From 539bf2f34eb9b5edf197c9dbe72f402c2294a3d4 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Mon, 12 Dec 2011 11:39:36 +0000
Subject: [PATCH 01/70] STYLE: Minor code formatting

---
 .../cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControls.H | 2 --
 .../conformalVoronoi2DMesh/cv2DControls/cv2DControlsI.H         | 1 -
 2 files changed, 3 deletions(-)

diff --git a/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControls.H b/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControls.H
index 9470badb2f..4ab8bdb167 100644
--- a/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControls.H
+++ b/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControls.H
@@ -237,8 +237,6 @@ public:
                 Ostream& os,
                 const cv2DControls& s
             );
-
-
 };
 
 
diff --git a/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControlsI.H b/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControlsI.H
index 3ff16735a8..f5187100b6 100644
--- a/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControlsI.H
+++ b/applications/utilities/mesh/generation/cv2DMesh/conformalVoronoi2DMesh/cv2DControls/cv2DControlsI.H
@@ -23,7 +23,6 @@ License
 
 \*---------------------------------------------------------------------------*/
 
-
 inline Foam::scalar Foam::cv2DControls::minCellSize() const
 {
     return minCellSize_;

From 2d7b3363edc7ffabb092a0c5daa3543a76fe5b4b Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Mon, 12 Dec 2011 16:33:11 +0000
Subject: [PATCH 02/70] ENH: patchToFace: allow patch groups in patchToFace

---
 .../mesh/manipulation/topoSet/topoSetDict     |  3 +-
 .../faceSources/patchToFace/patchToFace.C     | 39 ++++++++++---------
 2 files changed, 22 insertions(+), 20 deletions(-)

diff --git a/applications/utilities/mesh/manipulation/topoSet/topoSetDict b/applications/utilities/mesh/manipulation/topoSet/topoSetDict
index 9c910aa7ec..5b8a4b73bb 100644
--- a/applications/utilities/mesh/manipulation/topoSet/topoSetDict
+++ b/applications/utilities/mesh/manipulation/topoSet/topoSetDict
@@ -211,7 +211,8 @@ FoamFile
 //    source patchToFace;
 //    sourceInfo
 //    {
-//        name ".*Wall";      // Name of patch, regular expressions allowed
+//        name ".*Wall";      // Name of patch or patch group,
+//                            // (regular expressions allowed)
 //    }
 //
 //    // All faces of faceZone
diff --git a/src/meshTools/sets/faceSources/patchToFace/patchToFace.C b/src/meshTools/sets/faceSources/patchToFace/patchToFace.C
index 4ee6ead863..4dec426303 100644
--- a/src/meshTools/sets/faceSources/patchToFace/patchToFace.C
+++ b/src/meshTools/sets/faceSources/patchToFace/patchToFace.C
@@ -54,33 +54,34 @@ Foam::topoSetSource::addToUsageTable Foam::patchToFace::usage_
 
 void Foam::patchToFace::combine(topoSet& set, const bool add) const
 {
-    bool hasMatched = false;
+    labelHashSet patchIDs = mesh_.boundaryMesh().patchSet
+    (
+        List<wordRe>(1, patchName_),
+        true,           // warn if not found
+        true            // use patch groups if available
+    );
 
-    forAll(mesh_.boundaryMesh(), patchI)
+    forAllConstIter(labelHashSet, patchIDs, iter)
     {
+        label patchI = iter.key();
+
         const polyPatch& pp = mesh_.boundaryMesh()[patchI];
 
-        if (patchName_.match(pp.name()))
+        Info<< "    Found matching patch " << pp.name()
+            << " with " << pp.size() << " faces." << endl;
+
+        for
+        (
+            label faceI = pp.start();
+            faceI < pp.start() + pp.size();
+            faceI++
+        )
         {
-            Info<< "    Found matching patch " << pp.name()
-                << " with " << pp.size() << " faces." << endl;
-
-            hasMatched = true;
-
-
-            for
-            (
-                label faceI = pp.start();
-                faceI < pp.start() + pp.size();
-                faceI++
-            )
-            {
-                addOrDelete(set, faceI, add);
-            }
+            addOrDelete(set, faceI, add);
         }
     }
 
-    if (!hasMatched)
+    if (patchIDs.empty())
     {
         WarningIn("patchToFace::combine(topoSet&, const bool)")
             << "Cannot find any patch named " << patchName_ << endl

From da4f8e69dce21656ac700949bb838893f06b9936 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Mon, 12 Dec 2011 17:34:54 +0000
Subject: [PATCH 03/70] STYLE: Minor code formatting

---
 applications/utilities/mesh/generation/cv2DMesh/indexedFaceI.H | 2 ++
 .../utilities/mesh/generation/cv2DMesh/indexedVertexI.H        | 3 +++
 2 files changed, 5 insertions(+)

diff --git a/applications/utilities/mesh/generation/cv2DMesh/indexedFaceI.H b/applications/utilities/mesh/generation/cv2DMesh/indexedFaceI.H
index 89bdf68691..c3151fffc5 100644
--- a/applications/utilities/mesh/generation/cv2DMesh/indexedFaceI.H
+++ b/applications/utilities/mesh/generation/cv2DMesh/indexedFaceI.H
@@ -106,3 +106,5 @@ inline int CGAL::indexedFace<Gt, Fb>::faceIndex() const
     return index_;
 }
 
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
diff --git a/applications/utilities/mesh/generation/cv2DMesh/indexedVertexI.H b/applications/utilities/mesh/generation/cv2DMesh/indexedVertexI.H
index 6fef3fc7d4..65b254aabd 100644
--- a/applications/utilities/mesh/generation/cv2DMesh/indexedVertexI.H
+++ b/applications/utilities/mesh/generation/cv2DMesh/indexedVertexI.H
@@ -228,3 +228,6 @@ bool CGAL::outsideTriangle
         || (v1.farPoint() || v1.ppSlave())
         || (v2.farPoint() || v2.ppSlave());
 }
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //

From a723468c9d4e59b412740eb4f1127c7e78a39cbb Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Mon, 12 Dec 2011 17:35:25 +0000
Subject: [PATCH 04/70] ENH: Using const for liquid thermo pvInvert function

---
 .../liquidProperties/liquidProperties/liquidProperties.C        | 2 +-
 .../liquidProperties/liquidProperties/liquidProperties.H        | 2 +-
 2 files changed, 2 insertions(+), 2 deletions(-)

diff --git a/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.C b/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.C
index 877462f3b7..b4ae047fd9 100644
--- a/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.C
+++ b/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.C
@@ -342,7 +342,7 @@ Foam::scalar Foam::liquidProperties::D(scalar p, scalar T, scalar Wb) const
 }
 
 
-Foam::scalar Foam::liquidProperties::pvInvert(scalar p)
+Foam::scalar Foam::liquidProperties::pvInvert(scalar p) const
 {
     scalar T = Tc_;
     scalar deltaT = 10.0;
diff --git a/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.H b/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.H
index b72826d5e5..7cb4aa0710 100644
--- a/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.H
+++ b/src/thermophysicalModels/properties/liquidProperties/liquidProperties/liquidProperties.H
@@ -253,7 +253,7 @@ public:
 
             //- Invert the vapour pressure relationship to retrieve the
             //  boiling temperuture as a function of temperature
-            virtual scalar pvInvert(scalar p);
+            virtual scalar pvInvert(scalar p) const;
 
 
     // I-O

From 2499ad10a7f9d08cb916cee1ad19a7c6ddb291ab Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 13 Dec 2011 12:43:55 +0000
Subject: [PATCH 05/70] ENH: mappedPatchBase: make robust w.r.t. warped faces

---
 src/OpenFOAM/meshes/polyMesh/polyMesh.C       |   2 +
 src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C |   2 +
 src/meshTools/Make/files                      |   2 +
 .../mappedPolyPatch/mappedPatchBase.C         | 317 ++++++++++++++----
 .../mappedPolyPatch/mappedPatchBase.H         |  10 +-
 .../meshSearchFACECENTRETETSMeshObject.C      |  48 +++
 .../meshSearchFACECENTRETETSMeshObject.H      |  92 +++++
 .../meshSearch/meshSearchMeshObject.C         |  45 +++
 .../meshSearch/meshSearchMeshObject.H         |  92 +++++
 9 files changed, 537 insertions(+), 73 deletions(-)
 create mode 100644 src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.C
 create mode 100644 src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.H
 create mode 100644 src/meshTools/meshSearch/meshSearchMeshObject.C
 create mode 100644 src/meshTools/meshSearch/meshSearchMeshObject.H

diff --git a/src/OpenFOAM/meshes/polyMesh/polyMesh.C b/src/OpenFOAM/meshes/polyMesh/polyMesh.C
index 960e35ddd4..8dd2eaf423 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyMesh.C
+++ b/src/OpenFOAM/meshes/polyMesh/polyMesh.C
@@ -1172,6 +1172,8 @@ Foam::tmp<Foam::scalarField> Foam::polyMesh::movePoints
             )
         ).movePoints(points_);
     }
+    meshSearchMeshObject::Delete(*this);
+    meshSearchFACECENTRETETSMeshObject::Delete(*this);
 
     return sweptVols;
 }
diff --git a/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C b/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C
index bba7367e8b..4dc64d17d8 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C
+++ b/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C
@@ -95,6 +95,8 @@ void Foam::polyMesh::updateMesh(const mapPolyMesh& mpm)
             )
         ).updateMesh(mpm);
     }
+    meshSearchMeshObject::Delete(*this);
+    meshSearchFACECENTRETETSMeshObject::Delete(*this);
 }
 
 
diff --git a/src/meshTools/Make/files b/src/meshTools/Make/files
index d8687b042b..2be634334c 100644
--- a/src/meshTools/Make/files
+++ b/src/meshTools/Make/files
@@ -27,6 +27,8 @@ polyMeshZipUpCells/polyMeshZipUpCells.C
 primitiveMeshGeometry/primitiveMeshGeometry.C
 
 meshSearch/meshSearch.C
+meshSearch/meshSearchFACECENTRETETSMeshObject.C
+meshSearch/meshSearchMeshObject.C
 
 meshTools/meshTools.C
 
diff --git a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C
index 2b62b29e34..9950b9b061 100644
--- a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C
+++ b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C
@@ -26,7 +26,7 @@ License
 #include "mappedPatchBase.H"
 #include "addToRunTimeSelectionTable.H"
 #include "ListListOps.H"
-#include "meshSearch.H"
+#include "meshSearchMeshObject.H"
 #include "meshTools.H"
 #include "OFstream.H"
 #include "Random.H"
@@ -37,6 +37,7 @@ License
 #include "Time.H"
 #include "mapDistribute.H"
 #include "SubField.H"
+#include "triPointRef.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -80,64 +81,144 @@ const Foam::NamedEnum<Foam::mappedPatchBase::offsetMode, 3>
 
 // * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
 
+Foam::tmp<Foam::pointField> Foam::mappedPatchBase::facePoints
+(
+    const polyPatch& pp
+) const
+{
+    const polyMesh& mesh = pp.boundaryMesh().mesh();
+    const labelList& tetBasePts = mesh.tetBasePtIs();
+    const pointField& p = pp.points();
+    const pointField& cellCentres = mesh.cellCentres();
+    const labelList& faceCells = pp.faceCells();
+
+    // Initialise to face-centre
+    tmp<pointField> tfacePoints(new pointField(patch_.faceCentres()));
+    pointField& facePoints = tfacePoints();
+
+    forAll(pp, faceI)
+    {
+        const face& f = pp[faceI];
+
+        if (f.size() <= 3)
+        {
+            // Point already on tets of cell.
+        }
+        else
+        {
+            // Find intersection of (face-centre-decomposition) centre to
+            // cell-centre with face-diagonal-decomposition triangles.
+            const point& cc = cellCentres[faceCells[faceI]];
+            vector d = facePoints[faceI]-cc;
+
+            const label fp0 = tetBasePts[faceI];
+            const point& basePoint = p[f[fp0]];
+
+            //bool foundPoint = false;
+
+            label fp = f.fcIndex(fp0);
+            for (label i = 2; i < f.size(); i++)
+            {
+                const point& thisPoint = p[f[fp]];
+                label nextFp = f.fcIndex(fp);
+                const point& nextPoint = p[f[nextFp]];
+
+                const triPointRef tri(basePoint, thisPoint, nextPoint);
+                pointHit hitInfo = tri.intersection
+                (
+                    cc,
+                    d,
+                    intersection::HALF_RAY
+                );
+
+                if (hitInfo.hit() && hitInfo.distance() > 0)
+                {
+                    facePoints[faceI] = hitInfo.hitPoint();
+                    //foundPoint = true;
+                    break;
+                }
+
+                fp = nextFp;
+            }
+
+            //if (!foundPoint)
+            //{
+            //    Pout<< "cell:" << faceCells[faceI] << " at:" << cc
+            //        << " face-centre:" << patch_.faceCentres()[faceI]
+            //        << " did not find any intersection." << endl;
+            //}
+        }
+    }
+
+    return tfacePoints;
+}
+
+
 void Foam::mappedPatchBase::collectSamples
 (
+    const pointField& facePoints,
     pointField& samples,
     labelList& patchFaceProcs,
     labelList& patchFaces,
     pointField& patchFc
 ) const
 {
-
     // Collect all sample points and the faces they come from.
-    List<pointField> globalFc(Pstream::nProcs());
-    List<pointField> globalSamples(Pstream::nProcs());
-    labelListList globalFaces(Pstream::nProcs());
+    {
+        List<pointField> globalFc(Pstream::nProcs());
+        globalFc[Pstream::myProcNo()] = facePoints;
+        Pstream::gatherList(globalFc);
+        Pstream::scatterList(globalFc);
+        // Rework into straight list
+        patchFc = ListListOps::combine<pointField>
+        (
+            globalFc,
+            accessOp<pointField>()
+        );
+    }
 
-    globalFc[Pstream::myProcNo()] = patch_.faceCentres();
-    globalSamples[Pstream::myProcNo()] = samplePoints();
-    globalFaces[Pstream::myProcNo()] = identity(patch_.size());
+    {
+        List<pointField> globalSamples(Pstream::nProcs());
+        globalSamples[Pstream::myProcNo()] = samplePoints(facePoints);
+        Pstream::gatherList(globalSamples);
+        Pstream::scatterList(globalSamples);
+        // Rework into straight list
+        samples = ListListOps::combine<pointField>
+        (
+            globalSamples,
+            accessOp<pointField>()
+        );
+    }
 
-    // Distribute to all processors
-    Pstream::gatherList(globalSamples);
-    Pstream::scatterList(globalSamples);
-    Pstream::gatherList(globalFaces);
-    Pstream::scatterList(globalFaces);
-    Pstream::gatherList(globalFc);
-    Pstream::scatterList(globalFc);
+    {
+        labelListList globalFaces(Pstream::nProcs());
+        globalFaces[Pstream::myProcNo()] = identity(patch_.size());
+        // Distribute to all processors
+        Pstream::gatherList(globalFaces);
+        Pstream::scatterList(globalFaces);
 
-    // Rework into straight list
-    samples = ListListOps::combine<pointField>
-    (
-        globalSamples,
-        accessOp<pointField>()
-    );
-    patchFaces = ListListOps::combine<labelList>
-    (
-        globalFaces,
-        accessOp<labelList>()
-    );
-    patchFc = ListListOps::combine<pointField>
-    (
-        globalFc,
-        accessOp<pointField>()
-    );
-
-    patchFaceProcs.setSize(patchFaces.size());
-    labelList nPerProc
-    (
-        ListListOps::subSizes
+        patchFaces = ListListOps::combine<labelList>
         (
             globalFaces,
             accessOp<labelList>()
-        )
-    );
-    label sampleI = 0;
-    forAll(nPerProc, procI)
+        );
+    }
+
     {
-        for (label i = 0; i < nPerProc[procI]; i++)
+        labelList nPerProc(Pstream::nProcs());
+        nPerProc[Pstream::myProcNo()] = patch_.size();
+        Pstream::gatherList(nPerProc);
+        Pstream::scatterList(nPerProc);
+
+        patchFaceProcs.setSize(patchFaces.size());
+
+        label sampleI = 0;
+        forAll(nPerProc, procI)
         {
-            patchFaceProcs[sampleI++] = procI;
+            for (label i = 0; i < nPerProc[procI]; i++)
+            {
+                patchFaceProcs[sampleI++] = procI;
+            }
         }
     }
 }
@@ -173,8 +254,9 @@ void Foam::mappedPatchBase::findSamples
                     << sampleModeNames_[mode_] << " mode." << exit(FatalError);
             }
 
-            // Octree based search engine
-            meshSearch meshSearchEngine(mesh);
+            //- Note: face-diagonal decomposition
+            const meshSearchMeshObject& meshSearchEngine =
+                meshSearchMeshObject::New(mesh);
 
             forAll(samples, sampleI)
             {
@@ -290,8 +372,9 @@ void Foam::mappedPatchBase::findSamples
                     << sampleModeNames_[mode_] << " mode." << exit(FatalError);
             }
 
-            // Octree based search engine
-            meshSearch meshSearchEngine(mesh);
+            //- Note: face-diagonal decomposition
+            const meshSearchMeshObject& meshSearchEngine =
+                meshSearchMeshObject::New(mesh);
 
             forAll(samples, sampleI)
             {
@@ -355,23 +438,6 @@ void Foam::mappedPatchBase::findSamples
         }
     }
 
-    // Check for samples not being found
-    forAll(nearest, sampleI)
-    {
-        if (!nearest[sampleI].first().hit())
-        {
-            FatalErrorIn
-            (
-                "mappedPatchBase::findSamples"
-                "(const pointField&, labelList&"
-                ", labelList&, pointField&)"
-            )   << "Did not find sample " << samples[sampleI]
-                << " on any processor of region " << sampleRegion_
-                << exit(FatalError);
-        }
-    }
-
-
     // Convert back into proc+local index
     sampleProcs.setSize(samples.size());
     sampleIndices.setSize(samples.size());
@@ -379,21 +445,40 @@ void Foam::mappedPatchBase::findSamples
 
     forAll(nearest, sampleI)
     {
-        sampleProcs[sampleI] = nearest[sampleI].second().second();
-        sampleIndices[sampleI] = nearest[sampleI].first().index();
-        sampleLocations[sampleI] = nearest[sampleI].first().hitPoint();
+        if (!nearest[sampleI].first().hit())
+        {
+            sampleProcs[sampleI] = -1;
+            sampleIndices[sampleI] = -1;
+            sampleLocations[sampleI] = vector::max;
+        }
+        else
+        {
+            sampleProcs[sampleI] = nearest[sampleI].second().second();
+            sampleIndices[sampleI] = nearest[sampleI].first().index();
+            sampleLocations[sampleI] = nearest[sampleI].first().hitPoint();
+        }
     }
 }
 
 
 void Foam::mappedPatchBase::calcMapping() const
 {
+    static bool hasWarned = false;
+
     if (mapPtr_.valid())
     {
         FatalErrorIn("mappedPatchBase::calcMapping() const")
             << "Mapping already calculated" << exit(FatalError);
     }
 
+    // Get points on face (since cannot use face-centres - might be off
+    // face-diagonal decomposed tets.
+    tmp<pointField> patchPoints(facePoints(patch_));
+
+    // Get offsetted points
+    const pointField offsettedPoints = samplePoints(patchPoints());
+
+
     // Do a sanity check
     // Am I sampling my own patch? This only makes sense for a non-zero
     // offset.
@@ -405,8 +490,10 @@ void Foam::mappedPatchBase::calcMapping() const
     );
 
     // Check offset
-    vectorField d(samplePoints()-patch_.faceCentres());
-    if (sampleMyself && gAverage(mag(d)) <= ROOTVSMALL)
+    vectorField d(offsettedPoints-patchPoints());
+    bool coincident = (gAverage(mag(d)) <= ROOTVSMALL);
+
+    if (sampleMyself && coincident)
     {
         WarningIn
         (
@@ -438,7 +525,15 @@ void Foam::mappedPatchBase::calcMapping() const
     labelList patchFaceProcs;
     labelList patchFaces;
     pointField patchFc;
-    collectSamples(samples, patchFaceProcs, patchFaces, patchFc);
+    collectSamples
+    (
+        patchPoints,
+        samples,
+        patchFaceProcs,
+        patchFaces,
+        patchFc
+    );
+
 
     // Find processor and cell/face samples are in and actual location.
     labelList sampleProcs;
@@ -446,6 +541,75 @@ void Foam::mappedPatchBase::calcMapping() const
     pointField sampleLocations;
     findSamples(samples, sampleProcs, sampleIndices, sampleLocations);
 
+    // Check for samples that were not found. This will only happen for
+    // NEARESTCELL since finds cell containing a location
+    if (mode_ == NEARESTCELL)
+    {
+        label nNotFound = 0;
+        forAll(sampleProcs, sampleI)
+        {
+            if (sampleProcs[sampleI] == -1)
+            {
+                nNotFound++;
+            }
+        }
+        reduce(nNotFound, sumOp<label>());
+
+        if (nNotFound > 0)
+        {
+            if (!hasWarned)
+            {
+                WarningIn
+                (
+                    "mappedPatchBase::mappedPatchBase\n"
+                    "(\n"
+                    "    const polyPatch& pp,\n"
+                    "    const word& sampleRegion,\n"
+                    "    const sampleMode mode,\n"
+                    "    const word& samplePatch,\n"
+                    "    const vector& offset\n"
+                    ")\n"
+                )   << "Did not find " << nNotFound
+                    << " out of " << sampleProcs.size() << " total samples."
+                    << " Sampling these on owner cell centre instead." << endl
+                    << "patch_:" << patch_.name() << endl
+                    << "sampleRegion_:" << sampleRegion_ << endl
+                    << "mode_:" << sampleModeNames_[mode_] << endl
+                    << "samplePatch_:" << samplePatch_ << endl
+                    << "offsetMode_:" << offsetModeNames_[offsetMode_] << endl;
+
+                hasWarned = true;
+            }
+
+            // Reset the samples that cannot be found to the cell centres.
+            pointField patchCc;
+            {
+                List<pointField> globalCc(Pstream::nProcs());
+                globalCc[Pstream::myProcNo()] = patch_.faceCellCentres();
+                Pstream::gatherList(globalCc);
+                Pstream::scatterList(globalCc);
+                patchCc = ListListOps::combine<pointField>
+                (
+                    globalCc,
+                    accessOp<pointField>()
+                );
+            }
+
+            forAll(sampleProcs, sampleI)
+            {
+                if (sampleProcs[sampleI] == -1)
+                {
+                    // Reset to cell centres
+                    samples[sampleI] = patchCc[sampleI];
+                }
+            }
+
+            // And re-search. Note: could be optimised to only search missing
+            // points.
+            findSamples(samples, sampleProcs, sampleIndices, sampleLocations);
+        }
+    }
+
 
     // Now we have all the data we need:
     // - where sample originates from (so destination when mapping):
@@ -613,7 +777,7 @@ void Foam::mappedPatchBase::calcAMI() const
 /*
     const polyPatch& nbr = samplePolyPatch();
 
-//    pointField nbrPoints(samplePoints());
+//    pointField nbrPoints(offsettedPoints());
     pointField nbrPoints(nbr.localPoints());
 
     if (debug)
@@ -932,9 +1096,12 @@ const Foam::polyPatch& Foam::mappedPatchBase::samplePolyPatch() const
 }
 
 
-Foam::tmp<Foam::pointField> Foam::mappedPatchBase::samplePoints() const
+Foam::tmp<Foam::pointField> Foam::mappedPatchBase::samplePoints
+(
+    const pointField& fc
+) const
 {
-    tmp<pointField> tfld(new pointField(patch_.faceCentres()));
+    tmp<pointField> tfld(new pointField(fc));
     pointField& fld = tfld();
 
     switch (offsetMode_)
@@ -964,6 +1131,12 @@ Foam::tmp<Foam::pointField> Foam::mappedPatchBase::samplePoints() const
 }
 
 
+Foam::tmp<Foam::pointField> Foam::mappedPatchBase::samplePoints() const
+{
+    return samplePoints(facePoints(patch_));
+}
+
+
 void Foam::mappedPatchBase::write(Ostream& os) const
 {
     os.writeKeyword("sampleMode") << sampleModeNames_[mode_]
diff --git a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H
index 43c19a671c..142bd86fb4 100644
--- a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H
+++ b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H
@@ -33,7 +33,7 @@ Description
         sampleRegion region0;
 
         // What to sample:
-        // - nearestCell         : sample nearest cell
+        // - nearestCell         : sample cell containing point
         // - nearestPatchFace    : nearest face on selected patch
         // - nearestPatchFaceAMI : nearest face on selected patch
                                    - patches need not conform
@@ -204,9 +204,14 @@ protected:
 
     // Protected Member Functions
 
+        //- Get the points from face-centre-decomposition face centres
+        //  and project them onto the face-diagonal-decomposition triangles.
+        tmp<pointField> facePoints(const polyPatch&) const;
+
         //- Collect single list of samples and originating processor+face.
         void collectSamples
         (
+            const pointField& facePoints,
             pointField&,
             labelList& patchFaceProcs,
             labelList& patchFaces,
@@ -222,6 +227,9 @@ protected:
             pointField& sampleLocations // actual representative location
         ) const;
 
+        //- Get the sample points given the face points
+        tmp<pointField> samplePoints(const pointField&) const;
+
         //- Calculate mapping
         void calcMapping() const;
 
diff --git a/src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.C b/src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.C
new file mode 100644
index 0000000000..ab023bfdc2
--- /dev/null
+++ b/src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.C
@@ -0,0 +1,48 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "meshSearchFACECENTRETETSMeshObject.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(meshSearchFACECENTRETETSMeshObject, 0);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::meshSearchFACECENTRETETSMeshObject::meshSearchFACECENTRETETSMeshObject
+(
+    const polyMesh& mesh
+)
+:
+    MeshObject<polyMesh, meshSearchFACECENTRETETSMeshObject>(mesh),
+    meshSearch(mesh, polyMesh::FACECENTRETETS)
+{}
+
+
+// ************************************************************************* //
diff --git a/src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.H b/src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.H
new file mode 100644
index 0000000000..2ddaf9d4fa
--- /dev/null
+++ b/src/meshTools/meshSearch/meshSearchFACECENTRETETSMeshObject.H
@@ -0,0 +1,92 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::meshSearchFACECENTRETETSMeshObject
+
+Description
+    MeshObject wrapper around meshSearch(mesh,  polyMesh::FACECENTRETETS).
+
+SourceFiles
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef meshSearchFACECENTRETETSMeshObject_H
+#define meshSearchFACECENTRETETSMeshObject_H
+
+#include "MeshObject.H"
+#include "meshSearch.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+              Class meshSearchFACECENTRETETSMeshObject Declaration
+\*---------------------------------------------------------------------------*/
+
+class meshSearchFACECENTRETETSMeshObject
+:
+    public MeshObject<polyMesh, meshSearchFACECENTRETETSMeshObject>,
+    public meshSearch
+{
+
+public:
+
+    // Declare name of the class and its debug switch
+    TypeName("meshSearchFACECENTRETETSMeshObject");
+
+
+    // Constructors
+
+        //- Constructor given polyMesh
+        explicit meshSearchFACECENTRETETSMeshObject(const polyMesh& mesh);
+
+    //- Destructor
+    virtual ~meshSearchFACECENTRETETSMeshObject()
+    {}
+
+//
+//    // Member functions
+//
+//        // Edit
+//
+//            //- Update mesh topology using the morph engine
+//            void updateMesh();
+//
+//            //- Correct weighting factors for moving mesh.
+//            bool movePoints();
+//
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/meshTools/meshSearch/meshSearchMeshObject.C b/src/meshTools/meshSearch/meshSearchMeshObject.C
new file mode 100644
index 0000000000..12211345a1
--- /dev/null
+++ b/src/meshTools/meshSearch/meshSearchMeshObject.C
@@ -0,0 +1,45 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "meshSearchMeshObject.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(meshSearchMeshObject, 0);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::meshSearchMeshObject::meshSearchMeshObject(const polyMesh& mesh)
+:
+    MeshObject<polyMesh, meshSearchMeshObject>(mesh),
+    meshSearch(mesh)
+{}
+
+
+// ************************************************************************* //
diff --git a/src/meshTools/meshSearch/meshSearchMeshObject.H b/src/meshTools/meshSearch/meshSearchMeshObject.H
new file mode 100644
index 0000000000..838aa80c70
--- /dev/null
+++ b/src/meshTools/meshSearch/meshSearchMeshObject.H
@@ -0,0 +1,92 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::meshSearchMeshObject
+
+Description
+    MeshObject wrapper around meshSearch(mesh).
+
+SourceFiles
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef meshSearchMeshObject_H
+#define meshSearchMeshObject_H
+
+#include "MeshObject.H"
+#include "meshSearch.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+              Class meshSearchMeshObject Declaration
+\*---------------------------------------------------------------------------*/
+
+class meshSearchMeshObject
+:
+    public MeshObject<polyMesh, meshSearchMeshObject>,
+    public meshSearch
+{
+
+public:
+
+    // Declare name of the class and its debug switch
+    TypeName("meshSearchMeshObject");
+
+
+    // Constructors
+
+        //- Constructor given polyMesh
+        explicit meshSearchMeshObject(const polyMesh& mesh);
+
+    //- Destructor
+    virtual ~meshSearchMeshObject()
+    {}
+
+//
+//    // Member functions
+//
+//        // Edit
+//
+//            //- Update mesh topology using the morph engine
+//            void updateMesh();
+//
+//            //- Correct weighting factors for moving mesh.
+//            bool movePoints();
+//
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

From 37861591bdd53bf954442d745c4e2bbc84d963a1 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 13 Dec 2011 12:44:45 +0000
Subject: [PATCH 06/70] STYLE: nearWallFields.C: added debug messages

---
 .../field/nearWallFields/nearWallFields.C     | 29 +++++++++++++++++--
 1 file changed, 27 insertions(+), 2 deletions(-)

diff --git a/src/postProcessing/functionObjects/field/nearWallFields/nearWallFields.C b/src/postProcessing/functionObjects/field/nearWallFields/nearWallFields.C
index 2be79c30cc..d586dfba0c 100644
--- a/src/postProcessing/functionObjects/field/nearWallFields/nearWallFields.C
+++ b/src/postProcessing/functionObjects/field/nearWallFields/nearWallFields.C
@@ -70,13 +70,23 @@ Foam::nearWallFields::nearWallFields
 // * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
 
 Foam::nearWallFields::~nearWallFields()
-{}
+{
+    if (debug)
+    {
+        Info<< "nearWallFields::~nearWallFields()" << endl;
+    }
+}
 
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
 void Foam::nearWallFields::read(const dictionary& dict)
 {
+    if (debug)
+    {
+        Info<< "nearWallFields::read(const dictionary&)" << endl;
+    }
+
     if (active_)
     {
         const fvMesh& mesh = refCast<const fvMesh>(obr_);
@@ -122,6 +132,11 @@ void Foam::nearWallFields::read(const dictionary& dict)
 
 void Foam::nearWallFields::execute()
 {
+    if (debug)
+    {
+        Info<< "nearWallFields:execute()" << endl;
+    }
+
     if (active_)
     {
         sampleFields(vsf_);
@@ -135,12 +150,22 @@ void Foam::nearWallFields::execute()
 
 void Foam::nearWallFields::end()
 {
-    // Do nothing
+    if (debug)
+    {
+        Info<< "nearWallFields:end()" << endl;
+    }
+    // Update fields
+    execute();
 }
 
 
 void Foam::nearWallFields::write()
 {
+    if (debug)
+    {
+        Info<< "nearWallFields:write()" << endl;
+    }
+
     // Do nothing
     if (active_)
     {

From 8b95187e7fae294e2aa0f33bac532b55a9062278 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 13 Dec 2011 12:59:13 +0000
Subject: [PATCH 07/70] COMP: polyMesh.C: include of meshTools functionality

---
 src/OpenFOAM/meshes/polyMesh/polyMesh.C       | 2 --
 src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C | 2 --
 2 files changed, 4 deletions(-)

diff --git a/src/OpenFOAM/meshes/polyMesh/polyMesh.C b/src/OpenFOAM/meshes/polyMesh/polyMesh.C
index 8dd2eaf423..960e35ddd4 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyMesh.C
+++ b/src/OpenFOAM/meshes/polyMesh/polyMesh.C
@@ -1172,8 +1172,6 @@ Foam::tmp<Foam::scalarField> Foam::polyMesh::movePoints
             )
         ).movePoints(points_);
     }
-    meshSearchMeshObject::Delete(*this);
-    meshSearchFACECENTRETETSMeshObject::Delete(*this);
 
     return sweptVols;
 }
diff --git a/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C b/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C
index 4dc64d17d8..bba7367e8b 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C
+++ b/src/OpenFOAM/meshes/polyMesh/polyMeshUpdate.C
@@ -95,8 +95,6 @@ void Foam::polyMesh::updateMesh(const mapPolyMesh& mpm)
             )
         ).updateMesh(mpm);
     }
-    meshSearchMeshObject::Delete(*this);
-    meshSearchFACECENTRETETSMeshObject::Delete(*this);
 }
 
 

From 5588507299b63a10c0fc72b8bdaf95ce543f48bc Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 13 Dec 2011 13:00:39 +0000
Subject: [PATCH 08/70] ENH: renumberMesh: have -dict option to read
 renumberMeshDict

---
 .../manipulation/renumberMesh/renumberMesh.C  | 46 ++++++++++++-------
 1 file changed, 30 insertions(+), 16 deletions(-)

diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
index 791f68cf98..a8c18c0712 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
+++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
@@ -459,6 +459,11 @@ autoPtr<mapPolyMesh> reorderMesh
 
 int main(int argc, char *argv[])
 {
+    argList::addNote
+    (
+        "Renumber mesh to minimise bandwidth"
+    );
+
     argList::addOption
     (
         "blockSize",
@@ -479,6 +484,11 @@ int main(int argc, char *argv[])
 #   include "addRegionOption.H"
 #   include "addOverwriteOption.H"
 #   include "addTimeOptions.H"
+    argList::addBoolOption
+    (
+        "dict",
+        "renumber according to system/renumberMeshDict"
+    );
 
 #   include "setRootCase.H"
 #   include "createTime.H"
@@ -495,6 +505,9 @@ int main(int argc, char *argv[])
 #   include "createNamedMesh.H"
     const word oldInstance = mesh.pointsInstance();
 
+    const bool readDict = args.optionFound("dict");
+
+
     label blockSize = 0;
     args.optionReadIfPresent("blockSize", blockSize, 0);
 
@@ -539,28 +552,29 @@ int main(int argc, char *argv[])
 
 
     // Construct renumberMethod
-    IOobject io
-    (
-        "renumberMeshDict",
-        runTime.system(),
-        mesh,
-        IOobject::MUST_READ_IF_MODIFIED,
-        IOobject::NO_WRITE
-    );
-
     autoPtr<renumberMethod> renumberPtr;
 
-    if (io.headerOk())
+    if (readDict)
     {
-        Info<< "Detected local " << runTime.system()/io.name() << "." << nl
-            << "Using this to select renumberMethod." << nl << endl;
-        renumberPtr = renumberMethod::New(IOdictionary(io));
+        Info<< "Renumber according to renumberMeshDict." << nl << endl;
+
+        IOdictionary renumberDict
+        (
+            IOobject
+            (
+                "renumberMeshDict",
+                runTime.system(),
+                mesh,
+                IOobject::MUST_READ_IF_MODIFIED,
+                IOobject::NO_WRITE
+            )
+        );
+
+        renumberPtr = renumberMethod::New(renumberDict);
     }
     else
     {
-        Info<< "No local " << runTime.system()/io.name()
-            << " dictionary found. Using default renumberMethod." << nl
-            << endl;
+        Info<< "Using default renumberMethod." << nl << endl;
         dictionary renumberDict;
         renumberPtr.reset(new CuthillMcKeeRenumber(renumberDict));
     }

From 5d5a94cfd061599aa5e9bd8cc09234abca1fd462 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 15:12:04 +0000
Subject: [PATCH 09/70] ENH: Added new processorField function object - outputs
 field of procesor ID

---
 .../functionObjects/field/Make/files          |   3 +
 .../field/processorField/IOprocessorField.H   |  49 ++++++
 .../field/processorField/postProcessingDict   |  35 ++++
 .../field/processorField/processorField.C     | 120 +++++++++++++
 .../field/processorField/processorField.H     | 146 ++++++++++++++++
 .../processorFieldFunctionObject.C            |  42 +++++
 .../processorFieldFunctionObject.H            |  54 ++++++
 .../processorField/processorFieldTemplates.C  | 158 ++++++++++++++++++
 8 files changed, 607 insertions(+)
 create mode 100644 src/postProcessing/functionObjects/field/processorField/IOprocessorField.H
 create mode 100644 src/postProcessing/functionObjects/field/processorField/postProcessingDict
 create mode 100644 src/postProcessing/functionObjects/field/processorField/processorField.C
 create mode 100644 src/postProcessing/functionObjects/field/processorField/processorField.H
 create mode 100644 src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.C
 create mode 100644 src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.H
 create mode 100644 src/postProcessing/functionObjects/field/processorField/processorFieldTemplates.C

diff --git a/src/postProcessing/functionObjects/field/Make/files b/src/postProcessing/functionObjects/field/Make/files
index 9d465d2663..1ea75cf3ff 100644
--- a/src/postProcessing/functionObjects/field/Make/files
+++ b/src/postProcessing/functionObjects/field/Make/files
@@ -18,6 +18,9 @@ fieldValues/cellSource/cellSourceFunctionObject.C
 nearWallFields/nearWallFields.C
 nearWallFields/nearWallFieldsFunctionObject.C
 
+processorField/processorField.C
+processorField/processorFieldFunctionObject.C
+
 readFields/readFields.C
 readFields/readFieldsFunctionObject.C
 
diff --git a/src/postProcessing/functionObjects/field/processorField/IOprocessorField.H b/src/postProcessing/functionObjects/field/processorField/IOprocessorField.H
new file mode 100644
index 0000000000..4c3e423972
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/IOprocessorField.H
@@ -0,0 +1,49 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Typedef
+    Foam::IOprocessorField
+
+Description
+    Instance of the generic IOOutputFilter for processorField.
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef IOprocessorField_H
+#define IOprocessorField_H
+
+#include "processorField.H"
+#include "IOOutputFilter.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    typedef IOOutputFilter<processorField> IOprocessorField;
+}
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/processorField/postProcessingDict b/src/postProcessing/functionObjects/field/processorField/postProcessingDict
new file mode 100644
index 0000000000..683e70c493
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/postProcessingDict
@@ -0,0 +1,35 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    object      postProcessingDict;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+functions
+{
+    processorField1
+    {
+        // Type of functionObject
+        type            processorField;
+
+        // Where to load it from (if not already in solver)
+        functionObjectLibs ("libfieldFunctionObjects.so");
+
+        // Function object enabled flag
+        enabled         true;
+
+        // When to output the average fields
+        outputControl   outputTime;
+    }
+}
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/processorField/processorField.C b/src/postProcessing/functionObjects/field/processorField/processorField.C
new file mode 100644
index 0000000000..87794ba92e
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/processorField.C
@@ -0,0 +1,120 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "processorField.H"
+#include "dictionary.H"
+#include "Pstream.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+defineTypeNameAndDebug(Foam::processorField, 0);
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::processorField::processorField
+(
+    const word& name,
+    const objectRegistry& obr,
+    const dictionary& dict,
+    const bool loadFromFiles
+)
+:
+    name_(name),
+    obr_(obr),
+    active_(true)
+{
+    // Check if the available mesh is an fvMesh otherise deactivate
+    if (!isA<fvMesh>(obr_))
+    {
+        active_ = false;
+        WarningIn
+        (
+            "processorField::processorField"
+            "("
+                "const word&, "
+                "const objectRegistry&, "
+                "const dictionary&, "
+                "const bool"
+            ")"
+        )   << "No fvMesh available, deactivating."
+            << endl;
+    }
+
+    read(dict);
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::processorField::~processorField()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::processorField::read(const dictionary& dict)
+{
+    // do nothing
+}
+
+
+void Foam::processorField::execute()
+{
+    // Do nothing
+}
+
+
+void Foam::processorField::end()
+{
+    // Do nothing
+}
+
+
+void Foam::processorField::write()
+{
+    if (active_)
+    {
+        const fvMesh& mesh = refCast<const fvMesh>(obr_);
+        volScalarField procField
+        (
+            IOobject
+            (
+                "processorID",
+                mesh.time().timeName(),
+                mesh,
+                IOobject::NO_READ,
+                IOobject::NO_WRITE
+            ),
+            mesh,
+            dimensionedScalar("procI", dimless, Pstream::myProcNo())
+        );
+
+        procField.write();
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/processorField/processorField.H b/src/postProcessing/functionObjects/field/processorField/processorField.H
new file mode 100644
index 0000000000..a51b17f969
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/processorField.H
@@ -0,0 +1,146 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::processorField
+
+Description
+    Writes a scalar field whose value is the local processor ID.  Output
+    field name is processorID.
+
+SourceFiles
+    processorField.C
+    IOprocessorField.H
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef processorField_H
+#define processorField_H
+
+#include "OFstream.H"
+#include "pointFieldFwd.H"
+#include "volFields.H"
+#include "surfaceFields.H"
+#include "coordinateSystem.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+// Forward declaration of classes
+class objectRegistry;
+class dictionary;
+class mapPolyMesh;
+
+/*---------------------------------------------------------------------------*\
+                      Class processorField Declaration
+\*---------------------------------------------------------------------------*/
+
+class processorField
+{
+protected:
+
+    // Protected data
+
+        //- Name of this set of nearWallFields object
+        word name_;
+
+        //- Reference to the database
+        const objectRegistry& obr_;
+
+        //- on/off switch
+        bool active_;
+
+
+    // Protected Member Functions
+
+        //- Disallow default bitwise copy construct
+        processorField(const processorField&);
+
+        //- Disallow default bitwise assignment
+        void operator=(const processorField&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("processorField");
+
+
+    // Constructors
+
+        //- Construct for given objectRegistry and dictionary.
+        //  Allow the possibility to load fields from files
+        processorField
+        (
+            const word& name,
+            const objectRegistry&,
+            const dictionary&,
+            const bool loadFromFiles = false
+        );
+
+
+    //- Destructor
+    virtual ~processorField();
+
+
+    // Member Functions
+
+        //- Return name of the processorField object
+        virtual const word& name() const
+        {
+            return name_;
+        }
+
+        //- Read the input data
+        virtual void read(const dictionary&);
+
+        //- Execute, currently does nothing
+        virtual void execute();
+
+        //- Execute at the final time-loop, currently does nothing
+        virtual void end();
+
+        //- Write
+        virtual void write();
+
+        //- Update for changes of mesh
+        virtual void updateMesh(const mapPolyMesh&)
+        {}
+
+        //- Update for changes of mesh
+        virtual void movePoints(const pointField&)
+        {}
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.C b/src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.C
new file mode 100644
index 0000000000..52fb9eafce
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.C
@@ -0,0 +1,42 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "processorFieldFunctionObject.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineNamedTemplateTypeNameAndDebug(processorFieldFunctionObject, 0);
+
+    addToRunTimeSelectionTable
+    (
+        functionObject,
+        processorFieldFunctionObject,
+        dictionary
+    );
+}
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.H b/src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.H
new file mode 100644
index 0000000000..29b9b29c5b
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/processorFieldFunctionObject.H
@@ -0,0 +1,54 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Typedef
+    Foam::processorFieldFunctionObject
+
+Description
+    FunctionObject wrapper around processorField to allow
+    them to be created via the functions entry within controlDict.
+
+SourceFiles
+    processorFieldFunctionObject.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef processorFieldFunctionObject_H
+#define processorFieldFunctionObject_H
+
+#include "processorField.H"
+#include "OutputFilterFunctionObject.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    typedef OutputFilterFunctionObject<processorField>
+        processorFieldFunctionObject;
+}
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/postProcessing/functionObjects/field/processorField/processorFieldTemplates.C b/src/postProcessing/functionObjects/field/processorField/processorFieldTemplates.C
new file mode 100644
index 0000000000..ac190e298b
--- /dev/null
+++ b/src/postProcessing/functionObjects/field/processorField/processorFieldTemplates.C
@@ -0,0 +1,158 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "processorField.H"
+#include "volFields.H"
+#include "surfaceFields.H"
+#include "Time.H"
+#include "transformGeometricField.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+template<class Type>
+void Foam::processorField::transformField
+(
+    const Type& field
+) const
+{
+    const word& fieldName = field.name() + "Transformed";
+
+    dimensionedTensor R("R", field.dimensions(), coordSys_.R());
+
+    if (obr_.foundObject<Type>(fieldName))
+    {
+        Type& transField =
+            const_cast<Type&>(obr_.lookupObject<Type>(fieldName));
+
+        transField == field;
+
+        forAll(field, i)
+        {
+            Foam::transform(transField, R, transField);
+        }
+
+        transField.write();
+    }
+    else
+    {
+        Type& transField = obr_.store
+        (
+            new Type
+            (
+                IOobject
+                (
+                    fieldName,
+                    obr_.time().timeName(),
+                    obr_,
+                    IOobject::READ_IF_PRESENT,
+                    IOobject::NO_WRITE
+                ),
+                field
+            )
+        );
+
+        forAll(field, i)
+        {
+            Foam::transform(transField, R, transField);
+        }
+
+        transField.write();
+    }
+}
+
+
+template<class Type>
+void Foam::processorField::transform
+(
+    const word& fieldName
+) const
+{
+    typedef GeometricField<Type, fvPatchField, volMesh> vfType;
+    typedef GeometricField<Type, fvsPatchField, surfaceMesh> sfType;
+
+    if (obr_.foundObject<vfType>(fieldName))
+    {
+        if (debug)
+        {
+            Info<< type() << ": Field " << fieldName << " already in database"
+                << endl;
+        }
+
+        transformField<vfType>(obr_.lookupObject<vfType>(fieldName));
+    }
+    else if (obr_.foundObject<sfType>(fieldName))
+    {
+        if (debug)
+        {
+            Info<< type() << ": Field " << fieldName << " already in database"
+                << endl;
+        }
+
+        transformField<sfType>(obr_.lookupObject<sfType>(fieldName));
+    }
+    else
+    {
+        IOobject fieldHeader
+        (
+            fieldName,
+            obr_.time().timeName(),
+            obr_,
+            IOobject::MUST_READ,
+            IOobject::NO_WRITE
+        );
+
+        if
+        (
+            fieldHeader.headerOk()
+         && fieldHeader.headerClassName() == vfType::typeName
+        )
+        {
+            if (debug)
+            {
+                Info<< type() << ": Field " << fieldName << " read from file"
+                    << endl;
+            }
+
+            transformField<vfType>(obr_.lookupObject<vfType>(fieldName));
+        }
+        else if
+        (
+            fieldHeader.headerOk()
+         && fieldHeader.headerClassName() == sfType::typeName
+        )
+        {
+            if (debug)
+            {
+                Info<< type() << ": Field " << fieldName << " read from file"
+                    << endl;
+            }
+
+            transformField<sfType>(obr_.lookupObject<sfType>(fieldName));
+        }
+    }
+}
+
+
+// ************************************************************************* //

From 43a6d313c48148afc05ababb7f710666bad75a7e Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 15:29:34 +0000
Subject: [PATCH 10/70] ENH: Added max diameter calc to base KinematicCloud

---
 .../Templates/KinematicCloud/KinematicCloud.H    |  3 +++
 .../Templates/KinematicCloud/KinematicCloudI.H   | 16 ++++++++++++++++
 2 files changed, 19 insertions(+)

diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
index 986c7eaf44..77c0aacdac 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
@@ -468,6 +468,9 @@ public:
             //- Mean diameter Dij
             inline scalar Dij(const label i, const label j) const;
 
+            //- Max diameter
+            inline scalar Dmax() const;
+
 
             // Fields
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H
index 9bb7a96a56..a340095807 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H
@@ -302,6 +302,22 @@ inline Foam::scalar Foam::KinematicCloud<CloudType>::Dij
 }
 
 
+template<class CloudType>
+inline Foam::scalar Foam::KinematicCloud<CloudType>::Dmax() const
+{
+    scalar d = -GREAT;
+    forAllConstIter(typename KinematicCloud<CloudType>, *this, iter)
+    {
+        const parcelType& p = iter();
+        d = max(d, p.d());
+    }
+
+    reduce(d, maxOp<scalar>());
+
+    return d;
+}
+
+
 template<class CloudType>
 inline Foam::scalar Foam::KinematicCloud<CloudType>::penetration
 (

From 188ad9733359cfa98ce429f557e822589de20205 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 15:30:17 +0000
Subject: [PATCH 11/70] ENH: Improves output messages for sprayCloud operation

---
 .../spray/clouds/Templates/SprayCloud/SprayCloud.C         | 7 +++++--
 1 file changed, 5 insertions(+), 2 deletions(-)

diff --git a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C
index 67723a6e02..a5aa28045f 100644
--- a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C
+++ b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C
@@ -362,10 +362,13 @@ void Foam::SprayCloud<CloudType>::info() const
 {
     CloudType::info();
     scalar d32 = 1.0e+6*this->Dij(3, 2);
+    scalar d10 = 1.0e+6*this->Dij(1, 0);
+    scalar dMax = 1.0e+6*this->Dmax();
     scalar pen = this->penetration(0.95);
 
-    Info << "    D32 (mu)                        = " << d32 << endl;
-    Info << "    Liquid penetration 95% mass (m) = " << pen << endl;
+    Info << "    D10, D32, Dmax (mu)             = " << d10 << ", " << d32
+         << ", " << dMax << nl
+         << "    Liquid penetration 95% mass (m) = " << pen << endl;
 }
 
