
writeAverages(); writeAverages();
writeAveragingProperties(); writeAveragingProperties();

View File

@ -96,7 +96,20 @@ void Foam::fieldCoordinateSystemTransform::read(const dictionary& dict)
void Foam::fieldCoordinateSystemTransform::execute() void Foam::fieldCoordinateSystemTransform::execute()
{ {
// Do nothing if (active_)
{
Info<< type() << " " << name_ << " output:" << nl;
forAll(fieldSet_, fieldI)
{
// If necessary load field
transform<scalar>(fieldSet_[fieldI]);
transform<vector>(fieldSet_[fieldI]);
transform<sphericalTensor>(fieldSet_[fieldI]);
transform<symmTensor>(fieldSet_[fieldI]);
transform<tensor>(fieldSet_[fieldI]);
}
}
} }
@ -113,17 +126,24 @@ void Foam::fieldCoordinateSystemTransform::timeSet()
void Foam::fieldCoordinateSystemTransform::write() void Foam::fieldCoordinateSystemTransform::write()
{
if (active_)
{ {
Info<< type() << " " << name_ << " output:" << nl; Info<< type() << " " << name_ << " output:" << nl;
forAll(fieldSet_, fieldI) forAll(fieldSet_, fieldI)
{ {
// If necessary load field const word fieldName = fieldSet_[fieldI] + ":Transformed";
transform<scalar>(fieldSet_[fieldI]);
transform<vector>(fieldSet_[fieldI]); const regIOobject& field =
transform<sphericalTensor>(fieldSet_[fieldI]); obr_.lookupObject<regIOobject>(fieldName);
transform<symmTensor>(fieldSet_[fieldI]);
transform<tensor>(fieldSet_[fieldI]); Info<< " writing field " << field.name() << nl;
field.write();
}
Info<< endl;
} }
} }

View File

@ -37,7 +37,7 @@ void Foam::fieldCoordinateSystemTransform::transformField
const Type& field const Type& field
) const ) const
{ {
const word& fieldName = field.name() + "Transformed"; const word& fieldName = field.name() + ":Transformed";
if (!obr_.foundObject<Type>(fieldName)) if (!obr_.foundObject<Type>(fieldName))
{ {

View File

@ -112,20 +112,23 @@ void Foam::fieldMinMax::read(const dictionary& dict)
void Foam::fieldMinMax::writeFileHeader(const label i) void Foam::fieldMinMax::writeFileHeader(const label i)
{ {
file() writeHeader(file(), "Field minima and maxima");
<< "# Time" << token::TAB << "field" << token::TAB writeCommented(file(), "Time");
<< "min" << token::TAB << "position(min)"; writeTabbed(file(), "field");
writeTabbed(file(), "min");
writeTabbed(file(), "position(min)");
if (Pstream::parRun()) if (Pstream::parRun())
{ {
file() << token::TAB << "proc"; writeTabbed(file(), "processor");
} }
file() << token::TAB << "max" << token::TAB << "position(max)"; writeTabbed(file(), "max");
writeTabbed(file(), "position(max)");
if (Pstream::parRun()) if (Pstream::parRun())
{ {
file() << token::TAB << "proc"; writeTabbed(file(), "processor");
} }
file() << endl; file() << endl;

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011-2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -111,17 +111,21 @@ void Foam::fieldMinMax::calcMinMaxFields
scalar maxValue = maxVs[maxI]; scalar maxValue = maxVs[maxI];
const vector& maxC = maxCs[maxI]; const vector& maxC = maxCs[maxI];
file()<< obr_.time().value();
writeTabbed(file(), fieldName);
file() file()
<< obr_.time().value() << token::TAB << token::TAB << minValue
<< fieldName << token::TAB << token::TAB << minC;
<< minValue << token::TAB << minC;
if (Pstream::parRun()) if (Pstream::parRun())
{ {
file()<< token::TAB << minI; file()<< token::TAB << minI;
} }
file() << token::TAB << maxValue << token::TAB << maxC; file()
<< token::TAB << maxValue
<< token::TAB << maxC;
if (Pstream::parRun()) if (Pstream::parRun())
{ {
@ -212,17 +216,21 @@ void Foam::fieldMinMax::calcMinMaxFields
Type maxValue = maxVs[maxI]; Type maxValue = maxVs[maxI];
const vector& maxC = maxCs[maxI]; const vector& maxC = maxCs[maxI];
file()<< obr_.time().value();
writeTabbed(file(), fieldName);
file() file()
<< obr_.time().value() << token::TAB << token::TAB << minValue
<< fieldName << token::TAB << token::TAB << minC;
<< minValue << token::TAB << minC;
if (Pstream::parRun()) if (Pstream::parRun())
{ {
file()<< token::TAB << minI; file()<< token::TAB << minI;
} }
file() << token::TAB << maxValue << token::TAB << maxC; file()
<< token::TAB << maxValue
<< token::TAB << maxC;
if (Pstream::parRun()) if (Pstream::parRun())
{ {

View File

@ -94,11 +94,10 @@ void Foam::fieldValues::fieldValueDelta::writeFileHeader(const label i)
Ostream& os = file(); Ostream& os = file();
os << "# Source1 : " << source1Ptr_->name() << nl writeHeaderValue(os, "Source1", source1Ptr_->name());
<< "# Source2 : " << source2Ptr_->name() << nl writeHeaderValue(os, "Source2", source2Ptr_->name());
<< "# Operation : " << operationTypeNames_[operation_] << nl; writeHeaderValue(os, "Operation", operationTypeNames_[operation_]);
writeCommented(os, "Time");
os << "# Time";
forAll(commonFields, i) forAll(commonFields, i)
{ {
@ -156,7 +155,7 @@ void Foam::fieldValues::fieldValueDelta::write()
if (Pstream::master()) if (Pstream::master())
{ {
file()<< obr_.time().timeName(); file()<< obr_.time().value();
} }
if (log_) if (log_)

View File

@ -328,32 +328,8 @@ void Foam::nearWallFields::execute()
{ {
Info<< "nearWallFields:execute()" << endl; Info<< "nearWallFields:execute()" << endl;
} }
}
void Foam::nearWallFields::end()
{
if (debug)
{
Info<< "nearWallFields:end()" << endl;
}
}
void Foam::nearWallFields::timeSet()
{
// Do nothing
}
void Foam::nearWallFields::write()
{
if (debug)
{
Info<< "nearWallFields:write()" << endl;
}
// Do nothing
if (active_) if (active_)
{ {
if if
@ -380,7 +356,7 @@ void Foam::nearWallFields::write()
Info<< type() << " " << name_ << " output:" << nl; Info<< type() << " " << name_ << " output:" << nl;
Info<< " Writing sampled fields to " << obr_.time().timeName() Info<< " Sampling fields fields to " << obr_.time().timeName()
<< endl; << endl;
sampleFields(vsf_); sampleFields(vsf_);
@ -388,8 +364,37 @@ void Foam::nearWallFields::write()
sampleFields(vSpheretf_); sampleFields(vSpheretf_);
sampleFields(vSymmtf_); sampleFields(vSymmtf_);
sampleFields(vtf_); sampleFields(vtf_);
}
}
void Foam::nearWallFields::end()
{
if (debug)
{
Info<< "nearWallFields:end()" << endl;
}
}
void Foam::nearWallFields::timeSet()
{
// Do nothing
}
void Foam::nearWallFields::write()
{
if (debug)
{
Info<< "nearWallFields:write()" << endl;
}
if (active_)
{
Info<< " Writing sampled fields to " << obr_.time().timeName()
<< endl;
// Write fields
forAll(vsf_, i) forAll(vsf_, i)
{ {
vsf_[i].write(); vsf_[i].write();

View File

@ -53,6 +53,27 @@ Foam::processorField::processorField
if (isA<fvMesh>(obr_)) if (isA<fvMesh>(obr_))
{ {
read(dict); read(dict);
const fvMesh& mesh = refCast<const fvMesh>(obr_);
volScalarField* procFieldPtr
(
new volScalarField
(
IOobject
(
"processorID",
mesh.time().timeName(),
mesh,
IOobject::NO_READ,
IOobject::NO_WRITE
),
mesh,
dimensionedScalar("0", dimless, 0.0)
)
);
mesh.objectRegistry::store(procFieldPtr);
} }
else else
{ {
@ -88,7 +109,14 @@ void Foam::processorField::read(const dictionary& dict)
void Foam::processorField::execute() void Foam::processorField::execute()
{ {
// Do nothing if (active_)
{
const volScalarField& procField =
obr_.lookupObject<volScalarField>("processorID");
const_cast<volScalarField&>(procField) ==
dimensionedScalar("procI", dimless, Pstream::myProcNo());
}
} }
@ -108,20 +136,8 @@ void Foam::processorField::write()
{ {
if (active_) if (active_)
{ {
const fvMesh& mesh = refCast<const fvMesh>(obr_); const volScalarField& procField =
volScalarField procField obr_.lookupObject<volScalarField>("processorID");
(
IOobject
(
"processorID",
mesh.time().timeName(),
mesh,
IOobject::NO_READ,
IOobject::NO_WRITE
),
mesh,
dimensionedScalar("procI", dimless, Pstream::myProcNo())
);
procField.write(); procField.write();
} }

View File

@ -1,158 +0,0 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "processorField.H"
#include "volFields.H"
#include "surfaceFields.H"
#include "Time.H"
#include "transformGeometricField.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
template<class Type>
void Foam::processorField::transformField
(
const Type& field
) const
{
const word& fieldName = field.name() + "Transformed";
dimensionedTensor R("R", field.dimensions(), coordSys_.R());
if (obr_.foundObject<Type>(fieldName))
{
Type& transField =
const_cast<Type&>(obr_.lookupObject<Type>(fieldName));
transField == field;
forAll(field, i)
{
Foam::transform(transField, R, transField);
}
transField.write();
}
else
{
Type& transField = obr_.store
(
new Type
(
IOobject
(
fieldName,
obr_.time().timeName(),
obr_,
IOobject::READ_IF_PRESENT,
IOobject::NO_WRITE
),
field
)
);
forAll(field, i)
{
Foam::transform(transField, R, transField);
}
transField.write();
}
}
template<class Type>
void Foam::processorField::transform
(
const word& fieldName
) const
{
typedef GeometricField<Type, fvPatchField, volMesh> vfType;
typedef GeometricField<Type, fvsPatchField, surfaceMesh> sfType;
if (obr_.foundObject<vfType>(fieldName))
{
if (debug)
{
Info<< type() << ": Field " << fieldName << " already in database"
<< endl;
}
transformField<vfType>(obr_.lookupObject<vfType>(fieldName));
}
else if (obr_.foundObject<sfType>(fieldName))
{
if (debug)
{
Info<< type() << ": Field " << fieldName << " already in database"
<< endl;
}
transformField<sfType>(obr_.lookupObject<sfType>(fieldName));
}
else
{
IOobject fieldHeader
(
fieldName,
obr_.time().timeName(),
obr_,
IOobject::MUST_READ,
IOobject::NO_WRITE
);
if
(
fieldHeader.headerOk()
&& fieldHeader.headerClassName() == vfType::typeName
)
{
if (debug)
{
Info<< type() << ": Field " << fieldName << " read from file"
<< endl;
}
transformField<vfType>(obr_.lookupObject<vfType>(fieldName));
}
else if
(
fieldHeader.headerOk()
&& fieldHeader.headerClassName() == sfType::typeName
)
{
if (debug)
{
Info<< type() << ": Field " << fieldName << " read from file"
<< endl;
}
transformField<sfType>(obr_.lookupObject<sfType>(fieldName));
}
}
}
// ************************************************************************* //

View File

@ -47,7 +47,7 @@ Description
- alpha_liquidCore : alpha with outside liquid core set to 0 - alpha_liquidCore : alpha with outside liquid core set to 0
- alpha_background : alpha with outside background set to 0. - alpha_background : alpha with outside background set to 0.
Histogram: %Histogram:
- determine histogram of diameter (given minDiameter, maxDiameter, nBins) - determine histogram of diameter (given minDiameter, maxDiameter, nBins)
- write graph of number of droplets per bin - write graph of number of droplets per bin
- write graph of sum, average and deviation of droplet volume per bin - write graph of sum, average and deviation of droplet volume per bin

View File

@ -45,34 +45,65 @@ void Foam::forceCoeffs::writeFileHeader(const label i)
{ {
// force coeff data // force coeff data
writeHeader(file(i), "Force coefficients");
writeHeaderValue(file(i), "liftDir", liftDir_);
writeHeaderValue(file(i), "dragDir", dragDir_);
writeHeaderValue(file(i), "pitchAxis", pitchAxis_);
writeHeaderValue(file(i), "magUInf", magUInf_);
writeHeaderValue(file(i), "lRef", lRef_);
writeHeaderValue(file(i), "Aref", Aref_);
writeHeaderValue(file(i), "CofR", coordSys_.origin());
writeCommented(file(i), "Time");
writeTabbed(file(i), "Cm");
writeTabbed(file(i), "Cd");
writeTabbed(file(i), "Cl");
writeTabbed(file(i), "Cl(f)");
writeTabbed(file(i), "Cl(r)");
file(i) file(i)
<< "# liftDir : " << liftDir_ << nl << tab << "Cm" << tab << "Cd" << tab << "Cl" << tab << "Cl(f)"
<< "# dragDir : " << dragDir_ << nl << tab << "Cl(r)";
<< "# pitchAxis : " << pitchAxis_ << nl
<< "# magUInf : " << magUInf_ << nl
<< "# lRef : " << lRef_ << nl
<< "# Aref : " << Aref_ << nl
<< "# CofR : " << coordSys_.origin() << nl
<< "# Time" << tab << "Cm" << tab << "Cd" << tab << "Cl" << tab
<< "Cl(f)" << tab << "Cl(r)";
} }
else if (i == 1) else if (i == 1)
{ {
// bin coeff data // bin coeff data
file(i) writeHeader(file(i), "Force coefficient bins");
<< "# bins : " << nBin_ << nl writeHeaderValue(file(i), "bins", nBin_);
<< "# start : " << binMin_ << nl writeHeaderValue(file(i), "start", binMin_);
<< "# delta : " << binDx_ << nl writeHeaderValue(file(i), "delta", binDx_);
<< "# direction : " << binDir_ << nl writeHeaderValue(file(i), "direction", binDir_);
<< "# Time";
vectorField binPoints(nBin_);
writeCommented(file(i), "x co-ords :");
forAll(binPoints, pointI)
{
binPoints[pointI] = (binMin_ + (pointI + 1)*binDx_)*binDir_;
file(i) << tab << binPoints[pointI].x();
}
file(i) << nl;
writeCommented(file(i), "y co-ords :");
forAll(binPoints, pointI)
{
file(i) << tab << binPoints[pointI].y();
}
file(i) << nl;
writeCommented(file(i), "z co-ords :");
forAll(binPoints, pointI)
{
file(i) << tab << binPoints[pointI].z();
}
file(i) << nl;
writeCommented(file(i), "Time");
for (label j = 0; j < nBin_; j++) for (label j = 0; j < nBin_; j++)
{ {
const word jn('[' + Foam::name(j) + ']'); const word jn('[' + Foam::name(j) + ']');
writeTabbed(file(i), "Cm" + jn);
file(i) writeTabbed(file(i), "Cd" + jn);
<< tab << "Cm" << jn << tab << "Cd" << jn << tab << "Cl" << jn; writeTabbed(file(i), "Cl" + jn);
} }
} }
else else
@ -193,9 +224,8 @@ void Foam::forceCoeffs::write()
scalar Clr = Cl/2.0 - Cm; scalar Clr = Cl/2.0 - Cm;
file(0) file(0)
<< obr_.time().value() << tab << obr_.time().value() << tab << Cm << tab << Cd
<< Cm << tab << Cd << tab << Cl << tab << Clf << tab << Clr << tab << Cl << tab << Clf << tab << Clr << endl;
<< endl;
if (log_) if (log_)
{ {

View File

@ -73,11 +73,13 @@ void Foam::forces::writeFileHeader(const label i)
{ {
// force data // force data
writeHeader(file(i), "Forces");
writeHeaderValue(file(i), "CofR", coordSys_.origin());
writeCommented(file(i), "Time");
file(i) file(i)
<< "# CofR : " << coordSys_.origin() << nl << "forces[pressure,viscous,porous] "
<< "# Time" << tab << "moment[pressure,viscous,porous]";
<< "forces(pressure,viscous,porous) "
<< "moment(pressure,viscous,porous)";
if (localSystem_) if (localSystem_)
{ {
@ -91,32 +93,54 @@ void Foam::forces::writeFileHeader(const label i)
{ {
// bin data // bin data
file(i) writeHeader(file(i), "Force bins");
<< "# bins : " << nBin_ << nl writeHeaderValue(file(i), "bins", nBin_);
<< "# start : " << binMin_ << nl writeHeaderValue(file(i), "start", binMin_);
<< "# delta : " << binDx_ << nl writeHeaderValue(file(i), "delta", binDx_);
<< "# direction : " << binDir_ << nl writeHeaderValue(file(i), "direction", binDir_);
<< "# Time";
vectorField binPoints(nBin_);
writeCommented(file(i), "x co-ords :");
forAll(binPoints, pointI)
{
binPoints[pointI] = (binMin_ + (pointI + 1)*binDx_)*binDir_;
file(i) << tab << binPoints[pointI].x();
}
file(i) << nl;
writeCommented(file(i), "y co-ords :");
forAll(binPoints, pointI)
{
file(i) << tab << binPoints[pointI].y();
}
file(i) << nl;
writeCommented(file(i), "z co-ords :");
forAll(binPoints, pointI)
{
file(i) << tab << binPoints[pointI].z();
}
file(i) << nl;
writeCommented(file(i), "Time");
for (label j = 0; j < nBin_; j++) for (label j = 0; j < nBin_; j++)
{ {
const word jn('[' + Foam::name(j) + ']'); const word jn('[' + Foam::name(j) + ']');
const word f("forces" + jn + "[pressure,viscous,porous]");
const word m("moments" + jn + "[pressure,viscous,porous]");
file(i) file(i)<< tab << f << tab << m;
<< tab
<< "forces" << jn << "(pressure,viscous,porous) "
<< "moment" << jn << "(pressure,viscous,porous)";
} }
if (localSystem_) if (localSystem_)
{ {
for (label j = 0; j < nBin_; j++) for (label j = 0; j < nBin_; j++)
{ {
const word jn('[' + Foam::name(j) + ']'); const word jn('[' + Foam::name(j) + ']');
const word f("localForces" + jn + "[pressure,viscous,porous]");
const word m("localMoments" + jn + "[pressure,viscous,porous]");
file(i) file(i)<< tab << f << tab << m;
<< tab
<< "localForces" << jn << "(pressure,viscous,porous) "
<< "localMoments" << jn << "(pressure,viscous,porous)";
} }
} }
} }
@ -370,28 +394,24 @@ void Foam::forces::writeForces()
if (log_) if (log_)
{ {
Info<< type() << " " << name_ << " output:" << nl Info<< type() << " " << name_ << " output:" << nl
<< " forces(pressure,viscous,porous) = (" << " sum of forces:" << nl
<< sum(force_[0]) << "," << " pressure : " << sum(force_[0]) << nl
<< sum(force_[1]) << "," << " viscous : " << sum(force_[1]) << nl
<< sum(force_[2]) << ")" << nl << " porous : " << sum(force_[2]) << nl
<< " moment(pressure,viscous,porous) = (" << " sum of moments:" << nl
<< sum(moment_[0]) << "," << " pressure : " << sum(moment_[0]) << nl
<< sum(moment_[1]) << "," << " viscous : " << sum(moment_[1]) << nl
<< sum(moment_[2]) << ")" << " porous : " << sum(moment_[2])
<< nl; << endl;
} }
file(0) << obr_.time().value() << tab file(0) << obr_.time().value() << tab << setw(1) << '['
<< "(" << sum(force_[0]) << setw(1) << ','
<< sum(force_[0]) << "," << sum(force_[1]) << setw(1) << ","
<< sum(force_[1]) << "," << sum(force_[2]) << setw(3) << "] ["
<< sum(force_[2]) << sum(moment_[0]) << setw(1) << ","
<< ") " << sum(moment_[1]) << setw(1) << ","
<< "(" << sum(moment_[2]) << setw(1) << "]"
<< sum(moment_[0]) << ","
<< sum(moment_[1]) << ","
<< sum(moment_[2])
<< ")"
<< endl; << endl;
if (localSystem_) if (localSystem_)
@ -403,17 +423,13 @@ void Foam::forces::writeForces()
vectorField localMomentT(coordSys_.localVector(moment_[1])); vectorField localMomentT(coordSys_.localVector(moment_[1]));
vectorField localMomentP(coordSys_.localVector(moment_[2])); vectorField localMomentP(coordSys_.localVector(moment_[2]));
file(0) << obr_.time().value() << tab file(0) << obr_.time().value() << tab << setw(1) << "["
<< "(" << sum(localForceN) << setw(1) << ","
<< sum(localForceN) << "," << sum(localForceT) << setw(1) << ","
<< sum(localForceT) << "," << sum(localForceP) << setw(3) << "] ["
<< sum(localForceP) << sum(localMomentN) << setw(1) << ","
<< ") " << sum(localMomentT) << setw(1) << ","
<< "(" << sum(localMomentP) << setw(1) << "]"
<< sum(localMomentN) << ","
<< sum(localMomentT) << ","
<< sum(localMomentP)
<< ")"
<< endl; << endl;
} }
} }
@ -448,9 +464,13 @@ void Foam::forces::writeBins()
forAll(f[0], i) forAll(f[0], i)
{ {
file(1) file(1)
<< tab << tab << setw(1) << "["
<< "(" << f[0][i] << "," << f[1][i] << "," << f[2][i] << ") " << f[0][i] << setw(1) << ","
<< "(" << m[0][i] << "," << m[1][i] << "," << m[2][i] << ")"; << f[1][i] << setw(1) << ","
<< f[2][i] << setw(3) << "] ["
<< m[0][i] << setw(1) << ","
<< m[1][i] << setw(1) << ","
<< m[2][i] << setw(1) << "]";
} }
if (localSystem_) if (localSystem_)
@ -480,9 +500,13 @@ void Foam::forces::writeBins()
forAll(lf[0], i) forAll(lf[0], i)
{ {
file(1) file(1)
<< tab << tab << setw(1) << "["
<< "(" << lf[0][i] << "," << lf[1][i] << "," << lf[2][i] << ") " << lf[0][i] << setw(1) << ","
<< "(" << lm[0][i] << "," << lm[1][i] << "," << lm[2][i] << ")"; << lf[1][i] << setw(1) << ","
<< lf[2][i] << setw(3) << "] ["
<< lm[0][i] << setw(1) << ","
<< lm[1][i] << setw(1) << ","
<< lm[2][i] << setw(1) << "]";
} }
} }