 

From fe66afddbcc9802f3d2e1a197da27adc4d3a48ce Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 18:35:14 +0000
Subject: [PATCH 12/70] ENH: Added API for droplet boiling

---
 .../ReactingMultiphaseParcel.C                         |  1 +
 .../parcels/Templates/ReactingParcel/ReactingParcel.C  |  5 +++++
 .../parcels/Templates/ReactingParcel/ReactingParcel.H  |  1 +
 .../LiquidEvaporation/LiquidEvaporation.C              | 10 +++++-----
 .../LiquidEvaporation/LiquidEvaporation.H              |  3 +++
 .../PhaseChangeModel/PhaseChangeModel.C                |  6 ++++++
 .../PhaseChangeModel/PhaseChangeModel.H                |  3 +++
 7 files changed, 24 insertions(+), 5 deletions(-)

diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
index e6fafaa46d..740aa3f0b8 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
@@ -240,6 +240,7 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calc
         dt,
         cellI,
         Res,
+        Prs,
         Ts,
         mus/rhos,
         d0,
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
index 44fc4c1a86..68567ba0bc 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
@@ -329,6 +329,7 @@ void Foam::ReactingParcel<ParcelType>::calc
         dt,
         cellI,
         Res,
+        Prs,
         Ts,
         mus/rhos,
         d0,
@@ -464,6 +465,7 @@ void Foam::ReactingParcel<ParcelType>::calcPhaseChange
     const scalar dt,
     const label cellI,
     const scalar Re,
+    const scalar Pr,
     const scalar Ts,
     const scalar nus,
     const scalar d,
@@ -500,11 +502,14 @@ void Foam::ReactingParcel<ParcelType>::calcPhaseChange
         dt,
         cellI,
         Re,
+        Pr,
         d,
         nus,
         T,
         Ts,
         pc_,
+        this->Tc_,
+        YComponents,
         dMassPC
     );
 
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.H b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.H
index c69c7e3d30..4c79461587 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.H
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.H
@@ -210,6 +210,7 @@ protected:
             const scalar dt,           // timestep
             const label cellI,         // owner cell
             const scalar Re,           // Reynolds number
+            const scalar Pr,           // Prandtl number
             const scalar Ts,           // Surface temperature
             const scalar nus,          // Surface kinematic viscosity
             const scalar d,            // diameter
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.C b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.C
index 93e237be49..d2825055ba 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.C
@@ -140,20 +140,20 @@ void Foam::LiquidEvaporation<CloudType>::calculate
     const scalar dt,
     const label cellI,
     const scalar Re,
+    const scalar Pr,
     const scalar d,
     const scalar nu,
     const scalar T,
     const scalar Ts,
     const scalar pc,
+    const scalar Tc,
+    const scalarField& Yl,
     scalarField& dMassPC
 ) const
 {
     // construct carrier phase species volume fractions for cell, cellI
     const scalarField Xc(calcXc(cellI));
 
-    // droplet surface area
-    const scalar A = pi*sqr(d);
-
     // calculate mass transfer of each specie in liquid
     forAll(activeLiquids_, i)
     {
@@ -180,7 +180,7 @@ void Foam::LiquidEvaporation<CloudType>::calculate
         // mass transfer coefficient [m/s]
         const scalar kc = Sh*Dab/(d + ROOTVSMALL);
 
-        // vapour concentration at droplet surface [kmol/m3] at film temperature
+        // vapour concentration at surface [kmol/m3] at film temperature
         const scalar Cs = pSat/(specie::RR*Ts);
 
         // vapour concentration in bulk gas [kmol/m3] at film temperature
@@ -190,7 +190,7 @@ void Foam::LiquidEvaporation<CloudType>::calculate
         const scalar Ni = max(kc*(Cs - Cinf), 0.0);
 
         // mass transfer [kg]
-        dMassPC[lid] += Ni*A*liquids_.properties()[lid].W()*dt;
+        dMassPC[lid] += Ni*pi*sqr(d)*liquids_.properties()[lid].W()*dt;
     }
 }
 
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.H b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.H
index 6978b60fb3..60db6c63a5 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.H
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporation/LiquidEvaporation.H
@@ -111,11 +111,14 @@ public:
             const scalar dt,
             const label cellI,
             const scalar Re,
+            const scalar Pr,
             const scalar d,
             const scalar nu,
             const scalar T,
             const scalar Ts,
             const scalar pc,
+            const scalar Tc,
+            const scalarField& Yl,
             scalarField& dMassPC
         ) const;
 
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C
index f531c3ecce..1b79c4e08b 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C
@@ -135,6 +135,9 @@ void Foam::PhaseChangeModel<CloudType>::calculate
     const scalar,
     const scalar,
     const scalar,
+    const scalar,
+    const scalar,
+    const scalarField&,
     scalarField&
 ) const
 {
@@ -150,6 +153,9 @@ void Foam::PhaseChangeModel<CloudType>::calculate
             "const scalar, "
             "const scalar, "
             "const scalar, "
+            "const scalar, "
+            "const scalar, "
+            "const scalarField&,"
             "scalarField&"
         ") const"
     );
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H
index 09f1386bc1..9447d1cccc 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H
@@ -158,11 +158,14 @@ public:
             const scalar dt,
             const label cellI,
             const scalar Re,
+            const scalar Pr,
             const scalar d,
             const scalar nu,
             const scalar T,
             const scalar Ts,
             const scalar pc,
+            const scalar Tc,
+            const scalarField& Yl,
             scalarField& dMassPC
         ) const;
 

From b78d70237734e4643a5c8842e2e57ca4ad29bb49 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 18:36:00 +0000
Subject: [PATCH 13/70] ENH: Added new liquid evaporation+boiling spray phase
 change model

---
 .../makeReactingParcelPhaseChangeModels.H     |   4 +-
 .../LiquidEvaporationBoil.C                   | 299 ++++++++++++++++++
 .../LiquidEvaporationBoil.H                   | 151 +++++++++
 3 files changed, 453 insertions(+), 1 deletion(-)
 create mode 100644 src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C
 create mode 100644 src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.H

diff --git a/src/lagrangian/intermediate/parcels/include/makeReactingParcelPhaseChangeModels.H b/src/lagrangian/intermediate/parcels/include/makeReactingParcelPhaseChangeModels.H
index 0885ed63f6..47d4899e9d 100644
--- a/src/lagrangian/intermediate/parcels/include/makeReactingParcelPhaseChangeModels.H
+++ b/src/lagrangian/intermediate/parcels/include/makeReactingParcelPhaseChangeModels.H
@@ -30,6 +30,7 @@ License
 
 #include "NoPhaseChange.H"
 #include "LiquidEvaporation.H"
+#include "LiquidEvaporationBoil.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -37,7 +38,8 @@ License
                                                                               \
     makePhaseChangeModel(CloudType);                                          \
     makePhaseChangeModelType(NoPhaseChange, CloudType);                       \
-    makePhaseChangeModelType(LiquidEvaporation, CloudType);
+    makePhaseChangeModelType(LiquidEvaporation, CloudType);                   \
+    makePhaseChangeModelType(LiquidEvaporationBoil, CloudType);
 
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C
new file mode 100644
index 0000000000..b77fb348ee
--- /dev/null
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C
@@ -0,0 +1,299 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "LiquidEvaporationBoil.H"
+#include "specie.H"
+#include "mathematicalConstants.H"
+
+using namespace Foam::constant::mathematical;
+
+// * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::tmp<Foam::scalarField> Foam::LiquidEvaporationBoil<CloudType>::calcXc
+(
+    const label cellI
+) const
+{
+    scalarField Xc(this->owner().thermo().carrier().Y().size());
+
+    forAll(Xc, i)
+    {
+        Xc[i] =
+            this->owner().thermo().carrier().Y()[i][cellI]
+           /this->owner().thermo().carrier().W(i);
+    }
+
+    return Xc/sum(Xc);
+}
+
+
+template<class CloudType>
+Foam::scalar Foam::LiquidEvaporationBoil<CloudType>::Sh
+(
+    const scalar Re,
+    const scalar Sc
+) const
+{
+    return 2.0 + 0.6*Foam::sqrt(Re)*cbrt(Sc);
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::LiquidEvaporationBoil<CloudType>::LiquidEvaporationBoil
+(
+    const dictionary& dict,
+    CloudType& owner
+)
+:
+    PhaseChangeModel<CloudType>(dict, owner, typeName),
+    liquids_(owner.thermo().liquids()),
+    activeLiquids_(this->coeffDict().lookup("activeLiquids")),
+    liqToCarrierMap_(activeLiquids_.size(), -1),
+    liqToLiqMap_(activeLiquids_.size(), -1)
+{
+    if (activeLiquids_.size() == 0)
+    {
+        WarningIn
+        (
+            "Foam::LiquidEvaporationBoil<CloudType>::LiquidEvaporationBoil"
+            "("
+                "const dictionary& dict, "
+                "CloudType& owner"
+            ")"
+        )   << "Evaporation model selected, but no active liquids defined"
+            << nl << endl;
+    }
+    else
+    {
+        Info<< "Participating liquid species:" << endl;
+
+        // Determine mapping between liquid and carrier phase species
+        forAll(activeLiquids_, i)
+        {
+            Info<< "    " << activeLiquids_[i] << endl;
+            liqToCarrierMap_[i] =
+                owner.composition().globalCarrierId(activeLiquids_[i]);
+        }
+
+        // Determine mapping between model active liquids and global liquids
+        const label idLiquid = owner.composition().idLiquid();
+        forAll(activeLiquids_, i)
+        {
+            liqToLiqMap_[i] =
+                owner.composition().localId(idLiquid, activeLiquids_[i]);
+        }
+    }
+}
+
+
+template<class CloudType>
+Foam::LiquidEvaporationBoil<CloudType>::LiquidEvaporationBoil
+(
+    const LiquidEvaporationBoil<CloudType>& pcm
+)
+:
+    PhaseChangeModel<CloudType>(pcm),
+    liquids_(pcm.owner().thermo().liquids()),
+    activeLiquids_(pcm.activeLiquids_),
+    liqToCarrierMap_(pcm.liqToCarrierMap_),
+    liqToLiqMap_(pcm.liqToLiqMap_)
+{}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+template<class CloudType>
+Foam::LiquidEvaporationBoil<CloudType>::~LiquidEvaporationBoil()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+template<class CloudType>
+void Foam::LiquidEvaporationBoil<CloudType>::calculate
+(
+    const scalar dt,
+    const label cellI,
+    const scalar Re,
+    const scalar Pr,
+    const scalar d,
+    const scalar nu,
+    const scalar T,
+    const scalar Ts,
+    const scalar pc,
+    const scalar Tc,
+    const scalarField& Yl,
+    scalarField& dMassPC
+) const
+{
+    // construct carrier phase species volume fractions for cell, cellI
+    const scalarField XcMix(calcXc(cellI));
+
+    // liquid volume fraction
+    const scalarField X(liquids_.X(Yl));
+
+    // droplet surface pressure
+    scalar ps = liquids_.pv(pc, T, X);
+
+    // vapour density at droplet surface [kg/m3]
+    scalar rhos = ps*liquids_.W(X)/(specie::RR*Ts);
+
+    // thermal conductivity of carrier [W/m/K]
+    scalar kappac = 0.0;
+    forAll(this->owner().thermo().carrier().Y(), i)
+    {
+        const scalar Yc = this->owner().thermo().carrier().Y()[i][cellI];
+        kappac += Yc*this->owner().thermo().carrier().kappa(i, Ts);
+    }
+
+    // calculate mass transfer of each specie in liquid
+    forAll(activeLiquids_, i)
+    {
+        const label gid = liqToCarrierMap_[i];
+        const label lid = liqToLiqMap_[i];
+
+        // boiling temperature at cell pressure for liquid species lid [K]
+        const scalar TBoil = liquids_.properties()[lid].pvInvert(pc);
+
+        // limit droplet temperature to boiling/critical temperature
+        const scalar Td = min(T, 0.999*TBoil);
+
+        // saturation pressure for liquid species lid [Pa]
+        const scalar pSat = liquids_.properties()[lid].pv(pc, Td);
+
+        // carrier phase concentration
+        scalar Xc = XcMix[gid];
+
+        if (Xc*pc > pSat)
+        {
+            // saturated vapour - no phase change
+        }
+        else
+        {
+            if (pSat > 0.999*pc)
+            {
+                // boiling
+
+//                const scalar deltaT = max(Tc - Td, 0.5);
+                const scalar deltaT = max(Tc - T, 0.5);
+
+                // liquid specific heat capacity
+                const scalar Cp = liquids_.properties()[lid].Cp(pc, Td);
+
+                // vapour heat of fomation
+                const scalar hv = liquids_.properties()[lid].hl(pc, Td);
+
+                // Nusselt number
+                const scalar Nu = 2.0 + 0.6*sqrt(Re)*cbrt(Pr);
+
+                const scalar lg = log(1.0 + Cp*deltaT/max(SMALL, hv));
+
+                // mass transfer [kg]
+                dMassPC[lid] += pi*kappac*Nu*lg*d/Cp*dt;
+            }
+            else
+            {
+                // evaporation
+
+                // surface molar fraction - Raoult's Law
+                scalar Xs = X[lid]*pSat/pc;
+
+                // molar ratio
+                const scalar Xr = (Xs - Xc)/max(SMALL, 1.0 - Xs);
+
+
+                if (Xr > 0)
+                {
+                    // vapour diffusivity [m2/s]
+                    const scalar Dab = liquids_.properties()[lid].D(pc, Td);
+
+                    // Schmidt number
+                    const scalar Sc = nu/(Dab + ROOTVSMALL);
+
+                    // Sherwood number
+                    const scalar Sh = this->Sh(Re, Sc);
+
+                    // mass transfer coefficient [m/s]
+                    const scalar kc = Sh*Dab/(d + ROOTVSMALL);
+
+                    // mass transfer [kg]
+                    dMassPC[lid] += pi*sqr(d)*kc*rhos*log(1.0 + Xr)*dt;
+                }
+            }
+        }
+    }
+}
+
+
+template<class CloudType>
+Foam::scalar Foam::LiquidEvaporationBoil<CloudType>::dh
+(
+    const label idc,
+    const label idl,
+    const label p,
+    const label T
+) const
+{
+    scalar dh = 0;
+
+    typedef PhaseChangeModel<CloudType> parent;
+    switch (parent::enthalpyTransfer_)
+    {
+        case (parent::etLatentHeat):
+        {
+            dh = liquids_.properties()[idl].hl(p, T);
+            break;
+        }
+        case (parent::etEnthalpyDifference):
+        {
+            scalar hc = this->owner().composition().carrier().H(idc, T);
+            scalar hp = liquids_.properties()[idl].h(p, T);
+
+            dh = hc - hp;
+            break;
+        }
+        default:
+        {
+            FatalErrorIn
+            (
+                "Foam::scalar Foam::LiquidEvaporationBoil<CloudType>::dh"
+                "("
+                    "const label, "
+                    "const label, "
+                    "const label, "
+                    "const label"
+                ")"
+            )   << "Unknown enthalpyTransfer type" << abort(FatalError);
+        }
+    }
+
+    return dh;
+}
+
+
+// ************************************************************************* //
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.H b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.H
new file mode 100644
index 0000000000..f16ea47be9
--- /dev/null
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.H
@@ -0,0 +1,151 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::LiquidEvaporationBoil
+
+Description
+    Liquid evaporation model
+    - uses ideal gas assumption
+    - includes boiling model
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef LiquidEvaporationBoil_H
+#define LiquidEvaporationBoil_H
+
+#include "PhaseChangeModel.H"
+#include "liquidMixtureProperties.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+/*---------------------------------------------------------------------------*\
+                   Class LiquidEvaporationBoil Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class CloudType>
+class LiquidEvaporationBoil
+:
+    public PhaseChangeModel<CloudType>
+{
+protected:
+
+    // Protected data
+
+        //- Global liquid properties data
+        const liquidMixtureProperties& liquids_;
+
+        //- List of active liquid names
+        List<word> activeLiquids_;
+
+        //- Mapping between liquid and carrier species
+        List<label> liqToCarrierMap_;
+
+        //- Mapping between local and global liquid species
+        List<label> liqToLiqMap_;
+
+
+    // Protected Member Functions
+
+        //- Sherwood number as a function of Reynolds and Schmidt numbers
+        scalar Sh(const scalar Re, const scalar Sc) const;
+
+        //- Calculate the carrier phase component volume fractions at cellI
+        tmp<scalarField> calcXc(const label cellI) const;
+
+
+public:
+
+    //- Runtime type information
+    TypeName("liquidEvaporationBoil");
+
+
+    // Constructors
+
+        //- Construct from dictionary
+        LiquidEvaporationBoil(const dictionary& dict, CloudType& cloud);
+
+        //- Construct copy
+        LiquidEvaporationBoil(const LiquidEvaporationBoil<CloudType>& pcm);
+
+        //- Construct and return a clone
+        virtual autoPtr<PhaseChangeModel<CloudType> > clone() const
+        {
+            return autoPtr<PhaseChangeModel<CloudType> >
+            (
+                new LiquidEvaporationBoil<CloudType>(*this)
+            );
+        }
+
+
+    //- Destructor
+    virtual ~LiquidEvaporationBoil();
+
+
+    // Member Functions
+
+        //- Update model
+        virtual void calculate
+        (
+            const scalar dt,
+            const label cellI,
+            const scalar Re,
+            const scalar Pr,
+            const scalar d,
+            const scalar nu,
+            const scalar T,
+            const scalar Ts,
+            const scalar pc,
+            const scalar Tc,
+            const scalarField& Yl,
+            scalarField& dMassPC
+        ) const;
+
+        //- Return the enthalpy per unit mass
+        virtual scalar dh
+        (
+            const label idc,
+            const label idl,
+            const label p,
+            const label T
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#ifdef NoRepository
+#   include "LiquidEvaporationBoil.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

From e83f9b1d1e0feef3bd26f6b611476a7baaf7453c Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 18:36:31 +0000
Subject: [PATCH 14/70] ENH: Updated sprayFoam AachenBomb tutorial case set-up

---
 .../aachenBomb/constant/sprayCloudProperties  | 54 +++++++++++++------
 1 file changed, 39 insertions(+), 15 deletions(-)

diff --git a/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties b/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties
index 280145a35b..27e6772ec8 100644
--- a/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties
+++ b/tutorials/lagrangian/sprayFoam/aachenBomb/constant/sprayCloudProperties
@@ -61,7 +61,7 @@ constantProperties
     minParticleMass 1e-15;
 
     rho0            1000;
-    T0              300;
+    T0              320;
     Cp0             4187;
 
     youngsModulus   1e9;
@@ -94,13 +94,13 @@ subModels
 
     compositionModel singlePhaseMixture;
 
-    phaseChangeModel liquidEvaporation;
+    phaseChangeModel liquidEvaporationBoil;
 
     surfaceFilmModel none;
 
     atomizationModel none;
 
-    breakupModel    PilchErdman;
+    breakupModel    ReitzDiwakar; // ReitzKHRT;
 
     stochasticCollisionModel none;
 
@@ -118,7 +118,7 @@ subModels
         duration        1.25e-3;
         position        ( 0 0.0995 0 );
         direction       ( 0 -1 0 );
-        parcelsPerSecond 100000000;
+        parcelsPerSecond 20000000;
         flowRateProfile table
         (
             (0 0.1272)
@@ -154,21 +154,22 @@ subModels
             (0.00125 3.9213)
         );
 
-        Cd              constant 0.85;
+        Cd              constant 0.9;
 
         thetaInner      constant 0.0;
         thetaOuter      constant 10.0;
 
         sizeDistribution
         {
-            type            uniform;
+            type        RosinRammler;
 
-            uniformDistribution
+            RosinRammlerDistribution
             {
-                minValue        1.0e-4;
-                maxValue        1.1e-4;
+                minValue        1e-06;
+                maxValue        0.00015;
+                d               0.00015;
+                n               3;
             }
-
         }
     }
 
@@ -193,18 +194,41 @@ subModels
         );
     }
 
-    liquidEvaporationCoeffs
+    liquidEvaporationBoilCoeffs
     {
         enthalpyTransfer enthalpyDifference;
 
         activeLiquids    ( C7H16 );
     }
 
-    PilchErdmanCoeffs
+    ReitzDiwakarCoeffs
     {
-        solveOscillationEq false;
-        B1              0.375;
-        B2              0.236;
+        solveOscillationEq yes;
+        Cbag            6;
+        Cb              0.785;
+        Cstrip          0.5;
+        Cs              10;
+    }
+
+/*
+    ReitzKHRTCoeffs
+    {
+        solveOscillationEq yes;
+        B0              0.61;
+        B1              40;
+        Ctau            1;
+        CRT             0.1;
+        msLimit         0.2;
+        WeberLimit      6;
+    }
+*/
+    TABCoeffs
+    {
+        y0              0;
+        yDot0           0;
+        Cmu             10;
+        Comega          8;
+        WeCrit          12;
     }
 }
 

From 71fae4bb567cbcd2467d9dee47ed037e7a310175 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 13 Dec 2011 18:37:59 +0000
Subject: [PATCH 15/70] ENH: Use const for variables

---
 .../LiquidEvaporationBoil/LiquidEvaporationBoil.C             | 4 ++--
 1 file changed, 2 insertions(+), 2 deletions(-)

diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C
index b77fb348ee..651d95d1c6 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/LiquidEvaporationBoil/LiquidEvaporationBoil.C
@@ -187,7 +187,7 @@ void Foam::LiquidEvaporationBoil<CloudType>::calculate
         const scalar pSat = liquids_.properties()[lid].pv(pc, Td);
 
         // carrier phase concentration
-        scalar Xc = XcMix[gid];
+        const scalar Xc = XcMix[gid];
 
         if (Xc*pc > pSat)
         {
@@ -221,7 +221,7 @@ void Foam::LiquidEvaporationBoil<CloudType>::calculate
                 // evaporation
 
                 // surface molar fraction - Raoult's Law
-                scalar Xs = X[lid]*pSat/pc;
+                const scalar Xs = X[lid]*pSat/pc;
 
                 // molar ratio
                 const scalar Xr = (Xs - Xc)/max(SMALL, 1.0 - Xs);

From a263e210d57d0254f00a3563bec584e8c6eaa885 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Wed, 14 Dec 2011 11:03:32 +0000
Subject: [PATCH 16/70] ENH: Refactored spray break-up model - remove
 averageParcelMass from calc function args

---
 .../parcels/Templates/SprayParcel/SprayParcel.C |  1 -
 .../BreakupModel/BreakupModel/BreakupModel.C    |  2 --
 .../BreakupModel/BreakupModel/BreakupModel.H    |  1 -
 .../spray/submodels/BreakupModel/ETAB/ETAB.C    |  7 +++----
 .../spray/submodels/BreakupModel/ETAB/ETAB.H    |  3 +--
 .../BreakupModel/NoBreakup/NoBreakup.C          |  1 -
 .../BreakupModel/NoBreakup/NoBreakup.H          |  1 -
 .../BreakupModel/PilchErdman/PilchErdman.C      |  3 +--
 .../BreakupModel/PilchErdman/PilchErdman.H      |  3 +--
 .../BreakupModel/ReitzDiwakar/ReitzDiwakar.C    |  3 +--
 .../BreakupModel/ReitzDiwakar/ReitzDiwakar.H    |  1 -
 .../BreakupModel/ReitzKHRT/ReitzKHRT.C          |  7 ++++---
 .../BreakupModel/ReitzKHRT/ReitzKHRT.H          |  3 +--
 .../spray/submodels/BreakupModel/SHF/SHF.C      |  5 ++---
 .../spray/submodels/BreakupModel/SHF/SHF.H      |  4 +---
 .../spray/submodels/BreakupModel/TAB/TAB.C      | 17 +++++++++--------
 .../spray/submodels/BreakupModel/TAB/TAB.H      |  3 +--
 17 files changed, 25 insertions(+), 40 deletions(-)

diff --git a/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C b/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
index a4d277fa12..c90aa89c6a 100644
--- a/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
+++ b/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
@@ -274,7 +274,6 @@ void Foam::SprayParcel<ParcelType>::calcBreakup
             Urel,
             Urmag,
             tMom,
-            td.cloud().averageParcelMass(),
             dChild,
             massChild,
             td.cloud().rndGen()
diff --git a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
index b882058fb8..2c0c17f811 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
@@ -120,7 +120,6 @@ bool Foam::BreakupModel<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -149,7 +148,6 @@ bool Foam::BreakupModel<CloudType>::update
             "const vector&, "
             "const scalar, "
             "const scalar, "
-            "const scalar, "
             "scalar&, "
             "scalar&, "
             "cachedRandom&"
diff --git a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H
index 2e64d29b82..51905371da 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H
@@ -183,7 +183,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C
index 965729b215..66bbbde584 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C
@@ -112,7 +112,6 @@ bool Foam::ETAB<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -156,7 +155,7 @@ bool Foam::ETAB<CloudType>::update
             scalar quad = -y2/a;
             if (quad < 0)
             {
-                phi = 2*constant::mathematical::pi - phit;
+                phi = constant::mathematical::twoPi - phit;
             }
 
             scalar tb = 0;
@@ -167,11 +166,11 @@ bool Foam::ETAB<CloudType>::update
 
                 if (theta < phi)
                 {
-                    if (2*constant::mathematical::pi - theta >= phi)
+                    if (constant::mathematical::twoPi - theta >= phi)
                     {
                         theta = -theta;
                     }
-                    theta += 2*constant::mathematical::pi;
+                    theta += constant::mathematical::twoPi;
                 }
                 tb = (theta - phi)*romega;
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H
index 3586013c4b..4118f2cf96 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H
@@ -57,7 +57,7 @@ See Also
 namespace Foam
 {
 /*---------------------------------------------------------------------------*\
-                       Class ETAB Declaration
+                           Class ETAB Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -134,7 +134,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C
index 22641a9fcd..1b27dd125a 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C
@@ -84,7 +84,6 @@ bool Foam::NoBreakup<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H
index 9e3371be5b..406f1af0f1 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H
@@ -102,7 +102,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
index 14cd7d8d9f..402d619531 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
@@ -86,7 +86,6 @@ bool Foam::PilchErdman<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -94,7 +93,7 @@ bool Foam::PilchErdman<CloudType>::update
 {
     scalar semiMass = nParticle*pow3(d);
     scalar We = 0.5*rhoc*sqr(Urmag)*d/sigma;
-    scalar Oh = mu/pow(rho*d*sigma, 0.5);
+    scalar Oh = mu/sqrt(rho*d*sigma);
 
     scalar Wec = 6.0*(1.0 + 1.077*pow(Oh, 1.6));
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H
index 59c52408a3..a7e4d3f80f 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H
@@ -47,7 +47,7 @@ Description
 namespace Foam
 {
 /*---------------------------------------------------------------------------*\
-                       Class PilchErdman Declaration
+                        Class PilchErdman Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -115,7 +115,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C
index 452aa5f607..7c9256fa54 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C
@@ -92,7 +92,6 @@ bool Foam::ReitzDiwakar<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -130,7 +129,7 @@ bool Foam::ReitzDiwakar<CloudType>::update
 
         // preserve the total mass/volume by updating the number of
         // particles in parcels due to breakup
-        nParticle *= pow(d1/d, 3.0);
+        nParticle *= pow3(d1/d);
     }
 
     return false;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H
index 3e853f53a2..6644e34d84 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H
@@ -127,7 +127,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C
index c56f25a9fb..8214c2865f 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C
@@ -98,7 +98,6 @@ bool Foam::ReitzKHRT<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -106,6 +105,8 @@ bool Foam::ReitzKHRT<CloudType>::update
 {
     bool addParcel = false;
 
+    const scalar averageParcelMass = this->owner().averageParcelMass();
+
     scalar r = 0.5*d;
     scalar d3 = pow3(d);
     scalar d03 = pow3(d0);
@@ -158,7 +159,7 @@ bool Foam::ReitzKHRT<CloudType>::update
     scalar KRT = sqrt(helpVariable/(3.0*sigma + VSMALL));
 
     // wavelength of the fastest growing RT frequency
-    scalar lambdaRT = 2.0*constant::mathematical::pi*cRT_/(KRT + VSMALL);
+    scalar lambdaRT = constant::mathematical::twoPi*cRT_/(KRT + VSMALL);
 
     // if lambdaRT < diameter, then RT waves are growing on the surface
     // and we start to keep track of how long they have been growing
@@ -244,7 +245,7 @@ bool Foam::ReitzKHRT<CloudType>::update
         // Technology 3 (1987) 309-337, p.322) pIndKH() should be introduced
 
         scalar lengthScale =
-            min(lambdaKH, 2.0*constant::mathematical::pi*Urmag/omegaKH);
+            min(lambdaKH, constant::mathematical::twoPi*Urmag/omegaKH);
         scalar diameterLargerDrop = cbrt(1.5*d*d*lengthScale);
         d = diameterLargerDrop;
         ms = 0.0;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H
index efecd6c99b..aa6e7a2f95 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H
@@ -41,7 +41,7 @@ Description
 namespace Foam
 {
 /*---------------------------------------------------------------------------*\
-                       Class ReitzKHRT Declaration
+                         Class ReitzKHRT Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -114,7 +114,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
diff --git a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
index 8eb1cd087f..4d6f2d36a7 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
@@ -134,7 +134,6 @@ bool Foam::SHF<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -232,7 +231,7 @@ bool Foam::SHF<CloudType>::update
 
                 scalar p =
                     x
-                   /(2.0*sqrt(2.0*constant::mathematical::pi)*sigma_)
+                   /(2.0*sqrt(constant::mathematical::twoPi)*sigma_)
                    *exp(-0.5*sqr((x - mu_)/sigma_));
 
                 if (yGuess < p)
@@ -264,7 +263,7 @@ bool Foam::SHF<CloudType>::update
 
                 scalar p =
                     x
-                   /(2.0*sqrt(2.0*constant::mathematical::pi)*sigma_)
+                   /(2.0*sqrt(constant::mathematical::twoPi)*sigma_)
                    *exp(-0.5*sqr((x - mu_)/sigma_));
 
                 if (yGuess<p)
diff --git a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H
index 0d4e475678..2bd0a7486d 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H
@@ -48,7 +48,7 @@ Description
 namespace Foam
 {
 /*---------------------------------------------------------------------------*\
-                       Class SHF Declaration
+                            Class SHF Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -156,12 +156,10 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen
         ) const;
-
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C
index 72b5d5ded3..fefce9dbe6 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C
@@ -43,7 +43,7 @@ Foam::TAB<CloudType>::TAB
     // calculate the inverse function of the Rossin-Rammler Distribution
     const scalar xx0 = 12.0;
     const scalar rrd100 =
-        1.0/(1.0-exp(-xx0)*(1.0 + xx0 + sqr(xx0)/2.0 + pow3(xx0)/6.0));
+        1.0/(1.0 - exp(-xx0)*(1.0 + xx0 + sqr(xx0)/2.0 + pow3(xx0)/6.0));
 
     forAll(rrd_, n)
     {
@@ -54,7 +54,8 @@ Foam::TAB<CloudType>::TAB
 
     if (!BreakupModel<CloudType>::solveOscillationEq_)
     {
-        Info<< "Warning: solveOscillationEq is set to "
+        WarningIn("Foam::TAB<CloudType>::TAB(const dictionary&, CloudType&)")
+            << "solveOscillationEq is set to "
             << BreakupModel<CloudType>::solveOscillationEq_ << nl
             << " Setting it to true in order for the TAB model to work."
             << endl;
@@ -72,8 +73,9 @@ Foam::TAB<CloudType>::TAB
     else
     {
         SMDMethod_ = method2;
-        Info<< "Warning: SMDCalculationMethod unknown. Options are "
-            "(method1 | method2). Using method2" << endl;
+        WarningIn("Foam::TAB<CloudType>::TAB(const dictionary&, CloudType&)")
+            << "Unknown SMDCalculationMethod. Valid options are "
+            << "(method1 | method2). Using method2" << endl;
     }
 }
 
@@ -120,7 +122,6 @@ bool Foam::TAB<CloudType>::update
     const vector& Urel,
     const scalar Urmag,
     const scalar tMom,
-    const scalar averageParcelMass,
     scalar& dChild,
     scalar& massChild,
     cachedRandom& rndGen
@@ -162,7 +163,7 @@ bool Foam::TAB<CloudType>::update
             scalar quad = -y2/a;
             if (quad < 0)
             {
-                phi = 2.0*constant::mathematical::pi - phit;
+                phi = constant::mathematical::twoPi - phit;
             }
 
             scalar tb = 0;
@@ -179,11 +180,11 @@ bool Foam::TAB<CloudType>::update
 
                 if (theta < phi)
                 {
-                    if (2*constant::mathematical::pi-theta >= phi)
+                    if (constant::mathematical::twoPi - theta >= phi)
                     {
                         theta = -theta;
                     }
-                    theta += 2*constant::mathematical::pi;
+                    theta += constant::mathematical::twoPi;
                 }
                 tb = (theta-phi)/omega;
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H
index 972ed7c228..84af77f998 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H
@@ -54,7 +54,7 @@ See Also
 namespace Foam
 {
 /*---------------------------------------------------------------------------*\
-                       Class TAB Declaration
+                           Class TAB Declaration
 \*---------------------------------------------------------------------------*/
 
 template<class CloudType>
@@ -142,7 +142,6 @@ public:
             const vector& Urel,
             const scalar Urmag,
             const scalar tMom,
-            const scalar averageParcelMass,
             scalar& dChild,
             scalar& massChild,
             cachedRandom& rndGen

From fdad178fa96eef3ffa38dde9fde4bec10d20c116 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Wed, 14 Dec 2011 11:19:27 +0000
Subject: [PATCH 17/70] ENH: Added non-const access to break up model from
 spray cloud

---
 .../spray/clouds/Templates/SprayCloud/SprayCloud.H     |  3 +++
 .../spray/clouds/Templates/SprayCloud/SprayCloudI.H    | 10 ++++++++++
 2 files changed, 13 insertions(+)

diff --git a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H
index 675fc61ce1..19f584337f 100644
--- a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H
+++ b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H
@@ -196,6 +196,9 @@ public:
                 inline const BreakupModel<SprayCloud<CloudType> >&
                     breakup() const;
 
+                //- Return non-const-access to the breakup model
+                inline BreakupModel<SprayCloud<CloudType> >& breakup();
+
                 //- Return const-access to the breakup model
                 inline const StochasticCollisionModel<SprayCloud<CloudType> >&
                     stochasticCollision() const;
diff --git a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H
index f8d6d5f118..c27248aaae 100644
--- a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H
+++ b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H
@@ -49,6 +49,14 @@ Foam::SprayCloud<CloudType>::breakup() const
 }
 
 
+template<class CloudType>
+inline Foam::BreakupModel<Foam::SprayCloud<CloudType> >&
+Foam::SprayCloud<CloudType>::breakup()
+{
+    return breakupModel_();
+}
+
+
 template<class CloudType>
 inline const Foam::StochasticCollisionModel<Foam::SprayCloud<CloudType> >&
 Foam::SprayCloud<CloudType>::stochasticCollision() const
@@ -63,3 +71,5 @@ inline Foam::scalar Foam::SprayCloud<CloudType>::averageParcelMass() const
     return averageParcelMass_;
 }
 
+
+// ************************************************************************* //

From eea46a67315acd85c4e6873b60404545313bb3b8 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Wed, 14 Dec 2011 11:20:10 +0000
Subject: [PATCH 18/70] ENH: Refactored spray break-up model - removed rndGen
 from calc function args

---
 .../spray/parcels/Templates/SprayParcel/SprayParcel.C  |  3 +--
 .../submodels/BreakupModel/BreakupModel/BreakupModel.C | 10 ++++------
 .../submodels/BreakupModel/BreakupModel/BreakupModel.H |  5 ++---
 .../spray/submodels/BreakupModel/ETAB/ETAB.C           |  5 ++---
 .../spray/submodels/BreakupModel/ETAB/ETAB.H           |  5 ++---
 .../spray/submodels/BreakupModel/NoBreakup/NoBreakup.C |  5 ++---
 .../spray/submodels/BreakupModel/NoBreakup/NoBreakup.H |  5 ++---
 .../submodels/BreakupModel/PilchErdman/PilchErdman.C   |  5 ++---
 .../submodels/BreakupModel/PilchErdman/PilchErdman.H   |  5 ++---
 .../submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C |  5 ++---
 .../submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H |  5 ++---
 .../spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C |  5 ++---
 .../spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H |  5 ++---
 src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C  |  7 ++++---
 src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H  |  5 ++---
 src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C  |  7 ++++---
 src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H  |  5 ++---
 17 files changed, 39 insertions(+), 53 deletions(-)

diff --git a/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C b/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
index c90aa89c6a..8f987cb2f9 100644
--- a/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
+++ b/src/lagrangian/spray/parcels/Templates/SprayParcel/SprayParcel.C
@@ -275,8 +275,7 @@ void Foam::SprayParcel<ParcelType>::calcBreakup
             Urmag,
             tMom,
             dChild,
-            massChild,
-            td.cloud().rndGen()
+            massChild
         )
     )
     {
diff --git a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
index 2c0c17f811..a46179fd86 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
@@ -121,9 +121,8 @@ bool Foam::BreakupModel<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
     notImplemented
     (
@@ -149,9 +148,8 @@ bool Foam::BreakupModel<CloudType>::update
             "const scalar, "
             "const scalar, "
             "scalar&, "
-            "scalar&, "
-            "cachedRandom&"
-        ") const;"
+            "scalar&"
+        ");"
     );
 
     return false;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H
index 51905371da..e0672ca938 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.H
@@ -184,9 +184,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C
index 66bbbde584..fb48040831 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.C
@@ -113,9 +113,8 @@ bool Foam::ETAB<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
     scalar r  = 0.5*d;
     scalar r2 = r*r;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H
index 4118f2cf96..86d27e934d 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/ETAB/ETAB.H
@@ -135,9 +135,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C
index 1b27dd125a..cbe837eafd 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.C
@@ -85,9 +85,8 @@ bool Foam::NoBreakup<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
     // Do nothing
     return false;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H
index 406f1af0f1..b27792c54c 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/NoBreakup/NoBreakup.H
@@ -103,9 +103,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
index 402d619531..2f0337d006 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
@@ -87,9 +87,8 @@ bool Foam::PilchErdman<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
     scalar semiMass = nParticle*pow3(d);
     scalar We = 0.5*rhoc*sqr(Urmag)*d/sigma;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H
index a7e4d3f80f..830c1feeb5 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.H
@@ -116,9 +116,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C
index 7c9256fa54..25a123fc69 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.C
@@ -93,9 +93,8 @@ bool Foam::ReitzDiwakar<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
     scalar d1 = d;
     scalar nuc = muc/rhoc;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H
index 6644e34d84..84e9dac4a2 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzDiwakar/ReitzDiwakar.H
@@ -128,9 +128,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C
index 8214c2865f..d58678c4bd 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.C
@@ -99,9 +99,8 @@ bool Foam::ReitzKHRT<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
     bool addParcel = false;
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H
index aa6e7a2f95..d14d92b81e 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/ReitzKHRT/ReitzKHRT.H
@@ -115,9 +115,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
index 4d6f2d36a7..fc34d0c224 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.C
@@ -135,10 +135,11 @@ bool Foam::SHF<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
+    cachedRandom& rndGen = this->owner().rndGen();
+
     bool addChild = false;
 
     scalar d03 = pow3(d);
diff --git a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H
index 2bd0a7486d..2708488e0b 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/SHF/SHF.H
@@ -157,9 +157,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-        ) const;
+            scalar& massChild
+        );
 };
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C
index fefce9dbe6..8838a73ea0 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.C
@@ -123,10 +123,11 @@ bool Foam::TAB<CloudType>::update
     const scalar Urmag,
     const scalar tMom,
     scalar& dChild,
-    scalar& massChild,
-    cachedRandom& rndGen
-) const
+    scalar& massChild
+)
 {
+    cachedRandom& rndGen = this->owner().rndGen();
+
     scalar r = 0.5*d;
     scalar r2 = r*r;
     scalar r3 = r*r2;
diff --git a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H
index 84af77f998..e5c9234666 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H
+++ b/src/lagrangian/spray/submodels/BreakupModel/TAB/TAB.H
@@ -143,9 +143,8 @@ public:
             const scalar Urmag,
             const scalar tMom,
             scalar& dChild,
-            scalar& massChild,
-            cachedRandom& rndGen
-    ) const;
+            scalar& massChild
+    );
 };
 
 

From 944af168009a9c1a35c8f203d50985c8d6808415 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Wed, 14 Dec 2011 11:33:47 +0000
Subject: [PATCH 19/70] ENH: Use sqrt instead of pow(XXX, 0.5)

---
 .../spray/submodels/BreakupModel/PilchErdman/PilchErdman.C      | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
index 2f0337d006..bb4477a83b 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/PilchErdman/PilchErdman.C
@@ -122,7 +122,7 @@ bool Foam::PilchErdman<CloudType>::update
             taubBar = 6.0*pow(2.0*We - 12.0, -0.25);
         }
 
-        scalar rho12 = pow(rhoc/rho, 0.5);
+        scalar rho12 = sqrt(rhoc/rho);
 
         scalar Vd = Urmag*rho12*(B1_*taubBar * B2_*taubBar*taubBar);
         scalar Vd1 = sqr(1.0 - Vd/Urmag);

From 657e68ed78afa859abf35b09b8145d084efd39ac Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Thu, 15 Dec 2011 10:16:59 +0000
Subject: [PATCH 20/70] ENH: ensightWriter: added ensight format to sampledSets

---
 .../postProcessing/sampling/sample/sampleDict |   1 +
 src/finiteVolume/fvMesh/fvMesh.C              |  12 +
 .../mappedPolyPatch/mappedPatchBase.C         | 158 +++++----
 .../mappedPolyPatch/mappedPatchBase.H         |  15 +
 src/sampling/Make/files                       |   2 +
 .../writers/ensight/ensightSetWriter.C        | 315 ++++++++++++++++++
 .../writers/ensight/ensightSetWriter.H        | 111 ++++++
 .../writers/ensight/ensightSetWriterRunTime.C |  37 ++
 .../motorBike/motorBike/system/streamLines    |   2 +-
 .../simpleFoam/motorBike/system/streamLines   |   2 +-
 .../simpleFoam/pitzDaily/system/controlDict   |   2 +-
 .../pitzDailyExptInlet/system/controlDict     |   2 +-
 12 files changed, 595 insertions(+), 64 deletions(-)
 create mode 100644 src/sampling/sampledSet/writers/ensight/ensightSetWriter.C
 create mode 100644 src/sampling/sampledSet/writers/ensight/ensightSetWriter.H
 create mode 100644 src/sampling/sampledSet/writers/ensight/ensightSetWriterRunTime.C

diff --git a/applications/utilities/postProcessing/sampling/sample/sampleDict b/applications/utilities/postProcessing/sampling/sample/sampleDict
index 9a77a66417..8684d76932 100644
--- a/applications/utilities/postProcessing/sampling/sample/sampleDict
+++ b/applications/utilities/postProcessing/sampling/sample/sampleDict
@@ -20,6 +20,7 @@ FoamFile
 //      gnuplot
 //      raw
 //      vtk
+//      ensight
 //      csv
 setFormat raw;
 
diff --git a/src/finiteVolume/fvMesh/fvMesh.C b/src/finiteVolume/fvMesh/fvMesh.C
index 51ded1992f..e90919877d 100644
--- a/src/finiteVolume/fvMesh/fvMesh.C
+++ b/src/finiteVolume/fvMesh/fvMesh.C
@@ -59,6 +59,8 @@ License
 #include "upwindFECCellToFaceStencilObject.H"
 
 #include "centredCFCFaceToCellStencilObject.H"
+#include "meshSearchMeshObject.H"
+#include "meshSearchFACECENTRETETSMeshObject.H"
 
 // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
 
@@ -99,6 +101,11 @@ void Foam::fvMesh::clearGeom()
     CentredFitData<quadraticLinearFitPolynomial>::Delete(*this);
     skewCorrectionVectors::Delete(*this);
     //quadraticFitSnGradData::Delete(*this);
+
+    // Note: should be in polyMesh::clearGeom but meshSearch not in OpenFOAM
+    // library
+    meshSearchMeshObject::Delete(*this);
+    meshSearchFACECENTRETETSMeshObject::Delete(*this);
 }
 
 
@@ -128,6 +135,11 @@ void Foam::fvMesh::clearAddressing()
     upwindFECCellToFaceStencilObject::Delete(*this);
 
     centredCFCFaceToCellStencilObject::Delete(*this);
+
+    // Note: should be in polyMesh::clearGeom but meshSearch not in OpenFOAM
+    // library
+    meshSearchMeshObject::Delete(*this);
+    meshSearchFACECENTRETETSMeshObject::Delete(*this);
 }
 
 
diff --git a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C
index 9950b9b061..ec3d7c7471 100644
--- a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C
+++ b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.C
@@ -87,67 +87,22 @@ Foam::tmp<Foam::pointField> Foam::mappedPatchBase::facePoints
 ) const
 {
     const polyMesh& mesh = pp.boundaryMesh().mesh();
-    const labelList& tetBasePts = mesh.tetBasePtIs();
-    const pointField& p = pp.points();
-    const pointField& cellCentres = mesh.cellCentres();
-    const labelList& faceCells = pp.faceCells();
+
+    // Force construction of min-tet decomp
+    (void)mesh.tetBasePtIs();
 
     // Initialise to face-centre
-    tmp<pointField> tfacePoints(new pointField(patch_.faceCentres()));
+    tmp<pointField> tfacePoints(new pointField(patch_.size()));
     pointField& facePoints = tfacePoints();
 
     forAll(pp, faceI)
     {
-        const face& f = pp[faceI];
-
-        if (f.size() <= 3)
-        {
-            // Point already on tets of cell.
-        }
-        else
-        {
-            // Find intersection of (face-centre-decomposition) centre to
-            // cell-centre with face-diagonal-decomposition triangles.
-            const point& cc = cellCentres[faceCells[faceI]];
-            vector d = facePoints[faceI]-cc;
-
-            const label fp0 = tetBasePts[faceI];
-            const point& basePoint = p[f[fp0]];
-
-            //bool foundPoint = false;
-
-            label fp = f.fcIndex(fp0);
-            for (label i = 2; i < f.size(); i++)
-            {
-                const point& thisPoint = p[f[fp]];
-                label nextFp = f.fcIndex(fp);
-                const point& nextPoint = p[f[nextFp]];
-
-                const triPointRef tri(basePoint, thisPoint, nextPoint);
-                pointHit hitInfo = tri.intersection
-                (
-                    cc,
-                    d,
-                    intersection::HALF_RAY
-                );
-
-                if (hitInfo.hit() && hitInfo.distance() > 0)
-                {
-                    facePoints[faceI] = hitInfo.hitPoint();
-                    //foundPoint = true;
-                    break;
-                }
-
-                fp = nextFp;
-            }
-
-            //if (!foundPoint)
-            //{
-            //    Pout<< "cell:" << faceCells[faceI] << " at:" << cc
-            //        << " face-centre:" << patch_.faceCentres()[faceI]
-            //        << " did not find any intersection." << endl;
-            //}
-        }
+        facePoints[faceI] = facePoint
+        (
+            mesh,
+            pp.start()+faceI,
+            polyMesh::FACEDIAGTETS
+        ).rawPoint();
     }
 
     return tfacePoints;
@@ -572,11 +527,13 @@ void Foam::mappedPatchBase::calcMapping() const
                 )   << "Did not find " << nNotFound
                     << " out of " << sampleProcs.size() << " total samples."
                     << " Sampling these on owner cell centre instead." << endl
-                    << "patch_:" << patch_.name() << endl
-                    << "sampleRegion_:" << sampleRegion_ << endl
-                    << "mode_:" << sampleModeNames_[mode_] << endl
-                    << "samplePatch_:" << samplePatch_ << endl
-                    << "offsetMode_:" << offsetModeNames_[offsetMode_] << endl;
+                    << "On patch " << patch_.name()
+                    << " on region " << sampleRegion_
+                    << " in mode " << sampleModeNames_[mode_] << endl
+                    << "whilst sampling patch " << samplePatch_ << endl
+                    << " with offset mode " << offsetModeNames_[offsetMode_]
+                    << endl
+                    << "Suppressing further warnings from " << type() << endl;
 
                 hasWarned = true;
             }
@@ -1137,6 +1094,87 @@ Foam::tmp<Foam::pointField> Foam::mappedPatchBase::samplePoints() const
 }
 