View File

@ -125,29 +125,16 @@ void Foam::calcFvcDiv::read(const dictionary& dict)
{ {
dict.lookup("fieldName") >> fieldName_; dict.lookup("fieldName") >> fieldName_;
dict.lookup("resultName") >> resultName_; dict.lookup("resultName") >> resultName_;
if (resultName_ == "none")
{
resultName_ = "fvc::div(" + fieldName_ + ")";
}
} }
} }
void Foam::calcFvcDiv::execute() void Foam::calcFvcDiv::execute()
{
// Do nothing - only valid on write
}
void Foam::calcFvcDiv::end()
{
// Do nothing - only valid on write
}
void Foam::calcFvcDiv::timeSet()
{
// Do nothing - only valid on write
}
void Foam::calcFvcDiv::write()
{ {
if (active_) if (active_)
{ {
@ -165,4 +152,34 @@ void Foam::calcFvcDiv::write()
} }
void Foam::calcFvcDiv::end()
{
// Do nothing
}
void Foam::calcFvcDiv::timeSet()
{
// Do nothing
}
void Foam::calcFvcDiv::write()
{
if (active_)
{
if (obr_.foundObject<regIOobject>(resultName_))
{
const regIOobject& field =
obr_.lookupObject<regIOobject>(resultName_);
Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << field.name() << nl << endl;
field.write();
}
}
}
// ************************************************************************* // // ************************************************************************* //

View File

@ -38,25 +38,14 @@ void Foam::calcFvcDiv::calcDiv
{ {
const fvMesh& mesh = refCast<const fvMesh>(obr_); const fvMesh& mesh = refCast<const fvMesh>(obr_);
word divName = resultName;
if (divName == "none")
{
divName = "fvc::div(" + fieldName + ")";
}
if (mesh.foundObject<FieldType>(fieldName)) if (mesh.foundObject<FieldType>(fieldName))
{ {
const FieldType& vf = mesh.lookupObject<FieldType>(fieldName); const FieldType& vf = mesh.lookupObject<FieldType>(fieldName);
volScalarField& field = divField(divName, vf.dimensions()); volScalarField& field = divField(resultName, vf.dimensions());
field = fvc::div(vf); field = fvc::div(vf);
Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << field.name() << nl << endl;
field.write();
processed = true; processed = true;
} }
} }

View File

@ -87,29 +87,16 @@ void Foam::calcFvcGrad::read(const dictionary& dict)
{ {
dict.lookup("fieldName") >> fieldName_; dict.lookup("fieldName") >> fieldName_;
dict.lookup("resultName") >> resultName_; dict.lookup("resultName") >> resultName_;
if (resultName_ == "none")
{
resultName_ = "fvc::grad(" + fieldName_ + ")";
}
} }
} }
void Foam::calcFvcGrad::execute() void Foam::calcFvcGrad::execute()
{
// Do nothing - only valid on write
}
void Foam::calcFvcGrad::end()
{
// Do nothing - only valid on write
}
void Foam::calcFvcGrad::timeSet()
{
// Do nothing - only valid on write
}
void Foam::calcFvcGrad::write()
{ {
if (active_) if (active_)
{ {
@ -127,4 +114,34 @@ void Foam::calcFvcGrad::write()
} }
void Foam::calcFvcGrad::end()
{
// Do nothing
}
void Foam::calcFvcGrad::timeSet()
{
// Do nothing
}
void Foam::calcFvcGrad::write()
{
if (active_)
{
if (obr_.foundObject<regIOobject>(resultName_))
{
const regIOobject& field =
obr_.lookupObject<regIOobject>(resultName_);
Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << field.name() << nl << endl;
field.write();
}
}
}
// ************************************************************************* // // ************************************************************************* //

View File

@ -91,40 +91,25 @@ void Foam::calcFvcGrad::calcGrad
const fvMesh& mesh = refCast<const fvMesh>(obr_); const fvMesh& mesh = refCast<const fvMesh>(obr_);
word gradName = resultName;
if (gradName == "none")
{
gradName = "fvc::grad(" + fieldName + ")";
}
if (mesh.foundObject<vfType>(fieldName)) if (mesh.foundObject<vfType>(fieldName))
{ {
const vfType& vf = mesh.lookupObject<vfType>(fieldName); const vfType& vf = mesh.lookupObject<vfType>(fieldName);
vfGradType& field = gradField<Type>(gradName, vf.dimensions()); vfGradType& field = gradField<Type>(resultName, vf.dimensions());
field = fvc::grad(vf); field = fvc::grad(vf);
Info<< type() << " output:" << nl
<< " writing " << field.name() << " field" << nl << endl;
field.write();
processed = true; processed = true;
} }
else if (mesh.foundObject<sfType>(fieldName)) else if (mesh.foundObject<sfType>(fieldName))
{ {
const sfType& sf = mesh.lookupObject<sfType>(fieldName); const sfType& sf = mesh.lookupObject<sfType>(fieldName);
vfGradType& field = gradField<Type>(gradName, sf.dimensions()); vfGradType& field = gradField<Type>(resultName, sf.dimensions());
field = fvc::grad(sf); field = fvc::grad(sf);
Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << field.name() << nl << endl;
field.write();
processed = true; processed = true;
} }
} }

View File

@ -87,29 +87,16 @@ void Foam::calcMag::read(const dictionary& dict)
{ {
dict.lookup("fieldName") >> fieldName_; dict.lookup("fieldName") >> fieldName_;
dict.lookup("resultName") >> resultName_; dict.lookup("resultName") >> resultName_;
if (resultName_ == "none")
{
resultName_ = "mag(" + fieldName_ + ")";
}
} }
} }
void Foam::calcMag::execute() void Foam::calcMag::execute()
{
// Do nothing - only valid on write
}
void Foam::calcMag::end()
{
// Do nothing - only valid on write
}
void Foam::calcMag::timeSet()
{
// Do nothing - only valid on write
}
void Foam::calcMag::write()
{ {
if (active_) if (active_)
{ {
@ -130,4 +117,34 @@ void Foam::calcMag::write()
} }
void Foam::calcMag::end()
{
// Do nothing
}
void Foam::calcMag::timeSet()
{
// Do nothing
}
void Foam::calcMag::write()
{
if (active_)
{
if (obr_.foundObject<regIOobject>(resultName_))
{
const regIOobject& field =
obr_.lookupObject<regIOobject>(resultName_);
Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << field.name() << nl << endl;
field.write();
}
}
}
// ************************************************************************* // // ************************************************************************* //

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2012-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -80,26 +80,15 @@ void Foam::calcMag::calc
const fvMesh& mesh = refCast<const fvMesh>(obr_); const fvMesh& mesh = refCast<const fvMesh>(obr_);
word magName = resultName;
if (magName == "none")
{
magName = "mag(" + fieldName + ")";
}
if (mesh.foundObject<vfType>(fieldName)) if (mesh.foundObject<vfType>(fieldName))
{ {
const vfType& vf = mesh.lookupObject<vfType>(fieldName); const vfType& vf = mesh.lookupObject<vfType>(fieldName);
volScalarField& field = volScalarField& field =
magField<volScalarField>(magName, vf.dimensions()); magField<volScalarField>(resultName_, vf.dimensions());
field = mag(vf); field = mag(vf);
Info<< type() << " output:" << nl
<< " writing " << field.name() << " field" << nl << endl;
field.write();
processed = true; processed = true;
} }
else if (mesh.foundObject<sfType>(fieldName)) else if (mesh.foundObject<sfType>(fieldName))
@ -107,15 +96,10 @@ void Foam::calcMag::calc
const sfType& sf = mesh.lookupObject<sfType>(fieldName); const sfType& sf = mesh.lookupObject<sfType>(fieldName);
surfaceScalarField& field = surfaceScalarField& field =
magField<surfaceScalarField>(magName, sf.dimensions()); magField<surfaceScalarField>(resultName_, sf.dimensions());
field = mag(sf); field = mag(sf);
Info<< type() << " output:" << nl
<< " writing " << field.name() << " field" << nl << endl;
field.write();
processed = true; processed = true;
} }
} }