 
+Foam::pointIndexHit Foam::mappedPatchBase::facePoint
+(
+    const polyMesh& mesh,
+    const label faceI,
+    const polyMesh::cellRepresentation decompMode
+)
+{
+    const point& fc = mesh.faceCentres()[faceI];
+
+    switch (decompMode)
+    {
+        case polyMesh::FACEPLANES:
+        case polyMesh::FACECENTRETETS:
+        {
+            // For both decompositions the face centre is guaranteed to be
+            // on the face
+            return pointIndexHit(true, fc, faceI);
+        }
+        break;
+
+        case polyMesh::FACEDIAGTETS:
+        {
+            // Find the intersection of a ray from face centre to cell
+            // centre
+            // Find intersection of (face-centre-decomposition) centre to
+            // cell-centre with face-diagonal-decomposition triangles.
+
+            const pointField& p = mesh.points();
+            const face& f = mesh.faces()[faceI];
+
+            if (f.size() <= 3)
+            {
+                // Return centre of triangle.
+                return pointIndexHit(true, fc, 0);
+            }
+
+            label cellI = mesh.faceOwner()[faceI];
+            const point& cc = mesh.cellCentres()[cellI];
+            vector d = fc-cc;
+
+            const label fp0 = mesh.tetBasePtIs()[faceI];
+            const point& basePoint = p[f[fp0]];
+
+            label fp = f.fcIndex(fp0);
+            for (label i = 2; i < f.size(); i++)
+            {
+                const point& thisPoint = p[f[fp]];
+                label nextFp = f.fcIndex(fp);
+                const point& nextPoint = p[f[nextFp]];
+
+                const triPointRef tri(basePoint, thisPoint, nextPoint);
+                pointHit hitInfo = tri.intersection
+                (
+                    cc,
+                    d,
+                    intersection::HALF_RAY
+                );
+
+                if (hitInfo.hit() && hitInfo.distance() > 0)
+                {
+                    return pointIndexHit(true, hitInfo.hitPoint(), i-2);
+                }
+
+                fp = nextFp;
+            }
+
+            // Fall-back
+            return pointIndexHit(false, fc, -1);
+        }
+        break;
+
+        default:
+        {
+            FatalErrorIn("mappedPatchBase::facePoint()")
+                << "problem" << abort(FatalError);
+            return pointIndexHit();
+        }
+    }
+}
+
+
 void Foam::mappedPatchBase::write(Ostream& os) const
 {
     os.writeKeyword("sampleMode") << sampleModeNames_[mode_]
diff --git a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H
index 142bd86fb4..d5f6743edb 100644
--- a/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H
+++ b/src/meshTools/mappedPatches/mappedPolyPatch/mappedPatchBase.H
@@ -339,9 +339,24 @@ public:
             //- Get the patch on the region
             const polyPatch& samplePolyPatch() const;
 
+        // Helpers
+
             //- Get the sample points
             tmp<pointField> samplePoints() const;
 
+            //- Get a point on the face given a face decomposition method:
+            //  face-centre-tet : face centre. Returns index of face.
+            //  face-planes     : face centre. Returns index of face.
+            //  face-diagonal   : intersection of ray from cellcentre to
+            //                    facecentre with any of the triangles.
+            //                    Returns index (0..size-2) of triangle.
+            static pointIndexHit facePoint
+            (
+                const polyMesh&,
+                const label faceI,
+                const polyMesh::cellRepresentation
+            );
+
 
         // Distribute
 
diff --git a/src/sampling/Make/files b/src/sampling/Make/files
index f7c4775e88..0c89693a8e 100644
--- a/src/sampling/Make/files
+++ b/src/sampling/Make/files
@@ -11,6 +11,7 @@ sampledSet/polyLine/polyLineSet.C
 sampledSet/face/faceOnlySet.C
 sampledSet/midPoint/midPointSet.C
 sampledSet/midPointAndFace/midPointAndFaceSet.C
+/* sampledSet/patchSeed/patchSeedSet.C */
 sampledSet/sampledSet/sampledSet.C
 sampledSet/sampledSets/sampledSets.C
 sampledSet/sampledSets/sampledSetsGrouping.C
@@ -21,6 +22,7 @@ sampledSet/uniform/uniformSet.C
 setWriters = sampledSet/writers
 
 $(setWriters)/writers.C
+$(setWriters)/ensight/ensightSetWriterRunTime.C
 $(setWriters)/gnuplot/gnuplotSetWriterRunTime.C
 $(setWriters)/jplot/jplotSetWriterRunTime.C
 $(setWriters)/raw/rawSetWriterRunTime.C
diff --git a/src/sampling/sampledSet/writers/ensight/ensightSetWriter.C b/src/sampling/sampledSet/writers/ensight/ensightSetWriter.C
new file mode 100644
index 0000000000..23d8e7843d
--- /dev/null
+++ b/src/sampling/sampledSet/writers/ensight/ensightSetWriter.C
@@ -0,0 +1,315 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "ensightSetWriter.H"
+#include "coordSet.H"
+#include "OFstream.H"
+#include "addToRunTimeSelectionTable.H"
+#include "IOmanip.H"
+#include "foamVersion.H"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+template<class Type>
+Foam::ensightSetWriter<Type>::ensightSetWriter()
+:
+    writer<Type>()
+{}
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+template<class Type>
+Foam::ensightSetWriter<Type>::~ensightSetWriter()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+template<class Type>
+Foam::fileName Foam::ensightSetWriter<Type>::getFileName
+(
+    const coordSet& points,
+    const wordList& valueSetNames
+) const
+{
+    return
+        this->getBaseName(points, valueSetNames)
+      //+ '_'
+      //+ pTraits<Type>::typeName
+      + ".case";
+}
+
+
+template<class Type>
+void Foam::ensightSetWriter<Type>::write
+(
+    const coordSet& points,
+    const wordList& valueSetNames,
+    const List<const Field<Type>*>& valueSets,
+    Ostream& os
+) const
+{
+    const fileName base(os.name().lessExt());
+    const fileName meshFile(base + ".mesh");
+
+    // Write .case file
+    os  << "FORMAT" << nl
+        << "type: ensight gold" << nl
+        << nl
+        << "GEOMETRY" << nl
+        << "model:        1     " << meshFile.name().c_str() << nl
+        << nl
+        << "VARIABLE"
+        << nl;
+    forAll(valueSetNames, setI)
+    {
+        fileName dataFile(base + ".***." + valueSetNames[setI]);
+
+        os.setf(ios_base::left);
+        os  << pTraits<Type>::typeName
+            << " per node:            1       "
+            << setw(15) << valueSetNames[setI]
+            << " " << dataFile.name().c_str()
+            << nl;
+    }
+    os  << nl
+        << "TIME" << nl
+        << "time set:                      1" << nl
+        << "number of steps:               1" << nl
+        << "filename start number:         0" << nl
+        << "filename increment:            1" << nl
+        << "time values:" << nl
+        << "0.00000e+00" << nl;
+
+    // Write .mesh file
+    {
+        string desc = string("written by OpenFOAM-") + Foam::FOAMversion;
+        OFstream os(meshFile);
+        os.setf(ios_base::scientific, ios_base::floatfield);
+        os.precision(5);
+
+        os  << "EnSight Geometry File" << nl
+            << desc.c_str() << nl
+            << "node id assign" << nl
+            << "element id assign" << nl
+            << "part" << nl
+            << setw(10) << 1 << nl
+            << "internalMesh" << nl
+            << "coordinates" << nl
+            << setw(10) << points.size() << nl;
+
+        for (direction cmpt = 0; cmpt < vector::nComponents; cmpt++)
+        {
+            forAll(points, pointI)
+            {
+                const scalar comp = points[pointI][cmpt];
+                if (mag(comp) >= scalar(floatScalarVSMALL))
+                {
+                    os  << setw(12) << comp << nl;
+                }
+                else
+                {
+                    os  << setw(12) << scalar(0) << nl;
+                }
+            }
+        }
+        os  << "point" << nl
+            << setw(10) << points.size() << nl;
+        forAll(points, pointI)
+        {
+            os  << setw(10) << pointI+1 << nl;
+        }
+    }
+
+    // Write data files
+    forAll(valueSetNames, setI)
+    {
+        fileName dataFile(base + ".000." + valueSetNames[setI]);
+        OFstream os(dataFile);
+        os.setf(ios_base::scientific, ios_base::floatfield);
+        os.precision(5);
+        {
+            os  << pTraits<Type>::typeName << nl
+                << "part" << nl
+                << setw(10) << 1 << nl
+                << "coordinates" << nl;
+            for (direction cmpt = 0; cmpt < pTraits<Type>::nComponents; cmpt++)
+            {
+                const scalarField fld = valueSets[setI]->component(cmpt);
+                forAll(fld, i)
+                {
+                    if (mag(fld[i]) >= scalar(floatScalarVSMALL))
+                    {
+                        os  << setw(12) << fld[i] << nl;
+                    }
+                    else
+                    {
+                        os  << setw(12) << scalar(0) << nl;
+                    }
+                }
+            }
+        }
+    }
+}
+
+
+template<class Type>
+void Foam::ensightSetWriter<Type>::write
+(
+    const bool writeTracks,
+    const PtrList<coordSet>& tracks,
+    const wordList& valueSetNames,
+    const List<List<Field<Type> > >& valueSets,
+    Ostream& os
+) const
+{
+    const fileName base(os.name().lessExt());
+    const fileName meshFile(base + ".mesh");
+
+    // Write .case file
+    os  << "FORMAT" << nl
+        << "type: ensight gold" << nl
+        << nl
+        << "GEOMETRY" << nl
+        << "model:        1     " << meshFile.name().c_str() << nl
+        << nl
+        << "VARIABLE"
+        << nl;
+    forAll(valueSetNames, setI)
+    {
+        fileName dataFile(base + ".***." + valueSetNames[setI]);
+
+        os.setf(ios_base::left);
+        os  << pTraits<Type>::typeName
+            << " per node:            1       "
+            << setw(15) << valueSetNames[setI]
+            << " " << dataFile.name().c_str()
+            << nl;
+    }
+    os  << nl
+        << "TIME" << nl
+        << "time set:                      1" << nl
+        << "number of steps:               1" << nl
+        << "filename start number:         0" << nl
+        << "filename increment:            1" << nl
+        << "time values:" << nl
+        << "0.00000e+00" << nl;
+
+    // Write .mesh file
+    {
+        string desc = string("written by OpenFOAM-") + Foam::FOAMversion;
+        OFstream os(meshFile);
+        os.setf(ios_base::scientific, ios_base::floatfield);
+        os.precision(5);
+        os  << "EnSight Geometry File" << nl
+            << desc.c_str() << nl
+            << "node id assign" << nl
+            << "element id assign" << nl;
+
+        forAll(tracks, trackI)
+        {
+            const coordSet& points = tracks[trackI];
+
+            os  << "part" << nl
+                << setw(10) << trackI+1 << nl
+                << "internalMesh" << nl
+                << "coordinates" << nl
+                << setw(10) << points.size() << nl;
+
+            for (direction cmpt = 0; cmpt < vector::nComponents; cmpt++)
+            {
+                forAll(points, pointI)
+                {
+                    const scalar comp = points[pointI][cmpt];
+                    if (mag(comp) >= scalar(floatScalarVSMALL))
+                    {
+                        os  << setw(12) << comp << nl;
+                    }
+                    else
+                    {
+                        os  << setw(12) << scalar(0) << nl;
+                    }
+                }
+            }
+
+            if (writeTracks)
+            {
+                os  << "bar2" << nl
+                    << setw(10) << points.size()-1 << nl;
+                for (label i = 0; i < points.size()-1; i++)
+                {
+                    os  << setw(10) << i+1
+                        << setw(10) << i+2
+                        << nl;
+                }
+            }
+        }
+    }
+
+
+    // Write data files
+    forAll(valueSetNames, setI)
+    {
+        fileName dataFile(base + ".000." + valueSetNames[setI]);
+        OFstream os(dataFile);
+        os.setf(ios_base::scientific, ios_base::floatfield);
+        os.precision(5);
+        {
+            os  << pTraits<Type>::typeName << nl;
+
+            const List<Field<Type> >& fieldVals = valueSets[setI];
+            forAll(fieldVals, trackI)
+            {
+                os  << "part" << nl
+                    << setw(10) << trackI+1 << nl
+                    << "coordinates" << nl;
+
+                for
+                (
+                    direction cmpt = 0;
+                    cmpt < pTraits<Type>::nComponents;
+                    cmpt++
+                )
+                {
+                    const scalarField fld = fieldVals[trackI].component(cmpt);
+                    forAll(fld, i)
+                    {
+                        if (mag(fld[i]) >= scalar(floatScalarVSMALL))
+                        {
+                            os  << setw(12) << fld[i] << nl;
+                        }
+                        else
+                        {
+                            os  << setw(12) << scalar(0) << nl;
+                        }
+                    }
+                }
+            }
+        }
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/src/sampling/sampledSet/writers/ensight/ensightSetWriter.H b/src/sampling/sampledSet/writers/ensight/ensightSetWriter.H
new file mode 100644
index 0000000000..5118c85faa
--- /dev/null
+++ b/src/sampling/sampledSet/writers/ensight/ensightSetWriter.H
@@ -0,0 +1,111 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::ensightSetWriter
+
+Description
+
+SourceFiles
+    ensightSetWriter.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef ensightSetWriter_H
+#define ensightSetWriter_H
+
+#include "writer.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                     Class ensightSetWriter Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class Type>
+class ensightSetWriter
+:
+    public writer<Type>
+{
+
+public:
+
+    //- Runtime type information
+    TypeName("ensight");
+
+
+    // Constructors
+
+        //- Construct null
+        ensightSetWriter();
+
+
+    //- Destructor
+    virtual ~ensightSetWriter();
+
+
+    // Member Functions
+
+        virtual fileName getFileName
+        (
+            const coordSet&,
+            const wordList&
+        ) const;
+
+        virtual void write
+        (
+            const coordSet&,
+            const wordList&,
+            const List<const Field<Type>*>&,
+            Ostream&
+        ) const;
+
+        virtual void write
+        (
+            const bool writeTracks,
+            const PtrList<coordSet>&,
+            const wordList& valueSetNames,
+            const List<List<Field<Type> > >&,
+            Ostream&
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#ifdef NoRepository
+#   include "ensightSetWriter.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/sampling/sampledSet/writers/ensight/ensightSetWriterRunTime.C b/src/sampling/sampledSet/writers/ensight/ensightSetWriterRunTime.C
new file mode 100644
index 0000000000..b987035b33
--- /dev/null
+++ b/src/sampling/sampledSet/writers/ensight/ensightSetWriterRunTime.C
@@ -0,0 +1,37 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "ensightSetWriter.H"
+#include "writers.H"
+#include "addToRunTimeSelectionTable.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    makeSetWriters(ensightSetWriter);
+}
+
+// ************************************************************************* //
diff --git a/tutorials/incompressible/pisoFoam/les/motorBike/motorBike/system/streamLines b/tutorials/incompressible/pisoFoam/les/motorBike/motorBike/system/streamLines
index a8a0c377cc..aa0b6a1d7b 100644
--- a/tutorials/incompressible/pisoFoam/les/motorBike/motorBike/system/streamLines
+++ b/tutorials/incompressible/pisoFoam/les/motorBike/motorBike/system/streamLines
@@ -14,7 +14,7 @@ streamLines
     outputControl   outputTime;
     // outputInterval 10;
 
-    setFormat       vtk; //gnuplot; //xmgr; //raw; //jplot;
+    setFormat       vtk; //gnuplot; //xmgr; //raw; //jplot; //csv; //ensight;
 
     // Velocity field to use for tracking.
     U U;
diff --git a/tutorials/incompressible/simpleFoam/motorBike/system/streamLines b/tutorials/incompressible/simpleFoam/motorBike/system/streamLines
index 82c3f1d68c..8b82eccbb1 100644
--- a/tutorials/incompressible/simpleFoam/motorBike/system/streamLines
+++ b/tutorials/incompressible/simpleFoam/motorBike/system/streamLines
@@ -14,7 +14,7 @@ streamLines
     outputControl   outputTime;
     // outputInterval 10;
 
-    setFormat       vtk; //gnuplot; //xmgr; //raw; //jplot;
+    setFormat       vtk; //gnuplot; //xmgr; //raw; //jplot; //csv; //ensight;
 
     // Velocity field to use for tracking.
     UName U;
diff --git a/tutorials/incompressible/simpleFoam/pitzDaily/system/controlDict b/tutorials/incompressible/simpleFoam/pitzDaily/system/controlDict
index aaedd23dab..688796fe63 100644
--- a/tutorials/incompressible/simpleFoam/pitzDaily/system/controlDict
+++ b/tutorials/incompressible/simpleFoam/pitzDaily/system/controlDict
@@ -58,7 +58,7 @@ functions
         outputControl   outputTime;
         // outputInterval 10;
 
-        setFormat       vtk; //gnuplot; //xmgr; //raw; //jplot;
+        setFormat       vtk; //gnuplot;//xmgr;//raw;//jplot;//csv;//ensight;
 
         // Velocity field to use for tracking.
         UName U;
diff --git a/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/system/controlDict b/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/system/controlDict
index c2b5d2e493..18e4c651fb 100644
--- a/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/system/controlDict
+++ b/tutorials/incompressible/simpleFoam/pitzDailyExptInlet/system/controlDict
@@ -58,7 +58,7 @@ functions
         outputControl   outputTime;
         // outputInterval 10;
 
-        setFormat       vtk; //gnuplot; //xmgr; //raw; //jplot;
+        setFormat       vtk; //gnuplot;//xmgr;//raw;//jplot;//csv;//ensight;
 
         // Velocity field to use for tracking.
         UName U;

From df5feff48294b034fff4a9a65bae14eb79c028a9 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Thu, 15 Dec 2011 14:12:09 +0000
Subject: [PATCH 21/70] BUG: searchableSurfaceCollection: calculation of
 bounds, transformation of normal

---
 .../searchableSurfaceCollection.C             | 32 +++++++++++++++++++
 1 file changed, 32 insertions(+)

diff --git a/src/meshTools/searchableSurface/searchableSurfaceCollection.C b/src/meshTools/searchableSurface/searchableSurfaceCollection.C
index 794cee2090..91115688b2 100644
--- a/src/meshTools/searchableSurface/searchableSurfaceCollection.C
+++ b/src/meshTools/searchableSurface/searchableSurfaceCollection.C
@@ -247,6 +247,35 @@ Foam::searchableSurfaceCollection::searchableSurfaceCollection
     transform_.setSize(surfI);
     subGeom_.setSize(surfI);
     indexOffset_.setSize(surfI+1);
+
+    // Bounds is the overall bounds
+    bounds() = boundBox(point::max, point::min);
+
+    forAll(subGeom_, surfI)
+    {
+        const boundBox& surfBb = subGeom_[surfI].bounds();
+
+        // Transform back to global coordinate sys.
+        const point surfBbMin = transform_[surfI].globalPosition
+        (
+            cmptMultiply
+            (
+                surfBb.min(),
+                scale_[surfI]
+            )
+        );
+        const point surfBbMax = transform_[surfI].globalPosition
+        (
+            cmptMultiply
+            (
+                surfBb.max(),
+                scale_[surfI]
+            )
+        );
+
+        bounds().min() = min(bounds().min(), surfBbMin);
+        bounds().max() = max(bounds().max(), surfBbMax);
+    }
 }
 
 
@@ -579,6 +608,9 @@ void Foam::searchableSurfaceCollection::getNormal
             vectorField surfNormal;
             subGeom_[surfI].getNormal(surfInfo[surfI], surfNormal);
 
+            // Transform back to global coordinate sys.
+            surfNormal = transform_[surfI].globalVector(surfNormal);
+
             const labelList& map = infoMap[surfI];
             forAll(map, i)
             {

From aa96de0caa8ff0a18044cd976e2ea7df5c856fe8 Mon Sep 17 00:00:00 2001
From: laurence <laurence>
Date: Thu, 15 Dec 2011 14:30:02 +0000
Subject: [PATCH 22/70] BUG: searchableSurfaceWithGaps did not initialise the
 boundbox

---
 src/meshTools/searchableSurface/searchableSurfaceWithGaps.C | 2 ++
 1 file changed, 2 insertions(+)

diff --git a/src/meshTools/searchableSurface/searchableSurfaceWithGaps.C b/src/meshTools/searchableSurface/searchableSurfaceWithGaps.C
index 6e40feb9ef..dd74c17135 100644
--- a/src/meshTools/searchableSurface/searchableSurfaceWithGaps.C
+++ b/src/meshTools/searchableSurface/searchableSurfaceWithGaps.C
@@ -187,6 +187,8 @@ Foam::searchableSurfaceWithGaps::searchableSurfaceWithGaps
         io.db().lookupObject<searchableSurface>(subGeomName);
 
     subGeom_.set(0, &const_cast<searchableSurface&>(s));
+
+    bounds() = subGeom_[0].bounds();
 }
 
 

From 96a4cf4097bb2e516e2b115e1e22ea6868488bb8 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Thu, 15 Dec 2011 16:54:36 +0000
Subject: [PATCH 23/70] ENH: Updated writing of cloud properties to file for
 consistent restarts

---
 .../Templates/KinematicCloud/KinematicCloud.C |  38 ++++-
 .../Templates/KinematicCloud/KinematicCloud.H |  14 +-
 .../KinematicCloud/KinematicCloudI.H          |  15 ++
 .../Templates/ReactingCloud/ReactingCloud.C   |  11 +-
 .../Templates/ReactingCloud/ReactingCloud.H   |  20 ++-
 .../Templates/ReactingCloud/ReactingCloudI.H  |   8 +
 .../ReactingMultiphaseCloud.C                 |  29 +---
 .../ReactingMultiphaseCloud.H                 |  31 ++--
 .../ReactingMultiphaseCloudI.H                |  22 +++
 .../Templates/ThermoCloud/ThermoCloud.C       |   2 +-
 .../Templates/ThermoCloud/ThermoCloud.H       |   2 +-
 .../ReactingMultiphaseParcel.C                |   9 +-
 .../Templates/ReactingParcel/ReactingParcel.C |   4 +-
 .../CloudFunctionObject/CloudFunctionObject.C |   2 +-
 .../CloudFunctionObject/CloudFunctionObject.H |   2 +-
 .../CollisionModel/CollisionModel.C           |   2 +-
 .../DispersionModel/DispersionModel.C         |   2 +-
 .../InjectionModel/InjectionModel.C           | 117 ++++----------
 .../InjectionModel/InjectionModel.H           |  13 +-
 .../LocalInteraction/LocalInteraction.C       | 101 +++---------
 .../LocalInteraction/LocalInteraction.H       |  17 +--
 .../PatchInteractionModel.C                   |   4 +-
 .../PatchInteractionModel.H                   |   2 +-
 .../StandardWallInteraction.C                 | 101 +++---------
 .../StandardWallInteraction.H                 |  17 +--
 .../SurfaceFilmModel/SurfaceFilmModel.C       |   2 +-
 .../CompositionModel/CompositionModel.C       |   2 +-
 .../PhaseChangeModel/PhaseChangeModel.C       |  38 ++++-
 .../PhaseChangeModel/PhaseChangeModel.H       |  16 ++
 .../DevolatilisationModel.C                   |  39 ++++-
 .../DevolatilisationModel.H                   |  17 +++
 .../SurfaceReactionModel.C                    |  39 ++++-
 .../SurfaceReactionModel.H                    |  17 +++
 .../intermediate/submodels/SubModelBase.C     | 144 ++++++++++++++++++
 .../intermediate/submodels/SubModelBase.H     |  42 ++++-
 .../HeatTransferModel/HeatTransferModel.C     |   2 +-
 .../clouds/Templates/SprayCloud/SprayCloud.C  |   2 +-
 .../clouds/Templates/SprayCloud/SprayCloud.H  |  19 ++-
 .../clouds/Templates/SprayCloud/SprayCloudI.H |  16 ++
 .../AtomizationModel/AtomizationModel.C       |   2 +-
 .../BreakupModel/BreakupModel/BreakupModel.C  |   2 +-
 .../StochasticCollisionModel.C                |   2 +-
 42 files changed, 588 insertions(+), 398 deletions(-)

diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C
index 6288a9b5e6..5c97c41d5c 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.C
@@ -230,6 +230,16 @@ void Foam::KinematicCloud<CloudType>::postEvolve()
     functions_.postEvolve();
 
     solution_.nextIter();
+
+    if (this->db().time().outputTime())
+    {
+        outputProperties_.writeObject
+        (
+            IOstream::ASCII,
+            IOstream::currentVersion,
+            this->db().time().writeCompression()
+        );
+    }
 }
 
 
@@ -281,6 +291,18 @@ Foam::KinematicCloud<CloudType>::KinematicCloud
             IOobject::NO_WRITE
         )
     ),
+    outputProperties_
+    (
+        IOobject
+        (
+            cloudName + "OutputProperties",
+            mesh_.time().timeName(),
+            "uniform"/cloud::prefix/cloudName,
+            mesh_,
+            IOobject::READ_IF_PRESENT,
+            IOobject::NO_WRITE
+        )
+    ),
     solution_(mesh_, particleProperties_.subDict("solution")),
     constProps_(particleProperties_, solution_.active()),
     subModelProperties_
@@ -384,6 +406,7 @@ Foam::KinematicCloud<CloudType>::KinematicCloud
     cloudCopyPtr_(NULL),
     mesh_(c.mesh_),
     particleProperties_(c.particleProperties_),
+    outputProperties_(c.outputProperties_),
     solution_(c.solution_),
     constProps_(c.constProps_),
     subModelProperties_(c.subModelProperties_),
@@ -460,6 +483,19 @@ Foam::KinematicCloud<CloudType>::KinematicCloud
             false
         )
     ),
+    outputProperties_
+    (
+        IOobject
+        (
+            name + "OutputProperties",
+            mesh_.time().timeName(),
+            "uniform"/cloud::prefix/name,
+            mesh_,
+            IOobject::NO_READ,
+            IOobject::NO_WRITE,
+            false
+        )
+    ),
     solution_(mesh),
     constProps_(),
     subModelProperties_(dictionary::null),
@@ -639,7 +675,7 @@ void  Foam::KinematicCloud<CloudType>::motion(TrackData& td)
 
 
 template<class CloudType>
-void Foam::KinematicCloud<CloudType>::info() const
+void Foam::KinematicCloud<CloudType>::info()
 {
     vector linearMomentum = linearMomentumOfSystem();
     reduce(linearMomentum, sumOp<vector>());
diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
index 77c0aacdac..fd32ff790c 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloud.H
@@ -143,6 +143,9 @@ protected:
         //- Dictionary of particle properties
         IOdictionary particleProperties_;
 
+        //- Dictionary of output properties
+        IOdictionary outputProperties_;
+
         //- Solution properties
         cloudSolution solution_;
 
@@ -324,6 +327,12 @@ public:
                 //- Return particle properties dictionary
                 inline const IOdictionary& particleProperties() const;
 
+                //- Return output properties dictionary
+                inline const IOdictionary& outputProperties() const;
+
+                //- Return non-const access to the output properties dictionary
+                inline IOdictionary& outputProperties();
+
                 //- Return const access to the solution properties
                 inline const cloudSolution& solution() const;
 
@@ -546,8 +555,11 @@ public:
             template<class TrackData>
             void motion(TrackData& td);
 
+
+        // I-O
+
             //- Print cloud information
-            void info() const;
+            void info();
 };
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H
index a340095807..94b95168a5 100644
--- a/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H
+++ b/src/lagrangian/intermediate/clouds/Templates/KinematicCloud/KinematicCloudI.H
@@ -50,6 +50,21 @@ Foam::KinematicCloud<CloudType>::particleProperties() const
 }
 
 
+template<class CloudType>
+inline const Foam::IOdictionary&
+Foam::KinematicCloud<CloudType>::outputProperties() const
+{
+    return outputProperties_;
+}
+
+
+template<class CloudType>
+inline Foam::IOdictionary& Foam::KinematicCloud<CloudType>::outputProperties()
+{
+    return outputProperties_;
+}
+
+
 template<class CloudType>
 inline const Foam::cloudSolution&
 Foam::KinematicCloud<CloudType>::solution() const
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C
index 0882dfe03f..3de4ae546d 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.C
@@ -341,20 +341,13 @@ void Foam::ReactingCloud<CloudType>::evolve()
 }
 
 
-template<class CloudType>
-void Foam::ReactingCloud<CloudType>::addToMassPhaseChange(const scalar dMass)
-{
-    dMassPhaseChange_ += dMass;
-}
-
 
 template<class CloudType>
-void Foam::ReactingCloud<CloudType>::info() const
+void Foam::ReactingCloud<CloudType>::info()
 {
     CloudType::info();
 
-    Info<< "    Mass transfer phase change      = "
-        << returnReduce(dMassPhaseChange_, sumOp<scalar>()) << nl;
+    this->phaseChange().info(Info);
 }
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H
index 2de85665cc..7f58d83bd6 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloud.H
@@ -215,14 +215,18 @@ public:
 
             // Sub-models
 
-                //- Return reference to reacting composition model
+                //- Return const access to reacting composition model
                 inline const CompositionModel<ReactingCloud<CloudType> >&
                     composition() const;
 
-                //- Return reference to reacting phase change model
+                //- Return const access to reacting phase change model
                 inline const PhaseChangeModel<ReactingCloud<CloudType> >&
                     phaseChange() const;
 
+                //- Return reference to reacting phase change model
+                inline PhaseChangeModel<ReactingCloud<CloudType> >&
+                    phaseChange();
+
 
             // Sources
 
@@ -259,12 +263,6 @@ public:
                     inline tmp<fvScalarMatrix> Srho(volScalarField& rho) const;
 
 
-        // Check
-
-            //- Add to cumulative phase change mass transfer
-            void addToMassPhaseChange(const scalar dMass);
-
-
         // Cloud evolution functions
 
             //- Set parcel thermo properties
@@ -300,12 +298,12 @@ public:
             //- Evolve the cloud
             void evolve();
 
-            //- Print cloud information
-            void info() const;
-
 
         // I-O
 
+            //- Print cloud information
+            void info();
+
             //- Write the field data for the cloud
             virtual void writeFields() const;
 };
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloudI.H b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloudI.H
index 68925178d3..2a9bbb2423 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloudI.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingCloud/ReactingCloudI.H
@@ -57,6 +57,14 @@ Foam::ReactingCloud<CloudType>::phaseChange() const
 }
 
 
+template<class CloudType>
+inline Foam::PhaseChangeModel<Foam::ReactingCloud<CloudType> >&
+Foam::ReactingCloud<CloudType>::phaseChange()
+{
+    return phaseChangeModel_();
+}
+
+
 template<class CloudType>
 inline Foam::DimensionedField<Foam::scalar, Foam::volMesh>&
 Foam::ReactingCloud<CloudType>::rhoTrans(const label i)
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C
index 199fafe84b..9088b97717 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.C
@@ -253,33 +253,12 @@ void Foam::ReactingMultiphaseCloud<CloudType>::evolve()
 
 
 template<class CloudType>
-void Foam::ReactingMultiphaseCloud<CloudType>::addToMassDevolatilisation
-(
-    const scalar dMass
-)
-{
-    dMassDevolatilisation_ += dMass;
-}
-
-
-template<class CloudType>
-void Foam::ReactingMultiphaseCloud<CloudType>::addToMassSurfaceReaction
-(
-    const scalar dMass
-)
-{
-    dMassSurfaceReaction_ += dMass;
-}
-
-
-template<class CloudType>
-void Foam::ReactingMultiphaseCloud<CloudType>::info() const
+void Foam::ReactingMultiphaseCloud<CloudType>::info()
 {
     CloudType::info();
-    Info<< "    Mass transfer devolatilisation  = "
-        << returnReduce(dMassDevolatilisation_, sumOp<scalar>()) << nl;
-    Info<< "    Mass transfer surface reaction  = "
-        << returnReduce(dMassSurfaceReaction_, sumOp<scalar>()) << nl;
+
+    this->devolatilisation().info(Info);
+    this->surfaceReaction().info(Info);
 }
 
 
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.H b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.H
index 4f692212d7..5f92be1ea8 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloud.H
@@ -214,28 +214,33 @@ public:
 
             // Sub-models
 
-                //- Return reference to devolatilisation model
+                //- Return const access to devolatilisation model
                 inline const DevolatilisationModel
                 <
                     ReactingMultiphaseCloud<CloudType>
                 >&
                 devolatilisation() const;
 
-                //- Return reference to reacting surface reaction model
+                //- Return reference to devolatilisation model
+                inline DevolatilisationModel
+                <
+                    ReactingMultiphaseCloud<CloudType>
+                >&
+                devolatilisation();
+
+                //- Return const access to reacting surface reaction model
                 inline const SurfaceReactionModel
                 <
                     ReactingMultiphaseCloud<CloudType>
                 >&
                 surfaceReaction() const;
 
-
-        // Check
-
-            //- Add to cumulative volatilisation mass transfer
-            void addToMassDevolatilisation(const scalar dMass);
-
-            //- Add to cumulative surface reaction transfer
-            void addToMassSurfaceReaction(const scalar dMass);
+                //- Return reference to reacting surface reaction model
+                inline SurfaceReactionModel
+                <
+                    ReactingMultiphaseCloud<CloudType>
+                >&
+                surfaceReaction();
 
 
         // Cloud evolution functions
@@ -267,12 +272,12 @@ public:
             //- Evolve the cloud
             void evolve();
 
-            //- Print cloud information
-            void info() const;
-
 
         // I-O
 
+            //- Print cloud information
+            void info();
+
             //- Write the field data for the cloud
             virtual void writeFields() const;
 };
diff --git a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloudI.H b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloudI.H
index 019339b25f..e4cef9783b 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloudI.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ReactingMultiphaseCloud/ReactingMultiphaseCloudI.H
@@ -52,6 +52,17 @@ Foam::ReactingMultiphaseCloud<CloudType>::devolatilisation() const
 }
 
 
+template<class CloudType>
+inline Foam::DevolatilisationModel
+<
+    Foam::ReactingMultiphaseCloud<CloudType>
+>&
+Foam::ReactingMultiphaseCloud<CloudType>::devolatilisation()
+{
+    return devolatilisationModel_();
+}
+
+
 template<class CloudType>
 inline const Foam::SurfaceReactionModel
 <
@@ -63,4 +74,15 @@ Foam::ReactingMultiphaseCloud<CloudType>::surfaceReaction() const
 }
 
 
+template<class CloudType>
+inline Foam::SurfaceReactionModel
+<
+    Foam::ReactingMultiphaseCloud<CloudType>
+>&
+Foam::ReactingMultiphaseCloud<CloudType>::surfaceReaction()
+{
+    return surfaceReactionModel_();
+}
+
+
 // ************************************************************************* //
diff --git a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C
index 9d92ddffcd..9530707bb4 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C
+++ b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.C
@@ -334,7 +334,7 @@ void Foam::ThermoCloud<CloudType>::evolve()
 
 
 template<class CloudType>
-void Foam::ThermoCloud<CloudType>::info() const
+void Foam::ThermoCloud<CloudType>::info()
 {
     CloudType::info();
 }
diff --git a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H
index cc71939f5c..c3c552472f 100644
--- a/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H
+++ b/src/lagrangian/intermediate/clouds/Templates/ThermoCloud/ThermoCloud.H
@@ -321,7 +321,7 @@ public:
         // Check
 
             //- Print cloud information
-            void info() const;
+            void info();
 };
 
 
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
index 740aa3f0b8..14450d6c27 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingMultiphaseParcel/ReactingMultiphaseParcel.C
@@ -369,7 +369,7 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calc
 
             td.cloud().hsTrans()[cellI] += dm*HsEff(td, pc, T0, idG, idL, idS);
 
-            td.cloud().addToMassPhaseChange(dm);
+            td.cloud().phaseChange().addToPhaseChangeMass(dm);
         }
 
         return;
@@ -520,7 +520,10 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calcDevolatilisation
 
     scalar dMassTot = sum(dMassDV);
 
-    td.cloud().addToMassDevolatilisation(this->nParticle_*dMassTot);
+    td.cloud().devolatilisation().addToDevolatilisationMass
+    (
+        this->nParticle_*dMassTot
+    );
 
     Sh -= dMassTot*td.cloud().constProps().LDevol()/dt;
 
@@ -608,7 +611,7 @@ void Foam::ReactingMultiphaseParcel<ParcelType>::calcSurfaceReactions
         dMassSRCarrier
     );
 
-    td.cloud().addToMassSurfaceReaction
+    td.cloud().surfaceReaction().addToSurfaceReactionMass
     (
         this->nParticle_
        *(sum(dMassSRGas) + sum(dMassSRLiquid) + sum(dMassSRSolid))
diff --git a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
index 68567ba0bc..88acc1a9af 100644
--- a/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
+++ b/src/lagrangian/intermediate/parcels/Templates/ReactingParcel/ReactingParcel.C
@@ -385,7 +385,7 @@ void Foam::ReactingParcel<ParcelType>::calc
             }
             td.cloud().UTrans()[cellI] += dm*U0;
 
-            td.cloud().addToMassPhaseChange(dm);
+            td.cloud().phaseChange().addToPhaseChangeMass(dm);
         }
 
         return;
@@ -519,7 +519,7 @@ void Foam::ReactingParcel<ParcelType>::calcPhaseChange
     const scalar dMassTot = sum(dMassPC);
 
     // Add to cumulative phase change mass
-    td.cloud().addToMassPhaseChange(this->nParticle_*dMassTot);
+    td.cloud().phaseChange().addToPhaseChangeMass(this->nParticle_*dMassTot);
 
     forAll(dMassPC, i)
     {
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C
index d31ddd7c5e..b8409231ff 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.C
@@ -51,7 +51,7 @@ Foam::CloudFunctionObject<CloudType>::CloudFunctionObject
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type, "")
+    SubModelBase<CloudType>(owner, dict, typeName, type, "")
 {}
 
 
diff --git a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H
index df17418c4b..b0818aa708 100644
--- a/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H
+++ b/src/lagrangian/intermediate/submodels/CloudFunctionObjects/CloudFunctionObject/CloudFunctionObject.H
@@ -64,7 +64,7 @@ class CloudFunctionObject
 public:
 
     //- Runtime type information
-    TypeName("postProcessingModel");
+    TypeName("cloudFunctionObject");
 
     //- Declare runtime constructor selection table
     declareRunTimeSelectionTable
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.C
index d0fbadc02c..259691002f 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/CollisionModel/CollisionModel/CollisionModel.C
@@ -42,7 +42,7 @@ Foam::CollisionModel<CloudType>::CollisionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type)
+    SubModelBase<CloudType>(owner, dict, typeName, type)
 {}
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/DispersionModel/DispersionModel/DispersionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/DispersionModel/DispersionModel/DispersionModel.C
index 35d73305d3..98b1d16075 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/DispersionModel/DispersionModel/DispersionModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/DispersionModel/DispersionModel/DispersionModel.C
@@ -42,7 +42,7 @@ Foam::DispersionModel<CloudType>::DispersionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type)
+    SubModelBase<CloudType>(owner, dict, typeName, type)
 {}
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C
index 28d211397e..abdce88750 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.C
@@ -31,76 +31,6 @@ using namespace Foam::constant::mathematical;
 
 // * * * * * * * * * * * Protected Member Functions  * * * * * * * * * * * * //
 
-template<class CloudType>
-void Foam::InjectionModel<CloudType>::readProps()
-{
-    if (!this->owner().solution().transient())
-    {
-        return;
-    }
-
-    IOobject propsDictHeader
-    (
-        "injectionProperties",
-        this->owner().db().time().timeName(),
-        "uniform"/cloud::prefix/this->owner().name(),
-        this->owner().db(),
-        IOobject::MUST_READ_IF_MODIFIED,
-        IOobject::NO_WRITE,
-        false
-    );
-
-    if (propsDictHeader.headerOk())
-    {
-        const IOdictionary propsDict(propsDictHeader);
-
-        propsDict.readIfPresent("massInjected", massInjected_);
-        propsDict.readIfPresent("nInjections", nInjections_);
-        propsDict.readIfPresent("parcelsAddedTotal", parcelsAddedTotal_);
-        propsDict.readIfPresent("timeStep0", timeStep0_);
-    }
-}
-
-
-template<class CloudType>
-void Foam::InjectionModel<CloudType>::writeProps()
-{
-    if (!this->owner().solution().transient())
-    {
-        return;
-    }
-
-    if (this->owner().db().time().outputTime())
-    {
-        IOdictionary propsDict
-        (
-            IOobject
-            (
-                "injectionProperties",
-                this->owner().db().time().timeName(),
-                "uniform"/cloud::prefix/this->owner().name(),
-                this->owner().db(),
-                IOobject::NO_READ,
-                IOobject::NO_WRITE,
-                false
-            )
-        );
-
-        propsDict.add("massInjected", massInjected_);
-        propsDict.add("nInjections", nInjections_);
-        propsDict.add("parcelsAddedTotal", parcelsAddedTotal_);
-        propsDict.add("timeStep0", timeStep0_);
-
-        propsDict.writeObject
-        (
-            IOstream::ASCII,
-            IOstream::currentVersion,
-            this->owner().db().time().writeCompression()
-        );
-    }
-}
-
-
 template<class CloudType>
 bool Foam::InjectionModel<CloudType>::validInjection(const label parcelI)
 {
@@ -328,9 +258,6 @@ void Foam::InjectionModel<CloudType>::postInjectCheck
 
     // Increment number of injections
     nInjections_++;
-
-    // Write current state to properties file
-    writeProps();
 }
 
 
@@ -343,16 +270,17 @@ Foam::InjectionModel<CloudType>::InjectionModel(CloudType& owner)
     SOI_(0.0),
     volumeTotal_(0.0),
     massTotal_(0.0),
-    massInjected_(0.0),
-    nInjections_(0),
-    parcelsAddedTotal_(0),
+    massInjected_(this->template getBaseProperty<scalar>("massInjected")),
+    nInjections_(this->template getBaseProperty<scalar>("nInjections")),
+    parcelsAddedTotal_
+    (
+        this->template getBaseProperty<scalar>("parcelsAddedTotal")
+    ),
     parcelBasis_(pbNumber),
     nParticleFixed_(0.0),
     time0_(0.0),
-    timeStep0_(0.0)
-{
-    readProps();
-}
+    timeStep0_(this->template getBaseProperty<scalar>("timeStep0"))
+{}
 
 
 template<class CloudType>
@@ -363,17 +291,20 @@ Foam::InjectionModel<CloudType>::InjectionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     SOI_(0.0),
     volumeTotal_(0.0),
     massTotal_(0.0),
-    massInjected_(0.0),
-    nInjections_(0),
-    parcelsAddedTotal_(0),
+    massInjected_(this->template getBaseProperty<scalar>("massInjected")),
+    nInjections_(this->template getBaseProperty<scalar>("nInjections")),
+    parcelsAddedTotal_
+    (
+        this->template getBaseProperty<scalar>("parcelsAddedTotal")
+    ),
     parcelBasis_(pbNumber),
     nParticleFixed_(0.0),
     time0_(owner.db().time().value()),
-    timeStep0_(0.0)
+    timeStep0_(this->template getBaseProperty<scalar>("timeStep0"))
 {
     // Provide some info
     // - also serves to initialise mesh dimensions - needed for parallel runs
@@ -424,8 +355,6 @@ Foam::InjectionModel<CloudType>::InjectionModel
         )<< "parcelBasisType must be either 'number', 'mass' or 'fixed'" << nl
          << exit(FatalError);
     }
-
-    readProps();
 }
 
 
@@ -803,10 +732,22 @@ bool Foam::InjectionModel<CloudType>::fullyDescribed() const
 
 
 template<class CloudType>
-void Foam::InjectionModel<CloudType>::info(Ostream& os) const
+void Foam::InjectionModel<CloudType>::info(Ostream& os)
 {
     os  << "    Total number of parcels added   = " << parcelsAddedTotal_ << nl
         << "    Total mass introduced           = " << massInjected_ << nl;
+
+    if
+    (
+        this->owner().solution().transient()
+     && this->owner().db().time().outputTime()
+    )
+    {
+        this->setBaseProperty("massInjected", massInjected_);
+        this->setBaseProperty("nInjections", nInjections_);
+        this->setBaseProperty("parcelsAddedTotal", parcelsAddedTotal_);
+        this->setBaseProperty("timeStep0", timeStep0_);
+    }
 }
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H
index 12a6e507c9..82426a9159 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/InjectionModel/InjectionModel/InjectionModel.H
@@ -85,17 +85,6 @@ public:
         };
 
 
-private:
-
-    // Private Member Functions
-
-        //- Read injector properties from previous run (if applicable)
-        void readProps();
-
-        //- Write injector properties
-        void writeProps();
-
-
 protected:
 
     // Protected data
@@ -328,7 +317,7 @@ public:
         // I-O
 
             //- Write injection info to stream
-            virtual void info(Ostream& os) const;
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C
index 4ff52cf17b..345c34e27b 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.C
@@ -25,83 +25,6 @@ License
 
 #include "LocalInteraction.H"
 
-// * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * * //
-
-template<class CloudType>
-void Foam::LocalInteraction<CloudType>::readProps()
-{
-    if (!this->owner().solution().transient())
-    {
-        return;
-    }
-
-    IOobject propsDictHeader
-    (
-        "localInteractionProperties",
-        this->owner().db().time().timeName(),
-        "uniform"/cloud::prefix/this->owner().name(),
-        this->owner().db(),
-        IOobject::MUST_READ_IF_MODIFIED,
-        IOobject::NO_WRITE,
-        false
-    );
-
-    if (propsDictHeader.headerOk())
-    {
-        const IOdictionary propsDict(propsDictHeader);
-        propsDict.readIfPresent("nEscape", nEscape0_);
-        propsDict.readIfPresent("massEscape", massEscape0_);
-        propsDict.readIfPresent("nStick", nStick0_);
-        propsDict.readIfPresent("massStick", massStick0_);
-    }
-}
-
-
-template<class CloudType>
-void Foam::LocalInteraction<CloudType>::writeProps
-(
-    const labelList& nEscape,
-    const scalarList& massEscape,
-    const labelList& nStick,
-    const scalarList& massStick
-) const
-{
-    if (!this->owner().solution().transient())
-    {
-        return;
-    }
-
-    if (this->owner().db().time().outputTime())
-    {
-        IOdictionary propsDict
-        (
-            IOobject
-            (
-                "localInteractionProperties",
-                this->owner().db().time().timeName(),
-                "uniform"/cloud::prefix/this->owner().name(),
-                this->owner().db(),
-                IOobject::NO_READ,
-                IOobject::NO_WRITE,
-                false
-            )
-        );
-
-        propsDict.add("nEscape", nEscape);
-        propsDict.add("massEscape", massEscape);
-        propsDict.add("nStick", nStick);
-        propsDict.add("massStick", massStick);
-
-        propsDict.writeObject
-        (
-            IOstream::ASCII,
-            IOstream::currentVersion,
-            this->owner().db().time().writeCompression()
-        );
-    }
-}
-
-
 // * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * * //
 
 template<class CloudType>
@@ -122,6 +45,12 @@ Foam::LocalInteraction<CloudType>::LocalInteraction
     nStick_(patchData_.size(), 0),
     massStick_(patchData_.size(), 0.0)
 {
+    // intialise starting counters
+    this->getModelProperty("nEscape", nEscape0_);
+    this->getModelProperty("massEscape", massEscape0_);
+    this->getModelProperty("nStick", nStick0_);
+    this->getModelProperty("massStick", massStick0_);
+
     // check that interactions are valid/specified
     forAll(patchData_, patchI)
     {
@@ -141,8 +70,6 @@ Foam::LocalInteraction<CloudType>::LocalInteraction
                 << nl << exit(FatalError);
         }
     }
-
-    readProps();
 }
 
 
@@ -255,7 +182,7 @@ bool Foam::LocalInteraction<CloudType>::correct
                         "typename CloudType::parcelType&, "
                         "const polyPatch&, "
                         "bool&, "
-                        "scalar&, "
+                        "const scalar, "
                         "const tetIndices&"
                     ") const"
                 )   << "Unknown interaction type "
@@ -275,7 +202,7 @@ bool Foam::LocalInteraction<CloudType>::correct
 
 
 template<class CloudType>
-void Foam::LocalInteraction<CloudType>::info(Ostream& os) const
+void Foam::LocalInteraction<CloudType>::info(Ostream& os)
 {
     labelList npe(nEscape_);
     Pstream::listCombineGather(npe, plusEqOp<label>());
@@ -304,7 +231,17 @@ void Foam::LocalInteraction<CloudType>::info(Ostream& os) const
             << ", " << mps[i] << nl;
     }
 
-    writeProps(npe, mpe, nps, mps);
+    if
+    (
+        this->owner().solution().transient()
+     && this->owner().db().time().outputTime()
+    )
+    {
+        this->setModelProperty("nEscape", npe);
+        this->setModelProperty("massEscape", mpe);
+        this->setModelProperty("nStick", nps);
+        this->setModelProperty("massStick", mps);
+    }
 }
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H
index 8a6283b814..ee051d3140 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/LocalInteraction/LocalInteraction.H
@@ -84,21 +84,6 @@ class LocalInteraction
             List<scalar> massStick_;
 
 
-    // Private Member Functions
-
-        //- Read interaction properties from file
-        void readProps();
-
-        //- Write interaction properties to file
-        void writeProps
-        (
-            const labelList& nEscape,
-            const scalarList& massEscape,
-            const labelList& nStick,
-            const scalarList& massStick
-        ) const;
-
-
 public:
 
     //- Runtime type information
@@ -144,7 +129,7 @@ public:
         // I-O
 
             //- Write patch interaction info to stream
-            virtual void info(Ostream& os) const;
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C
index d947b30228..9d2566ab36 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.C
@@ -122,7 +122,7 @@ Foam::PatchInteractionModel<CloudType>::PatchInteractionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     UName_(this->coeffDict().lookupOrDefault("UName", word("U")))
 {}
 
@@ -333,7 +333,7 @@ void Foam::PatchInteractionModel<CloudType>::patchData
 
 
 template<class CloudType>
-void Foam::PatchInteractionModel<CloudType>::info(Ostream& os) const
+void Foam::PatchInteractionModel<CloudType>::info(Ostream& os)
 {
     // do nothing
 }
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H
index f105443710..293d2cdb45 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/PatchInteractionModel/PatchInteractionModel.H
@@ -180,7 +180,7 @@ public:
         // I-O
 