View File

@ -154,24 +154,6 @@ void Foam::CourantNo::read(const dictionary& dict)
void Foam::CourantNo::execute() void Foam::CourantNo::execute()
{
// Do nothing - only valid on write
}
void Foam::CourantNo::end()
{
// Do nothing - only valid on write
}
void Foam::CourantNo::timeSet()
{
// Do nothing - only valid on write
}
void Foam::CourantNo::write()
{ {
if (active_) if (active_)
{ {
@ -197,6 +179,28 @@ void Foam::CourantNo::write()
iField = 0.5*sumPhi/mesh.V().field()*mesh.time().deltaTValue(); iField = 0.5*sumPhi/mesh.V().field()*mesh.time().deltaTValue();
CourantNo.correctBoundaryConditions(); CourantNo.correctBoundaryConditions();
}
}
void Foam::CourantNo::end()
{
// Do nothing
}
void Foam::CourantNo::timeSet()
{
// Do nothing
}
void Foam::CourantNo::write()
{
if (active_)
{
const volScalarField& CourantNo =
obr_.lookupObject<volScalarField>(type());
Info<< type() << " " << name_ << " output:" << nl Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << CourantNo.name() << nl << " writing field " << CourantNo.name() << nl

View File

@ -42,9 +42,11 @@ defineTypeNameAndDebug(DESModelRegions, 0);
void Foam::DESModelRegions::writeFileHeader(const label i) void Foam::DESModelRegions::writeFileHeader(const label i)
{ {
file() << "# DES model region coverage (% volume)" << nl writeHeader(file(), "DES model region coverage (% volume)");
<< "# time " << token::TAB << "LES" << token::TAB << "RAS"
<< endl; writeCommented(file(), "Time");
writeTabbed(file(), "LES");
writeTabbed(file(), "RAS");
} }
@ -127,24 +129,6 @@ void Foam::DESModelRegions::read(const dictionary& dict)
void Foam::DESModelRegions::execute() void Foam::DESModelRegions::execute()
{
// Do nothing - only valid on write
}
void Foam::DESModelRegions::end()
{
// Do nothing - only valid on write
}
void Foam::DESModelRegions::timeSet()
{
// Do nothing - only valid on write
}
void Foam::DESModelRegions::write()
{ {
typedef incompressible::turbulenceModel icoModel; typedef incompressible::turbulenceModel icoModel;
typedef incompressible::DESModel icoDESModel; typedef incompressible::DESModel icoDESModel;
@ -206,19 +190,17 @@ void Foam::DESModelRegions::write()
if (Pstream::master() && log_) if (Pstream::master() && log_)
{ {
file() << obr_.time().timeName() << token::TAB file() << obr_.time().value()
<< prc << token::TAB << 100.0 - prc << endl; << token::TAB << prc
<< token::TAB << 100.0 - prc
<< endl;
} }
if (log_) if (log_)
{ {
Info<< " LES = " << prc << " % (volume)" << nl Info<< " LES = " << prc << " % (volume)" << nl
<< " RAS = " << 100.0 - prc << " % (volume)" << nl << " RAS = " << 100.0 - prc << " % (volume)" << endl;
<< " writing field " << DESModelRegions.name() << nl
<< endl;
} }
DESModelRegions.write();
} }
else else
{ {
@ -232,4 +214,33 @@ void Foam::DESModelRegions::write()
} }
void Foam::DESModelRegions::end()
{
// Do nothing
}
void Foam::DESModelRegions::timeSet()
{
// Do nothing
}
void Foam::DESModelRegions::write()
{
if (log_)
{
const volScalarField& DESModelRegions =
obr_.lookupObject<volScalarField>(type());
Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << DESModelRegions.name() << nl
<< endl;
DESModelRegions.write();
}
}
// ************************************************************************* // // ************************************************************************* //

View File

@ -115,24 +115,6 @@ void Foam::Lambda2::read(const dictionary& dict)
void Foam::Lambda2::execute() void Foam::Lambda2::execute()
{
// Do nothing - only valid on write
}
void Foam::Lambda2::end()
{
// Do nothing - only valid on write
}
void Foam::Lambda2::timeSet()
{
// Do nothing - only valid on write
}
void Foam::Lambda2::write()
{ {
if (active_) if (active_)
{ {
@ -156,6 +138,28 @@ void Foam::Lambda2::write()
); );
Lambda2 = -eigenValues(SSplusWW)().component(vector::Y); Lambda2 = -eigenValues(SSplusWW)().component(vector::Y);
}
}
void Foam::Lambda2::end()
{
// Do nothing
}
void Foam::Lambda2::timeSet()
{
// Do nothing
}
void Foam::Lambda2::write()
{
if (active_)
{
const volScalarField& Lambda2 =
obr_.lookupObject<volScalarField>(type());
Info<< type() << " " << name_ << " output:" << nl Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << Lambda2.name() << nl << " writing field " << Lambda2.name() << nl

View File

@ -119,23 +119,6 @@ void Foam::Peclet::read(const dictionary& dict)
void Foam::Peclet::execute() void Foam::Peclet::execute()
{
// Do nothing - only valid on write
}
void Foam::Peclet::end()
{
// Do nothing - only valid on write
}
void Foam::Peclet::timeSet()
{
// Do nothing - only valid on write
}
void Foam::Peclet::write()
{ {
typedef compressible::turbulenceModel cmpTurbModel; typedef compressible::turbulenceModel cmpTurbModel;
typedef incompressible::turbulenceModel icoTurbModel; typedef incompressible::turbulenceModel icoTurbModel;
@ -208,6 +191,27 @@ void Foam::Peclet::write()
*mesh.surfaceInterpolation::deltaCoeffs() *mesh.surfaceInterpolation::deltaCoeffs()
*fvc::interpolate(nuEff) *fvc::interpolate(nuEff)
); );
}
}
void Foam::Peclet::end()
{
// Do nothing - only valid on write
}
void Foam::Peclet::timeSet()
{
// Do nothing - only valid on write
}
void Foam::Peclet::write()
{
if (active_)
{
const surfaceScalarField& Peclet =
obr_.lookupObject<surfaceScalarField>(type());
Info<< type() << " " << name_ << " output:" << nl Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << Peclet.name() << nl << " writing field " << Peclet.name() << nl

View File

@ -114,24 +114,6 @@ void Foam::Q::read(const dictionary& dict)
void Foam::Q::execute() void Foam::Q::execute()
{
// Do nothing - only valid on write
}
void Foam::Q::end()
{
// Do nothing - only valid on write
}
void Foam::Q::timeSet()
{
// Do nothing - only valid on write
}
void Foam::Q::write()
{ {
if (active_) if (active_)
{ {
@ -149,6 +131,28 @@ void Foam::Q::write()
); );
Q = 0.5*(sqr(tr(gradU)) - tr(((gradU) & (gradU)))); Q = 0.5*(sqr(tr(gradU)) - tr(((gradU) & (gradU))));
}
}
void Foam::Q::end()
{
// Do nothing
}
void Foam::Q::timeSet()
{
// Do nothing
}
void Foam::Q::write()
{
if (active_)
{
const volScalarField& Q =
obr_.lookupObject<volScalarField>(type());
Info<< type() << " " << name_ << " output:" << nl Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << Q.name() << nl << " writing field " << Q.name() << nl

View File

@ -291,24 +291,6 @@ void Foam::pressureTools::read(const dictionary& dict)
void Foam::pressureTools::execute() void Foam::pressureTools::execute()
{
// Do nothing - only valid on write
}
void Foam::pressureTools::end()
{
// Do nothing - only valid on write
}
void Foam::pressureTools::timeSet()
{
// Do nothing - only valid on write
}
void Foam::pressureTools::write()
{ {
if (active_) if (active_)
{ {
@ -321,6 +303,28 @@ void Foam::pressureTools::write()
); );
pResult == convertToCoeff(rhoScale(p)*p + pDyn(p) + pRef()); pResult == convertToCoeff(rhoScale(p)*p + pDyn(p) + pRef());
}
}
void Foam::pressureTools::end()
{
// Do nothing
}
void Foam::pressureTools::timeSet()
{
// Do nothing
}
void Foam::pressureTools::write()
{
if (active_)
{
const volScalarField& pResult =
obr_.lookupObject<volScalarField>(pName());
Info<< type() << " " << name_ << " output:" << nl Info<< type() << " " << name_ << " output:" << nl
<< " writing field " << pResult.name() << nl << " writing field " << pResult.name() << nl

View File

@ -43,9 +43,11 @@ defineTypeNameAndDebug(wallShearStress, 0);
void Foam::wallShearStress::writeFileHeader(const label i) void Foam::wallShearStress::writeFileHeader(const label i)
{ {
// Add headers to output data // Add headers to output data
file() << "# Wall shear stress" << nl writeHeader(file(), "Wall shear stress");
<< "# time " << token::TAB << "patch" << token::TAB writeCommented(file(), "Time");
<< "min" << token::TAB << "max" << endl; writeTabbed(file(), "patch");
writeTabbed(file(), "min");
writeTabbed(file(), "max");
} }
@ -73,9 +75,11 @@ void Foam::wallShearStress::calcShearStress
if (Pstream::master()) if (Pstream::master())
{ {
file() << mesh.time().timeName() << token::TAB file() << mesh.time().value()
<< pp.name() << token::TAB << minSsp << token::TAB << pp.name()
<< token::TAB << maxSsp << endl; << token::TAB << minSsp
<< token::TAB << maxSsp
<< endl;
} }
if (log_) if (log_)
@ -220,24 +224,6 @@ void Foam::wallShearStress::read(const dictionary& dict)
void Foam::wallShearStress::execute() void Foam::wallShearStress::execute()
{
// Do nothing - only valid on write
}
void Foam::wallShearStress::end()
{
// Do nothing - only valid on write
}
void Foam::wallShearStress::timeSet()
{
// Do nothing - only valid on write
}
void Foam::wallShearStress::write()
{ {
typedef compressible::turbulenceModel cmpModel; typedef compressible::turbulenceModel cmpModel;
typedef incompressible::turbulenceModel icoModel; typedef incompressible::turbulenceModel icoModel;
@ -282,8 +268,31 @@ void Foam::wallShearStress::write()
<< "database" << exit(FatalError); << "database" << exit(FatalError);
} }
calcShearStress(mesh, Reff(), wallShearStress); calcShearStress(mesh, Reff(), wallShearStress);
}
}
void Foam::wallShearStress::end()
{
// Do nothing
}
void Foam::wallShearStress::timeSet()
{
// Do nothing
}
void Foam::wallShearStress::write()
{
if (active_)
{
functionObjectFile::write();
const volVectorField& wallShearStress =
obr_.lookupObject<volVectorField>(type());
if (log_) if (log_)
{ {

View File

@ -44,10 +44,13 @@ defineTypeNameAndDebug(yPlusLES, 0);
void Foam::yPlusLES::writeFileHeader(const label i) void Foam::yPlusLES::writeFileHeader(const label i)
{ {
file() << "# y+ (LES)" << nl writeHeader(file(), "y+ (LES)");
<< "# time " << token::TAB << "patch" << token::TAB
<< "min" << token::TAB << "max" << token::TAB << "average" writeCommented(file(), "Time");
<< endl; writeTabbed(file(), "patch");
writeTabbed(file(), "min");
writeTabbed(file(), "max");
writeTabbed(file(), "average");
} }
@ -100,10 +103,12 @@ void Foam::yPlusLES::calcIncompressibleYPlus
if (Pstream::master()) if (Pstream::master())
{ {
file() << obr_.time().value() << token::TAB file() << obr_.time().value()
<< currPatch.name() << token::TAB << token::TAB << currPatch.name()
<< minYp << token::TAB << maxYp << token::TAB << token::TAB << minYp
<< avgYp << endl; << token::TAB << maxYp
<< token::TAB << avgYp
<< endl;
} }
} }
} }
@ -166,10 +171,12 @@ void Foam::yPlusLES::calcCompressibleYPlus
if (Pstream::master()) if (Pstream::master())
{ {
file() << obr_.time().value() << token::TAB file() << obr_.time().value()
<< currPatch.name() << token::TAB << token::TAB << currPatch.name()
<< minYp << token::TAB << maxYp << token::TAB << token::TAB << minYp
<< avgYp << endl; << token::TAB << maxYp
<< token::TAB << avgYp
<< endl;
} }
} }
} }
@ -261,24 +268,6 @@ void Foam::yPlusLES::read(const dictionary& dict)
void Foam::yPlusLES::execute() void Foam::yPlusLES::execute()
{
// Do nothing - only valid on write
}
void Foam::yPlusLES::end()
{
// Do nothing - only valid on write
}
void Foam::yPlusLES::timeSet()
{
// Do nothing - only valid on write
}
void Foam::yPlusLES::write()
{ {
if (active_) if (active_)
{ {
@ -310,6 +299,30 @@ void Foam::yPlusLES::write()
{ {
calcIncompressibleYPlus(mesh, U, yPlusLES); calcIncompressibleYPlus(mesh, U, yPlusLES);
} }
}
}
void Foam::yPlusLES::end()
{
// Do nothing
}
void Foam::yPlusLES::timeSet()
{
// Do nothing
}
void Foam::yPlusLES::write()
{
if (active_)
{
functionObjectFile::write();
const volScalarField& yPlusLES =
obr_.lookupObject<volScalarField>(type());
if (log_) if (log_)
{ {

View File

@ -46,10 +46,13 @@ defineTypeNameAndDebug(yPlusRAS, 0);
void Foam::yPlusRAS::writeFileHeader(const label i) void Foam::yPlusRAS::writeFileHeader(const label i)
{ {
file() << "# y+ (RAS)" << nl writeHeader(file(), "y+ (RAS)");
<< "# time " << token::TAB << "patch" << token::TAB
<< "min" << token::TAB << "max" << token::TAB << "average" writeCommented(file(), "Time");
<< endl; writeTabbed(file(), "patch");
writeTabbed(file(), "min");
writeTabbed(file(), "max");
writeTabbed(file(), "average");
} }
@ -95,10 +98,12 @@ void Foam::yPlusRAS::calcIncompressibleYPlus
if (Pstream::master()) if (Pstream::master())
{ {
file() << obr_.time().value() << token::TAB file() << obr_.time().value()
<< nutPw.patch().name() << token::TAB << token::TAB << nutPw.patch().name()
<< minYp << token::TAB << maxYp << token::TAB << token::TAB << minYp
<< avgYp << endl; << token::TAB << maxYp
<< token::TAB << avgYp
<< endl;
} }
} }
} }
@ -153,10 +158,12 @@ void Foam::yPlusRAS::calcCompressibleYPlus
if (Pstream::master()) if (Pstream::master())
{ {
file() << obr_.time().value() << token::TAB file() << obr_.time().value()
<< mutPw.patch().name() << token::TAB << token::TAB << mutPw.patch().name()
<< minYp << token::TAB << maxYp << token::TAB << token::TAB << minYp
<< avgYp << endl; << token::TAB << maxYp
<< token::TAB << avgYp
<< endl;
} }
} }
} }
@ -248,24 +255,6 @@ void Foam::yPlusRAS::read(const dictionary& dict)
void Foam::yPlusRAS::execute() void Foam::yPlusRAS::execute()
{
// Do nothing - only valid on write
}
void Foam::yPlusRAS::end()
{
// Do nothing - only valid on write
}
void Foam::yPlusRAS::timeSet()
{
// Do nothing - only valid on write
}
void Foam::yPlusRAS::write()
{ {
if (active_) if (active_)
{ {
@ -295,6 +284,30 @@ void Foam::yPlusRAS::write()
{ {
calcIncompressibleYPlus(mesh, yPlusRAS); calcIncompressibleYPlus(mesh, yPlusRAS);
} }
}
}
void Foam::yPlusRAS::end()
{
// Do nothing
}
void Foam::yPlusRAS::timeSet()
{
// Do nothing
}
void Foam::yPlusRAS::write()
{
if (active_)
{
functionObjectFile::write();
const volScalarField& yPlusRAS =
obr_.lookupObject<volScalarField>(type());
if (log_) if (log_)
{ {

View File

@ -440,6 +440,7 @@ kinematicSingleLayer::kinematicSingleLayer
cumulativeContErr_(0.0), cumulativeContErr_(0.0),
deltaSmall_("deltaSmall", dimLength, SMALL), deltaSmall_("deltaSmall", dimLength, SMALL),
deltaCoLimit_(solution().lookupOrDefault("deltaCoLimit", 1e-4)),
rho_ rho_
( (
@ -898,15 +899,17 @@ scalar kinematicSingleLayer::CourantNumber() const
if (regionMesh().nInternalFaces() > 0) if (regionMesh().nInternalFaces() > 0)
{ {
const scalarField sumPhi(fvc::surfaceSum(mag(phi_))); const scalarField sumPhi
(
fvc::surfaceSum(mag(phi_))().internalField()
/ (deltaRho_.internalField() + ROOTVSMALL)
);
const scalarField& V = regionMesh().V(); forAll(delta_, i)
forAll(deltaRho_, i)
{ {
if (deltaRho_[i] > SMALL) if (delta_[i] > deltaCoLimit_)
{ {
CoNum = max(CoNum, sumPhi[i]/deltaRho_[i]/V[i]); CoNum = max(CoNum, sumPhi[i]/(delta_[i]*magSf()[i]));
} }
} }

View File

@ -100,6 +100,9 @@ protected:
//- Small delta //- Small delta
const dimensionedScalar deltaSmall_; const dimensionedScalar deltaSmall_;
//- Film thickness above which Courant number calculation in valid
scalar deltaCoLimit_;
// Thermo properties // Thermo properties

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -45,11 +45,35 @@ addToRunTimeSelectionTable(injectionModel, removeInjection, dictionary);
removeInjection::removeInjection removeInjection::removeInjection
( (
const surfaceFilmModel& owner, const surfaceFilmModel& owner,
const dictionary& const dictionary& dict
) )
: :
injectionModel(owner) injectionModel(type(), owner, dict),
{} deltaStable_(coeffs_.lookupOrDefault<scalar>("deltaStable", 0.0)),
mask_(owner.regionMesh().nCells(), -1)
{
wordReList patches;
if (coeffs_.readIfPresent("patches", patches))
{
Info<< " applying to patches:" << nl;
const polyBoundaryMesh& pbm = owner.regionMesh().boundaryMesh();
const labelHashSet patchSet = pbm.patchSet(patches);
forAllConstIter(labelHashSet, patchSet, iter)
{
label patchI = iter.key();
const polyPatch& pp = pbm[patchI];
UIndirectList<scalar>(mask_, pp.faceCells()) = 1.0;
Info<< " " << pp.name() << endl;
}
}
else
{
Info<< " applying to all patches" << endl;
mask_ = 1.0;
}
}
// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * // // * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * //
@ -64,11 +88,23 @@ void removeInjection::correct
( (
scalarField& availableMass, scalarField& availableMass,
scalarField& massToInject, scalarField& massToInject,
scalarField& scalarField& diameterToInject
) )
{ {
massToInject = availableMass; const scalarField& delta = owner().delta();
availableMass = 0.0; const scalarField& rho = owner().rho();
const scalarField& magSf = owner().magSf();
forAll(delta, cellI)
{
if (mask_[cellI] > 0)
{
scalar ddelta = max(0.0, delta[cellI] - deltaStable_);
scalar dMass = ddelta*rho[cellI]*magSf[cellI];
massToInject[cellI] += dMass;
availableMass[cellI] -= dMass;
}
}
} }

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -65,6 +65,16 @@ private:
void operator=(const removeInjection&); void operator=(const removeInjection&);
protected:
//- Stable film thickness - mass only removed if thickness execeeds
// this threhold value
scalar deltaStable_;
//- Mask per cell to indicate whether mass can be removed
scalarField mask_;
public: public:
//- Runtime type information //- Runtime type information