             //- Write patch interaction info to stream
-            virtual void info(Ostream& os) const;
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C
index 7443c2fcc2..94470c710c 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.C
@@ -25,83 +25,6 @@ License
 
 #include "StandardWallInteraction.H"
 
-// * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * * //
-
-template<class CloudType>
-void Foam::StandardWallInteraction<CloudType>::readProps()
-{
-    if (!this->owner().solution().transient())
-    {
-        return;
-    }
-
-    IOobject propsDictHeader
-    (
-        "standardWallInteractionProperties",
-        this->owner().db().time().timeName(),
-        "uniform"/cloud::prefix/this->owner().name(),
-        this->owner().db(),
-        IOobject::MUST_READ_IF_MODIFIED,
-        IOobject::NO_WRITE,
-        false
-    );
-
-    if (propsDictHeader.headerOk())
-    {
-        const IOdictionary propsDict(propsDictHeader);
-        propsDict.readIfPresent("nEscape", nEscape0_);
-        propsDict.readIfPresent("massEscape", massEscape0_);
-        propsDict.readIfPresent("nStick", nStick0_);
-        propsDict.readIfPresent("massStick", massStick0_);
-    }
-}
-
-
-template<class CloudType>
-void Foam::StandardWallInteraction<CloudType>::writeProps
-(
-    const label nEscape,
-    const scalar massEscape,
-    const label nStick,
-    const scalar massStick
-) const
-{
-    if (!this->owner().solution().transient())
-    {
-        return;
-    }
-
-    if (this->owner().db().time().outputTime())
-    {
-        IOdictionary propsDict
-        (
-            IOobject
-            (
-                "standardWallInteractionProperties",
-                this->owner().db().time().timeName(),
-                "uniform"/cloud::prefix/this->owner().name(),
-                this->owner().db(),
-                IOobject::NO_READ,
-                IOobject::NO_WRITE,
-                false
-            )
-        );
-
-        propsDict.add("nEscape", nEscape);
-        propsDict.add("massEscape", massEscape);
-        propsDict.add("nStick", nStick);
-        propsDict.add("massStick", massStick);
-
-        propsDict.writeObject
-        (
-            IOstream::ASCII,
-            IOstream::currentVersion,
-            this->owner().db().time().writeCompression()
-        );
-    }
-}
-
-
 // * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
 
 template<class CloudType>
@@ -118,10 +41,10 @@ Foam::StandardWallInteraction<CloudType>::StandardWallInteraction
     ),
     e_(0.0),
     mu_(0.0),
-    nEscape0_(0),
-    massEscape0_(0.0),
-    nStick0_(0),
-    massStick0_(0.0),
+    nEscape0_(this->template getModelProperty<label>("nEscape")),
+    massEscape0_(this->template getModelProperty<scalar>("massEscape")),
+    nStick0_(this->template getModelProperty<label>("nStick")),
+    massStick0_(this->template getModelProperty<scalar>("massStick")),
     nEscape_(0),
     massEscape_(0.0),
     nStick_(0),
@@ -279,7 +202,7 @@ bool Foam::StandardWallInteraction<CloudType>::correct
 
 
 template<class CloudType>
-void Foam::StandardWallInteraction<CloudType>::info(Ostream& os) const
+void Foam::StandardWallInteraction<CloudType>::info(Ostream& os)
 {
     label npe = returnReduce(nEscape_, sumOp<label>()) + nEscape0_;
     scalar mpe = returnReduce(massEscape_, sumOp<scalar>()) + massEscape0_;
@@ -287,11 +210,21 @@ void Foam::StandardWallInteraction<CloudType>::info(Ostream& os) const
     label nps = returnReduce(nStick_, sumOp<label>()) + nStick0_;
     scalar mps = returnReduce(massStick_, sumOp<scalar>()) + massStick0_;
 
-    os  << "    Parcel fates:" << nl
+    os  << "    Parcel fate (number, mass)" << nl
         << "      - escape                      = " << npe << ", " << mpe << nl
         << "      - stick                       = " << nps << ", " << mps << nl;
 
-    writeProps(npe, mpe, nps, mps);
+    if
+    (
+        this->owner().solution().transient()
+     && this->owner().db().time().outputTime()
+    )
+    {
+        this->setModelProperty("nEscape", npe);
+        this->setModelProperty("massEscape", mpe);
+        this->setModelProperty("nStick", nps);
+        this->setModelProperty("massStick", mps);
+    }
 }
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.H b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.H
index 71705a7851..b1f89b9694 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.H
+++ b/src/lagrangian/intermediate/submodels/Kinematic/PatchInteractionModel/StandardWallInteraction/StandardWallInteraction.H
@@ -104,21 +104,6 @@ protected:
             scalar massStick_;
 
 
-    // Protected Member Functions
-
-        //- Read interaction properties from file
-        void readProps();
-
-        //- Write interaction properties to file
-        void writeProps
-        (
-            const label nEscape,
-            const scalar massEscape,
-            const label nStick,
-            const scalar massStick
-        ) const;
-
-
 public:
 
     //- Runtime type information
@@ -164,7 +149,7 @@ public:
         // I-O
 
             //- Write patch interaction info to stream
-            virtual void info(Ostream& os) const;
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/Kinematic/SurfaceFilmModel/SurfaceFilmModel/SurfaceFilmModel.C b/src/lagrangian/intermediate/submodels/Kinematic/SurfaceFilmModel/SurfaceFilmModel/SurfaceFilmModel.C
index af83ca1429..46fb9296dc 100644
--- a/src/lagrangian/intermediate/submodels/Kinematic/SurfaceFilmModel/SurfaceFilmModel/SurfaceFilmModel.C
+++ b/src/lagrangian/intermediate/submodels/Kinematic/SurfaceFilmModel/SurfaceFilmModel/SurfaceFilmModel.C
@@ -57,7 +57,7 @@ Foam::SurfaceFilmModel<CloudType>::SurfaceFilmModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     g_(g),
     ejectedParcelType_
     (
diff --git a/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C b/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C
index c3189e31cf..ffd5329fbd 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/CompositionModel/CompositionModel/CompositionModel.C
@@ -44,7 +44,7 @@ Foam::CompositionModel<CloudType>::CompositionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     thermo_(owner.thermo()),
     phaseProps_
     (
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C
index 1b79c4e08b..5b78c81058 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.C
@@ -76,7 +76,8 @@ Foam::PhaseChangeModel<CloudType>::PhaseChangeModel
 )
 :
     SubModelBase<CloudType>(owner),
-    enthalpyTransfer_(etLatentHeat)
+    enthalpyTransfer_(etLatentHeat),
+    dMass_(0.0)
 {}
 
 
@@ -87,7 +88,8 @@ Foam::PhaseChangeModel<CloudType>::PhaseChangeModel
 )
 :
     SubModelBase<CloudType>(pcm),
-    enthalpyTransfer_(pcm.enthalpyTransfer_)
+    enthalpyTransfer_(pcm.enthalpyTransfer_),
+    dMass_(pcm.dMass_)
 {}
 
 
@@ -99,11 +101,12 @@ Foam::PhaseChangeModel<CloudType>::PhaseChangeModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     enthalpyTransfer_
     (
         wordToEnthalpyTransfer(this->coeffDict().lookup("enthalpyTransfer"))
-    )
+    ),
+    dMass_(0.0)
 {}
 
 
@@ -175,6 +178,33 @@ Foam::scalar Foam::PhaseChangeModel<CloudType>::dh
 }
 
 
+template<class CloudType>
+void Foam::PhaseChangeModel<CloudType>::addToPhaseChangeMass(const scalar dMass)
+{
+    dMass_ += dMass;
+}
+
+
+template<class CloudType>
+void Foam::PhaseChangeModel<CloudType>::info(Ostream& os)
+{
+    const scalar mass0 = this->template getBaseProperty<scalar>("mass");
+    const scalar massTotal = mass0 + returnReduce(dMass_, sumOp<scalar>());
+
+    Info<< "    Mass transfer phase change      = " << massTotal << nl;
+
+    if
+    (
+        this->owner().solution().transient()
+     && this->owner().db().time().outputTime()
+    )
+    {
+        this->setBaseProperty("mass", massTotal);
+        dMass_ = 0.0;
+    }
+}
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 #include "PhaseChangeModelNew.C"
diff --git a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H
index 9447d1cccc..3ee8d4dbd3 100644
--- a/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H
+++ b/src/lagrangian/intermediate/submodels/Reacting/PhaseChangeModel/PhaseChangeModel/PhaseChangeModel.H
@@ -78,6 +78,12 @@ protected:
         enthalpyTransferType enthalpyTransfer_;
 
 
+        // Counters
+
+            //- Mass of lagrangian phase converted
+            scalar dMass_;
+
+
     // Protected Member Functions
 
         //- Convert word to enthalpy transfer type
@@ -177,6 +183,16 @@ public:
             const label p,
             const label T
         ) const;
+
+
+        //- Add to phase change mass
+        void addToPhaseChangeMass(const scalar dMass);
+
+
+        // I-O
+
+            //- Write injection info to stream
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C
index 6b99c4d382..010230c722 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.C
@@ -33,7 +33,8 @@ Foam::DevolatilisationModel<CloudType>::DevolatilisationModel
     CloudType& owner
 )
 :
-    SubModelBase<CloudType>(owner)
+    SubModelBase<CloudType>(owner),
+    dMass_(0.0)
 {}
 
 
@@ -45,7 +46,8 @@ Foam::DevolatilisationModel<CloudType>::DevolatilisationModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type)
+    SubModelBase<CloudType>(owner, dict, typeName, type),
+    dMass_(0.0)
 {}
 
 
@@ -55,7 +57,8 @@ Foam::DevolatilisationModel<CloudType>::DevolatilisationModel
     const DevolatilisationModel<CloudType>& dm
 )
 :
-    SubModelBase<CloudType>(dm)
+    SubModelBase<CloudType>(dm),
+    dMass_(dm.dMass_)
 {}
 
 
@@ -96,6 +99,36 @@ void Foam::DevolatilisationModel<CloudType>::calculate
 }
 
 
+template<class CloudType>
+void Foam::DevolatilisationModel<CloudType>::addToDevolatilisationMass
+(
+    const scalar dMass
+)
+{
+    dMass_ += dMass;
+}
+
+
+template<class CloudType>
+void Foam::DevolatilisationModel<CloudType>::info(Ostream& os)
+{
+    const scalar mass0 = this->template getBaseProperty<scalar>("mass");
+    const scalar massTotal = mass0 + returnReduce(dMass_, sumOp<scalar>());
+
+    Info<< "    Mass transfer devolatilisation  = " << massTotal << nl;
+
+    if
+    (
+        this->owner().solution().transient()
+     && this->owner().db().time().outputTime()
+    )
+    {
+        this->setBaseProperty("mass", massTotal);
+        dMass_ = 0.0;
+    }
+}
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 #include "DevolatilisationModelNew.C"
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H
index 6eaf6e7442..5b72c0a36d 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/DevolatilisationModel/DevolatilisationModel/DevolatilisationModel.H
@@ -55,6 +55,14 @@ class DevolatilisationModel
 :
     public SubModelBase<CloudType>
 {
+protected:
+
+    // Protected data
+
+        //- Mass of lagrangian phase converted
+        scalar dMass_;
+
+
 public:
 
     //- Runtime type information
@@ -125,6 +133,15 @@ public:
             bool& canCombust,
             scalarField& dMassDV
         ) const;
+
+        //- Add to devolatilisation mass
+        void addToDevolatilisationMass(const scalar dMass);
+
+
+        // I-O
+
+            //- Write injection info to stream
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.C b/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.C
index 11bd9e56a8..3e6fe7989f 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.C
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.C
@@ -33,7 +33,8 @@ Foam::SurfaceReactionModel<CloudType>::SurfaceReactionModel
     CloudType& owner
 )
 :
-    SubModelBase<CloudType>(owner)
+    SubModelBase<CloudType>(owner),
+    dMass_(0.0)
 {}
 
 
@@ -45,7 +46,8 @@ Foam::SurfaceReactionModel<CloudType>::SurfaceReactionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type)
+    SubModelBase<CloudType>(owner, dict, typeName, type),
+    dMass_(0.0)
 {}
 
 
@@ -55,7 +57,8 @@ Foam::SurfaceReactionModel<CloudType>::SurfaceReactionModel
     const SurfaceReactionModel<CloudType>& srm
 )
 :
-    SubModelBase<CloudType>(srm)
+    SubModelBase<CloudType>(srm),
+    dMass_(srm.dMass_)
 {}
 
 
@@ -118,6 +121,36 @@ Foam::scalar Foam::SurfaceReactionModel<CloudType>::calculate
 }
 
 
+template<class CloudType>
+void Foam::SurfaceReactionModel<CloudType>::addToSurfaceReactionMass
+(
+    const scalar dMass
+)
+{
+    dMass_ += dMass;
+}
+
+
+template<class CloudType>
+void Foam::SurfaceReactionModel<CloudType>::info(Ostream& os)
+{
+    const scalar mass0 = this->template getBaseProperty<scalar>("mass");
+    const scalar massTotal = mass0 + returnReduce(dMass_, sumOp<scalar>());
+
+    Info<< "    Mass transfer surface reaction  = " << massTotal << nl;
+
+    if
+    (
+        this->owner().solution().transient()
+     && this->owner().db().time().outputTime()
+    )
+    {
+        this->setBaseProperty("mass", massTotal);
+        dMass_ = 0.0;
+    }
+}
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 #include "SurfaceReactionModelNew.C"
diff --git a/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.H b/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.H
index 2494c9d726..43f8d3ac89 100644
--- a/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.H
+++ b/src/lagrangian/intermediate/submodels/ReactingMultiphase/SurfaceReactionModel/SurfaceReactionModel/SurfaceReactionModel.H
@@ -56,6 +56,14 @@ class SurfaceReactionModel
 :
     public SubModelBase<CloudType>
 {
+protected:
+
+    // Protected data
+
+        //- Mass of lagrangian phase converted
+        scalar dMass_;
+
+
 public:
 
     //-Runtime type information
@@ -138,6 +146,15 @@ public:
             scalarField& dMassSolid,
             scalarField& dMassSRCarrier
         ) const;
+
+        //- Add to devolatilisation mass
+        void addToSurfaceReactionMass(const scalar dMass);
+
+
+        // I-O
+
+            //- Write injection info to stream
+            virtual void info(Ostream& os);
 };
 
 
diff --git a/src/lagrangian/intermediate/submodels/SubModelBase.C b/src/lagrangian/intermediate/submodels/SubModelBase.C
index bccd095bf1..607e5263f0 100644
--- a/src/lagrangian/intermediate/submodels/SubModelBase.C
+++ b/src/lagrangian/intermediate/submodels/SubModelBase.C
@@ -32,6 +32,8 @@ Foam::SubModelBase<CloudType>::SubModelBase(CloudType& owner)
 :
     owner_(owner),
     dict_(dictionary::null),
+    baseName_("none"),
+    name_("none"),
     coeffDict_(dictionary::null)
 {}
 
@@ -41,12 +43,15 @@ Foam::SubModelBase<CloudType>::SubModelBase
 (
     CloudType& owner,
     const dictionary& dict,
+    const word& baseName,
     const word& name,
     const word& dictExt
 )
 :
     owner_(owner),
     dict_(dict),
+    baseName_(baseName),
+    name_(name),
     coeffDict_(dict.subDict(name + dictExt))
 {}
 
@@ -56,6 +61,8 @@ Foam::SubModelBase<CloudType>::SubModelBase(const SubModelBase<CloudType>& smb)
 :
     owner_(smb.owner_),
     dict_(smb.dict_),
+    baseName_(smb.baseName_),
+    name_(smb.name_),
     coeffDict_(smb.coeffDict_)
 {}
 
@@ -83,6 +90,20 @@ const Foam::dictionary& Foam::SubModelBase<CloudType>::dict() const
 }
 
 
+template<class CloudType>
+const Foam::word& Foam::SubModelBase<CloudType>::baseName() const
+{
+    return baseName_;
+}
+
+
+template<class CloudType>
+const Foam::word& Foam::SubModelBase<CloudType>::name() const
+{
+    return name_;
+}
+
+
 template<class CloudType>
 const Foam::dictionary& Foam::SubModelBase<CloudType>::coeffDict() const
 {
@@ -126,6 +147,129 @@ void Foam::SubModelBase<CloudType>::cacheFields(const bool)
 }
 
 
+template<class CloudType>
+template<class Type>
+Type Foam::SubModelBase<CloudType>::getBaseProperty
+(
+    const word& entryName
+) const
+{
+    Type result = pTraits<Type>::zero;
+
+    const dictionary& properties = this->owner().outputProperties();
+
+    if (properties.found(baseName_))
+    {
+        const dictionary& baseDict = properties.subDict(baseName_);
+        baseDict.readIfPresent(entryName, result);
+    }
+
+    return result;
+}
+
+
+template<class CloudType>
+template<class Type>
+void Foam::SubModelBase<CloudType>::setBaseProperty
+(
+    const word& entryName,
+    const Type& value
+)
+{
+    dictionary& properties = this->owner().outputProperties();
+
+    if (properties.found(baseName_))
+    {
+        dictionary& baseDict = properties.subDict(baseName_);
+        baseDict.add(entryName, value, true);
+    }
+    else
+    {
+        properties.add(baseName_, dictionary());
+        properties.subDict(baseName_).add(entryName, value);
+    }
+}
+
+
+template<class CloudType>
+template<class Type>
+Type Foam::SubModelBase<CloudType>::getModelProperty
+(
+    const word& entryName
+) const
+{
+    Type result = pTraits<Type>::zero;
+
+    const dictionary& properties = this->owner().outputProperties();
+
+    if (properties.found(baseName_))
+    {
+        const dictionary& baseDict = properties.subDict(baseName_);
+
+        if (baseDict.found(name_))
+        {
+            baseDict.subDict(name_).readIfPresent(entryName, result);
+        }
+    }
+
+    return result;
+}
+
+
+template<class CloudType>
+template<class Type>
+void Foam::SubModelBase<CloudType>::getModelProperty
+(
+    const word& entryName,
+    Type& value
+) const
+{
+    const dictionary& properties = this->owner().outputProperties();
+
+    if (properties.found(baseName_))
+    {
+        const dictionary& baseDict = properties.subDict(baseName_);
+
+        if (baseDict.found(name_))
+        {
+            baseDict.subDict(name_).readIfPresent(entryName, value);
+        }
+    }
+}
+
+
+template<class CloudType>
+template<class Type>
+void Foam::SubModelBase<CloudType>::setModelProperty
+(
+    const word& entryName,
+    const Type& value
+)
+{
+    dictionary& properties = this->owner().outputProperties();
+
+    if (properties.found(baseName_))
+    {
+        dictionary& baseDict = properties.subDict(baseName_);
+        if (baseDict.found(name_))
+        {
+            baseDict.subDict(name_).add(entryName, value, true);
+        }
+        else
+        {
+            baseDict.add(name_, dictionary());
+            baseDict.subDict(name_).add(entryName, value, true);
+        }
+    }
+    else
+    {
+        properties.add(baseName_, dictionary());
+        properties.subDict(baseName_).add(name_, dictionary());
+        properties.subDict(baseName_).subDict(name_).add(entryName, value);
+    }
+}
+
+
 template<class CloudType>
 void Foam::SubModelBase<CloudType>::write(Ostream& os) const
 {
diff --git a/src/lagrangian/intermediate/submodels/SubModelBase.H b/src/lagrangian/intermediate/submodels/SubModelBase.H
index 0ae7c16ef3..afa42881bf 100644
--- a/src/lagrangian/intermediate/submodels/SubModelBase.H
+++ b/src/lagrangian/intermediate/submodels/SubModelBase.H
@@ -63,6 +63,12 @@ protected:
         //- Reference to the cloud dictionary
         const dictionary& dict_;
 
+        //- Name of the sub-model bas class
+        const word baseName_;
+
+        //- Name of the sub-model
+        const word name_;
+
         //- Coefficients dictionary
         const dictionary& coeffDict_;
 
@@ -79,6 +85,7 @@ public:
         (
             CloudType& owner,
             const dictionary& dict,
+            const word& baseName,
             const word& name,
             const word& dictExt = "Coeffs"
         );
@@ -98,15 +105,24 @@ public:
 
         // Access
 
-            //- Return const access to the cloud dictionary
-            const dictionary& dict() const;
-
             //- Return const access to the owner cloud
             const CloudType& owner() const;
 
+            //- Return const access to the cloud dictionary
+            const dictionary& dict() const;
+
+            //- Return const access to the base name of the sub-model
+            const word& baseName() const;
+
+            //- Return const access to the name of the sub-model
+            const word& name() const;
+
             //- Return const access to the coefficients dictionary
             const dictionary& coeffDict() const;
 
+            //- Return const access to the properties dictionary
+            const IOdictionary& properties() const;
+
             //- Returns true if defaultCoeffs is true and outputs on printMsg
             bool defaultCoeffs(const bool printMsg) const;
 
@@ -122,6 +138,26 @@ public:
             //- Return non-const access to the owner cloud for manipulation
             CloudType& owner();
 
+            //- Retrieve generic property from sub-model
+            template<class Type>
+            Type getModelProperty(const word& entryName) const;
+
+            //- Retrieve generic property from sub-model
+            template<class Type>
+            void getModelProperty(const word& entryName, Type& value) const;
+
+            //- Add generic property from sub-model
+            template<class Type>
+            void setModelProperty(const word& entryName, const Type& value);
+
+            //- Retrieve generic property from base model
+            template<class Type>
+            Type getBaseProperty(const word& entryName) const;
+
+            //- Add generic property from base model
+            template<class Type>
+            void setBaseProperty(const word& entryName, const Type& value);
+
 
         // I-O
 
diff --git a/src/lagrangian/intermediate/submodels/Thermodynamic/HeatTransferModel/HeatTransferModel/HeatTransferModel.C b/src/lagrangian/intermediate/submodels/Thermodynamic/HeatTransferModel/HeatTransferModel/HeatTransferModel.C
index 742b5d566a..abfdc581ac 100644
--- a/src/lagrangian/intermediate/submodels/Thermodynamic/HeatTransferModel/HeatTransferModel/HeatTransferModel.C
+++ b/src/lagrangian/intermediate/submodels/Thermodynamic/HeatTransferModel/HeatTransferModel/HeatTransferModel.C
@@ -43,7 +43,7 @@ Foam::HeatTransferModel<CloudType>::HeatTransferModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     BirdCorrection_(this->coeffDict().lookup("BirdCorrection"))
 {}
 
diff --git a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C
index a5aa28045f..0115d2741a 100644
--- a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C
+++ b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.C
@@ -358,7 +358,7 @@ void Foam::SprayCloud<CloudType>::motion(TrackData& td)
 
 
 template<class CloudType>
-void Foam::SprayCloud<CloudType>::info() const
+void Foam::SprayCloud<CloudType>::info()
 {
     CloudType::info();
     scalar d32 = 1.0e+6*this->Dij(3, 2);
diff --git a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H
index 19f584337f..f8ffbbc7df 100644
--- a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H
+++ b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloud.H
@@ -192,22 +192,23 @@ public:
                 inline const AtomizationModel<SprayCloud<CloudType> >&
                     atomization() const;
 
+                //- Return reference to the atomization model
+                inline AtomizationModel<SprayCloud<CloudType> >& atomization();
+
                 //- Return const-access to the breakup model
                 inline const BreakupModel<SprayCloud<CloudType> >&
                     breakup() const;
 
-                //- Return non-const-access to the breakup model
+                //- Return reference to the breakup model
                 inline BreakupModel<SprayCloud<CloudType> >& breakup();
 
                 //- Return const-access to the breakup model
                 inline const StochasticCollisionModel<SprayCloud<CloudType> >&
                     stochasticCollision() const;
 
-
-        // Check
-
-            //- Print cloud information
-            void info() const;
+                //- Return reference to the breakup model
+                inline StochasticCollisionModel<SprayCloud<CloudType> >&
+                    stochasticCollision();
 
 
         // Cloud evolution functions
@@ -239,6 +240,12 @@ public:
 
             template<class TrackData>
             void motion(TrackData& td);
+
+
+        // I-O
+
+            //- Print cloud information
+            void info();
 };
 
 
diff --git a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H
index c27248aaae..fc07462670 100644
--- a/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H
+++ b/src/lagrangian/spray/clouds/Templates/SprayCloud/SprayCloudI.H
@@ -41,6 +41,14 @@ Foam::SprayCloud<CloudType>::atomization() const
 }
 
 
+template<class CloudType>
+inline Foam::AtomizationModel<Foam::SprayCloud<CloudType> >&
+Foam::SprayCloud<CloudType>::atomization()
+{
+    return atomizationModel_();
+}
+
+
 template<class CloudType>
 inline const Foam::BreakupModel<Foam::SprayCloud<CloudType> >&
 Foam::SprayCloud<CloudType>::breakup() const
@@ -65,6 +73,14 @@ Foam::SprayCloud<CloudType>::stochasticCollision() const
 }
 
 
+template<class CloudType>
+inline Foam::StochasticCollisionModel<Foam::SprayCloud<CloudType> >&
+Foam::SprayCloud<CloudType>::stochasticCollision()
+{
+    return stochasticCollisionModel_();
+}
+
+
 template<class CloudType>
 inline Foam::scalar Foam::SprayCloud<CloudType>::averageParcelMass() const
 {
diff --git a/src/lagrangian/spray/submodels/AtomizationModel/AtomizationModel/AtomizationModel.C b/src/lagrangian/spray/submodels/AtomizationModel/AtomizationModel/AtomizationModel.C
index e7f906c873..5ef8c9126d 100644
--- a/src/lagrangian/spray/submodels/AtomizationModel/AtomizationModel/AtomizationModel.C
+++ b/src/lagrangian/spray/submodels/AtomizationModel/AtomizationModel/AtomizationModel.C
@@ -55,7 +55,7 @@ Foam::AtomizationModel<CloudType>::AtomizationModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type)
+    SubModelBase<CloudType>(owner, dict, typeName, type)
 {}
 
 
diff --git a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
index a46179fd86..f714be34f4 100644
--- a/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
+++ b/src/lagrangian/spray/submodels/BreakupModel/BreakupModel/BreakupModel.C
@@ -67,7 +67,7 @@ Foam::BreakupModel<CloudType>::BreakupModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type),
+    SubModelBase<CloudType>(owner, dict, typeName, type),
     solveOscillationEq_(this->coeffDict().lookup("solveOscillationEq")),
     y0_(0.0),
     yDot0_(0.0),
diff --git a/src/lagrangian/spray/submodels/StochasticCollision/StochasticCollisionModel/StochasticCollisionModel.C b/src/lagrangian/spray/submodels/StochasticCollision/StochasticCollisionModel/StochasticCollisionModel.C
index f527097c40..fa22d59f0b 100644
--- a/src/lagrangian/spray/submodels/StochasticCollision/StochasticCollisionModel/StochasticCollisionModel.C
+++ b/src/lagrangian/spray/submodels/StochasticCollision/StochasticCollisionModel/StochasticCollisionModel.C
@@ -55,7 +55,7 @@ Foam::StochasticCollisionModel<CloudType>::StochasticCollisionModel
     const word& type
 )
 :
-    SubModelBase<CloudType>(owner, dict, type)
+    SubModelBase<CloudType>(owner, dict, typeName, type)
 {}
 
 

From 13fdae844c32bb2e9aee135f9bcf8e67a0d5113f Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 10:37:27 +0000
Subject: [PATCH 24/70] ENH: Updated simplifiedSiwek coalChemistryFoam solver

---
 .../simplifiedSiwek/constant/coalCloud1Properties           | 2 ++
 .../simplifiedSiwek/constant/sourcesProperties              | 6 +++---
 .../coalChemistryFoam/simplifiedSiwek/system/fvSolution     | 4 ++--
 3 files changed, 7 insertions(+), 5 deletions(-)

diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties
index 2f8d97d761..60fa4fb298 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/coalCloud1Properties
@@ -179,6 +179,8 @@ subModels
         volatileData
         (
             (CH4            12)
+            (H2             12)
+            (CO2            12)
         );
         residualCoeff   0.001;
     }
diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/sourcesProperties b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/sourcesProperties
index 06b09abe24..31175f402b 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/sourcesProperties
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/sourcesProperties
@@ -19,8 +19,8 @@ source1
 {
     type            scalarExplicitSource;
     active          true;
-    timeStart       0.15;
-    duration        0.2;
+    timeStart       0.1;
+    duration        0.4;
     selectionMode   cellSet;
     cellSet         ignitionCells;
 
@@ -29,7 +29,7 @@ source1
         volumeMode      absolute;
         injectionRate
         {
-            hs              20000;
+            hs              12000;
         }
     }
 }
diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSolution b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSolution
index 474ae84eb3..a6992031b3 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSolution
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSolution
@@ -99,11 +99,11 @@ relaxationFactors
 {
     fields
     {
-        ".*Final"       1;
+        ".*"            1;
     }
     equations
     {
-        ".*Final"       1;
+        ".*"            1;
     }
 }
 

From e8c76f66b9c673c7cdbb2bb6f43e2711a22c2bb8 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 11:08:39 +0000
Subject: [PATCH 25/70] ENH: Simplified I-O for liquid and solid mixtures

---
 .../liquidMixtureProperties.C                 | 22 ++----
 .../liquidMixtureProperties.H                 | 69 ++++++-------------
 .../solidMixtureProperties.C                  | 25 ++-----
 .../solidMixtureProperties.H                  | 33 ++++++---
 4 files changed, 57 insertions(+), 92 deletions(-)

diff --git a/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.C b/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.C
index 1a3913e0ba..6cee4cdd6b 100644
--- a/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.C
+++ b/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.C
@@ -36,31 +36,21 @@ const Foam::scalar Foam::liquidMixtureProperties::TrMax = 0.999;
 
 Foam::liquidMixtureProperties::liquidMixtureProperties
 (
-    const dictionary& thermophysicalProperties
+    const dictionary& dict
 )
 :
-    components_(thermophysicalProperties.lookup("liquidComponents")),
-    properties_(components_.size())
+    components_(),
+    properties_()
 {
-    // can use sub-dictionary "liquidProperties" to avoid
-    // collisions with identically named gas-phase entries
-    // (eg, H2O liquid vs. gas)
-    const dictionary* subDictPtr = thermophysicalProperties.subDictPtr
-    (
-        "liquidProperties"
-    );
-
-    const dictionary& props =
-    (
-        subDictPtr ? *subDictPtr : thermophysicalProperties
-    );
+    components_ = dict.toc();
+    properties_.setSize(components_.size());
 
     forAll(components_, i)
     {
         properties_.set
         (
             i,
-            liquidProperties::New(props.subDict(components_[i]))
+            liquidProperties::New(dict.subDict(components_[i]))
         );
     }
 }
diff --git a/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.H b/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.H
index 592e5d6223..a9b7a5a7de 100644
--- a/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.H
+++ b/src/thermophysicalModels/properties/liquidMixtureProperties/liquidMixtureProperties/liquidMixtureProperties.H
@@ -25,60 +25,33 @@ Class
     Foam::liquidMixtureProperties
 
 Description
-    A mixture of liquids.
+    A mixture of liquids
 
-    The theory in this class is to a very large extent based on the book:
-    'The Properties of Gases & Liquids' 4th ed.
-    by Reid, Prausnitz and Poling
-
-    For now it does not do much, since the perfect gas equation is used.
-
-    The dictionary constructor searches for the entry \c liquidComponents,
-    which is a wordList. The liquid properties of each component can either
-    be contained within a \c liquidProperties sub-dictionary or (for legacy
-    purposes) can be found directly in the dictionary.
-    The \c liquidProperties sub-dictionary entry should be used when possible
-    to avoid conflicts with identically named gas-phase entries.
-
-    A simple example of a single-component liquidMixtureProperties:
+    An example of a two component liquid mixture:
     \verbatim
-        liquidComponents
-        (
-            H2O
-        );
-
-        // the gas-phase species
-        species
-        (
-            AIR H2O
-        );
-
-        // thermo values from BurcatCpData
-        AIR
-            AIR 1 28.96518      // specie: name/nMoles/MolWt
-            200 6000 1000       // low/high/common temperature
-            3.0879272 0.0012459718 -4.2371895e-07 6.7477479e-11
-                -3.9707697e-15 -995.26275 5.9596093   // 7 upper Temp. coeffs
-            3.5683962 -0.00067872943 1.5537148e-06 -3.2993706e-12
-                -4.6639539e-13 -1062.3466 3.7158296 // 7 lower Temp. coeffs
-            1.4792e-06 116      // sutherlandTransport for AIR (STAR-CD)
-            ;
-        H2O
-            H2O 1 18.01528      // specie: name/nMoles/MolWt
-            200 6000 1000       // low/high/common temperature
-            2.6770389 0.0029731816 -7.7376889e-07 9.4433514e-11
-                -4.2689991e-15 -29885.894 6.88255    // 7 upper Temp. coeffs
-            4.1986352 -0.0020364017 6.5203416e-06 -5.4879269e-09
-                1.771968e-12 -30293.726 -0.84900901 // 7 lower Temp. coeffs
-            1.4792e-06 116      // sutherlandTransport for AIR (STAR-CD)
-            ;
-
-        liquidProperties
+        <parentDictionary>
         {
-            H2O H2O defaultCoeffs;
+            H2O
+            {
+                defaultCoeffs   yes;     // employ default coefficients
+            }
+            C7H16
+            {
+                defaultCoeffs   no;
+                C7H16Coeffs
+                {
+                    ... user defined properties for C7H16
+                }
+            }
         }
     \endverbatim
 
+SourceFiles
+    liquidMixtureProperties.C
+
+SeeAlso
+    Foam::liquidProperties
+
 \*---------------------------------------------------------------------------*/
 
 #ifndef liquidMixtureProperties_H
diff --git a/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.C b/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.C
index df262a11c4..ee37311f57 100644
--- a/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.C
+++ b/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.C
@@ -27,29 +27,16 @@ License
 
 // * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
 
-Foam::solidMixtureProperties::solidMixtureProperties
-(
-    const dictionary& thermophysicalProperties
-)
+Foam::solidMixtureProperties::solidMixtureProperties(const dictionary& dict)
 :
-    components_(thermophysicalProperties.lookup("solidComponents")),
-    properties_(components_.size())
+    components_(),
+    properties_()
 {
-    // can use sub-dictionary "solidProperties" to avoid
-    // collisions with identically named gas-phase entries
-    const dictionary* subDictPtr = thermophysicalProperties.subDictPtr
-    (
-        "solidProperties"
-    );
-
-    const dictionary& props =
-    (
-        subDictPtr ? *subDictPtr : thermophysicalProperties
-    );
-
+    components_ = dict.toc();
+    properties_.setSize(components_.size());
     forAll(components_, i)
     {
-        properties_.set(i, solidProperties::New(props.subDict(components_[i])));
+        properties_.set(i, solidProperties::New(dict.subDict(components_[i])));
     }
 }
 
diff --git a/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.H b/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.H
index 45b7de21f5..52b6134ec8 100644
--- a/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.H
+++ b/src/thermophysicalModels/properties/solidMixtureProperties/solidMixtureProperties/solidMixtureProperties.H
@@ -25,18 +25,33 @@ Class
     Foam::solidMixtureProperties
 
 Description
-    A mixture of solids.
+    A mixture of solids
 
-Note
-    The dictionary constructor searches for the entry \c solidComponents,
-    which is a wordList. The solid properties of each component can either
-    be contained within a \c solidProperties sub-dictionary or (for legacy
-    purposes) can be found directly in the dictionary.
-    The \c solidProperties sub-dictionary entry should be used when possible
-    to avoid conflicts with identically named gas-phase entries.
+    An example of a two component solid mixture:
+    \verbatim
+        <parentDictionary>
+        {
+            C
+            {
+                defaultCoeffs   yes;     // employ default coefficients
+            }
+            ash
+            {
+                defaultCoeffs   no;
+                ashCoeffs
+                {
+                    ... user defined properties for ash
+                }
+            }
+        }
+    \endverbatim
+
+
+SourceFiles
+    solidMixtureProperties.C
 
 SeeAlso
-    Foam::solidMixtureProperties
+    Foam::solidProperties
 
 \*---------------------------------------------------------------------------*/
 

From af25e71e1c5323a63b23e39c29852f4c89414288 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 16 Dec 2011 11:28:44 +0000
Subject: [PATCH 26/70] ENH: patchDist: helper class to determine distance on
 patch to neighbouring patches

---
 .../Test-PatchEdgeFaceWave.C                  | 158 ++++++++++------
 src/meshTools/Make/files                      |   1 +
 .../algorithms/PatchEdgeFaceWave/patchDist.C  | 173 ++++++++++++++++++
 .../algorithms/PatchEdgeFaceWave/patchDist.H  | 114 ++++++++++++
 4 files changed, 385 insertions(+), 61 deletions(-)
 create mode 100644 src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.C
 create mode 100644 src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.H

diff --git a/applications/test/PatchEdgeFaceWave/Test-PatchEdgeFaceWave.C b/applications/test/PatchEdgeFaceWave/Test-PatchEdgeFaceWave.C
index 2dfb19118b..cfc402e14a 100644
--- a/applications/test/PatchEdgeFaceWave/Test-PatchEdgeFaceWave.C
+++ b/applications/test/PatchEdgeFaceWave/Test-PatchEdgeFaceWave.C
@@ -32,6 +32,7 @@ Description
 #include "volFields.H"
 #include "PatchEdgeFaceWave.H"
 #include "patchEdgeFaceInfo.H"
+#include "patchDist.H"
 
 using namespace Foam;
 
@@ -49,80 +50,115 @@ int main(int argc, char *argv[])
 
     // Get name of patch
     const word patchName = args[1];
-
     const polyPatch& patch = patches[patchName];
 
-    // Data on all edges and faces
-    List<patchEdgeFaceInfo> allEdgeInfo(patch.nEdges());
-    List<patchEdgeFaceInfo> allFaceInfo(patch.size());
-
-    // Initial seed
-    DynamicList<label> initialEdges;
-    DynamicList<patchEdgeFaceInfo> initialEdgesInfo;
-
-
-    // Just set an edge on the master
-    if (Pstream::master())
+    // 1. Walk from a single edge
     {
-        label edgeI = 0;
-        Info<< "Starting walk on edge " << edgeI << endl;
+        // Data on all edges and faces
+        List<patchEdgeFaceInfo> allEdgeInfo(patch.nEdges());
+        List<patchEdgeFaceInfo> allFaceInfo(patch.size());
 
-        initialEdges.append(edgeI);
-        const edge& e = patch.edges()[edgeI];
-        initialEdgesInfo.append
-        (
-            patchEdgeFaceInfo
+        // Initial seed
+        DynamicList<label> initialEdges;
+        DynamicList<patchEdgeFaceInfo> initialEdgesInfo;
+
+
+        // Just set an edge on the master
+        if (Pstream::master())
+        {
+            label edgeI = 0;
+            Info<< "Starting walk on edge " << edgeI << endl;
+
+            initialEdges.append(edgeI);
+            const edge& e = patch.edges()[edgeI];
+            initialEdgesInfo.append
             (
-                e.centre(patch.localPoints()),
-                0.0
-            )
-        );
-    }
+                patchEdgeFaceInfo
+                (
+                    e.centre(patch.localPoints()),
+                    0.0
+                )
+            );
+        }
 
 
-    // Walk
-    PatchEdgeFaceWave
-    <
-        primitivePatch,
-        patchEdgeFaceInfo
-    > calc
-    (
-        mesh,
-        patch,
-        initialEdges,
-        initialEdgesInfo,
-        allEdgeInfo,
-        allFaceInfo,
-        returnReduce(patch.nEdges(), sumOp<label>())
-    );
-
-
-    // Extract as patchField
-    volScalarField vsf
-    (
-        IOobject
+        // Walk
+        PatchEdgeFaceWave
+        <
+            primitivePatch,
+            patchEdgeFaceInfo
+        > calc
         (
-            "patchDist",
-            runTime.timeName(),
             mesh,
-            IOobject::NO_READ,
-            IOobject::AUTO_WRITE
-        ),
-        mesh,
-        dimensionedScalar("patchDist", dimLength, 0.0)
-    );
-    scalarField pf(vsf.boundaryField()[patch.index()].size());
-    forAll(pf, faceI)
-    {
-        pf[faceI] = Foam::sqrt(allFaceInfo[faceI].distSqr());
+            patch,
+            initialEdges,
+            initialEdgesInfo,
+            allEdgeInfo,
+            allFaceInfo,
+            returnReduce(patch.nEdges(), sumOp<label>())
+        );
+
+
+        // Extract as patchField
+        volScalarField vsf
+        (
+            IOobject
+            (
+                "patchDist",
+                runTime.timeName(),
+                mesh,
+                IOobject::NO_READ,
+                IOobject::AUTO_WRITE
+            ),
+            mesh,
+            dimensionedScalar("patchDist", dimLength, 0.0)
+        );
+        scalarField pf(vsf.boundaryField()[patch.index()].size());
+        forAll(pf, faceI)
+        {
+            pf[faceI] = Foam::sqrt(allFaceInfo[faceI].distSqr());
+        }
+        vsf.boundaryField()[patch.index()] = pf;
+
+        Info<< "Writing patchDist volScalarField to " << runTime.value()
+            << endl;
+
+        vsf.write();
     }
-    vsf.boundaryField()[patch.index()] = pf;
 
-    Info<< "Writing patchDist volScalarField to " << runTime.value()
-        << endl;
 
-    vsf.write();
+    // 2. Use a wrapper to walk from all boundary edges on selected patches
+    {
+        labelHashSet otherPatchIDs(identity(mesh.boundaryMesh().size()));
+        otherPatchIDs.erase(patch.index());
 
+        Info<< "Walking on patch " << patch.index()
+            << " from edges shared with patches " << otherPatchIDs
+            << endl;
+
+        patchDist pwd(patch, otherPatchIDs);
+
+        // Extract as patchField
+        volScalarField vsf
+        (
+            IOobject
+            (
+                "otherPatchDist",
+                runTime.timeName(),
+                mesh,
+                IOobject::NO_READ,
+                IOobject::AUTO_WRITE
+            ),
+            mesh,
+            dimensionedScalar("otherPatchDist", dimLength, 0.0)
+        );
+        vsf.boundaryField()[patch.index()] = pwd;
+
+        Info<< "Writing otherPatchDist volScalarField to " << runTime.value()
+            << endl;
+
+        vsf.write();
+    }
 
     Info<< "\nEnd\n" << endl;
     return 0;
diff --git a/src/meshTools/Make/files b/src/meshTools/Make/files
index 2be634334c..5912ea12e4 100644
--- a/src/meshTools/Make/files
+++ b/src/meshTools/Make/files
@@ -41,6 +41,7 @@ $(pWave)/pointEdgePoint.C
 patchWave = $(algorithms)/PatchEdgeFaceWave
 $(patchWave)/PatchEdgeFaceWaveName.C
 $(patchWave)/patchEdgeFaceInfo.C
+$(patchWave)/patchDist.C
 
 meshWave = $(algorithms)/MeshWave
 $(meshWave)/MeshWaveName.C
diff --git a/src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.C b/src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.C
new file mode 100644
index 0000000000..22ea9a35f1
--- /dev/null
+++ b/src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.C
@@ -0,0 +1,173 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "patchDist.H"
+#include "PatchEdgeFaceWave.H"
+#include "syncTools.H"
+#include "polyMesh.H"
+#include "patchEdgeFaceInfo.H"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::patchDist::patchDist
+(
+    const polyPatch& patch,
+    const labelHashSet& nbrPatchIDs
+)
+:
+    patch_(patch),
+    nbrPatchIDs_(nbrPatchIDs),
+    nUnset_(0)
+{
+    patchDist::correct();
+}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+Foam::patchDist::~patchDist()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::patchDist::correct()
+{
+    // Mark all edge connected to a nbrPatch.
+    label nBnd = 0;
+    forAllConstIter(labelHashSet, nbrPatchIDs_, iter)
+    {
+        label nbrPatchI = iter.key();
+        const polyPatch& nbrPatch = patch_.boundaryMesh()[nbrPatchI];
+        nBnd += nbrPatch.nEdges()-nbrPatch.nInternalEdges();
+    }
+
+    // Mark all edges. Note: should use HashSet but have no syncTools
+    // functionality for these.
+    EdgeMap<label> nbrEdges(2*nBnd);
+
+    forAllConstIter(labelHashSet, nbrPatchIDs_, iter)
+    {
+        label nbrPatchI = iter.key();
+        const polyPatch& nbrPatch = patch_.boundaryMesh()[nbrPatchI];
+        const labelList& nbrMp = nbrPatch.meshPoints();
+
+        for
+        (
+            label edgeI = nbrPatch.nInternalEdges();
+            edgeI < nbrPatch.nEdges();
+            edgeI++
+        )
+        {
+            const edge& e = nbrPatch.edges()[edgeI];
+            const edge meshE = edge(nbrMp[e[0]], nbrMp[e[1]]);
+            nbrEdges.insert(meshE, nbrPatchI);
+        }
+    }
+
+
+    // Make sure these boundary edges are marked everywhere.
+    syncTools::syncEdgeMap
+    (
+        patch_.boundaryMesh().mesh(),
+        nbrEdges,
+        maxEqOp<label>()
+    );
+
+
+    // Data on all edges and faces
+    List<patchEdgeFaceInfo> allEdgeInfo(patch_.nEdges());
+    List<patchEdgeFaceInfo> allFaceInfo(patch_.size());
+
+    // Initial seed
+    label nBndEdges = patch_.nEdges() - patch_.nInternalEdges();
+    DynamicList<label> initialEdges(2*nBndEdges);
+    DynamicList<patchEdgeFaceInfo> initialEdgesInfo(2*nBndEdges);
+
+
+    // Seed all my edges that are also nbrEdges
+
+    const labelList& mp = patch_.meshPoints();
+
+    for
+    (
+        label edgeI = patch_.nInternalEdges();
+        edgeI < patch_.nEdges();
+        edgeI++
+    )
+    {
+        const edge& e = patch_.edges()[edgeI];
+        const edge meshE = edge(mp[e[0]], mp[e[1]]);
+        EdgeMap<label>::const_iterator edgeFnd = nbrEdges.find(meshE);
+        if (edgeFnd != nbrEdges.end())
+        {
+            initialEdges.append(edgeI);
+            initialEdgesInfo.append
+            (
+                patchEdgeFaceInfo
+                (
+                    e.centre(patch_.localPoints()),
+                    0.0
+                )
+            );
+        }
+    }
+
+
+    // Walk
+    PatchEdgeFaceWave
+    <
+        primitivePatch,
+        patchEdgeFaceInfo
+    > calc
+    (
+        patch_.boundaryMesh().mesh(),
+        patch_,
+        initialEdges,
+        initialEdgesInfo,
+        allEdgeInfo,
+        allFaceInfo,
+        returnReduce(patch_.nEdges(), sumOp<label>())
+    );
+
+
+    // Extract into *this
+    setSize(patch_.size());
+    nUnset_ = 0;
+    forAll(allFaceInfo, faceI)
+    {
+        if (allFaceInfo[faceI].valid(calc.data()))
+        {
+            operator[](faceI) =  Foam::sqrt(allFaceInfo[faceI].distSqr());
+        }
+        else
+        {
+            nUnset_++;
+        }
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.H b/src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.H
new file mode 100644
index 0000000000..11cf2f4825
--- /dev/null
+++ b/src/meshTools/algorithms/PatchEdgeFaceWave/patchDist.H
@@ -0,0 +1,114 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::patchDist
+
+Description
+    Like wallDist but calculates on patch distance to nearest neighbouring
+    patches. Uses PatchEdgeFaceWave to do actual calculation.
+
+SourceFiles
+    patchDist.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef patchDist_H
+#define patchDist_H
+
+#include "scalarField.H"
+#include "HashSet.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+//class polyMesh;
+class polyPatch;
+
+/*---------------------------------------------------------------------------*\
+                           Class patchDist Declaration
+\*---------------------------------------------------------------------------*/
+
+class patchDist
+:
+    public scalarField
+{
+
+
+private:
+
+    // Private Member Data
+
+        //- Patch to operate on
+        const polyPatch& patch_;
+
+        //- Patches to determine the distance to
+        const labelHashSet nbrPatchIDs_;
+
+        //- Number of unset faces.
+        label nUnset_;
+
+public:
+
+    // Constructors
+
+        //- Construct from patch and neighbour patches.
+        patchDist
+        (
+            const polyPatch& pp,
+            const labelHashSet& nbrPatchIDs
+        );
+
+
+    //- Destructor
+    virtual ~patchDist();
+
+
+    // Member Functions
+
+        const scalarField& y() const
+        {
+            return *this;
+        }
+
+        label nUnset() const
+        {
+            return nUnset_;
+        }
+
+        //- Correct for mesh geom/topo changes
+        virtual void correct();
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

From 7801d7f50f5f5910c8e826f7d6d6af7be95af390 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 12:10:06 +0000
Subject: [PATCH 27/70] ENH: Added CompatibilityConstant DataEntry for
 backwards comapatibility