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -248,6 +248,7 @@ Foam::tmp<Foam::vectorField> Foam::sampledPatch::sample
return sampleField(vField); return sampleField(vField);
} }
Foam::tmp<Foam::sphericalTensorField> Foam::sampledPatch::sample Foam::tmp<Foam::sphericalTensorField> Foam::sampledPatch::sample
( (
const volSphericalTensorField& vField const volSphericalTensorField& vField
@ -292,6 +293,7 @@ Foam::tmp<Foam::vectorField> Foam::sampledPatch::sample
return sampleField(sField); return sampleField(sField);
} }
Foam::tmp<Foam::sphericalTensorField> Foam::sampledPatch::sample Foam::tmp<Foam::sphericalTensorField> Foam::sampledPatch::sample
( (
const surfaceSphericalTensorField& sField const surfaceSphericalTensorField& sField
@ -318,6 +320,7 @@ Foam::tmp<Foam::tensorField> Foam::sampledPatch::sample
return sampleField(sField); return sampleField(sField);
} }
Foam::tmp<Foam::scalarField> Foam::sampledPatch::interpolate Foam::tmp<Foam::scalarField> Foam::sampledPatch::interpolate
( (
const interpolation<scalar>& interpolator const interpolation<scalar>& interpolator
@ -335,6 +338,7 @@ Foam::tmp<Foam::vectorField> Foam::sampledPatch::interpolate
return interpolateField(interpolator); return interpolateField(interpolator);
} }
Foam::tmp<Foam::sphericalTensorField> Foam::sampledPatch::interpolate Foam::tmp<Foam::sphericalTensorField> Foam::sampledPatch::interpolate
( (
const interpolation<sphericalTensor>& interpolator const interpolation<sphericalTensor>& interpolator

View File

@ -55,6 +55,7 @@ class sampledPatch
//- Private typedefs for convenience //- Private typedefs for convenience
typedef MeshedSurface<face> MeshStorage; typedef MeshedSurface<face> MeshStorage;
// Private data // Private data
//- Name of patches //- Name of patches
@ -78,16 +79,17 @@ class sampledPatch
//- Start indices (in patchFaceLabels_) of patches //- Start indices (in patchFaceLabels_) of patches
labelList patchStart_; labelList patchStart_;
// Private Member Functions // Private Member Functions
//- sample field on faces //- Sample field on faces
template<class Type> template<class Type>
tmp<Field<Type> > sampleField tmp<Field<Type> > sampleField
( (
const GeometricField<Type, fvPatchField, volMesh>& vField const GeometricField<Type, fvPatchField, volMesh>& vField
) const; ) const;
//- sample surface field on faces //- Sample surface field on faces
template<class Type> template<class Type>
tmp<Field<Type> > sampleField tmp<Field<Type> > sampleField
( (
@ -95,10 +97,9 @@ class sampledPatch
) const; ) const;
template<class Type> template<class Type>
tmp<Field<Type> > tmp<Field<Type> > interpolateField(const interpolation<Type>&) const;
interpolateField(const interpolation<Type>&) const;
//- remap action on triangulation or cleanup //- Re-map action on triangulation or cleanup
virtual void remapFaces(const labelUList& faceMap); virtual void remapFaces(const labelUList& faceMap);
@ -180,31 +181,32 @@ public:
} }
//- sample field on surface // Sample
//- Sample field on surface
virtual tmp<scalarField> sample virtual tmp<scalarField> sample
( (
const volScalarField& const volScalarField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<vectorField> sample virtual tmp<vectorField> sample
( (
const volVectorField& const volVectorField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<sphericalTensorField> sample virtual tmp<sphericalTensorField> sample
( (
const volSphericalTensorField& const volSphericalTensorField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<symmTensorField> sample virtual tmp<symmTensorField> sample
( (
const volSymmTensorField& const volSymmTensorField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<tensorField> sample virtual tmp<tensorField> sample
( (
const volTensorField& const volTensorField&
@ -240,32 +242,34 @@ public:
const surfaceTensorField& const surfaceTensorField&
) const; ) const;
//- interpolate field on surface
// Interpolate
//- Interpolate field on surface
virtual tmp<scalarField> interpolate virtual tmp<scalarField> interpolate
( (
const interpolation<scalar>& const interpolation<scalar>&
) const; ) const;
//- Interpolate field on surface
//- interpolate field on surface
virtual tmp<vectorField> interpolate virtual tmp<vectorField> interpolate
( (
const interpolation<vector>& const interpolation<vector>&
) const; ) const;
//- interpolate field on surface //- Interpolate field on surface
virtual tmp<sphericalTensorField> interpolate virtual tmp<sphericalTensorField> interpolate
( (
const interpolation<sphericalTensor>& const interpolation<sphericalTensor>&
) const; ) const;
//- interpolate field on surface //- Interpolate field on surface
virtual tmp<symmTensorField> interpolate virtual tmp<symmTensorField> interpolate
( (
const interpolation<symmTensor>& const interpolation<symmTensor>&
) const; ) const;
//- interpolate field on surface //- Interpolate field on surface
virtual tmp<tensorField> interpolate virtual tmp<tensorField> interpolate
( (
const interpolation<tensor>& const interpolation<tensor>&

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -204,6 +204,7 @@ Foam::tmp<Foam::vectorField> Foam::sampledPatchInternalField::interpolate
return interpolateField(interpolator); return interpolateField(interpolator);
} }
Foam::tmp<Foam::sphericalTensorField> Foam::tmp<Foam::sphericalTensorField>
Foam::sampledPatchInternalField::interpolate Foam::sampledPatchInternalField::interpolate
( (

View File

@ -74,6 +74,7 @@ class sampledPatchInternalField
template<class Type> template<class Type>
tmp<Field<Type> > interpolateField(const interpolation<Type>&) const; tmp<Field<Type> > interpolateField(const interpolation<Type>&) const;
public: public:
//- Runtime type information //- Runtime type information
@ -97,68 +98,72 @@ public:
// Member Functions // Member Functions
//- sample field on surface // Sample
//- Sample field on surface
virtual tmp<scalarField> sample virtual tmp<scalarField> sample
( (
const volScalarField& const volScalarField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<vectorField> sample virtual tmp<vectorField> sample
( (
const volVectorField& const volVectorField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<sphericalTensorField> sample virtual tmp<sphericalTensorField> sample
( (
const volSphericalTensorField& const volSphericalTensorField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<symmTensorField> sample virtual tmp<symmTensorField> sample
( (
const volSymmTensorField& const volSymmTensorField&
) const; ) const;
//- sample field on surface //- Sample field on surface
virtual tmp<tensorField> sample virtual tmp<tensorField> sample
( (
const volTensorField& const volTensorField&
) const; ) const;
//- interpolate field on surface // Interpolate
//- Interpolate field on surface
virtual tmp<scalarField> interpolate virtual tmp<scalarField> interpolate
( (
const interpolation<scalar>& const interpolation<scalar>&
) const; ) const;
//- Interpolate field on surface
//- interpolate field on surface
virtual tmp<vectorField> interpolate virtual tmp<vectorField> interpolate
( (
const interpolation<vector>& const interpolation<vector>&
) const; ) const;
//- interpolate field on surface //- Interpolate field on surface
virtual tmp<sphericalTensorField> interpolate virtual tmp<sphericalTensorField> interpolate
( (
const interpolation<sphericalTensor>& const interpolation<sphericalTensor>&
) const; ) const;
//- interpolate field on surface //- Interpolate field on surface
virtual tmp<symmTensorField> interpolate virtual tmp<symmTensorField> interpolate
( (
const interpolation<symmTensor>& const interpolation<symmTensor>&
) const; ) const;
//- interpolate field on surface //- Interpolate field on surface
virtual tmp<tensorField> interpolate virtual tmp<tensorField> interpolate
( (
const interpolation<tensor>& const interpolation<tensor>&
) const; ) const;
//- Write //- Write
virtual void print(Ostream&) const; virtual void print(Ostream&) const;
}; };

View File

@ -113,7 +113,7 @@ void Foam::sampledSurfaces::sampleAndWrite
) )
{ {
// interpolator for this field // interpolator for this field
autoPtr< interpolation<Type> > interpolator; autoPtr<interpolation<Type> > interpolatorPtr;
const word& fieldName = vField.name(); const word& fieldName = vField.name();
const fileName outputDir = outputPath_/vField.time().timeName(); const fileName outputDir = outputPath_/vField.time().timeName();
@ -126,16 +126,16 @@ void Foam::sampledSurfaces::sampleAndWrite
if (s.interpolate()) if (s.interpolate())
{ {
if (interpolator.empty()) if (interpolatorPtr.empty())
{ {
interpolator = interpolation<Type>::New interpolatorPtr = interpolation<Type>::New
( (
interpolationScheme_, interpolationScheme_,
vField vField
); );
} }
values = s.interpolate(interpolator()); values = s.interpolate(interpolatorPtr());
} }
else else
{ {

View File

@ -27,6 +27,11 @@ submodels/absorptionEmissionModel/greyMeanAbsorptionEmission/greyMeanAbsorptionE
submodels/absorptionEmissionModel/wideBandAbsorptionEmission/wideBandAbsorptionEmission.C submodels/absorptionEmissionModel/wideBandAbsorptionEmission/wideBandAbsorptionEmission.C
submodels/absorptionEmissionModel/greyMeanSolidAbsorptionEmission/greyMeanSolidAbsorptionEmission.C submodels/absorptionEmissionModel/greyMeanSolidAbsorptionEmission/greyMeanSolidAbsorptionEmission.C
/* Soot model */
submodels/sootModel/sootModel/sootModel.C
submodels/sootModel/sootModel/sootModelNew.C
submodels/sootModel/mixtureFractionSoot/mixtureFractionSoots.C
submodels/sootModel/noSoot/noSoot.C
/* Boundary conditions */ /* Boundary conditions */
derivedFvPatchFields/MarshakRadiation/MarshakRadiationFvPatchScalarField.C derivedFvPatchFields/MarshakRadiation/MarshakRadiationFvPatchScalarField.C

View File

@ -337,6 +337,17 @@ Foam::radiation::greyMeanAbsorptionEmission::ECont(const label bandI) const
} }
} }
} }
else
{
WarningIn
(
"tmp<volScalarField>"
"radiation::greyMeanAbsorptionEmission::ECont"
"("
"const label"
") const"
) << "dQ field not found in mesh" << endl;
}
return E; return E;
} }