---
 .../CompatibilityConstant.C                   |  86 +++++++++++
 .../CompatibilityConstant.H                   | 143 ++++++++++++++++++
 .../CompatibilityConstantIO.C                 |  69 +++++++++
 .../DataEntry/DataEntry/DataEntryNew.C        |  22 ++-
 .../functions/DataEntry/makeDataEntries.C     |   7 +
 5 files changed, 322 insertions(+), 5 deletions(-)
 create mode 100644 src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.C
 create mode 100644 src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.H
 create mode 100644 src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstantIO.C

diff --git a/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.C b/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.C
new file mode 100644
index 0000000000..205b4b5732
--- /dev/null
+++ b/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.C
@@ -0,0 +1,86 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "CompatibilityConstant.H"
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+template<class Type>
+Foam::CompatibilityConstant<Type>::CompatibilityConstant
+(
+    const word& entryName, const dictionary& dict
+)
+:
+    DataEntry<Type>(entryName),
+    value_(pTraits<Type>::zero)
+{
+    dict.lookup(entryName)  >> value_;
+}
+
+
+template<class Type>
+Foam::CompatibilityConstant<Type>::CompatibilityConstant
+(
+    const CompatibilityConstant<Type>& cnst
+)
+:
+    DataEntry<Type>(cnst),
+    value_(cnst.value_)
+{}
+
+
+// * * * * * * * * * * * * * * * * Destructor  * * * * * * * * * * * * * * * //
+
+template<class Type>
+Foam::CompatibilityConstant<Type>::~CompatibilityConstant()
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+template<class Type>
+Type Foam::CompatibilityConstant<Type>::value(const scalar x) const
+{
+    return value_;
+}
+
+
+template<class Type>
+Type Foam::CompatibilityConstant<Type>::integrate
+(
+    const scalar x1,
+    const scalar x2
+) const
+{
+    return (x2 - x1)*value_;
+}
+
+
+// * * * * * * * * * * * * * *  IOStream operators * * * * * * * * * * * * * //
+
+#include "CompatibilityConstantIO.C"
+
+
+// ************************************************************************* //
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.H b/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.H
new file mode 100644
index 0000000000..9e2f46bb20
--- /dev/null
+++ b/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstant.H
@@ -0,0 +1,143 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::CompatibilityConstant
+
+Description
+    Templated basic entry that holds a constant value for backwards
+    compatibility (when DataEntry type is not present)
+
+    Usage - for entry \<entryName\> having the value <value>:
+    \verbatim
+        <entryName>    <value>
+    \endverbatim
+
+SourceFiles
+    CompatibilityConstant.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef CompatibilityConstant_H
+#define CompatibilityConstant_H
+
+#include "DataEntry.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+template<class Type>
+class CompatibilityConstant;
+
+template<class Type>
+Ostream& operator<<(Ostream&, const CompatibilityConstant<Type>&);
+
+/*---------------------------------------------------------------------------*\
+                   Class CompatibilityConstant Declaration
+\*---------------------------------------------------------------------------*/
+
+template<class Type>
+class CompatibilityConstant
+:
+    public DataEntry<Type>
+{
+    // Private data
+
+        //- Constant value
+        Type value_;
+
+
+    // Private Member Functions
+
+        //- Disallow default bitwise assignment
+        void operator=(const CompatibilityConstant<Type>&);
+
+
+public:
+
+    // Runtime type information
+    TypeName("CompatibilityConstant");
+
+
+    // Constructors
+
+        //- Construct from entry name and Istream
+        CompatibilityConstant(const word& entryName, const dictionary& dict);
+
+        //- Copy constructor
+        CompatibilityConstant(const CompatibilityConstant<Type>& cnst);
+
+        //- Construct and return a clone
+        virtual tmp<DataEntry<Type> > clone() const
+        {
+            return tmp<DataEntry<Type> >
+            (
+                new CompatibilityConstant<Type>(*this)
+            );
+        }
+
+
+    //- Destructor
+    virtual ~CompatibilityConstant();
+
+
+    // Member Functions
+
+        //- Return constant value
+        Type value(const scalar) const;
+
+        //- Integrate between two values
+        Type integrate(const scalar x1, const scalar x2) const;
+
+
+    // I/O
+
+        //- Ostream Operator
+        friend Ostream& operator<< <Type>
+        (
+            Ostream& os,
+            const CompatibilityConstant<Type>& cnst
+        );
+
+        //- Write in dictionary format
+        virtual void writeData(Ostream& os) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#ifdef NoRepository
+#   include "CompatibilityConstant.C"
+#endif
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstantIO.C b/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstantIO.C
new file mode 100644
index 0000000000..4cb72ab8c2
--- /dev/null
+++ b/src/OpenFOAM/primitives/functions/DataEntry/CompatibilityConstant/CompatibilityConstantIO.C
@@ -0,0 +1,69 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "DataEntry.H"
+
+// * * * * * * * * * * * * * * * IOstream Operators  * * * * * * * * * * * * //
+
+template<class Type>
+Foam::Ostream& Foam::operator<<
+(
+    Ostream& os,
+    const CompatibilityConstant<Type>& cnst
+)
+{
+    if (os.format() == IOstream::ASCII)
+    {
+        os  << static_cast<const DataEntry<Type>& >(cnst)
+            << token::SPACE << cnst.value_;
+    }
+    else
+    {
+        os  << static_cast<const DataEntry<Type>& >(cnst);
+        os.write
+        (
+            reinterpret_cast<const char*>(&cnst.value_),
+            sizeof(cnst.value_)
+        );
+    }
+
+    // Check state of Ostream
+    os.check
+    (
+        "Ostream& operator<<(Ostream&, const CompatibilityConstant<Type>&)"
+    );
+
+    return os;
+}
+
+
+template<class Type>
+void Foam::CompatibilityConstant<Type>::writeData(Ostream& os) const
+{
+    os.writeKeyword(this->name_) << value_ << token::END_STATEMENT << nl;
+}
+
+
+// ************************************************************************* //
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C b/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C
index 57cf79c419..b43eed2d6e 100644
--- a/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C
+++ b/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C
@@ -35,17 +35,29 @@ Foam::autoPtr<Foam::DataEntry<Type> > Foam::DataEntry<Type>::New
 )
 {
     Istream& is(dict.lookup(entryName));
-    word DataEntryType(is);
+
+    token firstToken(is);
+
+    word DataEntryType;
+    if (firstToken.isWord())
+    {
+        DataEntryType = firstToken.wordToken();
+    }
+    else
+    {
+        is.putBack(firstToken);
+//        DataEntryType = CompatibilityConstant<Type>::typeName;
+        DataEntryType = "CompatibilityConstant";
+    }
+    
 
     typename dictionaryConstructorTable::iterator cstrIter =
         dictionaryConstructorTablePtr_->find(DataEntryType);
 
     if (cstrIter == dictionaryConstructorTablePtr_->end())
     {
-        FatalErrorIn
-        (
-            "DataEntry<Type>::New(Istream&)"
-        )   << "Unknown DataEntry type "
+        FatalErrorIn("DataEntry<Type>::New(const word&, const dictionary&)")
+            << "Unknown DataEntry type "
             << DataEntryType << " for DataEntry "
             << entryName << nl << nl
             << "Valid DataEntry types are:" << nl
diff --git a/src/OpenFOAM/primitives/functions/DataEntry/makeDataEntries.C b/src/OpenFOAM/primitives/functions/DataEntry/makeDataEntries.C
index d443fb9b76..78935f0b80 100644
--- a/src/OpenFOAM/primitives/functions/DataEntry/makeDataEntries.C
+++ b/src/OpenFOAM/primitives/functions/DataEntry/makeDataEntries.C
@@ -23,6 +23,7 @@ License
 
 \*---------------------------------------------------------------------------*/
 
+#include "CompatibilityConstant.H"
 #include "Constant.H"
 #include "CSV.H"
 #include "DataEntry.H"
@@ -39,36 +40,42 @@ License
 namespace Foam
 {
     makeDataEntry(label);
+    makeDataEntryType(CompatibilityConstant, label);
     makeDataEntryType(Constant, label);
 //    makeDataEntryType(CSV, label);
     makeDataEntryType(Table, label);
     makeDataEntryType(TableFile, label);
 
     makeDataEntry(scalar);
+    makeDataEntryType(CompatibilityConstant, scalar);
     makeDataEntryType(Constant, scalar);
     makeDataEntryType(CSV, scalar);
     makeDataEntryType(Table, scalar);
     makeDataEntryType(TableFile, scalar);
 
     makeDataEntry(vector);
+    makeDataEntryType(CompatibilityConstant, vector);
     makeDataEntryType(Constant, vector);
     makeDataEntryType(CSV, vector);
     makeDataEntryType(Table, vector);
     makeDataEntryType(TableFile, vector);
 
     makeDataEntry(sphericalTensor);
+    makeDataEntryType(CompatibilityConstant, sphericalTensor);
     makeDataEntryType(Constant, sphericalTensor);
     makeDataEntryType(CSV, sphericalTensor);
     makeDataEntryType(Table, sphericalTensor);
     makeDataEntryType(TableFile, sphericalTensor);
 
     makeDataEntry(symmTensor);
+    makeDataEntryType(CompatibilityConstant, symmTensor);
     makeDataEntryType(Constant, symmTensor);
     makeDataEntryType(CSV, symmTensor);
     makeDataEntryType(Table, symmTensor);
     makeDataEntryType(TableFile, symmTensor);
 
     makeDataEntry(tensor);
+    makeDataEntryType(CompatibilityConstant, tensor);
     makeDataEntryType(Constant, tensor);
     makeDataEntryType(CSV, tensor);
     makeDataEntryType(Table, tensor);

From 6efb6a2027367c44e542750c75814bcd1e793246 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 12:14:46 +0000
Subject: [PATCH 28/70] ENH: Cleaned-up tutorial thermo input dictionaries for
 use with reacting clouds

---
 .../verticalChannel/constant/thermophysicalProperties    | 9 +--------
 .../simplifiedSiwek/constant/thermophysicalProperties    | 2 --
 .../filter/constant/thermophysicalProperties             | 3 +--
 .../parcelInBox/constant/thermophysicalProperties        | 9 +--------
 .../verticalChannel/constant/thermophysicalProperties    | 9 +--------
 .../cylinder/constant/thermophysicalProperties           | 4 +---
 .../hotBoxes/constant/thermophysicalProperties           | 4 +---
 .../rivuletPanel/constant/thermophysicalProperties       | 4 +---
 .../splashPanel/constant/thermophysicalProperties        | 4 +---
 .../evaporationTest/constant/thermophysicalProperties    | 3 +--
 .../aachenBomb/constant/thermophysicalProperties         | 3 +--
 11 files changed, 10 insertions(+), 44 deletions(-)

diff --git a/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/thermophysicalProperties b/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/thermophysicalProperties
index ebfe63a442..52c55104b8 100644
--- a/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/LTSReactingParcelFoam/verticalChannel/constant/thermophysicalProperties
@@ -27,11 +27,6 @@ inertSpecie     air;
 
 liquids
 {
-    liquidComponents
-    (
-        H2O
-    );
-
     H2O
     {
         defaultCoeffs   yes;
@@ -40,9 +35,7 @@ liquids
 
 solids
 {
-    solidComponents
-    (
-    );
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/thermophysicalProperties b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/thermophysicalProperties
index c6d411a67a..63e7e7175b 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/constant/thermophysicalProperties
@@ -27,7 +27,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents ( H2O );
     H2O
     {
         defaultCoeffs   yes;
@@ -36,7 +35,6 @@ liquids
 
 solids
 {
-    solidComponents ( C ash );
     C
     {
         defaultCoeffs   yes;
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/thermophysicalProperties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/thermophysicalProperties
index 3664555a38..f5879b64a4 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/filter/constant/thermophysicalProperties
@@ -25,7 +25,6 @@ foamChemistryThermoFile "$FOAM_CASE/constant/thermo.incompressiblePoly";
 
 liquids
 {
-    liquidComponents ( H2O );
     H2O
     {
         defaultCoeffs   yes;
@@ -34,7 +33,7 @@ liquids
 
 solids
 {
-    solidComponents ( );
+    // none
 }
 
 inertSpecie     N2;
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/thermophysicalProperties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/thermophysicalProperties
index 4952037ec1..ed3725758e 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/constant/thermophysicalProperties
@@ -27,11 +27,6 @@ inertSpecie     air;
 
 liquids
 {
-    liquidComponents
-    (
-        H2O
-    );
-
     H2O
     {
         defaultCoeffs yes;
@@ -40,9 +35,7 @@ liquids
 
 solids
 {
-    solidComponents
-    (
-    );
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/thermophysicalProperties b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/thermophysicalProperties
index ebfe63a442..52c55104b8 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/verticalChannel/constant/thermophysicalProperties
@@ -27,11 +27,6 @@ inertSpecie     air;
 
 liquids
 {
-    liquidComponents
-    (
-        H2O
-    );
-
     H2O
     {
         defaultCoeffs   yes;
@@ -40,9 +35,7 @@ liquids
 
 solids
 {
-    solidComponents
-    (
-    );
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/thermophysicalProperties b/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/thermophysicalProperties
index 399f07112f..a12807251c 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/cylinder/constant/thermophysicalProperties
@@ -28,8 +28,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents (H2O);
-
     H2O
     {
         defaultCoeffs   yes;
@@ -39,7 +37,7 @@ liquids
 
 solids
 {
-    solidComponents ();
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/thermophysicalProperties b/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/thermophysicalProperties
index 399f07112f..a12807251c 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/hotBoxes/constant/thermophysicalProperties
@@ -28,8 +28,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents (H2O);
-
     H2O
     {
         defaultCoeffs   yes;
@@ -39,7 +37,7 @@ liquids
 
 solids
 {
-    solidComponents ();
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/constant/thermophysicalProperties b/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/constant/thermophysicalProperties
index 399f07112f..a12807251c 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/constant/thermophysicalProperties
@@ -28,8 +28,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents (H2O);
-
     H2O
     {
         defaultCoeffs   yes;
@@ -39,7 +37,7 @@ liquids
 
 solids
 {
-    solidComponents ();
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/thermophysicalProperties b/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/thermophysicalProperties
index 399f07112f..a12807251c 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/splashPanel/constant/thermophysicalProperties
@@ -28,8 +28,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents (H2O);
-
     H2O
     {
         defaultCoeffs   yes;
@@ -39,7 +37,7 @@ liquids
 
 solids
 {
-    solidComponents ();
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/thermophysicalProperties b/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/thermophysicalProperties
index c7a0a270bc..8236d34685 100644
--- a/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/reactingParcelFoam/evaporationTest/constant/thermophysicalProperties
@@ -27,7 +27,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents ( H2O );
     H2O
     {
         defaultCoeffs   yes;
@@ -36,7 +35,7 @@ liquids
 
 solids
 {
-    solidComponents ( );
+    // none
 }
 
 
diff --git a/tutorials/lagrangian/sprayFoam/aachenBomb/constant/thermophysicalProperties b/tutorials/lagrangian/sprayFoam/aachenBomb/constant/thermophysicalProperties
index 0f2475a388..655ee3aebb 100644
--- a/tutorials/lagrangian/sprayFoam/aachenBomb/constant/thermophysicalProperties
+++ b/tutorials/lagrangian/sprayFoam/aachenBomb/constant/thermophysicalProperties
@@ -26,7 +26,6 @@ inertSpecie     N2;
 
 liquids
 {
-    liquidComponents ( C7H16 );
     C7H16
     {
         defaultCoeffs   yes;
@@ -35,7 +34,7 @@ liquids
 
 solids
 {
-    solidComponents ( );
+    // none
 }
 
 // ************************************************************************* //

From 5a0e5da77e3a9fcbc233aa094104f331fceed59e Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 14:27:23 +0000
Subject: [PATCH 29/70] BUG: Added missing renumberMethods to src/Allwmake

---
 src/Allwmake | 2 ++
 1 file changed, 2 insertions(+)

diff --git a/src/Allwmake b/src/Allwmake
index aa17b418e3..a0622b30f7 100755
--- a/src/Allwmake
+++ b/src/Allwmake
@@ -46,6 +46,8 @@ wmake $makeType genericPatchFields
 # Build the proper scotchDecomp, metisDecomp etc.
 parallel/Allwmake $*
 
+wmake $makeType renumberMethods
+
 wmake $makeType conversion
 
 wmake $makeType sampling

From d46303b9cbe1c76bdb9d5109b7c4ab11b383b87b Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 14:39:45 +0000
Subject: [PATCH 30/70] STYLE: Removed trailing spaces

---
 .../primitives/functions/DataEntry/DataEntry/DataEntryNew.C      | 1 -
 1 file changed, 1 deletion(-)

diff --git a/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C b/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C
index b43eed2d6e..c7383f9d0d 100644
--- a/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C
+++ b/src/OpenFOAM/primitives/functions/DataEntry/DataEntry/DataEntryNew.C
@@ -49,7 +49,6 @@ Foam::autoPtr<Foam::DataEntry<Type> > Foam::DataEntry<Type>::New
 //        DataEntryType = CompatibilityConstant<Type>::typeName;
         DataEntryType = "CompatibilityConstant";
     }
-    
 
     typename dictionaryConstructorTable::iterator cstrIter =
         dictionaryConstructorTablePtr_->find(DataEntryType);

From 204e393d8bcfa01400ec308f59e24b16ef12fd63 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 14:50:23 +0000
Subject: [PATCH 31/70] STYLE: Minor code formatting

---
 .../CuthillMcKeeRenumber/CuthillMcKeeRenumber.H            | 4 ++--
 src/renumberMethods/manualRenumber/manualRenumber.H        | 4 ++--
 src/renumberMethods/randomRenumber/randomRenumber.H        | 3 ++-
 src/renumberMethods/springRenumber/springRenumber.H        | 4 ++--
 src/sampling/cuttingPlane/cuttingPlane.H                   | 7 +++++--
 5 files changed, 13 insertions(+), 9 deletions(-)

diff --git a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
index 90a81692e0..03148c8739 100644
--- a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
+++ b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
@@ -42,7 +42,7 @@ namespace Foam
 {
 
 /*---------------------------------------------------------------------------*\
-                           Class CuthillMcKeeRenumber Declaration
+                   Class CuthillMcKeeRenumber Declaration
 \*---------------------------------------------------------------------------*/
 
 class CuthillMcKeeRenumber
@@ -72,6 +72,7 @@ public:
         //- Construct given the renumber dictionary
         CuthillMcKeeRenumber(const dictionary& renumberDict);
 
+
     //- Destructor
     virtual ~CuthillMcKeeRenumber()
     {}
@@ -103,7 +104,6 @@ public:
             const labelListList& cellCells,
             const pointField& cc
         );
-
 };
 
 
diff --git a/src/renumberMethods/manualRenumber/manualRenumber.H b/src/renumberMethods/manualRenumber/manualRenumber.H
index 9aa0d76c06..635e93c614 100644
--- a/src/renumberMethods/manualRenumber/manualRenumber.H
+++ b/src/renumberMethods/manualRenumber/manualRenumber.H
@@ -41,7 +41,7 @@ namespace Foam
 {
 
 /*---------------------------------------------------------------------------*\
-                           Class manualRenumber Declaration
+                      Class manualRenumber Declaration
 \*---------------------------------------------------------------------------*/
 
 class manualRenumber
@@ -71,6 +71,7 @@ public:
         //- Construct given the renumber dictionary
         manualRenumber(const dictionary& renumberDict);
 
+
     //- Destructor
     virtual ~manualRenumber()
     {}
@@ -110,7 +111,6 @@ public:
             );
             return labelList(0);
         }
-
 };
 
 
diff --git a/src/renumberMethods/randomRenumber/randomRenumber.H b/src/renumberMethods/randomRenumber/randomRenumber.H
index 54d63d2835..be704d1097 100644
--- a/src/renumberMethods/randomRenumber/randomRenumber.H
+++ b/src/renumberMethods/randomRenumber/randomRenumber.H
@@ -41,7 +41,7 @@ namespace Foam
 {
 
 /*---------------------------------------------------------------------------*\
-                           Class randomRenumber Declaration
+                      Class randomRenumber Declaration
 \*---------------------------------------------------------------------------*/
 
 class randomRenumber
@@ -66,6 +66,7 @@ public:
         //- Construct given the renumber dictionary
         randomRenumber(const dictionary& renumberDict);
 
+
     //- Destructor
     virtual ~randomRenumber()
     {}
diff --git a/src/renumberMethods/springRenumber/springRenumber.H b/src/renumberMethods/springRenumber/springRenumber.H
index d6ee7f00c1..64342af1ec 100644
--- a/src/renumberMethods/springRenumber/springRenumber.H
+++ b/src/renumberMethods/springRenumber/springRenumber.H
@@ -52,7 +52,7 @@ namespace Foam
 {
 
 /*---------------------------------------------------------------------------*\
-                           Class springRenumber Declaration
+                       Class springRenumber Declaration
 \*---------------------------------------------------------------------------*/
 
 class springRenumber
@@ -87,6 +87,7 @@ public:
         //- Construct given the renumber dictionary
         springRenumber(const dictionary& renumberDict);
 
+
     //- Destructor
     virtual ~springRenumber()
     {}
@@ -117,7 +118,6 @@ public:
             const labelListList& cellCells,
             const pointField& cc
         );
-
 };
 
 
diff --git a/src/sampling/cuttingPlane/cuttingPlane.H b/src/sampling/cuttingPlane/cuttingPlane.H
index f23a50f504..d4f2ebe4bb 100644
--- a/src/sampling/cuttingPlane/cuttingPlane.H
+++ b/src/sampling/cuttingPlane/cuttingPlane.H
@@ -63,14 +63,16 @@ class cuttingPlane
     public plane,
     public MeshedSurface<face>
 {
-    //- Private typedefs for convenience
-        typedef MeshedSurface<face> MeshStorage;
+    //- Private typedef for convenience
+    typedef MeshedSurface<face> MeshStorage;
+
 
     // Private data
 
         //- List of cells cut by the plane
         labelList cutCells_;
 
+
     // Private Member Functions
 
         //- Determine cut cells, possibly restricted to a list of cells
@@ -129,6 +131,7 @@ protected:
         //- remap action on triangulation or cleanup
         virtual void remapFaces(const labelUList& faceMap);
 
+
 public:
 
     // Constructors

From ca1ac54225bd741da621588dae658dca66fcf0fd Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 15:05:24 +0000
Subject: [PATCH 32/70] BUG: orthogonal snGrad scheme had incorrect type name
 uncorrected

---
 .../snGradSchemes/orthogonalSnGrad/orthogonalSnGrad.H           | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/src/finiteVolume/finiteVolume/snGradSchemes/orthogonalSnGrad/orthogonalSnGrad.H b/src/finiteVolume/finiteVolume/snGradSchemes/orthogonalSnGrad/orthogonalSnGrad.H
index 5bd76fe516..b903298162 100644
--- a/src/finiteVolume/finiteVolume/snGradSchemes/orthogonalSnGrad/orthogonalSnGrad.H
+++ b/src/finiteVolume/finiteVolume/snGradSchemes/orthogonalSnGrad/orthogonalSnGrad.H
@@ -65,7 +65,7 @@ class orthogonalSnGrad
 public:
 
     //- Runtime type information
-    TypeName("uncorrected");
+    TypeName("orthogonal");
 
 
     // Constructors

From bd26bcca6bee3e379f08495b5393d961f4f780b2 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 15:30:07 +0000
Subject: [PATCH 33/70] ENH: Limit maxIter for p in parcelInBox tutorial -
 carrier not solved

---
 .../parcelInBox/system/fvSolution                                | 1 +
 1 file changed, 1 insertion(+)

diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSolution b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSolution
index ff633dd7d5..6622d336f4 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSolution
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSolution
@@ -66,6 +66,7 @@ solvers
         $p;
         tolerance       1e-06;
         relTol          0;
+        maxIter         20;
     }
 
     "(Yi|O2|N2|H2O)"

From 2dc13eb942d3b0962ebe29dd3186145cb97c109d Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 16 Dec 2011 15:30:58 +0000
Subject: [PATCH 34/70] ENH: tutorialse: use orthogonal scheme on orthogonal
 meshes

---
 .../rhoPimpleFoam/ras/cavity/system/fvSchemes  | 18 +++++++++---------
 .../laminar/shockTube/system/fvSchemes         |  8 ++++----
 .../buoyantCavity/system/fvSchemes             | 14 +++++++-------
 .../icoFoam/cavity/system/fvSchemes            |  6 +++---
 .../icoFoam/cavityClipped/system/fvSchemes     |  6 +++---
 .../counterFlowFlame2D/system/fvSchemes        | 16 ++++++++--------
 .../simplifiedSiwek/system/fvSchemes           | 18 +++++++++---------
 .../parcelInBox/system/fvSchemes               |  4 ++--
 .../rivuletPanel/system/fvSchemes              |  4 ++--
 .../system/wallFilmRegion/fvSchemes            |  8 ++++----
 .../sprayFoam/aachenBomb/system/fvSchemes      | 18 +++++++++---------
 11 files changed, 60 insertions(+), 60 deletions(-)

diff --git a/tutorials/compressible/rhoPimpleFoam/ras/cavity/system/fvSchemes b/tutorials/compressible/rhoPimpleFoam/ras/cavity/system/fvSchemes
index 3049da2bed..da4ffa1eaa 100644
--- a/tutorials/compressible/rhoPimpleFoam/ras/cavity/system/fvSchemes
+++ b/tutorials/compressible/rhoPimpleFoam/ras/cavity/system/fvSchemes
@@ -46,14 +46,14 @@ divSchemes
 laplacianSchemes
 {
     default         none;
-    laplacian(muEff,U) Gauss linear corrected;
-    laplacian(mut,U) Gauss linear corrected;
-    laplacian(DkEff,k) Gauss linear corrected;
-    laplacian(DepsilonEff,epsilon) Gauss linear corrected;
-    laplacian(DREff,R) Gauss linear corrected;
-    laplacian(DomegaEff,omega) Gauss linear corrected;
-    laplacian((rho*(1|A(U))),p) Gauss linear corrected;
-    laplacian(alphaEff,h) Gauss linear corrected;
+    laplacian(muEff,U) Gauss linear orthogonal;
+    laplacian(mut,U) Gauss linear orthogonal;
+    laplacian(DkEff,k) Gauss linear orthogonal;
+    laplacian(DepsilonEff,epsilon) Gauss linear orthogonal;
+    laplacian(DREff,R) Gauss linear orthogonal;
+    laplacian(DomegaEff,omega) Gauss linear orthogonal;
+    laplacian((rho*(1|A(U))),p) Gauss linear orthogonal;
+    laplacian(alphaEff,h) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -63,7 +63,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         corrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/compressible/sonicFoam/laminar/shockTube/system/fvSchemes b/tutorials/compressible/sonicFoam/laminar/shockTube/system/fvSchemes
index b4cf8d2e38..616ee4aa1b 100644
--- a/tutorials/compressible/sonicFoam/laminar/shockTube/system/fvSchemes
+++ b/tutorials/compressible/sonicFoam/laminar/shockTube/system/fvSchemes
@@ -40,9 +40,9 @@ divSchemes
 laplacianSchemes
 {
     default         none;
-    laplacian((rho*(1|A(U))),p) Gauss linear corrected;
-    laplacian(muEff,U) Gauss linear corrected;
-    laplacian(alphaEff,e) Gauss linear corrected;
+    laplacian((rho*(1|A(U))),p) Gauss linear orthogonal;
+    laplacian(muEff,U) Gauss linear orthogonal;
+    laplacian(alphaEff,e) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -52,7 +52,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         corrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/heatTransfer/buoyantSimpleFoam/buoyantCavity/system/fvSchemes b/tutorials/heatTransfer/buoyantSimpleFoam/buoyantCavity/system/fvSchemes
index 02edc9816b..cdaadf4c30 100644
--- a/tutorials/heatTransfer/buoyantSimpleFoam/buoyantCavity/system/fvSchemes
+++ b/tutorials/heatTransfer/buoyantSimpleFoam/buoyantCavity/system/fvSchemes
@@ -39,12 +39,12 @@ divSchemes
 laplacianSchemes
 {
     default         none;
-    laplacian(muEff,U) Gauss linear uncorrected;
-    laplacian((rho*(1|A(U))),p_rgh) Gauss linear uncorrected;
-    laplacian(alphaEff,h) Gauss linear uncorrected;
-    laplacian(DkEff,k) Gauss linear uncorrected;
-    laplacian(DepsilonEff,epsilon) Gauss linear uncorrected;
-    laplacian(DomegaEff,omega) Gauss linear uncorrected;
+    laplacian(muEff,U) Gauss linear orthogonal;
+    laplacian((rho*(1|A(U))),p_rgh) Gauss linear orthogonal;
+    laplacian(alphaEff,h) Gauss linear orthogonal;
+    laplacian(DkEff,k) Gauss linear orthogonal;
+    laplacian(DepsilonEff,epsilon) Gauss linear orthogonal;
+    laplacian(DomegaEff,omega) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -54,7 +54,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         uncorrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/incompressible/icoFoam/cavity/system/fvSchemes b/tutorials/incompressible/icoFoam/cavity/system/fvSchemes
index b9f9c65223..c311eb8961 100644
--- a/tutorials/incompressible/icoFoam/cavity/system/fvSchemes
+++ b/tutorials/incompressible/icoFoam/cavity/system/fvSchemes
@@ -35,8 +35,8 @@ divSchemes
 laplacianSchemes
 {
     default         none;
-    laplacian(nu,U) Gauss linear corrected;
-    laplacian((1|A(U)),p) Gauss linear corrected;
+    laplacian(nu,U) Gauss linear orthogonal;
+    laplacian((1|A(U)),p) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -47,7 +47,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         corrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/incompressible/icoFoam/cavityClipped/system/fvSchemes b/tutorials/incompressible/icoFoam/cavityClipped/system/fvSchemes
index b9f9c65223..c311eb8961 100644
--- a/tutorials/incompressible/icoFoam/cavityClipped/system/fvSchemes
+++ b/tutorials/incompressible/icoFoam/cavityClipped/system/fvSchemes
@@ -35,8 +35,8 @@ divSchemes
 laplacianSchemes
 {
     default         none;
-    laplacian(nu,U) Gauss linear corrected;
-    laplacian((1|A(U)),p) Gauss linear corrected;
+    laplacian(nu,U) Gauss linear orthogonal;
+    laplacian((1|A(U)),p) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -47,7 +47,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         corrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/lagrangian/LTSReactingParcelFoam/counterFlowFlame2D/system/fvSchemes b/tutorials/lagrangian/LTSReactingParcelFoam/counterFlowFlame2D/system/fvSchemes
index 1718307504..58be93e54d 100644
--- a/tutorials/lagrangian/LTSReactingParcelFoam/counterFlowFlame2D/system/fvSchemes
+++ b/tutorials/lagrangian/LTSReactingParcelFoam/counterFlowFlame2D/system/fvSchemes
@@ -41,13 +41,13 @@ divSchemes
 
 laplacianSchemes
 {
-    default         Gauss linear uncorrected;
-    laplacian(muEff,U) Gauss linear uncorrected;
-    laplacian(mut,U) Gauss linear uncorrected;
-    laplacian(DkEff,k) Gauss linear uncorrected;
-    laplacian(DepsilonEff,epsilon) Gauss linear uncorrected;
-    laplacian((rho*(1|A(U))),p) Gauss linear uncorrected;
-    laplacian(alphaEff,h) Gauss linear uncorrected;
+    default         Gauss linear orthogonal;
+    laplacian(muEff,U) Gauss linear orthogonal;
+    laplacian(mut,U) Gauss linear orthogonal;
+    laplacian(DkEff,k) Gauss linear orthogonal;
+    laplacian(DepsilonEff,epsilon) Gauss linear orthogonal;
+    laplacian((rho*(1|A(U))),p) Gauss linear orthogonal;
+    laplacian(alphaEff,h) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -57,7 +57,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         uncorrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSchemes b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSchemes
index f2abd9112f..99d8f6e1c3 100644
--- a/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSchemes
+++ b/tutorials/lagrangian/coalChemistryFoam/simplifiedSiwek/system/fvSchemes
@@ -42,14 +42,14 @@ divSchemes
 
 laplacianSchemes
 {
-    default         Gauss linear corrected;
-    laplacian(muEff,U) Gauss linear corrected;
-    laplacian(mut,U) Gauss linear corrected;
-    laplacian(DkEff,k) Gauss linear corrected;
-    laplacian(DepsilonEff,epsilon) Gauss linear corrected;
-    laplacian(DREff,R) Gauss linear corrected;
-    laplacian((rho*(1|A(U))),p) Gauss linear corrected;
-    laplacian(alphaEff,hs) Gauss linear corrected;
+    default         Gauss linear orthogonal;
+    laplacian(muEff,U) Gauss linear orthogonal;
+    laplacian(mut,U) Gauss linear orthogonal;
+    laplacian(DkEff,k) Gauss linear orthogonal;
+    laplacian(DepsilonEff,epsilon) Gauss linear orthogonal;
+    laplacian(DREff,R) Gauss linear orthogonal;
+    laplacian((rho*(1|A(U))),p) Gauss linear orthogonal;
+    laplacian(alphaEff,hs) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -59,7 +59,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         corrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSchemes b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSchemes
index a74c78c1fc..f7d8cb9e59 100644
--- a/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSchemes
+++ b/tutorials/lagrangian/porousExplicitSourceReactingParcelFoam/parcelInBox/system/fvSchemes
@@ -42,7 +42,7 @@ divSchemes
 
 laplacianSchemes
 {
-    default         Gauss linear uncorrected;
+    default         Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -52,7 +52,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         uncorrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/fvSchemes b/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/fvSchemes
index 729ed886a0..da2e0b5250 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/fvSchemes
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/fvSchemes
@@ -41,7 +41,7 @@ divSchemes
 
 laplacianSchemes
 {
-    default         Gauss linear uncorrected;
+    default         Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -51,7 +51,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         uncorrected;
+    default         orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/wallFilmRegion/fvSchemes b/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/wallFilmRegion/fvSchemes
index 00bb295977..970936568e 100644
--- a/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/wallFilmRegion/fvSchemes
+++ b/tutorials/lagrangian/reactingParcelFilmFoam/rivuletPanel/system/wallFilmRegion/fvSchemes
@@ -48,14 +48,14 @@ gradSchemes
 laplacianSchemes
 {
     default none;
-    laplacian(sigmaf,deltaf) Gauss linear uncorrected;
-    laplacian(deltaCoeff,deltaf) Gauss linear uncorrected;
+    laplacian(sigmaf,deltaf) Gauss linear orthogonal;
+    laplacian(deltaCoeff,deltaf) Gauss linear orthogonal;
 }
 
 snGradSchemes
 {
-    snGrad(p) uncorrected;
-    snGrad(deltaf) uncorrected;
+    snGrad(p) orthogonal;
+    snGrad(deltaf) orthogonal;
 }
 
 fluxRequired
diff --git a/tutorials/lagrangian/sprayFoam/aachenBomb/system/fvSchemes b/tutorials/lagrangian/sprayFoam/aachenBomb/system/fvSchemes
index f2abd9112f..99d8f6e1c3 100644
--- a/tutorials/lagrangian/sprayFoam/aachenBomb/system/fvSchemes
+++ b/tutorials/lagrangian/sprayFoam/aachenBomb/system/fvSchemes
@@ -42,14 +42,14 @@ divSchemes
 
 laplacianSchemes
 {
-    default         Gauss linear corrected;
-    laplacian(muEff,U) Gauss linear corrected;
-    laplacian(mut,U) Gauss linear corrected;
-    laplacian(DkEff,k) Gauss linear corrected;
-    laplacian(DepsilonEff,epsilon) Gauss linear corrected;
-    laplacian(DREff,R) Gauss linear corrected;
-    laplacian((rho*(1|A(U))),p) Gauss linear corrected;
-    laplacian(alphaEff,hs) Gauss linear corrected;
+    default         Gauss linear orthogonal;
+    laplacian(muEff,U) Gauss linear orthogonal;
+    laplacian(mut,U) Gauss linear orthogonal;
+    laplacian(DkEff,k) Gauss linear orthogonal;
+    laplacian(DepsilonEff,epsilon) Gauss linear orthogonal;
+    laplacian(DREff,R) Gauss linear orthogonal;
+    laplacian((rho*(1|A(U))),p) Gauss linear orthogonal;
+    laplacian(alphaEff,hs) Gauss linear orthogonal;
 }
 
 interpolationSchemes
@@ -59,7 +59,7 @@ interpolationSchemes
 
 snGradSchemes
 {
-    default         corrected;
+    default         orthogonal;
 }
 
 fluxRequired

From 941be2803e1d78607a9202a6a608b68cf005cf44 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Mon, 19 Dec 2011 09:54:36 +0000
Subject: [PATCH 35/70] BUG: Copy constructor for coal surface reaction models
 had incomplete initialisation lists

---
 .../COxidationDiffusionLimitedRate.C                           | 3 ++-
 .../COxidationKineticDiffusionLimitedRate.C                    | 3 ++-
 .../COxidationMurphyShaddix/COxidationMurphyShaddix.C          | 3 ++-
 3 files changed, 6 insertions(+), 3 deletions(-)

diff --git a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationDiffusionLimitedRate/COxidationDiffusionLimitedRate.C b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationDiffusionLimitedRate/COxidationDiffusionLimitedRate.C
index 8a76313396..c7d80d6672 100644
--- a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationDiffusionLimitedRate/COxidationDiffusionLimitedRate.C
+++ b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationDiffusionLimitedRate/COxidationDiffusionLimitedRate.C
@@ -90,7 +90,8 @@ Foam::COxidationDiffusionLimitedRate<CloudType>::COxidationDiffusionLimitedRate
     O2GlobalId_(srm.O2GlobalId_),
     CO2GlobalId_(srm.CO2GlobalId_),
     WC_(srm.WC_),
-    WO2_(srm.WO2_)
+    WO2_(srm.WO2_),
+    HcCO2_(srm.HcCO2_)
 {}
 
 
diff --git a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationKineticDiffusionLimitedRate/COxidationKineticDiffusionLimitedRate.C b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationKineticDiffusionLimitedRate/COxidationKineticDiffusionLimitedRate.C
index c3d48a31f5..552a6caab7 100644
--- a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationKineticDiffusionLimitedRate/COxidationKineticDiffusionLimitedRate.C
+++ b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationKineticDiffusionLimitedRate/COxidationKineticDiffusionLimitedRate.C
@@ -81,7 +81,8 @@ COxidationKineticDiffusionLimitedRate
     O2GlobalId_(srm.O2GlobalId_),
     CO2GlobalId_(srm.CO2GlobalId_),
     WC_(srm.WC_),
-    WO2_(srm.WO2_)
+    WO2_(srm.WO2_),
+    HcCO2_(srm.HcCO2_)
 {}
 
 
diff --git a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationMurphyShaddix/COxidationMurphyShaddix.C b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationMurphyShaddix/COxidationMurphyShaddix.C
index ee7ee48c7a..24bdf4927b 100644
--- a/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationMurphyShaddix/COxidationMurphyShaddix.C
+++ b/src/lagrangian/coalCombustion/submodels/surfaceReactionModel/COxidationMurphyShaddix/COxidationMurphyShaddix.C
@@ -96,7 +96,8 @@ Foam::COxidationMurphyShaddix<CloudType>::COxidationMurphyShaddix
     O2GlobalId_(srm.O2GlobalId_),
     CO2GlobalId_(srm.CO2GlobalId_),
     WC_(srm.WC_),
-    WO2_(srm.WO2_)
+    WO2_(srm.WO2_),
+    HcCO2_(srm.HcCO2_)
 {}
 
 

From f80b3a793abec398078b7500873f816f484e8edf Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 20 Dec 2011 09:09:51 +0000
Subject: [PATCH 36/70] ENH: nonBlockingGaussSmoother: block as late as
 possible.

renumberMesh: option for sorting proc cells last to benefit from this.
---
 .../manipulation/renumberMesh/renumberMesh.C  | 172 +++++++----
 .../renumberMesh/renumberMeshDict             |  17 ++
 src/OpenFOAM/Make/files                       |   1 +
 .../nonBlockingGaussSeidelSmoother.C          | 266 ++++++++++++++++++
 .../nonBlockingGaussSeidelSmoother.H          | 120 ++++++++
 5 files changed, 524 insertions(+), 52 deletions(-)
 create mode 100644 src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.C
 create mode 100644 src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.H

diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
index a8c18c0712..7e090fa30e 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
+++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
@@ -464,23 +464,6 @@ int main(int argc, char *argv[])
         "Renumber mesh to minimise bandwidth"
     );
 
-    argList::addOption
-    (
-        "blockSize",
-        "block size",
-        "order cells into blocks (using decomposition) before ordering"
-    );
-    argList::addBoolOption
-    (
-        "orderPoints",
-        "order points into internal and boundary points"
-    );
-    argList::addBoolOption
-    (
-        "writeMaps",
-        "write cellMap, faceMap, pointMap in polyMesh/"
-    );
-
 #   include "addRegionOption.H"
 #   include "addOverwriteOption.H"
 #   include "addTimeOptions.H"
@@ -507,41 +490,6 @@ int main(int argc, char *argv[])
 
     const bool readDict = args.optionFound("dict");
 
-
-    label blockSize = 0;
-    args.optionReadIfPresent("blockSize", blockSize, 0);
-
-    if (blockSize > 0)
-    {
-        Info<< "Ordering cells into regions of size " << blockSize
-            << " (using decomposition);"
-            << " ordering faces into region-internal and region-external." << nl
-            << endl;
-
-        if (blockSize < 0 || blockSize >= mesh.nCells())
-        {
-            FatalErrorIn(args.executable())
-                << "Block size " << blockSize << " should be positive integer"
-                << " and less than the number of cells in the mesh."
-                << exit(FatalError);
-        }
-    }
-
-    const bool orderPoints = args.optionFound("orderPoints");
-    if (orderPoints)
-    {
-        Info<< "Ordering points into internal and boundary points." << nl
-            << endl;
-    }
-
-    const bool writeMaps = args.optionFound("writeMaps");
-
-    if (writeMaps)
-    {
-        Info<< "Writing renumber maps (new to old) to polyMesh." << nl
-            << endl;
-    }
-
     const bool overwrite = args.optionFound("overwrite");
 
     label band = getBand(mesh.faceOwner(), mesh.faceNeighbour());
@@ -551,6 +499,11 @@ int main(int argc, char *argv[])
         << returnReduce(band, maxOp<label>()) << nl << endl;
 
 
+    bool sortCoupledFaceCells = false;
+    bool writeMaps = false;
+    bool orderPoints = false;
+    label blockSize = 0;
+
     // Construct renumberMethod
     autoPtr<renumberMethod> renumberPtr;
 
@@ -571,6 +524,51 @@ int main(int argc, char *argv[])
         );
 
         renumberPtr = renumberMethod::New(renumberDict);
+
+
+        sortCoupledFaceCells = renumberDict.lookupOrDefault
+        (
+            "sortCoupledFaceCells",
+            false
+        );
+        if (sortCoupledFaceCells)
+        {
+            Info<< "Sorting cells on coupled boundaries to be last." << nl
+                << endl;
+        }
+
+        blockSize = renumberDict.lookupOrDefault("blockSize", 0);
+        if (blockSize > 0)
+        {
+            Info<< "Ordering cells into regions of size " << blockSize
+                << " (using decomposition);"
+                << " ordering faces into region-internal and region-external."
+                << nl << endl;
+
+            if (blockSize < 0 || blockSize >= mesh.nCells())
+            {
+                FatalErrorIn(args.executable())
+                    << "Block size " << blockSize
+                    << " should be positive integer"
+                    << " and less than the number of cells in the mesh."
+                    << exit(FatalError);
+            }
+        }
+
+        orderPoints = renumberDict.lookupOrDefault("orderPoints", false);
+        if (orderPoints)
+        {
+            Info<< "Ordering points into internal and boundary points." << nl
+                << endl;
+        }
+
+        writeMaps = readLabel(renumberDict.lookup("writeMaps"));
+        if (writeMaps)
+        {
+            Info<< "Writing renumber maps (new to old) to polyMesh." << nl
+                << endl;
+        }
+
     }
     else
     {
@@ -765,6 +763,76 @@ int main(int argc, char *argv[])
 
         cellOrder = invert(mesh.nCells(), reverseCellOrder);
 
+
+        if (sortCoupledFaceCells)
+        {
+            // Change order so all coupled patch faceCells are at the end.
+            const polyBoundaryMesh& pbm = mesh.boundaryMesh();
+
+            // Collect all boundary cells on coupled patches
+            label nBndCells = 0;
+            forAll(pbm, patchI)
+            {
+                if (pbm[patchI].coupled())
+                {
+                    nBndCells += pbm[patchI].size();
+                }
+            }
+
+            labelList bndCellMap(nBndCells);
+            labelList bndCells(bndCellMap);
+            nBndCells = 0;
+            forAll(pbm, patchI)
+            {
+                if (pbm[patchI].coupled())
+                {
+                    const labelUList& faceCells = pbm[patchI].faceCells();
+                    forAll(faceCells, i)
+                    {
+                        label cellI = faceCells[i];
+                        bndCells[nBndCells] = cellI;
+                        bndCellMap[nBndCells++] = reverseCellOrder[cellI];
+                    }
+                }
+            }
+            bndCells.setSize(nBndCells);
+            bndCellMap.setSize(nBndCells);
+
+
+            // Sort
+            labelList order;
+            sortedOrder(bndCellMap, order);
+
+            // Redo newReverseCellOrder
+            labelList newReverseCellOrder(mesh.nCells(), -1);
+
+            label sortedI = mesh.nCells();
+            forAllReverse(order, i)
+            {
+                label origCellI = bndCells[order[i]];
+                newReverseCellOrder[origCellI] = --sortedI;
+            }
+
+            Info<< "Ordered all " << nBndCells << " cells with a coupled face"
+                << "  to the end of the cell list, starting at " << sortedI
+                << endl;
+
+            // Compact
+            sortedI = 0;
+            forAll(cellOrder, newCellI)
+            {
+                label origCellI = cellOrder[newCellI];
+                if (newReverseCellOrder[origCellI] == -1)
+                {
+                    newReverseCellOrder[origCellI] = sortedI++;
+                }
+            }
+
+            // Update sorted back to original (unsorted) map
+            cellOrder = invert(mesh.nCells(), newReverseCellOrder);
+        }
+
+
         // Determine new to old face order with new cell numbering
         faceOrder = getFaceOrder
         (
diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict b/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict
index 7ff33fc530..a852fad7db 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict
+++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict
@@ -15,6 +15,23 @@ FoamFile
 }
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
+// Write maps from renumbered back to original mesh
+writeMaps true;
+
+// Optional entry: sort cells on coupled boundaries to last for use with
+// e.g. nonBlockingGaussSeidel.
+sortCoupledFaceCells false;
+
+// Optional entry: renumber on a block-by-block basis. This can be used on
+// large cases to keep the blocks fitting in cache with all the the cache
+// missed bunched at the end.
+//blockSize 0;
+
+// Optional entry: sort points into internal and boundary points
+//orderPoints false;
+
+
+
 method          CuthillMcKee;
 //method          manual;
 //method          random;
diff --git a/src/OpenFOAM/Make/files b/src/OpenFOAM/Make/files
index cbd9888573..4bab8ad32a 100644
--- a/src/OpenFOAM/Make/files
+++ b/src/OpenFOAM/Make/files
@@ -250,6 +250,7 @@ $(lduMatrix)/solvers/ICCG/ICCG.C
 $(lduMatrix)/solvers/BICCG/BICCG.C
 
 $(lduMatrix)/smoothers/GaussSeidel/GaussSeidelSmoother.C
+$(lduMatrix)/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.C
 $(lduMatrix)/smoothers/DIC/DICSmoother.C
 $(lduMatrix)/smoothers/DICGaussSeidel/DICGaussSeidelSmoother.C
 $(lduMatrix)/smoothers/DILU/DILUSmoother.C
diff --git a/src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.C b/src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.C
new file mode 100644
index 0000000000..77c1ba5430
--- /dev/null
+++ b/src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.C
@@ -0,0 +1,266 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "nonBlockingGaussSeidelSmoother.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(nonBlockingGaussSeidelSmoother, 0);
+
+    lduMatrix::smoother::
+    addsymMatrixConstructorToTable<nonBlockingGaussSeidelSmoother>
+        addnonBlockingGaussSeidelSmootherSymMatrixConstructorToTable_;
+
+    lduMatrix::smoother::
+    addasymMatrixConstructorToTable<nonBlockingGaussSeidelSmoother>
+        addnonBlockingGaussSeidelSmootherAsymMatrixConstructorToTable_;
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::nonBlockingGaussSeidelSmoother::nonBlockingGaussSeidelSmoother
+(
+    const word& fieldName,
+    const lduMatrix& matrix,
+    const FieldField<Field, scalar>& interfaceBouCoeffs,
+    const FieldField<Field, scalar>& interfaceIntCoeffs,
+    const lduInterfaceFieldPtrsList& interfaces
+)
+:
+    lduMatrix::smoother
+    (
+        fieldName,
+        matrix,
+        interfaceBouCoeffs,
+        interfaceIntCoeffs,
+        interfaces
+    )
+{
+    // Check that all interface addressing is sorted to be after the
+    // non-interface addressing.
+
+    register const label nCells = matrix.diag().size();
+
+    blockStart_ = nCells;
+
+    labelList startCellI(interfaceBouCoeffs.size(), -1);
+    forAll(interfaces, patchi)
+    {
+        if (interfaces.set(patchi))
+        {
+            const labelUList& faceCells = matrix_.lduAddr().patchAddr(patchi);
+
+            blockStart_ = min(blockStart_, min(faceCells));
+        }
+    }
+
+    if (debug)
+    {
+        Pout<< "nonBlockingGaussSeidelSmoother :"
+            << " Starting block on cell " << blockStart_
+            << " out of " << nCells << endl;
+    }
+}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+void Foam::nonBlockingGaussSeidelSmoother::smooth
+(
+    const word& fieldName_,
+    scalarField& psi,
+    const lduMatrix& matrix_,
+    const label blockStart,
+    const scalarField& source,
+    const FieldField<Field, scalar>& interfaceBouCoeffs_,
+    const lduInterfaceFieldPtrsList& interfaces_,
+    const direction cmpt,
+    const label nSweeps
+)
+{
+    register scalar* __restrict__ psiPtr = psi.begin();
+
+    register const label nCells = psi.size();
+
+    scalarField bPrime(nCells);
+    register scalar* __restrict__ bPrimePtr = bPrime.begin();
+
+    register const scalar* const __restrict__ diagPtr = matrix_.diag().begin();
+    register const scalar* const __restrict__ upperPtr =
+        matrix_.upper().begin();
+    register const scalar* const __restrict__ lowerPtr =
+        matrix_.lower().begin();
+
+    register const label* const __restrict__ uPtr =
+        matrix_.lduAddr().upperAddr().begin();
+
+    register const label* const __restrict__ ownStartPtr =
+        matrix_.lduAddr().ownerStartAddr().begin();
+
+    // Parallel boundary initialisation.  The parallel boundary is treated
+    // as an effective jacobi interface in the boundary.
+    // Note: there is a change of sign in the coupled
+    // interface update.  The reason for this is that the
+    // internal coefficients are all located at the l.h.s. of
+    // the matrix whereas the "implicit" coefficients on the
+    // coupled boundaries are all created as if the
+    // coefficient contribution is of a source-kind (i.e. they
+    // have a sign as if they are on the r.h.s. of the matrix.
+    // To compensate for this, it is necessary to turn the
+    // sign of the contribution.
+
+    FieldField<Field, scalar>& mBouCoeffs =
+        const_cast<FieldField<Field, scalar>&>
+        (
+            interfaceBouCoeffs_
+        );
+    forAll(mBouCoeffs, patchi)
+    {
+        if (interfaces_.set(patchi))
+        {
+            mBouCoeffs[patchi].negate();
+        }
+    }
+
+    for (label sweep=0; sweep<nSweeps; sweep++)
+    {
+        bPrime = source;
+
+        matrix_.initMatrixInterfaces
+        (
+            mBouCoeffs,
+            interfaces_,
+            psi,
+            bPrime,
+            cmpt
+        );
+
+        register scalar curPsi;
+        register label fStart;
+        register label fEnd = ownStartPtr[0];
+
+        for (register label cellI=0; cellI<blockStart; cellI++)
+        {
+            // Start and end of this row
+            fStart = fEnd;
+            fEnd = ownStartPtr[cellI + 1];
+
+            // Get the accumulated neighbour side
+            curPsi = bPrimePtr[cellI];
+
+            // Accumulate the owner product side
+            for (register label curFace=fStart; curFace<fEnd; curFace++)
+            {
+                curPsi -= upperPtr[curFace]*psiPtr[uPtr[curFace]];
+            }
+
+            // Finish current psi
+            curPsi /= diagPtr[cellI];
+
+            // Distribute the neighbour side using current psi
+            for (register label curFace=fStart; curFace<fEnd; curFace++)
+            {
+                bPrimePtr[uPtr[curFace]] -= lowerPtr[curFace]*curPsi;
+            }
+
+            psiPtr[cellI] = curPsi;
+        }
+
+        matrix_.updateMatrixInterfaces
+        (
+            mBouCoeffs,
+            interfaces_,
+            psi,
+            bPrime,
+            cmpt
+        );
+
+        // Update rest of the cells
+        for (label cellI=blockStart; cellI < nCells; cellI++)
+        {
+            // Start and end of this row
+            fStart = fEnd;
+            fEnd = ownStartPtr[cellI + 1];
+
+            // Get the accumulated neighbour side
+            curPsi = bPrimePtr[cellI];
+
+            // Accumulate the owner product side
+            for (register label curFace=fStart; curFace<fEnd; curFace++)
+            {
+                curPsi -= upperPtr[curFace]*psiPtr[uPtr[curFace]];
+            }
+
+            // Finish current psi
+            curPsi /= diagPtr[cellI];
+
+            // Distribute the neighbour side using current psi
+            for (register label curFace=fStart; curFace<fEnd; curFace++)
+            {
+                bPrimePtr[uPtr[curFace]] -= lowerPtr[curFace]*curPsi;
+            }
+
+            psiPtr[cellI] = curPsi;
+        }
+    }
+
+    // Restore interfaceBouCoeffs_
+    forAll(mBouCoeffs, patchi)
+    {
+        if (interfaces_.set(patchi))
+        {
+            mBouCoeffs[patchi].negate();
+        }
+    }
+}
+
+
+void Foam::nonBlockingGaussSeidelSmoother::smooth
+(
+    scalarField& psi,
+    const scalarField& source,
+    const direction cmpt,
+    const label nSweeps
+) const
+{
+    smooth
+    (
+        fieldName_,
+        psi,
+        matrix_,
+        blockStart_,
+        source,
+        interfaceBouCoeffs_,
+        interfaces_,
+        cmpt,
+        nSweeps
+    );
+}
+
+
+// ************************************************************************* //
diff --git a/src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.H b/src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.H
new file mode 100644
index 0000000000..0562d875cf
--- /dev/null
+++ b/src/OpenFOAM/matrices/lduMatrix/smoothers/nonBlockingGaussSeidel/nonBlockingGaussSeidelSmoother.H
@@ -0,0 +1,120 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::nonBlockingGaussSeidelSmoother
+
+Description
+    Variant of gaussSeidelSmoother that expects processor boundary
+    cells to be sorted last and so can block later. Only when the
+    cells are actually visited does it need the results to be present.
+    It is expected that there is little benefit to be gained from doing
+    this on a patch by patch basis since the number of processor interfaces
+    is quite small and the overhead of checking whether a processor interface
+    is finished might be quite high (call into mpi). Also this would
+    require a dynamic memory allocation to store the state of the outstanding
+    requests.
+
+SourceFiles
+    nonBlockingGaussSeidelSmoother.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef nonBlockingGaussSeidelSmoother_H
+#define nonBlockingGaussSeidelSmoother_H
+
+#include "lduMatrix.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class nonBlockingGaussSeidelSmoother Declaration
+\*---------------------------------------------------------------------------*/
+
+class nonBlockingGaussSeidelSmoother
+:
+    public lduMatrix::smoother
+{
+    // Private data
+
+        //- Starting cell when to block
+        label blockStart_;
+
+public:
+
+    //- Runtime type information
+    TypeName("nonBlockingGaussSeidel");
+
+
+    // Constructors
+
+        //- Construct from components
+        nonBlockingGaussSeidelSmoother
+        (
+            const word& fieldName,
+            const lduMatrix& matrix,
+            const FieldField<Field, scalar>& interfaceBouCoeffs,
+            const FieldField<Field, scalar>& interfaceIntCoeffs,
+            const lduInterfaceFieldPtrsList& interfaces
+        );
+
+
+    // Member Functions
+
+        //- Smooth for the given number of sweeps
+        static void smooth
+        (
+            const word& fieldName,
+            scalarField& psi,
+            const lduMatrix& matrix,
+            const label blockStart,
+            const scalarField& source,
+            const FieldField<Field, scalar>& interfaceBouCoeffs,
+            const lduInterfaceFieldPtrsList& interfaces,
+            const direction cmpt,
+            const label nSweeps
+        );
+
+        //- Smooth the solution for a given number of sweeps
+        virtual void smooth
+        (
+            scalarField& psi,
+            const scalarField& Source,
+            const direction cmpt,
+            const label nSweeps
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

From d48da0cfacf2402f6c568bdee82b4f430750aecd Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 20 Dec 2011 09:36:53 +0000
Subject: [PATCH 37/70] ENH: GaussSeidelSmoother: avoid memory allocation - use
 in-place negation

---
 .../GaussSeidel/GaussSeidelSmoother.C         | 28 +++++++++++++++++--
 1 file changed, 25 insertions(+), 3 deletions(-)

diff --git a/src/OpenFOAM/matrices/lduMatrix/smoothers/GaussSeidel/GaussSeidelSmoother.C b/src/OpenFOAM/matrices/lduMatrix/smoothers/GaussSeidel/GaussSeidelSmoother.C
index 842771aed6..b0cb88ed6e 100644
--- a/src/OpenFOAM/matrices/lduMatrix/smoothers/GaussSeidel/GaussSeidelSmoother.C
+++ b/src/OpenFOAM/matrices/lduMatrix/smoothers/GaussSeidel/GaussSeidelSmoother.C
@@ -107,16 +107,29 @@ void Foam::GaussSeidelSmoother::smooth
     // To compensate for this, it is necessary to turn the
     // sign of the contribution.
 
-    FieldField<Field, scalar> mBouCoeffs(interfaceBouCoeffs_.size());
-
+    //FieldField<Field, scalar> mBouCoeffs(interfaceBouCoeffs_.size());
+    //
+    //forAll(mBouCoeffs, patchi)
+    //{
+    //    if (interfaces_.set(patchi))
+    //    {
+    //        mBouCoeffs.set(patchi, -interfaceBouCoeffs_[patchi]);
+    //    }
+    //}
+    FieldField<Field, scalar>& mBouCoeffs =
+        const_cast<FieldField<Field, scalar>&>
+        (
+            interfaceBouCoeffs_
+        );
     forAll(mBouCoeffs, patchi)
     {
         if (interfaces_.set(patchi))
         {
-            mBouCoeffs.set(patchi, -interfaceBouCoeffs_[patchi]);
+            mBouCoeffs[patchi].negate();
         }
     }
 
+
     for (label sweep=0; sweep<nSweeps; sweep++)
     {
         bPrime = source;
@@ -170,6 +183,15 @@ void Foam::GaussSeidelSmoother::smooth
             psiPtr[cellI] = curPsi;
         }
     }
+
+    // Restore interfaceBouCoeffs_
+    forAll(mBouCoeffs, patchi)
+    {
+        if (interfaces_.set(patchi))
+        {
+            mBouCoeffs[patchi].negate();
+        }
+    }
 }
 
 

From a479a295716fd6216c47e9606a77e8018c1e20b4 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 20 Dec 2011 10:25:49 +0000
Subject: [PATCH 38/70] BUG: Corrected reference to tmp in incompressible RAS
 models (mantis #360)

---
 .../kappatJayatillekeWallFunctionFvPatchScalarField.C     | 4 +++-
 .../nutURoughWallFunctionFvPatchScalarField.C             | 8 ++++++--
 .../nutUSpaldingWallFunctionFvPatchScalarField.C          | 8 ++++++--
 .../nutUTabulatedWallFunctionFvPatchScalarField.C         | 8 ++++++--
 .../nutUWallFunction/nutUWallFunctionFvPatchScalarField.C | 8 ++++++--
 .../nutkRoughWallFunctionFvPatchScalarField.C             | 4 +++-
 .../nutkWallFunction/nutkWallFunctionFvPatchScalarField.C | 8 ++++++--
 7 files changed, 36 insertions(+), 12 deletions(-)

diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/kappatWallFunctions/kappatJayatillekeWallFunction/kappatJayatillekeWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/kappatWallFunctions/kappatJayatillekeWallFunction/kappatJayatillekeWallFunctionFvPatchScalarField.C
index 96bc358621..917c65ca5f 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/kappatWallFunctions/kappatJayatillekeWallFunction/kappatJayatillekeWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/kappatWallFunctions/kappatJayatillekeWallFunction/kappatJayatillekeWallFunctionFvPatchScalarField.C
@@ -207,7 +207,9 @@ void kappatJayatillekeWallFunctionFvPatchScalarField::updateCoeffs()
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const scalar Cmu25 = pow(Cmu_, 0.25);
     const scalarField& y = rasModel.y()[patchI];
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
     const tmp<volScalarField> tk = rasModel.k();
     const volScalarField& k = tk();
 
diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutURoughWallFunction/nutURoughWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutURoughWallFunction/nutURoughWallFunctionFvPatchScalarField.C
index 51dabb01fd..41f7c926d3 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutURoughWallFunction/nutURoughWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutURoughWallFunction/nutURoughWallFunctionFvPatchScalarField.C
@@ -47,7 +47,9 @@ tmp<scalarField> nutURoughWallFunctionFvPatchScalarField::calcNut() const
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const scalarField& y = rasModel.y()[patchI];
     const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI];
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     // The flow velocity at the adjacent cell centre
     const scalarField magUp(mag(Uw.patchInternalField() - Uw));
@@ -80,7 +82,9 @@ tmp<scalarField> nutURoughWallFunctionFvPatchScalarField::calcYPlus
 
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const scalarField& y = rasModel.y()[patchI];
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     tmp<scalarField> tyPlus(new scalarField(patch().size(), 0.0));
     scalarField& yPlus = tyPlus();
diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUSpaldingWallFunction/nutUSpaldingWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUSpaldingWallFunction/nutUSpaldingWallFunctionFvPatchScalarField.C
index 37b641ebcd..93b6376601 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUSpaldingWallFunction/nutUSpaldingWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUSpaldingWallFunction/nutUSpaldingWallFunctionFvPatchScalarField.C
@@ -47,7 +47,9 @@ tmp<scalarField> nutUSpaldingWallFunctionFvPatchScalarField::calcNut() const
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI];
     const scalarField magGradU(mag(Uw.snGrad()));
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     return max
     (
@@ -181,7 +183,9 @@ tmp<scalarField> nutUSpaldingWallFunctionFvPatchScalarField::yPlus() const
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const scalarField& y = rasModel.y()[patchI];
     const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI];
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     return y*calcUTau(mag(Uw.snGrad()))/nuw;
 }
diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUTabulatedWallFunction/nutUTabulatedWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUTabulatedWallFunction/nutUTabulatedWallFunctionFvPatchScalarField.C
index 2ed3f35c95..4bb2c1ea19 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUTabulatedWallFunction/nutUTabulatedWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUTabulatedWallFunction/nutUTabulatedWallFunctionFvPatchScalarField.C
@@ -49,7 +49,9 @@ tmp<scalarField> nutUTabulatedWallFunctionFvPatchScalarField::calcNut() const
     const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI];
     const scalarField magUp(mag(Uw.patchInternalField() - Uw));
     const scalarField magGradU(mag(Uw.snGrad()));
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     return
         max
@@ -182,7 +184,9 @@ tmp<scalarField> nutUTabulatedWallFunctionFvPatchScalarField::yPlus() const
     const scalarField& y = rasModel.y()[patchI];
     const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI];
     const scalarField magUp(mag(Uw.patchInternalField() - Uw));
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
     const scalarField Rey(magUp*y/nuw);
 
     return Rey/(calcUPlus(Rey) + ROOTVSMALL);
diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUWallFunction/nutUWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUWallFunction/nutUWallFunctionFvPatchScalarField.C
index ce150094c8..77fc20e46a 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUWallFunction/nutUWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutUWallFunction/nutUWallFunctionFvPatchScalarField.C
@@ -47,7 +47,9 @@ tmp<scalarField> nutUWallFunctionFvPatchScalarField::calcNut() const
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const fvPatchVectorField& Uw = rasModel.U().boundaryField()[patchI];
     const scalarField magUp(mag(Uw.patchInternalField() - Uw));
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     tmp<scalarField> tyPlus = calcYPlus(magUp);
     scalarField& yPlus = tyPlus();
@@ -77,7 +79,9 @@ tmp<scalarField> nutUWallFunctionFvPatchScalarField::calcYPlus
 
     const RASModel& rasModel = db().lookupObject<RASModel>("RASProperties");
     const scalarField& y = rasModel.y()[patchI];
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     tmp<scalarField> tyPlus(new scalarField(patch().size(), 0.0));
     scalarField& yPlus = tyPlus();
diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.C
index 893c3aa977..9dc82a03ad 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkRoughWallFunction/nutkRoughWallFunctionFvPatchScalarField.C
@@ -71,7 +71,9 @@ tmp<scalarField> nutkRoughWallFunctionFvPatchScalarField::calcNut() const
     const scalarField& y = rasModel.y()[patchI];
     const tmp<volScalarField> tk = rasModel.k();
     const volScalarField& k = tk();
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     const scalar Cmu25 = pow025(Cmu_);
 
diff --git a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkWallFunction/nutkWallFunctionFvPatchScalarField.C b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkWallFunction/nutkWallFunctionFvPatchScalarField.C
index 8b7ed5cded..157b88731a 100644
--- a/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkWallFunction/nutkWallFunctionFvPatchScalarField.C
+++ b/src/turbulenceModels/incompressible/RAS/derivedFvPatchFields/wallFunctions/nutWallFunctions/nutkWallFunction/nutkWallFunctionFvPatchScalarField.C
@@ -80,7 +80,9 @@ tmp<scalarField> nutkWallFunctionFvPatchScalarField::calcNut() const
     const scalarField& y = rasModel.y()[patchI];
     const tmp<volScalarField> tk = rasModel.k();
     const volScalarField& k = tk();
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     const scalar Cmu25 = pow025(Cmu_);
 
@@ -220,7 +222,9 @@ tmp<scalarField> nutkWallFunctionFvPatchScalarField::yPlus() const
     const tmp<volScalarField> tk = rasModel.k();
     const volScalarField& k = tk();
     tmp<scalarField> kwc = k.boundaryField()[patchI].patchInternalField();
-    const scalarField& nuw = rasModel.nu()().boundaryField()[patchI];
+    const tmp<volScalarField> tnu = rasModel.nu();
+    const volScalarField& nu = tnu();
+    const scalarField& nuw = nu.boundaryField()[patchI];
 
     return pow025(Cmu_)*y*sqrt(kwc)/nuw;
 }

From b0e4892bb3f0dd8da1a28fccb7144cae47add5f6 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 20 Dec 2011 11:43:07 +0000
Subject: [PATCH 39/70] ENH: AMI - declaring functions const where appropriate

---
 .../AMIInterpolation/AMIInterpolation.C              | 12 ++++++------
 .../AMIInterpolation/AMIInterpolation.H              | 12 ++++++------
 2 files changed, 12 insertions(+), 12 deletions(-)

diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
index f2f1a764d7..bad15c8387 100644
--- a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
@@ -118,7 +118,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::checkPatches
 (
     const primitivePatch& srcPatch,
     const primitivePatch& tgtPatch
-)
+) const
 {
     const scalar maxBoundsError = 0.05;
 
@@ -188,7 +188,7 @@ Foam::label Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcDistribution
 (
     const primitivePatch& srcPatch,
     const primitivePatch& tgtPatch
-)
+) const
 {
     label procI = 0;
 
@@ -242,7 +242,7 @@ Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcOverlappingProcs
     const List<treeBoundBoxList>& procBb,
     const treeBoundBox& bb,
     boolList& overlaps
-)
+) const
 {
     overlaps.setSize(procBb.size());
     overlaps = false;
@@ -276,7 +276,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::distributePatches
     List<faceList>& faces,
     List<pointField>& points,
     List<labelList>& faceIDs
-)
+) const
 {
     PstreamBuffers pBufs(Pstream::nonBlocking);
 
@@ -373,7 +373,7 @@ distributeAndMergePatches
     faceList& tgtFaces,
     pointField& tgtPoints,
     labelList& tgtFaceIDs
-)
+) const
 {
     // Exchange per-processor data
     List<faceList> allFaces;
@@ -485,7 +485,7 @@ Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcProcMap
 (
     const primitivePatch& srcPatch,
     const primitivePatch& tgtPatch
-)
+) const
 {
     // Get decomposition of patch
     List<treeBoundBoxList> procBb(Pstream::nProcs());
diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
index ed62292430..45111f968e 100644
--- a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
@@ -187,7 +187,7 @@ class AMIInterpolation
             (
                 const primitivePatch& srcPatch,
                 const primitivePatch& tgtPatch
-            );
+            ) const;
 
             //- Reset the octree for the traget patch face search
             void resetTree(const primitivePatch& tgtPatch);
@@ -201,14 +201,14 @@ class AMIInterpolation
             (
                 const primitivePatch& srcPatch,
                 const primitivePatch& tgtPatch
-            );
+            ) const;
 
             label calcOverlappingProcs
             (
                 const List<treeBoundBoxList>& procBb,
                 const treeBoundBox& bb,
                 boolList& overlaps
-            );
+            ) const;
 
             void distributePatches
             (
@@ -218,7 +218,7 @@ class AMIInterpolation
                 List<faceList>& faces,
                 List<pointField>& points,
                 List<labelList>& tgtFaceIDs
-            );
+            ) const;
 
             void distributeAndMergePatches
             (
@@ -228,13 +228,13 @@ class AMIInterpolation
                 faceList& tgtFaces,
                 pointField& tgtPoints,
                 labelList& tgtFaceIDs
-            );
+            ) const;
 
             autoPtr<mapDistribute> calcProcMap
             (
                 const primitivePatch& srcPatch,
                 const primitivePatch& tgtPatch
-            );
+            ) const;
 
 
         // Initialisation

From f410060e38bbeb2d713edf70479248173c175b4b Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Tue, 20 Dec 2011 12:14:22 +0000
Subject: [PATCH 40/70] ENH: AMI - passing startSeedI into function instead of
 using member data

---
 .../AMIInterpolation/AMIInterpolation.C        | 18 +++++++++---------
 .../AMIInterpolation/AMIInterpolation.H        |  6 ++----
 2 files changed, 11 insertions(+), 13 deletions(-)

diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
index bad15c8387..3162fc3da6 100644
--- a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.C
@@ -764,6 +764,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::appendNbrFaces
 template<class SourcePatch, class TargetPatch>
 void Foam::AMIInterpolation<SourcePatch, TargetPatch>::setNextFaces
 (
+    label& startSeedI,
     label& srcFaceI,
     label& tgtFaceI,
     const primitivePatch& srcPatch0,
@@ -771,7 +772,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::setNextFaces
     const boolList& mapFlag,
     labelList& seedFaces,
     const DynamicList<label>& visitedFaces
-)
+) const
 {
 //    const labelList& srcNbrFaces = srcPatch0.pointFaces()[srcFaceI];
     const labelList& srcNbrFaces = srcPatch0.faceFaces()[srcFaceI];
@@ -815,13 +816,13 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::setNextFaces
     {
         // try to use existing seed
         bool foundNextSeed = false;
-        for (label faceI = startSeedI_; faceI < mapFlag.size(); faceI++)
+        for (label faceI = startSeedI; faceI < mapFlag.size(); faceI++)
         {
             if (mapFlag[faceI])
             {
                 if (!foundNextSeed)
                 {
-                    startSeedI_ = faceI;
+                    startSeedI = faceI;
                     foundNextSeed = true;
                 }
 
@@ -843,13 +844,13 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::setNextFaces
         }
 
 //        foundNextSeed = false;
-        for (label faceI = startSeedI_; faceI < mapFlag.size(); faceI++)
+        for (label faceI = startSeedI; faceI < mapFlag.size(); faceI++)
         {
             if (mapFlag[faceI])
             {
                 if (!foundNextSeed)
                 {
-                    startSeedI_ = faceI + 1;
+                    startSeedI = faceI + 1;
                     foundNextSeed = true;
                 }
 
@@ -867,6 +868,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::setNextFaces
         (
             "void Foam::cyclicAMIPolyPatch::setNextFaces"
             "("
+                "label&, "
                 "label&, "
                 "label&, "
                 "const primitivePatch&, "
@@ -1035,7 +1037,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcAddressing
     boolList mapFlag(nFacesRemaining, true);
 
     // reset starting seed
-    startSeedI_ = 0;
+    label startSeedI = 0;
 
     label nNonOverlap = 0;
     do
@@ -1086,6 +1088,7 @@ void Foam::AMIInterpolation<SourcePatch, TargetPatch>::calcAddressing
         {
             setNextFaces
             (
+                startSeedI,
                 srcFaceI,
                 tgtFaceI,
                 srcPatch,
@@ -1453,7 +1456,6 @@ Foam::AMIInterpolation<SourcePatch, TargetPatch>::AMIInterpolation
     tgtAddress_(),
     tgtWeights_(),
     treePtr_(NULL),
-    startSeedI_(0),
     triMode_(triMode),
     srcMapPtr_(NULL),
     tgtMapPtr_(NULL)
@@ -1486,7 +1488,6 @@ Foam::AMIInterpolation<SourcePatch, TargetPatch>::AMIInterpolation
     tgtAddress_(),
     tgtWeights_(),
     treePtr_(NULL),
-    startSeedI_(0),
     triMode_(triMode),
     srcMapPtr_(NULL),
     tgtMapPtr_(NULL)
@@ -1574,7 +1575,6 @@ Foam::AMIInterpolation<SourcePatch, TargetPatch>::AMIInterpolation
     tgtAddress_(),
     tgtWeights_(),
     treePtr_(NULL),
-    startSeedI_(0),
     triMode_(fineAMI.triMode_),
     srcMapPtr_(NULL),
     tgtMapPtr_(NULL)
diff --git a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
index 45111f968e..52d5b0787f 100644
--- a/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
+++ b/src/meshTools/AMIInterpolation/AMIInterpolation/AMIInterpolation.H
@@ -148,9 +148,6 @@ class AMIInterpolation
         //- Octree used to find face seeds
         autoPtr<indexedOctree<treeType> > treePtr_;
 
-        //- Starting face seed index
-        label startSeedI_;
-
         //- Face triangulation mode
         const faceAreaIntersect::triangulationMode triMode_;
 
@@ -268,6 +265,7 @@ class AMIInterpolation
             //- Set the source and target seed faces
             void setNextFaces
             (
+                label& startSeedI,
                 label& srcFaceI,
                 label& tgtFaceI,
                 const primitivePatch& srcPatch0,
@@ -275,7 +273,7 @@ class AMIInterpolation
                 const boolList& mapFlag,
                 labelList& seedFaces,
                 const DynamicList<label>& visitedFaces
-            );
+            ) const;
 
 
         // Evaluation

From 5dfb0347c79dc3f5a107b2c8dea56597a644b01e Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Tue, 20 Dec 2011 15:22:24 +0000
Subject: [PATCH 41/70] BUG: cyclicPolyPatch: incorrect transformation if
 rotation

---
 .../polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C  | 4 ++--
 1 file changed, 2 insertions(+), 2 deletions(-)

diff --git a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C
index 3cab9fa50c..84fd20affc 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C
+++ b/src/OpenFOAM/meshes/polyMesh/polyPatches/constraint/cyclic/cyclicPolyPatch.C
@@ -266,7 +266,7 @@ void Foam::cyclicPolyPatch::calcTransforms
             // Calculate using the given rotation axis and centre. Do not
             // use calculated normals.
             vector n0 = findFaceMaxRadius(half0Ctrs);
-            vector n1 = findFaceMaxRadius(half1Ctrs);
+            vector n1 = -findFaceMaxRadius(half1Ctrs);
             n0 /= mag(n0) + VSMALL;
             n1 /= mag(n1) + VSMALL;
 
@@ -424,7 +424,7 @@ void Foam::cyclicPolyPatch::getCentresAndAnchors
         case ROTATIONAL:
         {
             vector n0 = findFaceMaxRadius(half0Ctrs);
-            vector n1 = findFaceMaxRadius(half1Ctrs);
+            vector n1 = -findFaceMaxRadius(half1Ctrs);
             n0 /= mag(n0) + VSMALL;
             n1 /= mag(n1) + VSMALL;
 

From b16e058221bb024f0395af6f1838b75de0699f92 Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 21 Dec 2011 10:16:33 +0000
Subject: [PATCH 42/70] MRFZoneTemplates: Call internalField on phi to ensure
 the old-time value is stored for ddtPhiCorr

---
 .../cfdTools/general/MRF/MRFZoneTemplates.C          | 12 ++++++++++--
 1 file changed, 10 insertions(+), 2 deletions(-)

diff --git a/src/finiteVolume/cfdTools/general/MRF/MRFZoneTemplates.C b/src/finiteVolume/cfdTools/general/MRF/MRFZoneTemplates.C
index 55821dbfde..23cae40603 100644
--- a/src/finiteVolume/cfdTools/general/MRF/MRFZoneTemplates.C
+++ b/src/finiteVolume/cfdTools/general/MRF/MRFZoneTemplates.C
@@ -44,11 +44,15 @@ void Foam::MRFZone::relativeRhoFlux
     const vector& origin = origin_.value();
     const vector& Omega = Omega_.value();
 
+    const vectorField& Cfi = Cf.internalField();
+    const vectorField& Sfi = Sf.internalField();
+    scalarField& phii = phi.internalField();
+
     // Internal faces
     forAll(internalFaces_, i)
     {
         label facei = internalFaces_[i];
-        phi[facei] -= rho[facei]*(Omega ^ (Cf[facei] - origin)) & Sf[facei];
+        phii[facei] -= rho[facei]*(Omega ^ (Cfi[facei] - origin)) & Sfi[facei];
     }
 
     // Included patches
@@ -91,11 +95,15 @@ void Foam::MRFZone::absoluteRhoFlux
     const vector& origin = origin_.value();
     const vector& Omega = Omega_.value();
 
+    const vectorField& Cfi = Cf.internalField();
+    const vectorField& Sfi = Sf.internalField();
+    scalarField& phii = phi.internalField();
+
     // Internal faces
     forAll(internalFaces_, i)
     {
         label facei = internalFaces_[i];
-        phi[facei] += rho[facei]*(Omega ^ (Cf[facei] - origin)) & Sf[facei];
+        phii[facei] += rho[facei]*(Omega ^ (Cfi[facei] - origin)) & Sfi[facei];
     }
 
     // Included patches

From 7b7fe8cf0a9a803c2a533d530c5c0d5772b70a10 Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 21 Dec 2011 10:18:53 +0000
Subject: [PATCH 43/70] multiphaseEulerFoam phaseModel : Correct re-reading of
 dictionary entries

---
 .../phaseModel/phaseModel/phaseModel.C                    | 8 ++++----
 1 file changed, 4 insertions(+), 4 deletions(-)

diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/phaseModel/phaseModel/phaseModel.C b/applications/solvers/multiphase/multiphaseEulerFoam/phaseModel/phaseModel/phaseModel.C
index bf65fe659c..543927e29b 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/phaseModel/phaseModel/phaseModel.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/phaseModel/phaseModel/phaseModel.C
@@ -212,10 +212,10 @@ bool Foam::phaseModel::read(const dictionary& phaseDict)
 
     //if (nuModel_->read(phaseDict_))
     {
-        phaseDict_.lookup("nu") >> nu_;
-        phaseDict_.lookup("kappa") >> kappa_;
-        phaseDict_.lookup("Cp") >> Cp_;
-        phaseDict_.lookup("rho") >> rho_;
+        phaseDict_.lookup("nu") >> nu_.value();
+        phaseDict_.lookup("kappa") >> kappa_.value();
+        phaseDict_.lookup("Cp") >> Cp_.value();
+        phaseDict_.lookup("rho") >> rho_.value();
 
         return true;
     }

From 014c92982afeb4b22f7fe6491d9733a8ec0ef8ac Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 21 Dec 2011 10:20:35 +0000
Subject: [PATCH 44/70] multiphaseEulerFoam damBreak4phase tutorial: improved
 transport settings

---
 .../constant/transportProperties              | 125 +++++++++++++++++-
 .../damBreak4phaseFine/system/controlDict     |   2 +-
 2 files changed, 119 insertions(+), 8 deletions(-)

diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phase/constant/transportProperties b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phase/constant/transportProperties
index e59dbd8d6f..fad0a7a482 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phase/constant/transportProperties
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phase/constant/transportProperties
@@ -69,7 +69,7 @@ phases
          diameterModel constant;
          constantCoeffs
          {
-             d               1e-3;
+             d              3e-3;
          }
      }
 );
@@ -96,9 +96,9 @@ interfaceCompression
 
 virtualMass
 (
-    (air water)     0.5
-    (air oil)       0.5
-    (air mercury)   0.5
+    (air water)     0
+    (air oil)       0
+    (air mercury)   0
     (water oil)     0.5
     (water mercury) 0.5
     (oil mercury)   0.5
@@ -108,21 +108,132 @@ drag
 (
     (air water)
     {
-        type SchillerNaumann;
+        type blended;
+
+        air
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        water
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
         residualPhaseFraction 1e-3;
         residualSlip 1e-3;
     }
 
     (air oil)
     {
-        type SchillerNaumann;
+        type blended;
+
+        air
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        oil
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
         residualPhaseFraction 1e-3;
         residualSlip 1e-3;
     }
 
     (air mercury)
     {
-        type SchillerNaumann;
+        type blended;
+
+        air
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        mercury
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (water oil)
+    {
+        type blended;
+
+        water
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        oil
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (water mercury)
+    {
+        type blended;
+
+        water
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        mercury
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (oil mercury)
+    {
+        type blended;
+
+        oil
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        mercury
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
         residualPhaseFraction 1e-3;
         residualSlip 1e-3;
     }
diff --git a/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/controlDict b/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/controlDict
index fdcdcc258c..793c8a9121 100644
--- a/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/controlDict
+++ b/tutorials/multiphase/multiphaseInterFoam/laminar/damBreak4phaseFine/system/controlDict
@@ -17,7 +17,7 @@ FoamFile
 
 application     multiphaseInterFoam;
 
-startFrom       latestTime;
+startFrom       startTime;
 
 startTime       0;
 

From 29d4f2ff33fba32c670cc323668c8ed4d64dcc77 Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 21 Dec 2011 10:27:09 +0000
Subject: [PATCH 45/70] 
 multiphaseEulerFoam/multiphaseSystem/multiphaseSystem.C: updated drag
 pre-factor

---
 .../multiphaseEulerFoam/multiphaseSystem/multiphaseSystem.C  | 5 +++--
 1 file changed, 3 insertions(+), 2 deletions(-)

diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseSystem/multiphaseSystem.C b/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseSystem/multiphaseSystem.C
index 6ae60e42dc..2224030613 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseSystem/multiphaseSystem.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseSystem/multiphaseSystem.C
@@ -629,8 +629,9 @@ Foam::multiphaseSystem::dragCoeffs() const
             (
                 max
                 (
-                    fvc::average(dm.phase1())*fvc::average(dm.phase2()),
-                    //dm.phase1()*dm.phase2(),
+                    //fvc::average(dm.phase1()*dm.phase2()),
+                    //fvc::average(dm.phase1())*fvc::average(dm.phase2()),
+                    dm.phase1()*dm.phase2(),
                     dm.residualPhaseFraction()
                 )
                *dm.K

From 5d4030b7f2b5b2e165d193c498c73dd8d65417fb Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Wed, 21 Dec 2011 10:34:42 +0000
Subject: [PATCH 46/70] BUG: renumberMesh.C: reading bool from dictionary

---
 .../utilities/mesh/manipulation/renumberMesh/renumberMesh.C     | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
index 7e090fa30e..924096a22f 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
+++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
@@ -562,7 +562,7 @@ int main(int argc, char *argv[])
                 << endl;
         }
 
-        writeMaps = readLabel(renumberDict.lookup("writeMaps"));
+        renumberDict.lookup("writeMaps") >> writeMaps;
         if (writeMaps)
         {
             Info<< "Writing renumber maps (new to old) to polyMesh." << nl

From 744162e74e1e74e890e66b2686f61f1648348ae2 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Wed, 21 Dec 2011 10:35:34 +0000
Subject: [PATCH 47/70] STYLE: tetIndices.H: improved comment

---
 .../meshes/polyMesh/polyMeshTetDecomposition/tetIndices.H   | 6 ++++--
 1 file changed, 4 insertions(+), 2 deletions(-)

diff --git a/src/OpenFOAM/meshes/polyMesh/polyMeshTetDecomposition/tetIndices.H b/src/OpenFOAM/meshes/polyMesh/polyMeshTetDecomposition/tetIndices.H
index afd31e642a..76f82fa78c 100644
--- a/src/OpenFOAM/meshes/polyMesh/polyMeshTetDecomposition/tetIndices.H
+++ b/src/OpenFOAM/meshes/polyMesh/polyMeshTetDecomposition/tetIndices.H
@@ -144,11 +144,13 @@ public:
             inline tetPointRef oldTet(const polyMesh& mesh) const;
 
             //- Return the geometry corresponding to the tri on the
-            //  mesh face for this tet from the supplied mesh
+            //  mesh face for this tet from the supplied mesh. Normal of
+            //  the tri points out of the cell.
             inline triPointRef faceTri(const polyMesh& mesh) const;
 
             //- Return the point indices corresponding to the tri on the mesh
-            //  face for this tet from the supplied mesh
+            //  face for this tet from the supplied mesh. Normal of
+            //  the tri points out of the cell.
             inline triFace faceTriIs(const polyMesh& mesh) const;
 
             //- Return the geometry corresponding to the tri on the

From 0504c7a4f6a79e4a4cc510fab8062eb5aa32facd Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Wed, 21 Dec 2011 11:22:02 +0000
Subject: [PATCH 48/70] STYLE: system/streamLines: documented new tracking
 option

---
 .../simpleFoam/motorBike/system/streamLines           | 11 +++++++++--
 1 file changed, 9 insertions(+), 2 deletions(-)

diff --git a/tutorials/incompressible/simpleFoam/motorBike/system/streamLines b/tutorials/incompressible/simpleFoam/motorBike/system/streamLines
index 8b82eccbb1..50b9eefdd1 100644
--- a/tutorials/incompressible/simpleFoam/motorBike/system/streamLines
+++ b/tutorials/incompressible/simpleFoam/motorBike/system/streamLines
@@ -28,8 +28,15 @@ streamLines
     // Steps particles can travel before being removed
     lifeTime        10000;
 
-    // Number of steps per cell (estimate). Set to 1 to disable subcycling.
-    nSubCycle 5;
+    //- Specify either absolute length of steps (trackLength) or a number
+    //  of subcycling steps per cell (nSubCycle)
+
+        // Size of single track segment [m]
+        //trackLength 1e-3;
+
+        // Number of steps per cell (estimate). Set to 1 to disable subcycling.
+        nSubCycle 5;
+
 
     // Cloud name to use
     cloudName       particleTracks;

From 704b33fa79397870c6ba22733e3cce7745b42122 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Wed, 21 Dec 2011 15:13:04 +0000
Subject: [PATCH 49/70] ENH: renumberMesh: get block ordering working

- added boundaryFirst renumbering method
- renumbering in parallel
- make api methods const
---
 .../manipulation/renumberMesh/Make/options    |   2 +-
 .../manipulation/renumberMesh/renumberMesh.C  | 125 +++++++----
 .../renumberMesh/renumberMeshDict             |  35 ++-
 .../CuthillMcKeeRenumber.C                    |  14 +-
 .../CuthillMcKeeRenumber.H                    |   6 +-
 src/renumberMethods/Make/files                |   1 +
 .../boundaryFirstRenumber.C                   | 201 ++++++++++++++++++
 .../boundaryFirstRenumber.H                   | 129 +++++++++++
 .../manualRenumber/manualRenumber.C           |   2 +-
 .../manualRenumber/manualRenumber.H           |   6 +-
 .../randomRenumber/randomRenumber.C           |   6 +-
 .../randomRenumber/randomRenumber.H           |   6 +-
 .../renumberMethod/renumberMethod.C           |   4 +-
 .../renumberMethod/renumberMethod.H           |   8 +-
 .../springRenumber/springRenumber.C           |   4 +-
 .../springRenumber/springRenumber.H           |   6 +-
 16 files changed, 473 insertions(+), 82 deletions(-)
 create mode 100644 src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
 create mode 100644 src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H

diff --git a/applications/utilities/mesh/manipulation/renumberMesh/Make/options b/applications/utilities/mesh/manipulation/renumberMesh/Make/options
index 2981cf30be..dc78db3436 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/Make/options
+++ b/applications/utilities/mesh/manipulation/renumberMesh/Make/options
@@ -11,4 +11,4 @@ EXE_LIBS = \
     -lfiniteVolume \
     -lgenericPatchFields \
     -lrenumberMethods \
-    -ldecompositionMethods
+    -ldecompositionMethods -L$(FOAM_LIBBIN)/dummy -lmetisDecomp -lscotchDecomp
diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
index 924096a22f..02e5a06567 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
+++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMesh.C
@@ -29,7 +29,7 @@ Description
     renumbering all fields from all the time directories.
 
     By default uses bandCompression (CuthillMcKee) but will
-    read system/renumberMeshDict if present and use the method from there.
+    read system/renumberMeshDict if -dict option is present
 
 \*---------------------------------------------------------------------------*/
 
@@ -45,6 +45,7 @@ Description
 #include "renumberMethod.H"
 #include "zeroGradientFvPatchFields.H"
 #include "CuthillMcKeeRenumber.H"
+#include "fvMeshSubset.H"
 
 using namespace Foam;
 
@@ -455,6 +456,69 @@ autoPtr<mapPolyMesh> reorderMesh
 }
 
 
+// Return new to old cell numbering
+labelList regionRenumber
+(
+    const renumberMethod& method,
+    const fvMesh& mesh,
+    const labelList& cellToRegion
+)
+{
+    Info<< "Determining cell order:" << endl;
+
+    labelList cellOrder(cellToRegion.size());
+
+    label nRegions = max(cellToRegion)+1;
+
+    labelListList regionToCells(invertOneToMany(nRegions, cellToRegion));
+
+    label cellI = 0;
+
+    forAll(regionToCells, regionI)
+    {
+        Info<< "    region " << regionI << " starts at " << cellI << endl;
+
+        // Make sure no parallel comms
+        bool oldParRun = UPstream::parRun();
+        UPstream::parRun() = false;
+
+        // Per region do a reordering.
+        fvMeshSubset subsetter(mesh);
+        subsetter.setLargeCellSubset(cellToRegion, regionI);
+
+        const fvMesh& subMesh = subsetter.subMesh();
+
+        labelList subReverseCellOrder = method.renumber
+        (
+            subMesh,
+            subMesh.cellCentres()
+        );
+
+        labelList subCellOrder
+        (
+            invert
+            (
+                subMesh.nCells(),
+                subReverseCellOrder
+            )
+        );
+
+        // Restore state
+        UPstream::parRun() = oldParRun;
+
+        const labelList& cellMap = subsetter.cellMap();
+
+        forAll(subCellOrder, i)
+        {
+            cellOrder[cellI++] = cellMap[subCellOrder[i]];
+        }
+    }
+    Info<< endl;
+
+    return cellOrder;
+}
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 int main(int argc, char *argv[])
@@ -505,23 +569,28 @@ int main(int argc, char *argv[])
     label blockSize = 0;
 
     // Construct renumberMethod
+    autoPtr<IOdictionary> renumberDictPtr;
     autoPtr<renumberMethod> renumberPtr;
 
     if (readDict)
     {
         Info<< "Renumber according to renumberMeshDict." << nl << endl;
 
-        IOdictionary renumberDict
+        renumberDictPtr.reset
         (
-            IOobject
+            new IOdictionary
             (
-                "renumberMeshDict",
-                runTime.system(),
-                mesh,
-                IOobject::MUST_READ_IF_MODIFIED,
-                IOobject::NO_WRITE
+                IOobject
+                (
+                    "renumberMeshDict",
+                    runTime.system(),
+                    mesh,
+                    IOobject::MUST_READ_IF_MODIFIED,
+                    IOobject::NO_WRITE
+                )
             )
         );
+        const IOdictionary renumberDict = renumberDictPtr();
 
         renumberPtr = renumberMethod::New(renumberDict);
 
@@ -683,22 +752,15 @@ int main(int argc, char *argv[])
         // fields is done correctly!
 
         label nBlocks = mesh.nCells() / blockSize;
-        Info<< "nBlocks = " << nBlocks << endl;
+        Info<< "nBlocks   = " << nBlocks << endl;
 
-        // Read decomposePar dictionary
-        IOdictionary decomposeDict
-        (
-            IOobject
-            (
-                "decomposeParDict",
-                runTime.system(),
-                mesh,
-                IOobject::MUST_READ_IF_MODIFIED,
-                IOobject::NO_WRITE
-            )
-        );
+        // Read decompositionMethod dictionary
+        dictionary decomposeDict(renumberDictPtr().subDict("blockCoeffs"));
         decomposeDict.set("numberOfSubdomains", nBlocks);
 
+        bool oldParRun = UPstream::parRun();
+        UPstream::parRun() = false;
+
         autoPtr<decompositionMethod> decomposePtr = decompositionMethod::New
         (
             decomposeDict
@@ -713,6 +775,9 @@ int main(int argc, char *argv[])
             )
         );
 
+        // Restore state
+        UPstream::parRun() = oldParRun;
+
         // For debugging: write out region
         createScalarField
         (
@@ -726,23 +791,7 @@ int main(int argc, char *argv[])
             << nl << endl;
 
 
-        // Find point per region
-        pointField regionPoints(nBlocks, vector::zero);
-        forAll(cellToRegion, cellI)
-        {
-            regionPoints[cellToRegion[cellI]] = mesh.cellCentres()[cellI];
-        }
-
-        // Use block based renumbering.
-        // Detemines old to new cell ordering
-        labelList reverseCellOrder = renumberPtr().renumber
-        (
-            mesh,
-            cellToRegion,
-            regionPoints
-        );
-
-        cellOrder = invert(mesh.nCells(), reverseCellOrder);
+        cellOrder = regionRenumber(renumberPtr(), mesh, cellToRegion);
 
         // Determine new to old face order with new cell numbering
         faceOrder = getRegionFaceOrder
diff --git a/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict b/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict
index a852fad7db..988379720b 100644
--- a/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict
+++ b/applications/utilities/mesh/manipulation/renumberMesh/renumberMeshDict
@@ -22,10 +22,14 @@ writeMaps true;
 // e.g. nonBlockingGaussSeidel.
 sortCoupledFaceCells false;
 
-// Optional entry: renumber on a block-by-block basis. This can be used on
-// large cases to keep the blocks fitting in cache with all the the cache
-// missed bunched at the end.
-//blockSize 0;
+// Optional entry: renumber on a block-by-block basis. It uses a
+// blockCoeffs dictionary to construct a decompositionMethod to do
+// a block subdivision) and then applies the renumberMethod to each
+// block in turn. This can be used in large cases to keep the blocks
+// fitting in cache with all the the cache misses bunched at the end.
+// This number is the approximate size of the blocks - this gets converted
+// to a number of blocks that is the input to the decomposition method.
+//blockSize 1000;
 
 // Optional entry: sort points into internal and boundary points
 //orderPoints false;
@@ -37,11 +41,11 @@ method          CuthillMcKee;
 //method          random;
 //method          spring;
 
-CuthillMcKeeCoeffs
-{
-    // Reverse CuthillMcKee (RCM) or plain
-    reverse true;
-}
+//CuthillMcKeeCoeffs
+//{
+//    // Reverse CuthillMcKee (RCM) or plain
+//    reverse true;
+//}
 
 
 manualCoeffs
@@ -65,4 +69,17 @@ springCoeffs
 }
 
 
+blockCoeffs
+{
+    method          scotch;
+    //method hierarchical;
+    //hierarchicalCoeffs
+    //{
+    //    n           (1 2 1);
+    //    delta       0.001;
+    //    order       xyz;
+    //}
+}
+
+
 // ************************************************************************* //
diff --git a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
index e1ec010335..2732484b36 100644
--- a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
+++ b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
@@ -63,7 +63,7 @@ Foam::labelList Foam::CuthillMcKeeRenumber::renumber
 (
     const polyMesh& mesh,
     const pointField& points
-)
+) const
 {
     CompactListList<label> cellCells;
     decompositionMethod::calcCellCells
@@ -79,10 +79,7 @@ Foam::labelList Foam::CuthillMcKeeRenumber::renumber
 
     if (reverse_)
     {
-        for (label i = 0; i < orderedToOld.size()/2; i++)
-        {
-            Swap(orderedToOld[i], orderedToOld[orderedToOld.size()-i-1]);
-        }
+        reverse(orderedToOld);
     }
 
     return invert(orderedToOld.size(), orderedToOld);
@@ -93,16 +90,13 @@ Foam::labelList Foam::CuthillMcKeeRenumber::renumber
 (
     const labelListList& cellCells,
     const pointField& points
-)
+) const
 {
     labelList orderedToOld = bandCompression(cellCells);
 
     if (reverse_)
     {
-        for (label i = 0; i < orderedToOld.size()/2; i++)
-        {
-            Swap(orderedToOld[i], orderedToOld[orderedToOld.size()-i-1]);
-        }
+        reverse(orderedToOld);
     }
 
     return invert(orderedToOld.size(), orderedToOld);
diff --git a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
index 03148c8739..a4ec011b40 100644
--- a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
+++ b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
@@ -82,7 +82,7 @@ public:
 
         //- Return for every coordinate the wanted processor number.
         //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&)
+        virtual labelList renumber(const pointField&) const
         {
             notImplemented("CuthillMcKeeRenumber::renumber(const pointField&)");
             return labelList(0);
@@ -94,7 +94,7 @@ public:
         (
             const polyMesh& mesh,
             const pointField& cc
-        );
+        ) const;
 
         //- Return for every cell the new cell label.
         //  The connectivity is equal to mesh.cellCells() except
@@ -103,7 +103,7 @@ public:
         (
             const labelListList& cellCells,
             const pointField& cc
-        );
+        ) const;
 };
 
 
diff --git a/src/renumberMethods/Make/files b/src/renumberMethods/Make/files
index fb366f73c4..c19f1e6b6d 100644
--- a/src/renumberMethods/Make/files
+++ b/src/renumberMethods/Make/files
@@ -3,5 +3,6 @@ manualRenumber/manualRenumber.C
 CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
 randomRenumber/randomRenumber.C
 springRenumber/springRenumber.C
+boundaryFirstRenumber/boundaryFirstRenumber.C
 