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011-2012 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -255,15 +255,40 @@ Foam::radiation::wideBandAbsorptionEmission::ECont(const label bandI) const
) )
); );
if (mesh().foundObject<volScalarField>("hrr")) if (mesh().foundObject<volScalarField>("dQ"))
{
const volScalarField& dQ = mesh().lookupObject<volScalarField>("dQ");
if (dQ.dimensions() == dimEnergy/dimTime)
{ {
const volScalarField& hrr = mesh().lookupObject<volScalarField>("hrr");
E().internalField() = E().internalField() =
iEhrrCoeffs_[bandI] iEhrrCoeffs_[bandI]
*hrr.internalField() *dQ.internalField()
*(iBands_[bandI][1] - iBands_[bandI][0])
/totalWaveLength_
/mesh_.V();
}
else if (dQ.dimensions() == dimEnergy/dimTime/dimVolume)
{
E().internalField() =
iEhrrCoeffs_[bandI]
*dQ.internalField()
*(iBands_[bandI][1] - iBands_[bandI][0]) *(iBands_[bandI][1] - iBands_[bandI][0])
/totalWaveLength_; /totalWaveLength_;
} }
else
{
WarningIn
(
"tmp<volScalarField>"
"radiation::wideBandAbsorptionEmission::ECont"
"("
"const label"
") const"
)
<< "Incompatible dimensions for dQ field" << endl;
}
}
return E; return E;
} }
@ -289,9 +314,8 @@ void Foam::radiation::wideBandAbsorptionEmission::correct
for (label j=0; j<nBands_; j++) for (label j=0; j<nBands_; j++)
{ {
Info<< "Calculating absorption in band: " << j << endl;
aLambda[j].internalField() = this->a(j); aLambda[j].internalField() = this->a(j);
Info<< "Calculated absorption in band: " << j << endl;
a.internalField() += a.internalField() +=
aLambda[j].internalField() aLambda[j].internalField()
*(iBands_[j][1] - iBands_[j][0]) *(iBands_[j][1] - iBands_[j][0])

View File

@ -0,0 +1,166 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "mixtureFractionSoot.H"
#include "singleStepReactingMixture.H"
// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
template<class ThermoType>
const Foam::singleStepReactingMixture<ThermoType>&
Foam::radiation::mixtureFractionSoot<ThermoType>::checkThermo
(
const fluidThermo& thermo
)
{
if (isA<singleStepReactingMixture<ThermoType> >(thermo))
{
return dynamic_cast<const singleStepReactingMixture<ThermoType>& >
(
thermo
);
}
else
{
FatalErrorIn
(
"template<class ThermoType> "
"Foam::radiation::mixtureFractionSoot "
"("
"const dictionary&, "
"const fvMesh&"
")"
)
<< "Inconsistent thermo package for " << thermo.type()
<< "Please select a thermo package based on "
<< "singleStepReactingMixture" << exit(FatalError);
return dynamic_cast<const singleStepReactingMixture<ThermoType>& >
(
thermo
);
}
}
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
template<class ThermoType>
Foam::radiation::mixtureFractionSoot<ThermoType>::mixtureFractionSoot
(
const dictionary& dict,
const fvMesh& mesh,
const word& modelType
)
:
sootModel(dict, mesh, modelType),
soot_
(
IOobject
(
"soot",
mesh_.time().timeName(),
mesh_,
IOobject::MUST_READ,
IOobject::AUTO_WRITE
),
mesh_
),
coeffsDict_(dict.subOrEmptyDict(modelType + "Coeffs")),
nuSoot_(readScalar(coeffsDict_.lookup("nuSoot"))),
Wsoot_(readScalar(coeffsDict_.lookup("Wsoot"))),
sootMax_(-1),
mappingFieldName_
(
coeffsDict_.lookupOrDefault<word>("mappingFieldName", "none")
),
mapFieldMax_(1),
thermo_(mesh.lookupObject<fluidThermo>("thermophysicalProperties")),
mixture_(checkThermo(thermo_))
{
const Reaction<ThermoType>& reaction = mixture_.operator[](0);
const scalarList& specieStoichCoeffs(mixture_.specieStoichCoeffs());
scalar totalMol = 0.0;
forAll(reaction.rhs(), i)
{
label specieI = reaction.rhs()[i].index;
totalMol += mag(specieStoichCoeffs[specieI]);
}
totalMol += nuSoot_;
scalarList Xi(reaction.rhs().size());
scalar Wm = 0.0;
forAll(reaction.rhs(), i)
{
const label specieI = reaction.rhs()[i].index;
Xi[i] = mag(specieStoichCoeffs[specieI])/totalMol;
Wm += Xi[i]*mixture_.speciesData()[specieI].W();
}
const scalar XSoot = nuSoot_/totalMol;
Wm += XSoot*Wsoot_;
sootMax_ = XSoot*Wsoot_/Wm;
Info << "Maximum soot mass concentrations: " << sootMax_ << nl;
if (mappingFieldName_ == "none")
{
const label index = reaction.rhs()[0].index;
mappingFieldName_ = mixture_.Y(index).name();
}
const label mapFieldIndex = mixture_.species()[mappingFieldName_];
mapFieldMax_ = mixture_.Yprod0()[mapFieldIndex];
}
// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * //
template<class ThermoType>
Foam::radiation::mixtureFractionSoot<ThermoType>::~mixtureFractionSoot()
{}
// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * //
template<class ThermoType>
void Foam::radiation::mixtureFractionSoot<ThermoType>::correct()
{
const volScalarField& mapField =
mesh_.lookupObject<volScalarField>(mappingFieldName_);
soot_ = sootMax_*(mapField/mapFieldMax_);
}
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //

View File

@ -0,0 +1,179 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
Class
Foam::radiation::mixtureFractionSoot
Description
This soot model is purely an state model. The ammount of soot produced is
determined by a single step chemistry as :
nuf Fuel + nuOx Ox = nuP P + nuSoot soot
nuSoot is prescribed by the user.
The single step chemistry used is read from the combustion.
The soot is not considered into the thermodynamics of the system and it
is not considered as an extra specie in the solver.
The spacial distribution is given by the normalization of the first product
on the rhs of the reaction by default or it can be added as input.
The input dictionary reads like in the radiationProperties dictionary:
sootModel mixtureFractionSoot<gasHThermoPhysics>;
mixtureFractionSootCoeffs
{
nuSoot 0.015;
Wsoot 12;
mappingFieldName P;
}
SourceFiles
mixtureFractionSoot.C
\*---------------------------------------------------------------------------*/
#ifndef mixtureFractionSoot_H
#define mixtureFractionSoot_H
#include "interpolationLookUpTable.H"
#include "sootModel.H"
#include "HashTable.H"
#include "fluidThermo.H"
#include "singleStepReactingMixture.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
namespace radiation
{
/*---------------------------------------------------------------------------*\
Class mixtureFractionSoot Declaration
\*---------------------------------------------------------------------------*/
template<class ThermoType>
class mixtureFractionSoot
:
public sootModel
{
// Static functions
//- Check mixture in thermo
static const singleStepReactingMixture<ThermoType>& checkThermo
(
const fluidThermo&
);
// Private data
//- Soot mass fraction
volScalarField soot_;
//- Soot model dictionary
dictionary coeffsDict_;
//- Soot yield
scalar nuSoot_;
//- Soot molecular weight
scalar Wsoot_;
//- Maximum soot mass concentration at stoichiometric
scalar sootMax_;
//- Name of the field mapping the soot
word mappingFieldName_;
//- Maximum value of the map field
scalar mapFieldMax_;
//- Thermo package
const fluidThermo& thermo_;
//- Auto Ptr to singleStepReactingMixture
const singleStepReactingMixture<ThermoType>& mixture_;
public:
//- Runtime type information
TypeName("mixtureFractionSoot");
// Constructors
//- Construct from components
mixtureFractionSoot
(
const dictionary& dict,
const fvMesh& mesh,
const word& modelType
);
//- Destructor
virtual ~mixtureFractionSoot();
// Member Functions
// Edit
//- Main update/correction routine
virtual void correct();
// Access
//- Return Ysoot
const volScalarField& soot() const
{
return soot_;
}
};
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
} // End namespace radiation
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#ifdef NoRepository
# include "mixtureFractionSoot.C"
#endif
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif
// ************************************************************************* //

View File

@ -0,0 +1,47 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "mixtureFractionSoot.H"
#include "makeSootTypes.H"
#include "thermoPhysicsTypes.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
namespace radiation
{
// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
makeSootTypesThermo(mixtureFractionSoot, gasHThermoPhysics);
makeSootTypesThermo(mixtureFractionSoot, gasEThermoPhysics);
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
} // End namespace radiation
// ************************************************************************* //

View File

@ -0,0 +1,77 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "noSoot.H"
#include "addToRunTimeSelectionTable.H"
// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
namespace Foam
{
namespace radiation
{
defineTypeNameAndDebug(noSoot, 0);
addToRunTimeSelectionTable
(
sootModel,
noSoot,
dictionary
);
}
}
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::radiation::noSoot::noSoot
(
const dictionary& dict,
const fvMesh& mesh,
const word& modelType
)
:
sootModel(dict, mesh, modelType)
{}
// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * * //
Foam::radiation::noSoot::~noSoot()
{}
void Foam::radiation::noSoot::correct()
{
//Do nothing
}
const Foam::volScalarField& Foam::radiation::noSoot::soot() const
{
notImplemented
(
"Foam::volScalarField& Foam::radiation::noSoot::soot() const"
);
return tmp<volScalarField>(NULL);
}
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //

View File

@ -0,0 +1,98 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
Class
Foam::radiation::noSoot
Description
noSoot
SourceFiles
noSoot.C
\*---------------------------------------------------------------------------*/
#ifndef noSoot_H
#define noSoot_H
#include "sootModel.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
namespace radiation
{
/*---------------------------------------------------------------------------*\
Class noSoot Declaration
\*---------------------------------------------------------------------------*/
class noSoot
:
public sootModel
{
public:
//- Runtime type information
TypeName("none");
// Constructors
//- Construct from components
noSoot(const dictionary& dict, const fvMesh& mesh, const word&);
//- Destructor
virtual ~noSoot();
// Member Functions
// Edit
//- Main update/correction routine
void correct();
// Access
//- Return Ysoot
const volScalarField& soot() const;
};
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
} // End namespace radiation
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif
// ************************************************************************* //

View File

@ -0,0 +1,57 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#ifndef makeSootTypes_H
#define makeSootTypes_H
#include "addToRunTimeSelectionTable.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#define makeSootTypesThermo(sootModelType, Thermo) \
\
typedef sootModelType<Thermo> sootModelType##Thermo; \
\
defineTemplateTypeNameAndDebugWithName \
( \
sootModelType##Thermo, \
#sootModelType"<"#Thermo">", \
0 \
); \
\
addToRunTimeSelectionTable \
( \
sootModel, \
sootModelType##Thermo, \
dictionary \
);
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif
// ************************************************************************* //

View File

@ -0,0 +1,62 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "sootModel.H"
// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
namespace Foam
{
namespace radiation
{
defineTypeNameAndDebug(sootModel, 0);
defineRunTimeSelectionTable(sootModel, dictionary);
}
}
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::radiation::sootModel::sootModel
(
const dictionary& dict,
const fvMesh& mesh,
const word& modelType
)
:
dict_(dict),
mesh_(mesh)
{}
// * * * * * * * * * * * * * * * * Destructor * * * * * * * * * * * * * * //
Foam::radiation::sootModel::~sootModel()
{}
// * * * * * * * * * * * * * * * Member Functions * * * * * * * * * * * * * //
// ************************************************************************* //

View File

@ -0,0 +1,153 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
Class
Foam::radiation::sootModel
Description
Base class for soor models
\*---------------------------------------------------------------------------*/
#ifndef radiationsootModel_H
#define radiationsootModel_H
#include "IOdictionary.H"
#include "autoPtr.H"
#include "runTimeSelectionTables.H"
#include "volFields.H"
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
namespace Foam
{
namespace radiation
{
/*---------------------------------------------------------------------------*\
Class sootModel Declaration
\*---------------------------------------------------------------------------*/
class sootModel
{
protected:
// Protected data
//- Radiation model dictionary
const dictionary dict_;
//- Reference to the fvMesh
const fvMesh& mesh_;
public:
//- Runtime type information
TypeName("sootModel");
//- Declare runtime constructor selection table
declareRunTimeSelectionTable
(
autoPtr,
sootModel,
dictionary,
(
const dictionary& dict,
const fvMesh& mesh,
const word& modelType
),
(dict, mesh, modelType)
);
// Constructors
//- Construct from components
sootModel
(
const dictionary& dict,
const fvMesh& mesh,
const word& modelType
);
//- Selector
static autoPtr<sootModel> New
(
const dictionary& dict,
const fvMesh& mesh
);
//- Destructor
virtual ~sootModel();
// Member Functions
// Access
//- Reference to the mesh
inline const fvMesh& mesh() const
{
return mesh_;
}
//- Reference to the dictionary
inline const dictionary& dict() const
{
return dict_;
}
// Member Functions
// Edit
//- Main update/correction routine
virtual void correct() = 0;
// Access
//- Return const reference to soot
virtual const volScalarField& soot() const = 0;
};
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
} // End namespace Foam
} // End namespace radiation
// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
#endif
// ************************************************************************* //

View File

@ -0,0 +1,69 @@
/*---------------------------------------------------------------------------*\
========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration |
\\ / A nd | Copyright (C) 2013 OpenFOAM Foundation
\\/ M anipulation |
-------------------------------------------------------------------------------
License
This file is part of OpenFOAM.
OpenFOAM is free software: you can redistribute it and/or modify it
under the terms of the GNU General Public License as published by
the Free Software Foundation, either version 3 of the License, or
(at your option) any later version.
OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
FITNESS FOR A PARTICULAR PURPOSE. See the GNU General Public License
for more details.
You should have received a copy of the GNU General Public License
along with OpenFOAM. If not, see <http://www.gnu.org/licenses/>.
\*---------------------------------------------------------------------------*/
#include "error.H"
#include "sootModel.H"
// * * * * * * * * * * * * * * * * Constructors * * * * * * * * * * * * * * //
Foam::autoPtr<Foam::radiation::sootModel>
Foam::radiation::sootModel::New
(
const dictionary& dict,
const fvMesh& mesh
)
{
word modelType("none");
if (dict.found("sootModel"))
{
dict.lookup("sootModel") >> modelType;
Info<< "Selecting sootModel " << modelType << endl;
}
dictionaryConstructorTable::iterator cstrIter =
dictionaryConstructorTablePtr_->find(modelType);
if (cstrIter == dictionaryConstructorTablePtr_->end())
{
FatalErrorIn
(
"sootModel::New(const dictionary&, const fvMesh&)"
) << "Unknown sootModel type "
<< modelType << nl << nl
<< "Valid sootModel types are :" << nl
<< dictionaryConstructorTablePtr_->sortedToc() << exit(FatalError);
}
const label tempOpen = modelType.find('<');
const word className = modelType(0, tempOpen);
return autoPtr<sootModel>(cstrIter()(dict, mesh, className));
}
// ************************************************************************* //

View File

@ -281,9 +281,8 @@ void Foam::chemkinReader::addPressureDependentReaction
thirdBodyEfficiencies(speciesTable_, efficiencies) thirdBodyEfficiencies(speciesTable_, efficiencies)
) )
); );
}
break; break;
}
case Troe: case Troe:
{ {
scalarList TroeCoeffs scalarList TroeCoeffs
@ -337,9 +336,8 @@ void Foam::chemkinReader::addPressureDependentReaction
thirdBodyEfficiencies(speciesTable_, efficiencies) thirdBodyEfficiencies(speciesTable_, efficiencies)
) )
); );
}
break; break;
}
case SRI: case SRI:
{ {
scalarList SRICoeffs scalarList SRICoeffs
@ -395,12 +393,9 @@ void Foam::chemkinReader::addPressureDependentReaction
thirdBodyEfficiencies(speciesTable_, efficiencies) thirdBodyEfficiencies(speciesTable_, efficiencies)
) )
); );
}
break; break;
}
default: default:
{
if (fofType < 4)
{ {
FatalErrorIn("chemkinReader::addPressureDependentReaction") FatalErrorIn("chemkinReader::addPressureDependentReaction")
<< "Fall-off function type " << "Fall-off function type "
@ -409,14 +404,6 @@ void Foam::chemkinReader::addPressureDependentReaction
<< " not implemented" << " not implemented"
<< exit(FatalError); << exit(FatalError);
} }
else
{
FatalErrorIn("chemkinReader::addPressureDependentReaction")
<< "Unknown fall-off function type " << fofType
<< " on line " << lineNo_-1
<< exit(FatalError);
}
}
} }
} }
@ -537,9 +524,8 @@ void Foam::chemkinReader::addReaction
) )
); );
} }
}
break; break;
}
case thirdBodyArrhenius: case thirdBodyArrhenius:
{ {
if (rType == nonEquilibriumReversible) if (rType == nonEquilibriumReversible)
@ -597,9 +583,8 @@ void Foam::chemkinReader::addReaction
) )
); );
} }
}
break; break;
}
case unimolecularFallOff: case unimolecularFallOff:
{ {
addPressureDependentReaction<FallOffReactionRate> addPressureDependentReaction<FallOffReactionRate>
@ -616,9 +601,8 @@ void Foam::chemkinReader::addReaction
Afactor, Afactor,
RR RR
); );
}
break; break;
}
case chemicallyActivatedBimolecular: case chemicallyActivatedBimolecular:
{ {
addPressureDependentReaction<ChemicallyActivatedReactionRate> addPressureDependentReaction<ChemicallyActivatedReactionRate>
@ -635,9 +619,8 @@ void Foam::chemkinReader::addReaction
Afactor/concFactor, Afactor/concFactor,
RR RR
); );
}
break; break;
}
case LandauTeller: case LandauTeller:
{ {
const scalarList& LandauTellerCoeffs = const scalarList& LandauTellerCoeffs =
@ -705,9 +688,8 @@ void Foam::chemkinReader::addReaction
) )
); );
} }
}
break; break;
}
case Janev: case Janev:
{ {
const scalarList& JanevCoeffs = const scalarList& JanevCoeffs =
@ -727,9 +709,8 @@ void Foam::chemkinReader::addReaction
FixedList<scalar, 9>(JanevCoeffs) FixedList<scalar, 9>(JanevCoeffs)
) )
); );
}
break; break;
}
case powerSeries: case powerSeries:
{ {
const scalarList& powerSeriesCoeffs = const scalarList& powerSeriesCoeffs =
@ -749,21 +730,17 @@ void Foam::chemkinReader::addReaction
FixedList<scalar, 4>(powerSeriesCoeffs) FixedList<scalar, 4>(powerSeriesCoeffs)
) )
); );
}
break; break;
}
case unknownReactionRateType: case unknownReactionRateType:
{ {
FatalErrorIn("chemkinReader::addReaction") FatalErrorIn("chemkinReader::addReaction")
<< "Internal error on line " << lineNo_-1 << "Internal error on line " << lineNo_-1
<< ": reaction rate type has not been set" << ": reaction rate type has not been set"
<< exit(FatalError); << exit(FatalError);
}
break; break;
}
default: default:
{
if (rrType < 9)
{ {
FatalErrorIn("chemkinReader::addReaction") FatalErrorIn("chemkinReader::addReaction")
<< "Reaction rate type " << reactionRateTypeNames[rrType] << "Reaction rate type " << reactionRateTypeNames[rrType]
@ -771,14 +748,6 @@ void Foam::chemkinReader::addReaction
<< " not implemented" << " not implemented"
<< exit(FatalError); << exit(FatalError);
} }
else
{
FatalErrorIn("chemkinReader::addReaction")
<< "Unknown reaction rate type " << rrType
<< " on line " << lineNo_-1
<< exit(FatalError);
}
}
} }

View File

@ -2,7 +2,7 @@
========= | ========= |
\\ / F ield | OpenFOAM: The Open Source CFD Toolbox \\ / F ield | OpenFOAM: The Open Source CFD Toolbox
\\ / O peration | \\ / O peration |
\\ / A nd | Copyright (C) 2011 OpenFOAM Foundation \\ / A nd | Copyright (C) 2011-2013 OpenFOAM Foundation
\\/ M anipulation | \\/ M anipulation |
------------------------------------------------------------------------------- -------------------------------------------------------------------------------
License License
@ -96,6 +96,11 @@ public:
{ {
return PtrList<Reaction<ThermoType> >::operator[](i); return PtrList<Reaction<ThermoType> >::operator[](i);
} }
const Reaction<ThermoType>& operator [] (const label i) const
{
return PtrList<Reaction<ThermoType> >::operator[](i);
}
}; };

Some files were not shown because too many files have changed in this diff Show More