 LIB = $(FOAM_LIBBIN)/librenumberMethods
diff --git a/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C b/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
new file mode 100644
index 0000000000..293e5ba19b
--- /dev/null
+++ b/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
@@ -0,0 +1,201 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "boundaryFirstRenumber.H"
+#include "addToRunTimeSelectionTable.H"
+#include "bandCompression.H"
+#include "decompositionMethod.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(boundaryFirstRenumber, 0);
+
+    addToRunTimeSelectionTable
+    (
+        renumberMethod,
+        boundaryFirstRenumber,
+        dictionary
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::boundaryFirstRenumber::boundaryFirstRenumber
+(
+    const dictionary& renumberDict
+)
+:
+    renumberMethod(renumberDict),
+    reverse_
+    (
+        renumberDict.found(typeName + "Coeffs")
+      ? Switch(renumberDict.subDict(typeName + "Coeffs").lookup("reverse"))
+      : Switch(true)
+    )
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::labelList Foam::boundaryFirstRenumber::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    const labelList& own = mesh.faceOwner();
+    const labelList& nei = mesh.faceNeighbour();
+
+    // Distance to boundary. Minimum of neighbours.
+    labelList distance(mesh.nCells(), -1);
+
+    // New order
+    labelList newOrder(mesh.nCells());
+    label cellInOrder = 0;
+
+
+    // Starting faces for walk. These are the zero distance faces.
+    DynamicList<label> frontFaces(mesh.nFaces()-mesh.nInternalFaces());
+
+    const polyBoundaryMesh& patches = mesh.boundaryMesh();
+
+    forAll(patches, patchI)
+    {
+        const polyPatch& pp = patches[patchI];
+
+        //- Note: cannot check for empty since these are introduced by
+        //  fvMeshSubset. Also most loops don't care about patch type.
+        //if (!isA<emptyPolyPatch>(pp))
+        {
+            forAll(pp, i)
+            {
+                frontFaces.append(pp.start()+i);
+            }
+        }
+    }
+
+    // Loop over all frontFaces
+    label currentDistance = 0;
+    while (frontFaces.size() > 0)
+    {
+        DynamicList<label> frontCells(frontFaces.size());
+
+        // Set all of frontFaces' neighbours to current distance
+
+        forAll(frontFaces, i)
+        {
+            label faceI = frontFaces[i];
+
+            if (mesh.isInternalFace(faceI))
+            {
+                label ownCellI = own[faceI];
+                if (distance[ownCellI] == -1)
+                {
+                    distance[ownCellI] = currentDistance;
+                    frontCells.append(ownCellI);
+                }
+                label neiCellI = nei[faceI];
+                if (distance[neiCellI] == -1)
+                {
+                    distance[neiCellI] = currentDistance;
+                    frontCells.append(neiCellI);
+                }
+            }
+            else
+            {
+                label ownCellI = own[faceI];
+                if (distance[ownCellI] == -1)
+                {
+                    distance[ownCellI] = currentDistance;
+                    frontCells.append(ownCellI);
+                }
+            }
+        }
+
+        //Pout<< "For distance:" << currentDistance
+        //    << " from " << frontFaces.size() << " faces to "
+        //    << frontCells.size() << " cells." << endl;
+
+
+        // TBD. Determine order within current shell (frontCells). For now
+        // just add them.
+        forAll(frontCells, i)
+        {
+            newOrder[cellInOrder] = frontCells[i];
+            cellInOrder++;
+        }
+
+        // From cells to faces
+        frontFaces.clear();
+        forAll(frontCells, i)
+        {
+            label cellI = frontCells[i];
+            const cell& cFaces = mesh.cells()[cellI];
+
+            forAll(cFaces, i)
+            {
+                label faceI = cFaces[i];
+                if (mesh.isInternalFace(faceI))
+                {
+                    label nbrCellI =
+                    (
+                        mesh.faceOwner()[faceI] == cellI
+                      ? mesh.faceNeighbour()[faceI]
+                      : mesh.faceOwner()[faceI]
+                    );
+                    if (distance[nbrCellI] == -1)
+                    {
+                        frontFaces.append(faceI);
+                    }
+                }
+            }
+        }
+
+        currentDistance++;
+    }
+
+    // Return furthest away cell first
+    if (reverse_)
+    {
+        reverse(newOrder);
+    }
+
+    //forAll(newOrder, i)
+    //{
+    //    label cellI = newOrder[i];
+    //
+    //    Pout<< "cell:" << cellI << endl;
+    //    Pout<< " at distance:" << distance[cellI]
+    //        << endl;
+    //}
+
+    return invert(newOrder.size(), newOrder);
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H b/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
new file mode 100644
index 0000000000..690af21455
--- /dev/null
+++ b/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
@@ -0,0 +1,129 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::boundaryFirstRenumber
+
+Description
+    Cuthill-McKee renumbering
+
+SourceFiles
+    boundaryFirstRenumber.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef boundaryFirstRenumber_H
+#define boundaryFirstRenumber_H
+
+#include "renumberMethod.H"
+#include "Switch.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                   Class boundaryFirstRenumber Declaration
+\*---------------------------------------------------------------------------*/
+
+class boundaryFirstRenumber
+:
+    public renumberMethod
+{
+    // Private data
+
+        const Switch reverse_;
+
+
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        void operator=(const boundaryFirstRenumber&);
+        boundaryFirstRenumber(const boundaryFirstRenumber&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("boundaryFirst");
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        boundaryFirstRenumber(const dictionary& renumberDict);
+
+
+    //- Destructor
+    virtual ~boundaryFirstRenumber()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every coordinate the wanted processor number.
+        //  We need a polyMesh (to be able to load the file)
+        virtual labelList renumber(const pointField&) const
+        {
+            notImplemented
+            (
+                "boundaryFirstRenumber::renumber(const pointField&)"
+            );
+            return labelList(0);
+        }
+
+        //- Return for every coordinate the wanted processor number. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const pointField& cc
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const
+        {
+            notImplemented
+            (
+                "boundaryFirstRenumber::renumber"
+                "(const labelListList&, const pointField&)"
+            );
+            return labelList(0);
+        }
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/renumberMethods/manualRenumber/manualRenumber.C b/src/renumberMethods/manualRenumber/manualRenumber.C
index 40989264b5..92b5c8e00c 100644
--- a/src/renumberMethods/manualRenumber/manualRenumber.C
+++ b/src/renumberMethods/manualRenumber/manualRenumber.C
@@ -61,7 +61,7 @@ Foam::labelList Foam::manualRenumber::renumber
 (
     const polyMesh& mesh,
     const pointField& points
-)
+) const
 {
     labelIOList oldToNew
     (
diff --git a/src/renumberMethods/manualRenumber/manualRenumber.H b/src/renumberMethods/manualRenumber/manualRenumber.H
index 635e93c614..a4d4b2f46f 100644
--- a/src/renumberMethods/manualRenumber/manualRenumber.H
+++ b/src/renumberMethods/manualRenumber/manualRenumber.H
@@ -81,7 +81,7 @@ public:
 
         //- Return for every coordinate the wanted processor number.
         //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&)
+        virtual labelList renumber(const pointField&) const
         {
             notImplemented("manualRenumber::renumber(const pointField&)");
             return labelList(0);
@@ -93,7 +93,7 @@ public:
         (
             const polyMesh& mesh,
             const pointField& cc
-        );
+        ) const;
 
         //- Return for every cell the new cell label.
         //  The connectivity is equal to mesh.cellCells() except
@@ -102,7 +102,7 @@ public:
         (
             const labelListList& cellCells,
             const pointField& cc
-        )
+        ) const
         {
             notImplemented
             (
diff --git a/src/renumberMethods/randomRenumber/randomRenumber.C b/src/renumberMethods/randomRenumber/randomRenumber.C
index 27ddc29c3f..2dae28e438 100644
--- a/src/renumberMethods/randomRenumber/randomRenumber.C
+++ b/src/renumberMethods/randomRenumber/randomRenumber.C
@@ -55,7 +55,7 @@ Foam::randomRenumber::randomRenumber(const dictionary& renumberDict)
 Foam::labelList Foam::randomRenumber::renumber
 (
     const pointField& points
-)
+) const
 {
     Random rndGen(0);
 
@@ -77,7 +77,7 @@ Foam::labelList Foam::randomRenumber::renumber
 (
     const polyMesh& mesh,
     const pointField& points
-)
+) const
 {
     return renumber(points);
 }
@@ -87,7 +87,7 @@ Foam::labelList Foam::randomRenumber::renumber
 (
     const labelListList& cellCells,
     const pointField& points
-)
+) const
 {
     return renumber(points);
 }
diff --git a/src/renumberMethods/randomRenumber/randomRenumber.H b/src/renumberMethods/randomRenumber/randomRenumber.H
index be704d1097..0665d5159b 100644
--- a/src/renumberMethods/randomRenumber/randomRenumber.H
+++ b/src/renumberMethods/randomRenumber/randomRenumber.H
@@ -76,7 +76,7 @@ public:
 
         //- Return for every coordinate the wanted processor number.
         //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&);
+        virtual labelList renumber(const pointField&) const;
 
         //- Return for every coordinate the wanted processor number. Use the
         //  mesh connectivity (if needed)
@@ -84,7 +84,7 @@ public:
         (
             const polyMesh& mesh,
             const pointField& cc
-        );
+        ) const;
 
         //- Return for every cell the new cell label.
         //  The connectivity is equal to mesh.cellCells() except
@@ -93,7 +93,7 @@ public:
         (
             const labelListList& cellCells,
             const pointField& cc
-        );
+        ) const;
 };
 
 
diff --git a/src/renumberMethods/renumberMethod/renumberMethod.C b/src/renumberMethods/renumberMethod/renumberMethod.C
index 53138673b8..76ba1911e2 100644
--- a/src/renumberMethods/renumberMethod/renumberMethod.C
+++ b/src/renumberMethods/renumberMethod/renumberMethod.C
@@ -72,7 +72,7 @@ Foam::labelList Foam::renumberMethod::renumber
 (
     const polyMesh& mesh,
     const pointField& points
-)
+) const
 {
     CompactListList<label> cellCells;
     decompositionMethod::calcCellCells
@@ -94,7 +94,7 @@ Foam::labelList Foam::renumberMethod::renumber
     const polyMesh& mesh,
     const labelList& fineToCoarse,
     const pointField& coarsePoints
-)
+) const
 {
     CompactListList<label> coarseCellCells;
     decompositionMethod::calcCellCells
diff --git a/src/renumberMethods/renumberMethod/renumberMethod.H b/src/renumberMethods/renumberMethod/renumberMethod.H
index b4b6e89f22..ead92b1e41 100644
--- a/src/renumberMethods/renumberMethod/renumberMethod.H
+++ b/src/renumberMethods/renumberMethod/renumberMethod.H
@@ -111,7 +111,7 @@ public:
 
         //- Return for every cell the new cell label.
         //  This is only defined for geometric renumberMethods.
-        virtual labelList renumber(const pointField&)
+        virtual labelList renumber(const pointField&) const
         {
             notImplemented
             (
@@ -122,7 +122,7 @@ public:
 
         //- Return for every cell the new cell label. Use the
         //  mesh connectivity (if needed)
-        virtual labelList renumber(const polyMesh&, const pointField&);
+        virtual labelList renumber(const polyMesh&, const pointField&) const;
 
         //- Return for every cell the new cell label. Gets
         //  passed agglomeration map (from fine to coarse cells) and coarse
@@ -136,7 +136,7 @@ public:
             const polyMesh& mesh,
             const labelList& cellToRegion,
             const pointField& regionPoints
-        );
+        ) const;
 
         //- Return for every cell the new cell label.
         //  The connectivity is equal to mesh.cellCells() except
@@ -145,7 +145,7 @@ public:
         (
             const labelListList& cellCells,
             const pointField& cc
-        ) = 0;
+        ) const = 0;
 
 };
 
diff --git a/src/renumberMethods/springRenumber/springRenumber.C b/src/renumberMethods/springRenumber/springRenumber.C
index 5c6fa49350..64a15145ce 100644
--- a/src/renumberMethods/springRenumber/springRenumber.C
+++ b/src/renumberMethods/springRenumber/springRenumber.C
@@ -60,7 +60,7 @@ Foam::labelList Foam::springRenumber::renumber
 (
     const polyMesh& mesh,
     const pointField& points
-)
+) const
 {
     CompactListList<label> cellCells;
     decompositionMethod::calcCellCells
@@ -80,7 +80,7 @@ Foam::labelList Foam::springRenumber::renumber
 (
     const labelListList& cellCells,
     const pointField& points
-)
+) const
 {
     // Look at cell index as a 1D position parameter.
     // Move cells to the average 'position' of their neighbour.
diff --git a/src/renumberMethods/springRenumber/springRenumber.H b/src/renumberMethods/springRenumber/springRenumber.H
index 64342af1ec..30f7a3d838 100644
--- a/src/renumberMethods/springRenumber/springRenumber.H
+++ b/src/renumberMethods/springRenumber/springRenumber.H
@@ -96,7 +96,7 @@ public:
     // Member Functions
 
         //- Return for every coordinate the wanted processor number.
-        virtual labelList renumber(const pointField&)
+        virtual labelList renumber(const pointField&) const
         {
             notImplemented("springRenumber::renumber(const pointField&)");
             return labelList(0);
@@ -108,7 +108,7 @@ public:
         (
             const polyMesh& mesh,
             const pointField& cc
-        );
+        ) const;
 
         //- Return for every cell the new cell label.
         //  The connectivity is equal to mesh.cellCells() except
@@ -117,7 +117,7 @@ public:
         (
             const labelListList& cellCells,
             const pointField& cc
-        );
+        ) const;
 };
 
 

From 7e95308c6b886ebc37e3d7a15933644d320bb929 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Wed, 21 Dec 2011 16:16:54 +0000
Subject: [PATCH 50/70] ENH: decomposePar.C: add shortcircuit to avoid
 allocating point mappers

---
 .../parallelProcessing/decomposePar/decomposePar.C     | 10 +++++++++-
 1 file changed, 9 insertions(+), 1 deletion(-)

diff --git a/applications/utilities/parallelProcessing/decomposePar/decomposePar.C b/applications/utilities/parallelProcessing/decomposePar/decomposePar.C
index fd58570b34..02acd59236 100644
--- a/applications/utilities/parallelProcessing/decomposePar/decomposePar.C
+++ b/applications/utilities/parallelProcessing/decomposePar/decomposePar.C
@@ -528,7 +528,7 @@ int main(int argc, char *argv[])
                         << "Cell number should be between 0 and "
                         << mesh.nCells()-1 << nl
                         << "On this mesh the particle should be in cell "
-                        <<  mesh.findCell(iter().position())
+                        << mesh.findCell(iter().position())
                         << exit(FatalError);
                 }
 
@@ -789,6 +789,14 @@ int main(int argc, char *argv[])
 
 
         // Point fields
+        if
+        (
+            pointScalarFields.size()
+         || pointVectorFields.size()
+         || pointSphericalTensorFields.size()
+         || pointSymmTensorFields.size()
+         || pointTensorFields.size()
+        )
         {
             labelIOList pointProcAddressing
             (

From 0f2e8be91c6bea6de15e1bb7f828e7ec4eac683b Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Thu, 22 Dec 2011 11:39:54 +0000
Subject: [PATCH 51/70] ENH: mapFields: add -subtract option to subtract whilst
 mapping

---
 .../mapFields/MapConsistentVolFields.H        |  20 +-
 .../preProcessing/mapFields/MapMeshes.H       | 263 ++++++++++++++++++
 .../preProcessing/mapFields/MapVolFields.H    |  13 +-
 .../preProcessing/mapFields/mapFields.C       | 217 ++++++---------
 .../meshToMesh/meshToMesh.H                   |  45 +--
 .../meshToMesh/meshToMeshInterpolate.C        | 121 ++++----
 6 files changed, 476 insertions(+), 203 deletions(-)
 create mode 100644 applications/utilities/preProcessing/mapFields/MapMeshes.H

diff --git a/applications/utilities/preProcessing/mapFields/MapConsistentVolFields.H b/applications/utilities/preProcessing/mapFields/MapConsistentVolFields.H
index 2a203eac48..9015c473a2 100644
--- a/applications/utilities/preProcessing/mapFields/MapConsistentVolFields.H
+++ b/applications/utilities/preProcessing/mapFields/MapConsistentVolFields.H
@@ -35,12 +35,13 @@ License
 namespace Foam
 {
 
-template<class Type>
+template<class Type, class CombineOp>
 void MapConsistentVolFields
 (
     const IOobjectList& objects,
     const meshToMesh& meshToMeshInterp,
-    const meshToMesh::order& mapOrder
+    const meshToMesh::order& mapOrder,
+    const CombineOp& cop
 )
 {
     const fvMesh& meshSource = meshToMeshInterp.fromMesh();
@@ -84,7 +85,13 @@ void MapConsistentVolFields
             );
 
             // Interpolate field
-            meshToMeshInterp.interpolate(fieldTarget, fieldSource, mapOrder);
+            meshToMeshInterp.interpolate//<Type, eqOp<Type> >
+            (
+                fieldTarget,
+                fieldSource,
+                mapOrder,
+                cop
+            );
 
             // Write field
             fieldTarget.write();
@@ -97,7 +104,12 @@ void MapConsistentVolFields
             GeometricField<Type, fvPatchField, volMesh> fieldTarget
             (
                 fieldTargetIOobject,
-                meshToMeshInterp.interpolate(fieldSource, mapOrder)
+                meshToMeshInterp.interpolate//<Type, eqOp<Type> >
+                (
+                    fieldSource,
+                    mapOrder,
+                    cop
+                )
             );
 
             // Write field
diff --git a/applications/utilities/preProcessing/mapFields/MapMeshes.H b/applications/utilities/preProcessing/mapFields/MapMeshes.H
new file mode 100644
index 0000000000..e497eb0ccd
--- /dev/null
+++ b/applications/utilities/preProcessing/mapFields/MapMeshes.H
@@ -0,0 +1,263 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef MapMeshes_H
+#define MapMeshes_H
+
+#include "MapVolFields.H"
+#include "MapConsistentVolFields.H"
+#include "mapLagrangian.H"
+#include "UnMapped.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+
+template<template<class> class CombineOp>
+void MapConsistentMesh
+(
+    const fvMesh& meshSource,
+    const fvMesh& meshTarget,
+    const meshToMesh::order& mapOrder
+)
+{
+    // Create the interpolation scheme
+    meshToMesh meshToMeshInterp(meshSource, meshTarget);
+
+    Info<< nl
+        << "Consistently creating and mapping fields for time "
+        << meshSource.time().timeName() << nl << endl;
+
+    {
+        // Search for list of objects for this time
+        IOobjectList objects(meshSource, meshSource.time().timeName());
+
+        // Map volFields
+        // ~~~~~~~~~~~~~
+        MapConsistentVolFields<scalar>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<scalar>()
+        );
+        MapConsistentVolFields<vector>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<vector>()
+        );
+        MapConsistentVolFields<sphericalTensor>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<sphericalTensor>()
+        );
+        MapConsistentVolFields<symmTensor>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<symmTensor>()
+        );
+        MapConsistentVolFields<tensor>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<tensor>()
+        );
+    }
+
+    {
+        // Search for list of target objects for this time
+        IOobjectList objects(meshTarget, meshTarget.time().timeName());
+
+        // Mark surfaceFields as unmapped
+        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+        UnMapped<surfaceScalarField>(objects);
+        UnMapped<surfaceVectorField>(objects);
+        UnMapped<surfaceSphericalTensorField>(objects);
+        UnMapped<surfaceSymmTensorField>(objects);
+        UnMapped<surfaceTensorField>(objects);
+
+        // Mark pointFields as unmapped
+        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+        UnMapped<pointScalarField>(objects);
+        UnMapped<pointVectorField>(objects);
+        UnMapped<pointSphericalTensorField>(objects);
+        UnMapped<pointSymmTensorField>(objects);
+        UnMapped<pointTensorField>(objects);
+    }
+
+    mapLagrangian(meshToMeshInterp);
+}
+
+
+template<template<class> class CombineOp>
+void MapSubMesh
+(
+    const fvMesh& meshSource,
+    const fvMesh& meshTarget,
+    const HashTable<word>& patchMap,
+    const wordList& cuttingPatches,
+    const meshToMesh::order& mapOrder
+)
+{
+    // Create the interpolation scheme
+    meshToMesh meshToMeshInterp
+    (
+        meshSource,
+        meshTarget,
+        patchMap,
+        cuttingPatches
+    );
+
+    Info<< nl
+        << "Mapping fields for time " << meshSource.time().timeName()
+        << nl << endl;
+
+    {
+        // Search for list of source objects for this time
+        IOobjectList objects(meshSource, meshSource.time().timeName());
+
+        // Map volFields
+        // ~~~~~~~~~~~~~
+        MapVolFields<scalar>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<scalar>()
+        );
+        MapVolFields<vector>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<vector>()
+        );
+        MapVolFields<sphericalTensor>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<sphericalTensor>()
+        );
+        MapVolFields<symmTensor>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<symmTensor>()
+        );
+        MapVolFields<tensor>
+        (
+            objects,
+            meshToMeshInterp,
+            mapOrder,
+            CombineOp<tensor>()
+        );
+    }
+
+    {
+        // Search for list of target objects for this time
+        IOobjectList objects(meshTarget, meshTarget.time().timeName());
+
+        // Mark surfaceFields as unmapped
+        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+        UnMapped<surfaceScalarField>(objects);
+        UnMapped<surfaceVectorField>(objects);
+        UnMapped<surfaceSphericalTensorField>(objects);
+        UnMapped<surfaceSymmTensorField>(objects);
+        UnMapped<surfaceTensorField>(objects);
+
+        // Mark pointFields as unmapped
+        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+        UnMapped<pointScalarField>(objects);
+        UnMapped<pointVectorField>(objects);
+        UnMapped<pointSphericalTensorField>(objects);
+        UnMapped<pointSymmTensorField>(objects);
+        UnMapped<pointTensorField>(objects);
+    }
+
+    mapLagrangian(meshToMeshInterp);
+}
+
+
+template<template<class> class CombineOp>
+void MapConsistentSubMesh
+(
+    const fvMesh& meshSource,
+    const fvMesh& meshTarget,
+    const meshToMesh::order& mapOrder
+)
+{
+    HashTable<word> patchMap;
+    HashTable<label> cuttingPatchTable;
+
+    forAll(meshTarget.boundary(), patchi)
+    {
+        if (!isA<processorFvPatch>(meshTarget.boundary()[patchi]))
+        {
+            patchMap.insert
+            (
+                meshTarget.boundary()[patchi].name(),
+                meshTarget.boundary()[patchi].name()
+            );
+        }
+        else
+        {
+            cuttingPatchTable.insert
+            (
+                meshTarget.boundaryMesh()[patchi].name(),
+                -1
+            );
+        }
+    }
+
+    MapSubMesh<CombineOp>
+    (
+        meshSource,
+        meshTarget,
+        patchMap,
+        cuttingPatchTable.toc(),
+        mapOrder
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/applications/utilities/preProcessing/mapFields/MapVolFields.H b/applications/utilities/preProcessing/mapFields/MapVolFields.H
index 64547a54de..65eb44d12d 100644
--- a/applications/utilities/preProcessing/mapFields/MapVolFields.H
+++ b/applications/utilities/preProcessing/mapFields/MapVolFields.H
@@ -35,12 +35,13 @@ License
 namespace Foam
 {
 
-template<class Type>
+template<class Type, class CombineOp>
 void MapVolFields
 (
     const IOobjectList& objects,
     const meshToMesh& meshToMeshInterp,
-    const meshToMesh::order& mapOrder
+    const meshToMesh::order& mapOrder,
+    const CombineOp& cop
 )
 {
     const fvMesh& meshSource = meshToMeshInterp.fromMesh();
@@ -84,7 +85,13 @@ void MapVolFields
             );
 
             // Interpolate field
-            meshToMeshInterp.interpolate(fieldTarget, fieldSource, mapOrder);
+            meshToMeshInterp.interpolate//<Type, eqOp<Type> >
+            (
+                fieldTarget,
+                fieldSource,
+                mapOrder,
+                cop
+            );
 
             // Write field
             fieldTarget.write();
diff --git a/applications/utilities/preProcessing/mapFields/mapFields.C b/applications/utilities/preProcessing/mapFields/mapFields.C
index 8d70911cab..9571be6fb0 100644
--- a/applications/utilities/preProcessing/mapFields/mapFields.C
+++ b/applications/utilities/preProcessing/mapFields/mapFields.C
@@ -34,11 +34,8 @@ Description
 
 #include "fvCFD.H"
 #include "meshToMesh.H"
-#include "MapVolFields.H"
-#include "MapConsistentVolFields.H"
-#include "UnMapped.H"
 #include "processorFvPatch.H"
-#include "mapLagrangian.H"
+#include "MapMeshes.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -46,56 +43,28 @@ void mapConsistentMesh
 (
     const fvMesh& meshSource,
     const fvMesh& meshTarget,
-    const meshToMesh::order& mapOrder
+    const meshToMesh::order& mapOrder,
+    const bool subtract
 )
 {
-    // Create the interpolation scheme
-    meshToMesh meshToMeshInterp(meshSource, meshTarget);
-
-    Info<< nl
-        << "Consistently creating and mapping fields for time "
-        << meshSource.time().timeName() << nl << endl;
-
+    if (subtract)
     {
-        // Search for list of objects for this time
-        IOobjectList objects(meshSource, meshSource.time().timeName());
-
-        // Map volFields
-        // ~~~~~~~~~~~~~
-        MapConsistentVolFields<scalar>(objects, meshToMeshInterp, mapOrder);
-        MapConsistentVolFields<vector>(objects, meshToMeshInterp, mapOrder);
-        MapConsistentVolFields<sphericalTensor>
+        MapConsistentMesh<minusEqOp>
         (
-            objects,
-            meshToMeshInterp,
+            meshSource,
+            meshTarget,
             mapOrder
         );
-        MapConsistentVolFields<symmTensor>(objects, meshToMeshInterp, mapOrder);
-        MapConsistentVolFields<tensor>(objects, meshToMeshInterp, mapOrder);
     }
-
+    else
     {
-        // Search for list of target objects for this time
-        IOobjectList objects(meshTarget, meshTarget.time().timeName());
-
-        // Mark surfaceFields as unmapped
-        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
-        UnMapped<surfaceScalarField>(objects);
-        UnMapped<surfaceVectorField>(objects);
-        UnMapped<surfaceSphericalTensorField>(objects);
-        UnMapped<surfaceSymmTensorField>(objects);
-        UnMapped<surfaceTensorField>(objects);
-
-        // Mark pointFields as unmapped
-        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~
-        UnMapped<pointScalarField>(objects);
-        UnMapped<pointVectorField>(objects);
-        UnMapped<pointSphericalTensorField>(objects);
-        UnMapped<pointSymmTensorField>(objects);
-        UnMapped<pointTensorField>(objects);
+        MapConsistentMesh<eqOp>
+        (
+            meshSource,
+            meshTarget,
+            mapOrder
+        );
     }
-
-    mapLagrangian(meshToMeshInterp);
 }
 
 
@@ -105,57 +74,32 @@ void mapSubMesh
     const fvMesh& meshTarget,
     const HashTable<word>& patchMap,
     const wordList& cuttingPatches,
-    const meshToMesh::order& mapOrder
+    const meshToMesh::order& mapOrder,
+    const bool subtract
 )
 {
-    // Create the interpolation scheme
-    meshToMesh meshToMeshInterp
-    (
-        meshSource,
-        meshTarget,
-        patchMap,
-        cuttingPatches
-    );
-
-    Info<< nl
-        << "Mapping fields for time " << meshSource.time().timeName()
-        << nl << endl;
-
+    if (subtract)
     {
-        // Search for list of source objects for this time
-        IOobjectList objects(meshSource, meshSource.time().timeName());
-
-        // Map volFields
-        // ~~~~~~~~~~~~~
-        MapVolFields<scalar>(objects, meshToMeshInterp, mapOrder);
-        MapVolFields<vector>(objects, meshToMeshInterp, mapOrder);
-        MapVolFields<sphericalTensor>(objects, meshToMeshInterp, mapOrder);
-        MapVolFields<symmTensor>(objects, meshToMeshInterp, mapOrder);
-        MapVolFields<tensor>(objects, meshToMeshInterp, mapOrder);
+        MapSubMesh<minusEqOp>
+        (
+            meshSource,
+            meshTarget,
+            patchMap,
+            cuttingPatches,
+            mapOrder
+        );
     }
-
+    else
     {
-        // Search for list of target objects for this time
-        IOobjectList objects(meshTarget, meshTarget.time().timeName());
-
-        // Mark surfaceFields as unmapped
-        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
-        UnMapped<surfaceScalarField>(objects);
-        UnMapped<surfaceVectorField>(objects);
-        UnMapped<surfaceSphericalTensorField>(objects);
-        UnMapped<surfaceSymmTensorField>(objects);
-        UnMapped<surfaceTensorField>(objects);
-
-        // Mark pointFields as unmapped
-        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~
-        UnMapped<pointScalarField>(objects);
-        UnMapped<pointVectorField>(objects);
-        UnMapped<pointSphericalTensorField>(objects);
-        UnMapped<pointSymmTensorField>(objects);
-        UnMapped<pointTensorField>(objects);
+        MapSubMesh<eqOp>
+        (
+            meshSource,
+            meshTarget,
+            patchMap,
+            cuttingPatches,
+            mapOrder
+        );
     }
-
-    mapLagrangian(meshToMeshInterp);
 }
 
 
@@ -163,40 +107,28 @@ void mapConsistentSubMesh
 (
     const fvMesh& meshSource,
     const fvMesh& meshTarget,
-    const meshToMesh::order& mapOrder
+    const meshToMesh::order& mapOrder,
+    const bool subtract
 )
 {
-    HashTable<word> patchMap;
-    HashTable<label> cuttingPatchTable;
-
-    forAll(meshTarget.boundary(), patchi)
+    if (subtract)
     {
-        if (!isA<processorFvPatch>(meshTarget.boundary()[patchi]))
-        {
-            patchMap.insert
-            (
-                meshTarget.boundary()[patchi].name(),
-                meshTarget.boundary()[patchi].name()
-            );
-        }
-        else
-        {
-            cuttingPatchTable.insert
-            (
-                meshTarget.boundaryMesh()[patchi].name(),
-                -1
-            );
-        }
+        MapConsistentSubMesh<minusEqOp>
+        (
+            meshSource,
+            meshTarget,
+            mapOrder
+        );
+    }
+    else
+    {
+        MapConsistentSubMesh<eqOp>
+        (
+            meshSource,
+            meshTarget,
+            mapOrder
+        );
     }
-
-    mapSubMesh
-    (
-        meshSource,
-        meshTarget,
-        patchMap,
-        cuttingPatchTable.toc(),
-        mapOrder
-    );
 }
 
 
@@ -288,6 +220,11 @@ int main(int argc, char *argv[])
         "word",
         "specify the mapping method"
     );
+    argList::addBoolOption
+    (
+        "subtract",
+        "subtract mapped source from target"
+    );
 
     argList args(argc, argv);
 
@@ -350,6 +287,13 @@ int main(int argc, char *argv[])
         Info<< "Mapping method: " << mapMethod << endl;
     }
 
+    const bool subtract = args.optionFound("subtract");
+    if (subtract)
+    {
+        Info<< "Subtracting mapped source field from target" << endl;
+    }
+
+
     #include "createTimes.H"
 
     HashTable<word> patchMap;
@@ -431,7 +375,13 @@ int main(int argc, char *argv[])
 
             if (consistent)
             {
-                mapConsistentSubMesh(meshSource, meshTarget, mapOrder);
+                mapConsistentSubMesh
+                (
+                    meshSource,
+                    meshTarget,
+                    mapOrder,
+                    subtract
+                );
             }
             else
             {
@@ -441,7 +391,8 @@ int main(int argc, char *argv[])
                     meshTarget,
                     patchMap,
                     cuttingPatches,
-                    mapOrder
+                    mapOrder,
+                    subtract
                 );
             }
         }
@@ -503,7 +454,13 @@ int main(int argc, char *argv[])
 
             if (consistent)
             {
-                mapConsistentSubMesh(meshSource, meshTarget, mapOrder);
+                mapConsistentSubMesh
+                (
+                    meshSource,
+                    meshTarget,
+                    mapOrder,
+                    subtract
+                );
             }
             else
             {
@@ -513,7 +470,8 @@ int main(int argc, char *argv[])
                     meshTarget,
                     patchMap,
                     addProcessorPatches(meshTarget, cuttingPatches),
-                    mapOrder
+                    mapOrder,
+                    subtract
                 );
             }
         }
@@ -629,7 +587,8 @@ int main(int argc, char *argv[])
                             (
                                 meshSource,
                                 meshTarget,
-                                mapOrder
+                                mapOrder,
+                                subtract
                             );
                         }
                         else
@@ -640,7 +599,8 @@ int main(int argc, char *argv[])
                                 meshTarget,
                                 patchMap,
                                 addProcessorPatches(meshTarget, cuttingPatches),
-                                mapOrder
+                                mapOrder,
+                                subtract
                             );
                         }
                     }
@@ -679,7 +639,7 @@ int main(int argc, char *argv[])
 
         if (consistent)
         {
-            mapConsistentMesh(meshSource, meshTarget, mapOrder);
+            mapConsistentMesh(meshSource, meshTarget, mapOrder, subtract);
         }
         else
         {
@@ -689,7 +649,8 @@ int main(int argc, char *argv[])
                 meshTarget,
                 patchMap,
                 cuttingPatches,
-                mapOrder
+                mapOrder,
+                subtract
             );
         }
     }
diff --git a/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMesh.H b/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMesh.H
index 785829cc60..83d1ee902a 100644
--- a/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMesh.H
+++ b/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMesh.H
@@ -219,84 +219,93 @@ public:
         // Interpolation
 
             //- Map field
-            template<class Type>
+            template<class Type, class CombineOp>
             void mapField
             (
                 Field<Type>&,
                 const Field<Type>&,
-                const labelList& adr
+                const labelList& adr,
+                const CombineOp& cop
             ) const;
 
             //- Interpolate field using inverse-distance weights
-            template<class Type>
+            template<class Type, class CombineOp>
             void interpolateField
             (
                 Field<Type>&,
                 const GeometricField<Type, fvPatchField, volMesh>&,
                 const labelList& adr,
-                const scalarListList& weights
+                const scalarListList& weights,
+                const CombineOp& cop
             ) const;
 
             //- Interpolate field using cell-point interpolation
-            template<class Type>
+            template<class Type, class CombineOp>
             void interpolateField
             (
                 Field<Type>&,
                 const GeometricField<Type, fvPatchField, volMesh>&,
                 const labelList& adr,
-                const vectorField& centres
+                const vectorField& centres,
+                const CombineOp& cop
             ) const;
 
 
             //- Interpolate internal volume field
-            template<class Type>
+            template<class Type, class CombineOp>
             void interpolateInternalField
             (
                 Field<Type>&,
                 const GeometricField<Type, fvPatchField, volMesh>&,
-                order=INTERPOLATE
+                order=INTERPOLATE,
+                const CombineOp& cop = eqOp<Type>()
             ) const;
 
-            template<class Type>
+            template<class Type, class CombineOp>
             void interpolateInternalField
             (
                 Field<Type>&,
                 const tmp<GeometricField<Type, fvPatchField, volMesh> >&,
-                order=INTERPOLATE
+                order=INTERPOLATE,
+                const CombineOp& cop = eqOp<Type>()
             ) const;
 
 
             //- Interpolate volume field
-            template<class Type>
+            template<class Type, class CombineOp>
             void interpolate
             (
                 GeometricField<Type, fvPatchField, volMesh>&,
                 const GeometricField<Type, fvPatchField, volMesh>&,
-                order=INTERPOLATE
+                order=INTERPOLATE,
+                const CombineOp& cop = eqOp<Type>()
             ) const;
 
-            template<class Type>
+            template<class Type, class CombineOp>
             void interpolate
             (
                 GeometricField<Type, fvPatchField, volMesh>&,
                 const tmp<GeometricField<Type, fvPatchField, volMesh> >&,
-                order=INTERPOLATE
+                order=INTERPOLATE,
+                const CombineOp& cop = eqOp<Type>()
             ) const;
 
 
             //- Interpolate volume field
-            template<class Type>
+            template<class Type, class CombineOp>
             tmp<GeometricField<Type, fvPatchField, volMesh> > interpolate
             (
                 const GeometricField<Type, fvPatchField, volMesh>&,
-                order=INTERPOLATE
+                order=INTERPOLATE,
+                const CombineOp& cop = eqOp<Type>()
             ) const;
 
-            template<class Type>
+            template<class Type, class CombineOp>
             tmp<GeometricField<Type, fvPatchField, volMesh> > interpolate
             (
                 const tmp<GeometricField<Type, fvPatchField, volMesh> >&,
-                order=INTERPOLATE
+                order=INTERPOLATE,
+                const CombineOp& cop = eqOp<Type>()
             ) const;
 };
 
diff --git a/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMeshInterpolate.C b/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMeshInterpolate.C
index 991ae31826..7ed543ed3c 100644
--- a/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMeshInterpolate.C
+++ b/src/sampling/meshToMeshInterpolation/meshToMesh/meshToMeshInterpolate.C
@@ -31,12 +31,13 @@ License
 
 // * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::mapField
 (
     Field<Type>& toF,
     const Field<Type>& fromVf,
-    const labelList& adr
+    const labelList& adr,
+    const CombineOp& cop
 ) const
 {
     // Direct mapping of nearest-cell values
@@ -45,7 +46,7 @@ void Foam::meshToMesh::mapField
     {
         if (adr[celli] != -1)
         {
-            toF[celli] = fromVf[adr[celli]];
+            cop(toF[celli], fromVf[adr[celli]]);
         }
     }
 
@@ -53,13 +54,14 @@ void Foam::meshToMesh::mapField
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::interpolateField
 (
     Field<Type>& toF,
     const GeometricField<Type, fvPatchField, volMesh>& fromVf,
     const labelList& adr,
-    const scalarListList& weights
+    const scalarListList& weights,
+    const CombineOp& cop
 ) const
 {
     // Inverse distance weighted interpolation
@@ -74,24 +76,27 @@ void Foam::meshToMesh::interpolateField
             const labelList& neighbours = cc[adr[celli]];
             const scalarList& w = weights[celli];
 
-            toF[celli] = fromVf[adr[celli]]*w[0];
+            Type f = fromVf[adr[celli]]*w[0];
 
             for (label ni = 1; ni < w.size(); ni++)
             {
-                toF[celli] += fromVf[neighbours[ni - 1]]*w[ni];
+                f += fromVf[neighbours[ni - 1]]*w[ni];
             }
+
+            cop(toF[celli], f);
         }
     }
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::interpolateField
 (
     Field<Type>& toF,
     const GeometricField<Type, fvPatchField, volMesh>& fromVf,
     const labelList& adr,
-    const vectorField& centres
+    const vectorField& centres,
+    const CombineOp& cop
 ) const
 {
     // Cell-Point interpolation
@@ -101,31 +106,36 @@ void Foam::meshToMesh::interpolateField
     {
         if (adr[celli] != -1)
         {
-            toF[celli] = interpolator.interpolate
+            cop
             (
-                centres[celli],
-                adr[celli]
+                toF[celli],
+                interpolator.interpolate
+                (
+                    centres[celli],
+                    adr[celli]
+                )
             );
         }
     }
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::interpolateInternalField
 (
     Field<Type>& toF,
     const GeometricField<Type, fvPatchField, volMesh>& fromVf,
-    meshToMesh::order ord
+    meshToMesh::order ord,
+    const CombineOp& cop
 ) const
 {
     if (fromVf.mesh() != fromMesh_)
     {
         FatalErrorIn
         (
-            "meshToMesh::interpolateInternalField(Field<Type>& toF, "
-            "const GeometricField<Type, fvPatchField, volMesh>& fromVf, "
-            "meshToMesh::order ord) const"
+            "meshToMesh::interpolateInternalField(Field<Type>&, "
+            "const GeometricField<Type, fvPatchField, volMesh>&, "
+            "meshToMesh::order, const CombineOp&) const"
         )   << "the argument field does not correspond to the right mesh. "
             << "Field size: " << fromVf.size()
             << " mesh size: " << fromMesh_.nCells()
@@ -136,9 +146,9 @@ void Foam::meshToMesh::interpolateInternalField
     {
         FatalErrorIn
         (
-            "meshToMesh::interpolateInternalField(Field<Type>& toF, "
-            "const GeometricField<Type, fvPatchField, volMesh>& fromVf, "
-            "meshToMesh::order ord) const"
+            "meshToMesh::interpolateInternalField(Field<Type>&, "
+            "const GeometricField<Type, fvPatchField, volMesh>&, "
+            "meshToMesh::order, const CombineOp&) const"
         )   << "the argument field does not correspond to the right mesh. "
             << "Field size: " << toF.size()
             << " mesh size: " << toMesh_.nCells()
@@ -148,7 +158,7 @@ void Foam::meshToMesh::interpolateInternalField
     switch(ord)
     {
         case MAP:
-            mapField(toF, fromVf, cellAddressing_);
+            mapField(toF, fromVf, cellAddressing_, cop);
         break;
 
         case INTERPOLATE:
@@ -157,7 +167,8 @@ void Foam::meshToMesh::interpolateInternalField
                 toF,
                 fromVf,
                 cellAddressing_,
-                inverseDistanceWeights()
+                inverseDistanceWeights(),
+                cop
             );
         break;
 
@@ -167,44 +178,47 @@ void Foam::meshToMesh::interpolateInternalField
                 toF,
                 fromVf,
                 cellAddressing_,
-                toMesh_.cellCentres()
+                toMesh_.cellCentres(),
+                cop
             );
         break;
 
         default:
             FatalErrorIn
             (
-                "meshToMesh::interpolateInternalField(Field<Type>& toF, "
-                "const GeometricField<Type, fvPatchField, volMesh>& fromVf, "
-                "meshToMesh::order ord) const"
+                "meshToMesh::interpolateInternalField(Field<Type>&, "
+                "const GeometricField<Type, fvPatchField, volMesh>&, "
+                "meshToMesh::order, const CombineOp&) const"
             )   << "unknown interpolation scheme " << ord
                 << exit(FatalError);
     }
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::interpolateInternalField
 (
     Field<Type>& toF,
     const tmp<GeometricField<Type, fvPatchField, volMesh> >& tfromVf,
-    meshToMesh::order ord
+    meshToMesh::order ord,
+    const CombineOp& cop
 ) const
 {
-    interpolateInternalField(toF, tfromVf(), ord);
+    interpolateInternalField(toF, tfromVf(), ord, cop);
     tfromVf.clear();
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::interpolate
 (
     GeometricField<Type, fvPatchField, volMesh>& toVf,
     const GeometricField<Type, fvPatchField, volMesh>& fromVf,
-    meshToMesh::order ord
+    meshToMesh::order ord,
+    const CombineOp& cop
 ) const
 {
-    interpolateInternalField(toVf, fromVf, ord);
+    interpolateInternalField(toVf, fromVf, ord, cop);
 
     forAll(toMesh_.boundaryMesh(), patchi)
     {
@@ -219,7 +233,8 @@ void Foam::meshToMesh::interpolate
                     (
                         toVf.boundaryField()[patchi],
                         fromVf,
-                        boundaryAddressing_[patchi]
+                        boundaryAddressing_[patchi],
+                        cop
                     );
                 break;
 
@@ -229,7 +244,8 @@ void Foam::meshToMesh::interpolate
                         toVf.boundaryField()[patchi],
                         fromVf,
                         boundaryAddressing_[patchi],
-                        toPatch.Cf()
+                        toPatch.Cf(),
+                        cop
                     );
                 break;
 
@@ -239,7 +255,8 @@ void Foam::meshToMesh::interpolate
                         toVf.boundaryField()[patchi],
                         fromVf,
                         boundaryAddressing_[patchi],
-                        toPatch.Cf()
+                        toPatch.Cf(),
+                        cop
                     );
                 break;
 
@@ -247,9 +264,9 @@ void Foam::meshToMesh::interpolate
                     FatalErrorIn
                     (
                         "meshToMesh::interpolate("
-                        "GeometricField<Type, fvPatchField, volMesh>& toVf, "
-                        "const GeometricField<Type, fvPatchField, volMesh>& "
-                        "fromVf, meshToMesh::order ord) const"
+                        "GeometricField<Type, fvPatchField, volMesh>&, "
+                        "const GeometricField<Type, fvPatchField, volMesh>&, "
+                        "meshToMesh::order, const CombineOp&) const"
                     )   << "unknown interpolation scheme " << ord
                         << exit(FatalError);
             }
@@ -286,37 +303,40 @@ void Foam::meshToMesh::interpolate
                 [
                     fromMeshPatches_.find(patchMap_.find(toPatch.name())())()
                 ],
-                boundaryAddressing_[patchi]
+                boundaryAddressing_[patchi],
+                cop
             );
         }
     }
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 void Foam::meshToMesh::interpolate
 (
     GeometricField<Type, fvPatchField, volMesh>& toVf,
     const tmp<GeometricField<Type, fvPatchField, volMesh> >& tfromVf,
-    meshToMesh::order ord
+    meshToMesh::order ord,
+    const CombineOp& cop
 ) const
 {
-    interpolate(toVf, tfromVf(), ord);
+    interpolate(toVf, tfromVf(), ord, cop);
     tfromVf.clear();
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 Foam::tmp< Foam::GeometricField<Type, Foam::fvPatchField, Foam::volMesh> >
 Foam::meshToMesh::interpolate
 (
     const GeometricField<Type, fvPatchField, volMesh>& fromVf,
-    meshToMesh::order ord
+    meshToMesh::order ord,
+    const CombineOp& cop
 ) const
 {
     // Create and map the internal-field values
     Field<Type> internalField(toMesh_.nCells());
-    interpolateInternalField(internalField, fromVf, ord);
+    interpolateInternalField(internalField, fromVf, ord, cop);
 
     // check whether both meshes have got the same number
     // of boundary patches
@@ -325,8 +345,8 @@ Foam::meshToMesh::interpolate
         FatalErrorIn
         (
             "meshToMesh::interpolate"
-            "(const GeometricField<Type, fvPatchField, volMesh>& fromVf,"
-            "meshToMesh::order ord) const"
+            "(const GeometricField<Type, fvPatchField, volMesh>&,"
+            "meshToMesh::order, const CombineOp&) const"
         )   << "Incompatible meshes: different number of boundaries, "
                "only internal field may be interpolated"
             << exit(FatalError);
@@ -381,16 +401,17 @@ Foam::meshToMesh::interpolate
 }
 
 
-template<class Type>
+template<class Type, class CombineOp>
 Foam::tmp< Foam::GeometricField<Type, Foam::fvPatchField, Foam::volMesh> >
 Foam::meshToMesh::interpolate
 (
     const tmp<GeometricField<Type, fvPatchField, volMesh> >& tfromVf,
-    meshToMesh::order ord
+    meshToMesh::order ord,
+    const CombineOp& cop
 ) const
 {
     tmp<GeometricField<Type, fvPatchField, volMesh> > tint =
-        interpolate(tfromVf(), ord);
+        interpolate(tfromVf(), ord, cop);
     tfromVf.clear();
 
     return tint;

From 06699987a8afe1465064c5484b519cb60191177b Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Thu, 22 Dec 2011 11:40:40 +0000
Subject: [PATCH 52/70] ENH: redistributePar: print decomposition stats upon
 entry

---
 .../parallelProcessing/redistributePar/redistributePar.C   | 7 +++----
 1 file changed, 3 insertions(+), 4 deletions(-)

diff --git a/applications/utilities/parallelProcessing/redistributePar/redistributePar.C b/applications/utilities/parallelProcessing/redistributePar/redistributePar.C
index 5eaff912ef..cde7f5b12d 100644
--- a/applications/utilities/parallelProcessing/redistributePar/redistributePar.C
+++ b/applications/utilities/parallelProcessing/redistributePar/redistributePar.C
@@ -795,9 +795,9 @@ int main(int argc, char *argv[])
     );
     fvMesh& mesh = meshPtr();
 
-    //Pout<< "Read mesh:" << endl;
-    //printMeshData(Pout, mesh);
-    //Pout<< endl;
+    // Print some statistics
+    Info<< "Before distribution:" << endl;
+    printMeshData(mesh);
 
 
 
@@ -1022,7 +1022,6 @@ int main(int argc, char *argv[])
     //map().distributeFaceData(faceCc);
 
 
-    // Print a bit
     // Print some statistics
     Info<< "After distribution:" << endl;
     printMeshData(mesh);

From b752c60cd1850b5f4b07d83cf2de7895353844af Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Thu, 22 Dec 2011 11:46:14 +0000
Subject: [PATCH 53/70] ENH: streamLine: added preliminary support for surface
 following

---
 .../field/streamLine/streamLine.C             | 239 +++++++++++++++++-
 .../field/streamLine/streamLine.H             |  11 +
 .../field/streamLine/streamLineParticle.C     |  78 +++++-
 .../field/streamLine/streamLineParticle.H     |  29 ++-
 4 files changed, 336 insertions(+), 21 deletions(-)

diff --git a/src/postProcessing/functionObjects/field/streamLine/streamLine.C b/src/postProcessing/functionObjects/field/streamLine/streamLine.C
index 30d8052513..ab815a8df8 100644
--- a/src/postProcessing/functionObjects/field/streamLine/streamLine.C
+++ b/src/postProcessing/functionObjects/field/streamLine/streamLine.C
@@ -34,6 +34,7 @@ License
 #include "globalIndex.H"
 #include "mapDistribute.H"
 #include "interpolationCellPoint.H"
+#include "PatchTools.H"
 
 // * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
 
@@ -41,6 +42,57 @@ defineTypeNameAndDebug(Foam::streamLine, 0);
 
 // * * * * * * * * * * * * * Private Member Functions  * * * * * * * * * * * //
 
+Foam::autoPtr<Foam::indirectPrimitivePatch>
+Foam::streamLine::wallPatch() const
+{
+    const fvMesh& mesh = dynamic_cast<const fvMesh&>(obr_);
+
+    const polyBoundaryMesh& patches = mesh.boundaryMesh();
+
+    label nFaces = 0;
+
+    forAll(patches, patchI)
+    {
+        //if (!polyPatch::constraintType(patches[patchI].type()))
+        if (isA<wallPolyPatch>(patches[patchI]))
+        {
+            nFaces += patches[patchI].size();
+        }
+    }
+
+    labelList addressing(nFaces);
+
+    nFaces = 0;
+
+    forAll(patches, patchI)
+    {
+        //if (!polyPatch::constraintType(patches[patchI].type()))
+        if (isA<wallPolyPatch>(patches[patchI]))
+        {
+            const polyPatch& pp = patches[patchI];
+
+            forAll(pp, i)
+            {
+                addressing[nFaces++] = pp.start()+i;
+            }
+        }
+    }
+
+    return autoPtr<indirectPrimitivePatch>
+    (
+        new indirectPrimitivePatch
+        (
+            IndirectList<face>
+            (
+                mesh.faces(),
+                addressing
+            ),
+            mesh.points()
+        )
+    );
+}
+
+
 void Foam::streamLine::track()
 {
     const Time& runTime = obr_.time();
@@ -72,7 +124,7 @@ void Foam::streamLine::track()
 
     label nSeeds = returnReduce(particles.size(), sumOp<label>());
 
-    Info<< "Seeded " << nSeeds << " particles." << endl;
+    Info<< type() << " : seeded " << nSeeds << " particles." << endl;
 
     // Read or lookup fields
     PtrList<volScalarField> vsFlds;
@@ -163,7 +215,6 @@ void Foam::streamLine::track()
                 vsInterp.set
                 (
                     nScalar++,
-                    //new interpolationCellPoint<scalar>(f)
                     interpolation<scalar>::New
                     (
                         interpolationScheme_,
@@ -186,7 +237,6 @@ void Foam::streamLine::track()
                 vvInterp.set
                 (
                     nVector++,
-                    //new interpolationCellPoint<vector>(f)
                     interpolation<vector>::New
                     (
                         interpolationScheme_,
@@ -241,6 +291,120 @@ void Foam::streamLine::track()
         allVectors_[i].setCapacity(nSeeds);
     }
 
+
+    //- For surface following: per face the normal to constrain the velocity
+    //  with.
+    pointField patchNormals;
+
+
+    if (followSurface_)
+    {
+        // Determine geometric data on the non-constraint patches
+        // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+        // - point normals
+        // - neighbouring cells
+        autoPtr<indirectPrimitivePatch> boundaryPatch(wallPatch());
+
+        // Calculate parallel consistent normal (on boundaryPatch points only)
+        pointField boundaryNormals
+        (
+            PatchTools::pointNormals
+            (
+                mesh,
+                boundaryPatch(),
+                boundaryPatch().addressing()
+            )
+        );
+        // Make sure all points know about point normal. There might be points
+        // which are not on boundaryPatch() but coupled to points that are.
+        pointField pointNormals(mesh.nPoints(), vector::zero);
+        UIndirectList<point>
+        (
+            pointNormals,
+            boundaryPatch().meshPoints()
+        ) = boundaryNormals;
+        boundaryNormals.clear();
+
+        mesh.globalData().syncPointData
+        (
+            pointNormals,
+            maxMagSqrEqOp<point>(),
+            mapDistribute::transform()
+        );
+
+        // Calculate per-face a single constraint normal:
+        // - faces on patch: face-normal
+        // - faces on cell with point on patch: point-normal
+        // - rest: vector::zero
+        //
+        // Note: the disadvantage is that we can only handle faces with one
+        //       point on the patch - otherwise we might pick up the wrong
+        //       velocity.
+
+
+
+        patchNormals.setSize(mesh.nFaces(), vector::zero);
+        label nPointNormals = 0;
+
+        // 1. faces on patch
+        UIndirectList<point>(patchNormals, boundaryPatch().addressing()) =
+             boundaryPatch().faceNormals();
+
+        // 2. faces with a point on the patch
+        forAll(mesh.faces(), faceI)
+        {
+            if (patchNormals[faceI] == vector::zero)
+            {
+                const face& f = mesh.faces()[faceI];
+                forAll(f, fp)
+                {
+                    label pointI = f[fp];
+                    if (pointNormals[pointI] != vector::zero)
+                    {
+                        patchNormals[faceI] = pointNormals[pointI];
+                        nPointNormals++;
+                    }
+                }
+            }
+        }
+
+        // 3. cells on faces with a point on the patch
+        forAll(mesh.points(), pointI)
+        {
+            if (pointNormals[pointI] != vector::zero)
+            {
+                const labelList& pCells = mesh.pointCells(pointI);
+                forAll(pCells, i)
+                {
+                    const cell& cFaces = mesh.cells()[pCells[i]];
+                    forAll(cFaces, j)
+                    {
+                        label faceI = cFaces[j];
+
+                        if (patchNormals[faceI] == vector::zero)
+                        {
+                            patchNormals[faceI] = pointNormals[pointI];
+                            nPointNormals++;
+                        }
+                    }
+                }
+            }
+        }
+
+        Info<< type() << " : calculated constrained-tracking normals" << nl
+            << "Number of faces in mesh                     : "
+            << returnReduce(mesh.nFaces(), sumOp<label>()) << nl
+            << "    of which on walls                       : "
+            <<  returnReduce
+                (
+                    boundaryPatch().addressing().size(),
+                    sumOp<label>()
+                ) << nl
+            << "    of which on cell with point on boundary : "
+            << returnReduce(nPointNormals, sumOp<label>()) << nl
+            << endl;
+    }
+
     // additional particle info
     streamLineParticle::trackingData td
     (
@@ -248,8 +412,16 @@ void Foam::streamLine::track()
         vsInterp,
         vvInterp,
         UIndex,         // index of U in vvInterp
-        trackForward_,  // track in +u direction
-        nSubCycle_,     // step through cells in steps?
+        trackForward_,  // track in +u direction?
+        nSubCycle_,     // automatic track control:step through cells in steps?
+        trackLength_,   // fixed track length
+
+        //- For surface-constrained streamlines
+        followSurface_, // stay on surface?
+        patchNormals,   // per face normal to constrain tracking to
+        //pointNormals,   // per point          ,,
+        trackHeight_,   // track height
+
         allTracks_,
         allScalars_,
         allVectors_
@@ -279,7 +451,8 @@ Foam::streamLine::streamLine
     name_(name),
     obr_(obr),
     loadFromFiles_(loadFromFiles),
-    active_(true)
+    active_(true),
+    nSubCycle_(0)
 {
     // Only active if a fvMesh is available
     if (isA<fvMesh>(obr_))
@@ -334,6 +507,16 @@ void Foam::streamLine::read(const dictionary& dict)
                 dict.lookup("U") >> UName_;
             }
         }
+
+        if (findIndex(fields_, UName_) == -1)
+        {
+            FatalIOErrorIn("streamLine::read(const dictionary&)", dict)
+                << "Velocity field for tracking " << UName_
+                << " should be present in the list of fields " << fields_
+                << exit(FatalIOError);
+        }
+
+
         dict.lookup("trackForward") >> trackForward_;
         dict.lookup("lifeTime") >> lifeTime_;
         if (lifeTime_ < 1)
@@ -343,10 +526,48 @@ void Foam::streamLine::read(const dictionary& dict)
                 << exit(FatalError);
         }
 
-        dict.lookup("nSubCycle") >> nSubCycle_;
-        if (nSubCycle_ < 1)
+
+        bool subCycling = dict.found("nSubCycle");
+        bool fixedLength = dict.found("trackLength");
+
+        if (subCycling && fixedLength)
         {
-            nSubCycle_ = 1;
+            FatalIOErrorIn("streamLine::read(const dictionary&)", dict)
+                << "Cannot both specify automatic time stepping (through '"
+                << "nSubCycle' specification) and fixed track length (through '"
+                << "trackLength')"
+                << exit(FatalIOError);
+        }
+
+
+        nSubCycle_ = 1;
+        if (dict.readIfPresent("nSubCycle", nSubCycle_))
+        {
+            trackLength_ = VGREAT;
+            if (nSubCycle_ < 1)
+            {
+                nSubCycle_ = 1;
+            }
+            Info<< type() << " : automatic track length specified through"
+                << " number of sub cycles : " << nSubCycle_ << nl << endl;
+        }
+        else
+        {
+            dict.lookup("trackLength") >> trackLength_;
+
+            Info<< type() << " : fixed track length specified : "
+                << trackLength_ << nl << endl;
+        }
+
+
+        followSurface_ = false;
+        trackHeight_ = VGREAT;
+        if (dict.readIfPresent("followSurface", followSurface_))
+        {
+            dict.lookup("trackHeight") >> trackHeight_;
+
+            Info<< type() << " : surface-constrained streamline at "
+                << trackHeight_ << " distance above the surface" << nl << endl;
         }
 
         interpolationScheme_ = dict.lookupOrDefault
diff --git a/src/postProcessing/functionObjects/field/streamLine/streamLine.H b/src/postProcessing/functionObjects/field/streamLine/streamLine.H
index 9fc981034c..77984ed2c8 100644
--- a/src/postProcessing/functionObjects/field/streamLine/streamLine.H
+++ b/src/postProcessing/functionObjects/field/streamLine/streamLine.H
@@ -43,6 +43,7 @@ SourceFiles
 #include "vectorList.H"
 #include "polyMesh.H"
 #include "writer.H"
+#include "indirectPrimitivePatch.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -95,9 +96,17 @@ class streamLine
         //- Maximum lifetime (= number of cells) of particle
         label lifeTime_;
 
+        //- Surface-constrained?
+        bool followSurface_;
+
+        scalar trackHeight_;
+
         //- Number of subcycling steps
         label nSubCycle_;
 
+        //- Track length
+        scalar trackLength_;
+
         //- Optional specified name of particles
         word cloudName_;
 
@@ -141,6 +150,8 @@ class streamLine
             List<DynamicList<vectorList> > allVectors_;
 
 
+        //- Construct patch out of all wall patch faces
+        autoPtr<indirectPrimitivePatch> wallPatch() const;
 
         //- Do all seeding and tracking
         void track();
diff --git a/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.C b/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.C
index c7808b9900..279e17ef80 100644
--- a/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.C
+++ b/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.C
@@ -43,7 +43,7 @@ Foam::scalar Foam::streamLineParticle::calcSubCycleDeltaT
     const vector& U
 ) const
 {
-    streamLineParticle testParticle(*this);
+    particle testParticle(*this);
 
     bool oldKeepParticle = td.keepParticle;
     bool oldSwitchProcessor = td.switchProcessor;
@@ -59,7 +59,8 @@ Foam::vector Foam::streamLineParticle::interpolateFields
 (
     const trackingData& td,
     const point& position,
-    const label cellI
+    const label cellI,
+    const label faceI
 )
 {
     if (cellI == -1)
@@ -76,7 +77,8 @@ Foam::vector Foam::streamLineParticle::interpolateFields
             td.vsInterp_[scalarI].interpolate
             (
                 position,
-                cellI
+                cellI,
+                faceI
             )
         );
     }
@@ -89,7 +91,8 @@ Foam::vector Foam::streamLineParticle::interpolateFields
             td.vvInterp_[vectorI].interpolate
             (
                 position,
-                cellI
+                cellI,
+                faceI
             )
         );
     }
@@ -201,13 +204,24 @@ bool Foam::streamLineParticle::move
 
             // Store current position and sampled velocity.
             sampledPositions_.append(position());
-            vector U = interpolateFields(td, position(), cell());
+            vector U = interpolateFields(td, position(), cell(), face());
 
             if (!td.trackForward_)
             {
                 U = -U;
             }
 
+            if (td.followSurface_)
+            {
+                //- Simple: remove wall-normal component. Should keep particle
+                //  at same height. Does not work well on warped faces.
+                const vector& n = td.patchNormals_[tetFaceI_];
+                if (n != vector::zero)
+                {
+                    U -= (U&n)*n;
+                }
+            }
+
             scalar magU = mag(U);
 
             if (magU < SMALL)
@@ -219,7 +233,13 @@ bool Foam::streamLineParticle::move
 
             U /= magU;
 
-            if (subIter == 0 && td.nSubCycle_ > 1)
+            if (td.trackLength_ < GREAT)
+            {
+                dt = td.trackLength_;
+                //Pout<< "    subiteration " << subIter
+                //    << " : fixed length: updated dt:" << dt << endl;
+            }
+            else if (subIter == 0 && td.nSubCycle_ > 1)
             {
                 // Adapt dt to cross cell in a few steps
                 dt = calcSubCycleDeltaT(td, dt, U);
@@ -264,7 +284,8 @@ bool Foam::streamLineParticle::move
             if (debug)
             {
                 Pout<< "streamLineParticle : Removing stagnant particle:"
-                    << p << " sampled positions:" << sampledPositions_.size()
+                    << p.position()
+                    << " sampled positions:" << sampledPositions_.size()
                     << endl;
             }
             td.keepParticle = false;
@@ -273,12 +294,13 @@ bool Foam::streamLineParticle::move
         {
             // Normal exit. Store last position and fields
             sampledPositions_.append(position());
-            interpolateFields(td, position(), cell());
+            interpolateFields(td, position(), cell(), face());
 
             if (debug)
             {
                 Pout<< "streamLineParticle : Removing particle:"
-                    << p << " sampled positions:" << sampledPositions_.size()
+                    << p.position()
+                    << " sampled positions:" << sampledPositions_.size()
                     << endl;
             }
         }
@@ -374,8 +396,42 @@ void Foam::streamLineParticle::hitWallPatch
     const tetIndices&
 )
 {
-    // Remove particle
-    td.keepParticle = false;
+    if (td.followSurface_)
+    {
+        // Push slightly in. Since we're pushing to tet centre we should still
+        // be in the same tet.
+        tetPointRef tet = currentTet();
+
+        const point oldPosition(position());
+
+        position() += trackingCorrectionTol*(tet.centre() - position());
+
+        if (debug)
+        {
+            label patchID = patch(face());
+
+            Pout<< "hitWallPatch : on wall "
+                << mesh().boundaryMesh()[patchID].name()
+                << " moved from " << oldPosition
+                << " to " << position()
+                << " due to centre " << tet.centre() << endl;
+        }
+
+        // Check that still in tet (should always be the case
+        if (debug && !tet.inside(position()))
+        {
+            FatalErrorIn("streamLineParticle::hitWallPatch()")
+                << "Pushing particle " << *this
+                << " away from wall " << wpp.name()
+                << " moved it outside of tet."
+                << exit(FatalError);
+        }
+    }
+    else
+    {
+        // Remove particle
+        td.keepParticle = false;
+    }
 }
 
 
diff --git a/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.H b/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.H
index b1ee9acf88..c5feff4285 100644
--- a/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.H
+++ b/src/postProcessing/functionObjects/field/streamLine/streamLineParticle.H
@@ -73,6 +73,13 @@ public:
         const label UIndex_;
         const bool trackForward_;
         const label nSubCycle_;
+        const scalar trackLength_;
+
+        //- For surface-constrained tracking
+        const bool followSurface_;
+        const pointField& patchNormals_;
+        const scalar trackHeight_;
+
 
         DynamicList<vectorList>& allPositions_;
         List<DynamicList<scalarList> >& allScalars_;
@@ -89,6 +96,12 @@ public:
                 const label UIndex,
                 const bool trackForward,
                 const label nSubCycle,
+                const scalar trackLength,
+                const bool followSurface,
+
+                const pointField& patchNormals,
+                const scalar trackHeight,
+
                 DynamicList<List<point> >& allPositions,
                 List<DynamicList<scalarList> >& allScalars,
                 List<DynamicList<vectorList> >& allVectors
@@ -100,6 +113,12 @@ public:
                 UIndex_(UIndex),
                 trackForward_(trackForward),
                 nSubCycle_(nSubCycle),
+                trackLength_(trackLength),
+                followSurface_(followSurface),
+
+                patchNormals_(patchNormals),
+                trackHeight_(trackHeight),
+
                 allPositions_(allPositions),
                 allScalars_(allScalars),
                 allVectors_(allVectors)
@@ -135,12 +154,20 @@ private:
             const vector& U
         ) const;
 
+        void constrainVelocity
+        (
+            trackingData& td,
+            const scalar dt,
+            vector& U
+        );
+
         //- Interpolate all quantities; return interpolated velocity.
         vector interpolateFields
         (
             const trackingData&,
             const point&,
-            const label cellI
+            const label cellI,
+            const label faceI
         );
 
 

From 2d7e76951e12aad43bf7820d65ea05682b1f2864 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Thu, 22 Dec 2011 12:26:33 +0000
Subject: [PATCH 54/70] ENH: Provide message if ParaView is not installed
 instead of swallowing the error

---
 .../utilities/postProcessing/graphics/PV3Readers/Allwmake     | 4 +++-
 1 file changed, 3 insertions(+), 1 deletion(-)

diff --git a/applications/utilities/postProcessing/graphics/PV3Readers/Allwmake b/applications/utilities/postProcessing/graphics/PV3Readers/Allwmake
index 6851210bd7..1568f8afb8 100755
--- a/applications/utilities/postProcessing/graphics/PV3Readers/Allwmake
+++ b/applications/utilities/postProcessing/graphics/PV3Readers/Allwmake
@@ -1,6 +1,6 @@
 #!/bin/sh
 cd ${0%/*} || exit 1    # run from this directory
-set -x
+#set -x
 
 if [ -d "$ParaView_DIR" -a -r "$ParaView_DIR" ]
 then
@@ -15,6 +15,8 @@ then
     wmake libso vtkPV3Readers
     PV3blockMeshReader/Allwmake
     PV3FoamReader/Allwmake
+else
+    echo "ERROR: ParaView not found in $ParaView_DIR"
 fi
 
 # ----------------------------------------------------------------- end-of-file

From ddfd2bfb382670ce1a666dd74559228a002175a9 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Thu, 22 Dec 2011 12:27:03 +0000
Subject: [PATCH 55/70] ENH: Updated wallShearStress utility to include
 compressible RAS flows

---
 .../wall/wallShearStress/Make/options         |   7 +-
 .../wall/wallShearStress/createFields.H       |  22 ---
 .../wall/wallShearStress/wallShearStress.C    | 153 ++++++++++++++++--
 3 files changed, 144 insertions(+), 38 deletions(-)
 delete mode 100644 applications/utilities/postProcessing/wall/wallShearStress/createFields.H

diff --git a/applications/utilities/postProcessing/wall/wallShearStress/Make/options b/applications/utilities/postProcessing/wall/wallShearStress/Make/options
index 8862565863..b386fa4540 100644
--- a/applications/utilities/postProcessing/wall/wallShearStress/Make/options
+++ b/applications/utilities/postProcessing/wall/wallShearStress/Make/options
@@ -1,11 +1,14 @@
 EXE_INC = \
     -I$(LIB_SRC)/transportModels \
     -I$(LIB_SRC)/turbulenceModels \
-    -I$(LIB_SRC)/turbulenceModels/incompressible/RAS/RASModel \
+    -I$(LIB_SRC)/thermophysicalModels/basic/lnInclude \
     -I$(LIB_SRC)/finiteVolume/lnInclude
 
 EXE_LIBS = \
-    -lincompressibleRASModels \
     -lincompressibleTransportModels \
+    -lincompressibleRASModels \
+    -lbasicThermophysicalModels \
+    -lspecie \
+    -lcompressibleRASModels \
     -lfiniteVolume \
     -lgenericPatchFields
diff --git a/applications/utilities/postProcessing/wall/wallShearStress/createFields.H b/applications/utilities/postProcessing/wall/wallShearStress/createFields.H
deleted file mode 100644
index d069c4545d..0000000000
--- a/applications/utilities/postProcessing/wall/wallShearStress/createFields.H
+++ /dev/null
@@ -1,22 +0,0 @@
-    Info<< "Reading field U\n" << endl;
-    volVectorField U
-    (
-        IOobject
-        (
-            "U",
-            runTime.timeName(),
-            mesh,
-            IOobject::MUST_READ,
-            IOobject::AUTO_WRITE
-        ),
-        mesh
-    );
-
-#   include "createPhi.H"
-
-    singlePhaseTransportModel laminarTransport(U, phi);
-
-    autoPtr<incompressible::RASModel> RASModel
-    (
-        incompressible::RASModel::New(U, phi, laminarTransport)
-    );
diff --git a/applications/utilities/postProcessing/wall/wallShearStress/wallShearStress.C b/applications/utilities/postProcessing/wall/wallShearStress/wallShearStress.C
index 7d440417df..6069837b95 100644
--- a/applications/utilities/postProcessing/wall/wallShearStress/wallShearStress.C
+++ b/applications/utilities/postProcessing/wall/wallShearStress/wallShearStress.C
@@ -25,23 +25,130 @@ Application
     wallShearStress
 
 Description
-    Calculates and writes the wall shear stress, for the specified times.
+    Calculates and reports wall shear stress for all patches, for the
+    specified times when using RAS turbulence models.
+
+    Default behaviour assumes operating in incompressible mode.
+    Use the -compressible option for compressible RAS cases.
 
 \*---------------------------------------------------------------------------*/
 
 #include "fvCFD.H"
+
 #include "incompressible/singlePhaseTransportModel/singlePhaseTransportModel.H"
-#include "RASModel.H"
+#include "incompressible/RAS/RASModel/RASModel.H"
+
+#include "basicPsiThermo.H"
+#include "compressible/RAS/RASModel/RASModel.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
+void calcIncompressible
+(
+    const fvMesh& mesh,
+    const Time& runTime,
+    const volVectorField& U,
+    volVectorField& wallShearStress
+)
+{
+    #include "createPhi.H"
+
+    singlePhaseTransportModel laminarTransport(U, phi);
+
+    autoPtr<incompressible::RASModel> model
+    (
+        incompressible::RASModel::New(U, phi, laminarTransport)
+    );
+
+    const volSymmTensorField Reff(model->devReff());
+
+    forAll(wallShearStress.boundaryField(), patchI)
+    {
+        wallShearStress.boundaryField()[patchI] =
+        (
+           -mesh.Sf().boundaryField()[patchI]
+           /mesh.magSf().boundaryField()[patchI]
+        ) & Reff.boundaryField()[patchI];
+    }
+}
+
+
+void calcCompressible
+(
+    const fvMesh& mesh,
+    const Time& runTime,
+    const volVectorField& U,
+    volVectorField& wallShearStress
+)
+{
+    IOobject rhoHeader
+    (
+        "rho",
+        runTime.timeName(),
+        mesh,
+        IOobject::MUST_READ,
+        IOobject::NO_WRITE
+    );
+
+    if (!rhoHeader.headerOk())
+    {
+        Info<< "    no rho field" << endl;
+        return;
+    }
+
+    Info<< "Reading field rho\n" << endl;
+    volScalarField rho(rhoHeader, mesh);
+
+    #include "compressibleCreatePhi.H"
+
+    autoPtr<basicPsiThermo> pThermo
+    (
+        basicPsiThermo::New(mesh)
+    );
+    basicPsiThermo& thermo = pThermo();
+
+    autoPtr<compressible::RASModel> model
+    (
+        compressible::RASModel::New
+        (
+            rho,
+            U,
+            phi,
+            thermo
+        )
+    );
+
+    const volSymmTensorField Reff(model->devRhoReff());
+
+    forAll(wallShearStress.boundaryField(), patchI)
+    {
+        wallShearStress.boundaryField()[patchI] =
+        (
+           -mesh.Sf().boundaryField()[patchI]
+           /mesh.magSf().boundaryField()[patchI]
+        ) & Reff.boundaryField()[patchI];
+    }
+}
+
+
 int main(int argc, char *argv[])
 {
     timeSelector::addOptions();
+
+    #include "addRegionOption.H"
+
+    argList::addBoolOption
+    (
+        "compressible",
+        "calculate compressible wall shear stress"
+    );
+
     #include "setRootCase.H"
     #include "createTime.H"
     instantList timeDirs = timeSelector::select0(runTime, args);
-    #include "createMesh.H"
+    #include "createNamedMesh.H"
+
+    const bool compressible = args.optionFound("compressible");
 
     forAll(timeDirs, timeI)
     {
@@ -49,10 +156,6 @@ int main(int argc, char *argv[])
         Info<< "Time = " << runTime.timeName() << endl;
         mesh.readUpdate();
 
-        #include "createFields.H"
-
-        volSymmTensorField Reff(RASModel->devReff());
-
         volVectorField wallShearStress
         (
             IOobject
@@ -67,19 +170,41 @@ int main(int argc, char *argv[])
             dimensionedVector
             (
                 "wallShearStress",
-                Reff.dimensions(),
+                sqr(dimLength)/sqr(dimTime),
                 vector::zero
             )
         );
 
-        forAll(wallShearStress.boundaryField(), patchi)
+        IOobject UHeader
+        (
+            "U",
+            runTime.timeName(),
+            mesh,
+            IOobject::MUST_READ,
+            IOobject::NO_WRITE
+        );
+
+        if (UHeader.headerOk())
         {
-            wallShearStress.boundaryField()[patchi] =
-            (
-                -mesh.Sf().boundaryField()[patchi]
-                /mesh.magSf().boundaryField()[patchi]
-            ) & Reff.boundaryField()[patchi];
+            Info<< "Reading field U\n" << endl;
+            volVectorField U(UHeader, mesh);
+
+            if (compressible)
+            {
+                calcCompressible(mesh, runTime, U, wallShearStress);
+            }
+            else
+            {
+                calcIncompressible(mesh, runTime, U, wallShearStress);
+            }
         }
+        else
+        {
+            Info<< "    no U field" << endl;
+        }
+
+        Info<< "Writing wall shear stress to field " << wallShearStress.name()
+            << nl << endl;
 
         wallShearStress.write();
     }

From 9ed246733b308d0bfdbf90fcd899a6d101e36bec Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Thu, 22 Dec 2011 14:54:58 +0000
Subject: [PATCH 56/70] COMP: renumberMethods: move into subdirectory

---
 src/Allwmake                                  |   2 +-
 src/renumber/Allwmake                         |  30 +++
 .../CuthillMcKeeRenumber.C                    | 106 +++++++++
 .../CuthillMcKeeRenumber.H                    | 118 ++++++++++
 src/renumber/renumberMethods/Make/files       |   8 +
 src/renumber/renumberMethods/Make/options     |   7 +
 .../boundaryFirstRenumber.C                   | 201 ++++++++++++++++++
 .../boundaryFirstRenumber.H                   | 129 +++++++++++
 .../manualRenumber/manualRenumber.C           | 137 ++++++++++++
 .../manualRenumber/manualRenumber.H           | 125 +++++++++++
 .../randomRenumber/randomRenumber.C           |  96 +++++++++
 .../randomRenumber/randomRenumber.H           | 108 ++++++++++
 .../renumberMethod/renumberMethod.C           | 131 ++++++++++++
 .../renumberMethod/renumberMethod.H           | 161 ++++++++++++++
 .../springRenumber/springRenumber.C           | 172 +++++++++++++++
 .../springRenumber/springRenumber.H           | 132 ++++++++++++
 16 files changed, 1662 insertions(+), 1 deletion(-)
 create mode 100755 src/renumber/Allwmake
 create mode 100644 src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
 create mode 100644 src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
 create mode 100644 src/renumber/renumberMethods/Make/files
 create mode 100644 src/renumber/renumberMethods/Make/options
 create mode 100644 src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
 create mode 100644 src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
 create mode 100644 src/renumber/renumberMethods/manualRenumber/manualRenumber.C
 create mode 100644 src/renumber/renumberMethods/manualRenumber/manualRenumber.H
 create mode 100644 src/renumber/renumberMethods/randomRenumber/randomRenumber.C
 create mode 100644 src/renumber/renumberMethods/randomRenumber/randomRenumber.H
 create mode 100644 src/renumber/renumberMethods/renumberMethod/renumberMethod.C
 create mode 100644 src/renumber/renumberMethods/renumberMethod/renumberMethod.H
 create mode 100644 src/renumber/renumberMethods/springRenumber/springRenumber.C
 create mode 100644 src/renumber/renumberMethods/springRenumber/springRenumber.H

diff --git a/src/Allwmake b/src/Allwmake
index a0622b30f7..97023aa700 100755
--- a/src/Allwmake
+++ b/src/Allwmake
@@ -46,7 +46,7 @@ wmake $makeType genericPatchFields
 # Build the proper scotchDecomp, metisDecomp etc.
 parallel/Allwmake $*
 
-wmake $makeType renumberMethods
+renumber/Allwmake $*
 
 wmake $makeType conversion
 
diff --git a/src/renumber/Allwmake b/src/renumber/Allwmake
new file mode 100755
index 0000000000..36c057dafe
--- /dev/null
+++ b/src/renumber/Allwmake
@@ -0,0 +1,30 @@
+#!/bin/sh
+cd ${0%/*} || exit 1    # run from this directory
+makeType=${1:-libso}
+
+## get ZOLTAN_ARCH_PATH
+#if settings=`$WM_PROJECT_DIR/bin/foamEtcFile config/zoltan.sh`
+#then
+#    . $settings
+#    echo "using ZOLTAN_ARCH_PATH=$ZOLTAN_ARCH_PATH"
+#else
+#    echo
+#    echo "Error: no config/zoltan.sh settings"
+#    echo
+#fi
+
+
+set -x
+
+wmake $makeType renumberMethods
+
+#if [ -n "$ZOLTAN_ARCH_PATH" ]
+#then
+#    wmake $makeType zoltanRenumber
+#else
+#    echo
+#    echo "Skipping zoltanRenumber"
+#    echo
+#fi
+
+# ----------------------------------------------------------------- end-of-file
diff --git a/src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C b/src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
new file mode 100644
index 0000000000..2732484b36
--- /dev/null
+++ b/src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
@@ -0,0 +1,106 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "CuthillMcKeeRenumber.H"
+#include "addToRunTimeSelectionTable.H"
+#include "bandCompression.H"
+#include "decompositionMethod.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(CuthillMcKeeRenumber, 0);
+
+    addToRunTimeSelectionTable
+    (
+        renumberMethod,
+        CuthillMcKeeRenumber,
+        dictionary
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::CuthillMcKeeRenumber::CuthillMcKeeRenumber(const dictionary& renumberDict)
+:
+    renumberMethod(renumberDict),
+    reverse_
+    (
+        renumberDict.found(typeName + "Coeffs")
+      ? Switch(renumberDict.subDict(typeName + "Coeffs").lookup("reverse"))
+      : Switch(false)
+    )
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::labelList Foam::CuthillMcKeeRenumber::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    CompactListList<label> cellCells;
+    decompositionMethod::calcCellCells
+    (
+        mesh,
+        identity(mesh.nCells()),
+        mesh.nCells(),
+        false,                      // local only
+        cellCells
+    );
+
+    labelList orderedToOld = bandCompression(cellCells());
+
+    if (reverse_)
+    {
+        reverse(orderedToOld);
+    }
+
+    return invert(orderedToOld.size(), orderedToOld);
+}
+
+
+Foam::labelList Foam::CuthillMcKeeRenumber::renumber
+(
+    const labelListList& cellCells,
+    const pointField& points
+) const
+{
+    labelList orderedToOld = bandCompression(cellCells);
+
+    if (reverse_)
+    {
+        reverse(orderedToOld);
+    }
+
+    return invert(orderedToOld.size(), orderedToOld);
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H b/src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
new file mode 100644
index 0000000000..a4ec011b40
--- /dev/null
+++ b/src/renumber/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
@@ -0,0 +1,118 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::CuthillMcKeeRenumber
+
+Description
+    Cuthill-McKee renumbering
+
+SourceFiles
+    CuthillMcKeeRenumber.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef CuthillMcKeeRenumber_H
+#define CuthillMcKeeRenumber_H
+
+#include "renumberMethod.H"
+#include "Switch.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                   Class CuthillMcKeeRenumber Declaration
+\*---------------------------------------------------------------------------*/
+
+class CuthillMcKeeRenumber
+:
+    public renumberMethod
+{
+    // Private data
+
+        const Switch reverse_;
+
+
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        void operator=(const CuthillMcKeeRenumber&);
+        CuthillMcKeeRenumber(const CuthillMcKeeRenumber&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("CuthillMcKee");
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        CuthillMcKeeRenumber(const dictionary& renumberDict);
+
+
+    //- Destructor
+    virtual ~CuthillMcKeeRenumber()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every coordinate the wanted processor number.
+        //  We need a polyMesh (to be able to load the file)
+        virtual labelList renumber(const pointField&) const
+        {
+            notImplemented("CuthillMcKeeRenumber::renumber(const pointField&)");
+            return labelList(0);
+        }
+
+        //- Return for every coordinate the wanted processor number. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const pointField& cc
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/Make/files b/src/renumber/renumberMethods/Make/files
new file mode 100644
index 0000000000..c19f1e6b6d
--- /dev/null
+++ b/src/renumber/renumberMethods/Make/files
@@ -0,0 +1,8 @@
+renumberMethod/renumberMethod.C
+manualRenumber/manualRenumber.C
+CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
+randomRenumber/randomRenumber.C
+springRenumber/springRenumber.C
+boundaryFirstRenumber/boundaryFirstRenumber.C
+
+LIB = $(FOAM_LIBBIN)/librenumberMethods
diff --git a/src/renumber/renumberMethods/Make/options b/src/renumber/renumberMethods/Make/options
new file mode 100644
index 0000000000..03cb68d946
--- /dev/null
+++ b/src/renumber/renumberMethods/Make/options
@@ -0,0 +1,7 @@
+EXE_INC = \
+    -I$(LIB_SRC)/parallel/decompose/decompositionMethods/lnInclude \
+    -I$(LIB_SRC)/meshTools/lnInclude
+
+LIB_LIBS = \
+    -ldecompositionMethods \
+    -lmeshTools
diff --git a/src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C b/src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
new file mode 100644
index 0000000000..293e5ba19b
--- /dev/null
+++ b/src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
@@ -0,0 +1,201 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "boundaryFirstRenumber.H"
+#include "addToRunTimeSelectionTable.H"
+#include "bandCompression.H"
+#include "decompositionMethod.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(boundaryFirstRenumber, 0);
+
+    addToRunTimeSelectionTable
+    (
+        renumberMethod,
+        boundaryFirstRenumber,
+        dictionary
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::boundaryFirstRenumber::boundaryFirstRenumber
+(
+    const dictionary& renumberDict
+)
+:
+    renumberMethod(renumberDict),
+    reverse_
+    (
+        renumberDict.found(typeName + "Coeffs")
+      ? Switch(renumberDict.subDict(typeName + "Coeffs").lookup("reverse"))
+      : Switch(true)
+    )
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::labelList Foam::boundaryFirstRenumber::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    const labelList& own = mesh.faceOwner();
+    const labelList& nei = mesh.faceNeighbour();
+
+    // Distance to boundary. Minimum of neighbours.
+    labelList distance(mesh.nCells(), -1);
+
+    // New order
+    labelList newOrder(mesh.nCells());
+    label cellInOrder = 0;
+
+
+    // Starting faces for walk. These are the zero distance faces.
+    DynamicList<label> frontFaces(mesh.nFaces()-mesh.nInternalFaces());
+
+    const polyBoundaryMesh& patches = mesh.boundaryMesh();
+
+    forAll(patches, patchI)
+    {
+        const polyPatch& pp = patches[patchI];
+
+        //- Note: cannot check for empty since these are introduced by
+        //  fvMeshSubset. Also most loops don't care about patch type.
+        //if (!isA<emptyPolyPatch>(pp))
+        {
+            forAll(pp, i)
+            {
+                frontFaces.append(pp.start()+i);
+            }
+        }
+    }
+
+    // Loop over all frontFaces
+    label currentDistance = 0;
+    while (frontFaces.size() > 0)
+    {
+        DynamicList<label> frontCells(frontFaces.size());
+
+        // Set all of frontFaces' neighbours to current distance
+
+        forAll(frontFaces, i)
+        {
+            label faceI = frontFaces[i];
+
+            if (mesh.isInternalFace(faceI))
+            {
+                label ownCellI = own[faceI];
+                if (distance[ownCellI] == -1)
+                {
+                    distance[ownCellI] = currentDistance;
+                    frontCells.append(ownCellI);
+                }
+                label neiCellI = nei[faceI];
+                if (distance[neiCellI] == -1)
+                {
+                    distance[neiCellI] = currentDistance;
+                    frontCells.append(neiCellI);
+                }
+            }
+            else
+            {
+                label ownCellI = own[faceI];
+                if (distance[ownCellI] == -1)
+                {
+                    distance[ownCellI] = currentDistance;
+                    frontCells.append(ownCellI);
+                }
+            }
+        }
+
+        //Pout<< "For distance:" << currentDistance
+        //    << " from " << frontFaces.size() << " faces to "
+        //    << frontCells.size() << " cells." << endl;
+
+
+        // TBD. Determine order within current shell (frontCells). For now
+        // just add them.
+        forAll(frontCells, i)
+        {
+            newOrder[cellInOrder] = frontCells[i];
+            cellInOrder++;
+        }
+
+        // From cells to faces
+        frontFaces.clear();
+        forAll(frontCells, i)
+        {
+            label cellI = frontCells[i];
+            const cell& cFaces = mesh.cells()[cellI];
+
+            forAll(cFaces, i)
+            {
+                label faceI = cFaces[i];
+                if (mesh.isInternalFace(faceI))
+                {
+                    label nbrCellI =
+                    (
+                        mesh.faceOwner()[faceI] == cellI
+                      ? mesh.faceNeighbour()[faceI]
+                      : mesh.faceOwner()[faceI]
+                    );
+                    if (distance[nbrCellI] == -1)
+                    {
+                        frontFaces.append(faceI);
+                    }
+                }
+            }
+        }
+
+        currentDistance++;
+    }
+
+    // Return furthest away cell first
+    if (reverse_)
+    {
+        reverse(newOrder);
+    }
+
+    //forAll(newOrder, i)
+    //{
+    //    label cellI = newOrder[i];
+    //
+    //    Pout<< "cell:" << cellI << endl;
+    //    Pout<< " at distance:" << distance[cellI]
+    //        << endl;
+    //}
+
+    return invert(newOrder.size(), newOrder);
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H b/src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
new file mode 100644
index 0000000000..690af21455
--- /dev/null
+++ b/src/renumber/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
@@ -0,0 +1,129 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::boundaryFirstRenumber
+
+Description
+    Cuthill-McKee renumbering
+
+SourceFiles
+    boundaryFirstRenumber.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef boundaryFirstRenumber_H
+#define boundaryFirstRenumber_H
+
+#include "renumberMethod.H"
+#include "Switch.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                   Class boundaryFirstRenumber Declaration
+\*---------------------------------------------------------------------------*/
+
+class boundaryFirstRenumber
+:
+    public renumberMethod
+{
+    // Private data
+
+        const Switch reverse_;
+
+
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        void operator=(const boundaryFirstRenumber&);
+        boundaryFirstRenumber(const boundaryFirstRenumber&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("boundaryFirst");
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        boundaryFirstRenumber(const dictionary& renumberDict);
+
+
+    //- Destructor
+    virtual ~boundaryFirstRenumber()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every coordinate the wanted processor number.
+        //  We need a polyMesh (to be able to load the file)
+        virtual labelList renumber(const pointField&) const
+        {
+            notImplemented
+            (
+                "boundaryFirstRenumber::renumber(const pointField&)"
+            );
+            return labelList(0);
+        }
+
+        //- Return for every coordinate the wanted processor number. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const pointField& cc
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const
+        {
+            notImplemented
+            (
+                "boundaryFirstRenumber::renumber"
+                "(const labelListList&, const pointField&)"
+            );
+            return labelList(0);
+        }
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/manualRenumber/manualRenumber.C b/src/renumber/renumberMethods/manualRenumber/manualRenumber.C
new file mode 100644
index 0000000000..92b5c8e00c
--- /dev/null
+++ b/src/renumber/renumberMethods/manualRenumber/manualRenumber.C
@@ -0,0 +1,137 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "manualRenumber.H"
+#include "addToRunTimeSelectionTable.H"
+#include "IFstream.H"
+#include "labelIOList.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(manualRenumber, 0);
+
+    addToRunTimeSelectionTable
+    (
+        renumberMethod,
+        manualRenumber,
+        dictionary
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::manualRenumber::manualRenumber(const dictionary& renumberDict)
+:
+    renumberMethod(renumberDict),
+    dataFile_
+    (
+        renumberDict.subDict(typeName+"Coeffs").lookup("dataFile")
+    )
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::labelList Foam::manualRenumber::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    labelIOList oldToNew
+    (
+        IOobject
+        (
+            dataFile_,
+            mesh.facesInstance(),
+            mesh,
+            IOobject::MUST_READ,
+            IOobject::AUTO_WRITE,
+            false
+        )
+    );
+
+    // check if the final renumbering is OK
+
+    if (oldToNew.size() != points.size())
+    {
+        FatalErrorIn
+        (
+            "manualRenumber::renumber(const pointField&, const scalarField&)"
+        )   << "Size of renumber list does not correspond "
+            << "to the number of points.  Size: "
+            << oldToNew.size() << " Number of points: "
+            << points.size()
+            << ".\n" << "Manual renumbering data read from file "
+            << dataFile_ << "." << endl
+            << exit(FatalError);
+    }
+
+    // Invert to see if one to one
+    labelList newToOld(points.size(), -1);
+    forAll(oldToNew, i)
+    {
+        label newI = oldToNew[i];
+
+        if (newI < 0 || newI >= oldToNew.size())
+        {
+            FatalErrorIn
+            (
+                "manualRenumber::renumber(const pointField&"
+                ", const scalarField&)"
+            )   << "Renumbering is not one-to-one. Index "
+                << i << " maps onto " << newI
+                << ".\n" << "Manual renumbering data read from file "
+                << dataFile_ << "." << endl
+                << exit(FatalError);
+        }
+
+        if (newToOld[newI] == -1)
+        {
+            newToOld[newI] = i;
+        }
+        else
+        {
+            FatalErrorIn
+            (
+                "manualRenumber::renumber(const pointField&"
+                ", const scalarField&)"
+            )   << "Renumbering is not one-to-one. Both index "
+                << newToOld[newI]
+                << " and " << i << " map onto " << newI
+                << ".\n" << "Manual renumbering data read from file "
+                << dataFile_ << "." << endl
+                << exit(FatalError);
+        }
+    }
+
+    return oldToNew;
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/manualRenumber/manualRenumber.H b/src/renumber/renumberMethods/manualRenumber/manualRenumber.H
new file mode 100644
index 0000000000..a4d4b2f46f
--- /dev/null
+++ b/src/renumber/renumberMethods/manualRenumber/manualRenumber.H
@@ -0,0 +1,125 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::manualRenumber
+
+Description
+    Renumber given a cell-to-new cell association in a file
+
+SourceFiles
+    manualRenumber.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef manualRenumber_H
+#define manualRenumber_H
+
+#include "renumberMethod.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                      Class manualRenumber Declaration
+\*---------------------------------------------------------------------------*/
+
+class manualRenumber
+:
+    public renumberMethod
+{
+    // Private data
+
+        const fileName dataFile_;
+
+
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        void operator=(const manualRenumber&);
+        manualRenumber(const manualRenumber&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("manual");
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        manualRenumber(const dictionary& renumberDict);
+
+
+    //- Destructor
+    virtual ~manualRenumber()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every coordinate the wanted processor number.
+        //  We need a polyMesh (to be able to load the file)
+        virtual labelList renumber(const pointField&) const
+        {
+            notImplemented("manualRenumber::renumber(const pointField&)");
+            return labelList(0);
+        }
+
+        //- Return for every coordinate the wanted processor number. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const pointField& cc
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const
+        {
+            notImplemented
+            (
+                "manualRenumber::renumber"
+                "(const labelListList&, const pointField&)"
+            );
+            return labelList(0);
+        }
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/randomRenumber/randomRenumber.C b/src/renumber/renumberMethods/randomRenumber/randomRenumber.C
new file mode 100644
index 0000000000..2dae28e438
--- /dev/null
+++ b/src/renumber/renumberMethods/randomRenumber/randomRenumber.C
@@ -0,0 +1,96 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "randomRenumber.H"
+#include "addToRunTimeSelectionTable.H"
+#include "Random.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(randomRenumber, 0);
+
+    addToRunTimeSelectionTable
+    (
+        renumberMethod,
+        randomRenumber,
+        dictionary
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::randomRenumber::randomRenumber(const dictionary& renumberDict)
+:
+    renumberMethod(renumberDict)
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::labelList Foam::randomRenumber::renumber
+(
+    const pointField& points
+) const
+{
+    Random rndGen(0);
+
+    labelList oldToNew(identity(points.size()));
+
+    for (label iter = 0; iter < 10; iter++)
+    {
+        forAll(oldToNew, i)
+        {
+            label j = rndGen.integer(0, oldToNew.size()-1);
+            Swap(oldToNew[i], oldToNew[j]);
+        }
+    }
+    return oldToNew;
+}
+
+
+Foam::labelList Foam::randomRenumber::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    return renumber(points);
+}
+
+
+Foam::labelList Foam::randomRenumber::renumber
+(
+    const labelListList& cellCells,
+    const pointField& points
+) const
+{
+    return renumber(points);
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/randomRenumber/randomRenumber.H b/src/renumber/renumberMethods/randomRenumber/randomRenumber.H
new file mode 100644
index 0000000000..0665d5159b
--- /dev/null
+++ b/src/renumber/renumberMethods/randomRenumber/randomRenumber.H
@@ -0,0 +1,108 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::randomRenumber
+
+Description
+    Random renumber. Just to see effect of renumbering.
+
+SourceFiles
+    randomRenumber.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef randomRenumber_H
+#define randomRenumber_H
+
+#include "renumberMethod.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                      Class randomRenumber Declaration
+\*---------------------------------------------------------------------------*/
+
+class randomRenumber
+:
+    public renumberMethod
+{
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        void operator=(const randomRenumber&);
+        randomRenumber(const randomRenumber&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("random");
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        randomRenumber(const dictionary& renumberDict);
+
+
+    //- Destructor
+    virtual ~randomRenumber()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every coordinate the wanted processor number.
+        //  We need a polyMesh (to be able to load the file)
+        virtual labelList renumber(const pointField&) const;
+
+        //- Return for every coordinate the wanted processor number. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const pointField& cc
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/renumberMethod/renumberMethod.C b/src/renumber/renumberMethods/renumberMethod/renumberMethod.C
new file mode 100644
index 0000000000..76ba1911e2
--- /dev/null
+++ b/src/renumber/renumberMethods/renumberMethod/renumberMethod.C
@@ -0,0 +1,131 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+InClass
+    renumberMethod
+
+\*---------------------------------------------------------------------------*/
+
+#include "renumberMethod.H"
+#include "decompositionMethod.H"
+
+// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(renumberMethod, 0);
+    defineRunTimeSelectionTable(renumberMethod, dictionary);
+}
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::autoPtr<Foam::renumberMethod> Foam::renumberMethod::New
+(
+    const dictionary& renumberDict
+)
+{
+    const word methodType(renumberDict.lookup("method"));
+
+    //Info<< "Selecting renumberMethod " << methodType << endl;
+
+    dictionaryConstructorTable::iterator cstrIter =
+        dictionaryConstructorTablePtr_->find(methodType);
+
+    if (cstrIter == dictionaryConstructorTablePtr_->end())
+    {
+        FatalErrorIn
+        (
+            "renumberMethod::New"
+            "(const dictionary& renumberDict)"
+        )   << "Unknown renumberMethod "
+            << methodType << nl << nl
+            << "Valid renumberMethods are : " << endl
+            << dictionaryConstructorTablePtr_->sortedToc()
+            << exit(FatalError);
+    }
+
+    return autoPtr<renumberMethod>(cstrIter()(renumberDict));
+}
+
+
+Foam::labelList Foam::renumberMethod::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    CompactListList<label> cellCells;
+    decompositionMethod::calcCellCells
+    (
+        mesh,
+        identity(mesh.nCells()),
+        mesh.nCells(),
+        false,                      // local only
+        cellCells
+    );
+
+    // Renumber based on agglomerated points
+    return renumber(cellCells(), points);
+}
+
+
+Foam::labelList Foam::renumberMethod::renumber
+(
+    const polyMesh& mesh,
+    const labelList& fineToCoarse,
+    const pointField& coarsePoints
+) const
+{
+    CompactListList<label> coarseCellCells;
+    decompositionMethod::calcCellCells
+    (
+        mesh,
+        fineToCoarse,
+        coarsePoints.size(),
+        false,                      // local only
+        coarseCellCells
+    );
+
+    // Renumber based on agglomerated points
+    labelList coarseDistribution
+    (
+        renumber
+        (
+            coarseCellCells(),
+            coarsePoints
+        )
+    );
+
+    // Rework back into renumbering for original mesh_
+    labelList fineDistribution(fineToCoarse.size());
+
+    forAll(fineDistribution, i)
+    {
+        fineDistribution[i] = coarseDistribution[fineToCoarse[i]];
+    }
+
+    return fineDistribution;
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/renumberMethod/renumberMethod.H b/src/renumber/renumberMethods/renumberMethod/renumberMethod.H
new file mode 100644
index 0000000000..ead92b1e41
--- /dev/null
+++ b/src/renumber/renumberMethods/renumberMethod/renumberMethod.H
@@ -0,0 +1,161 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::renumberMethod
+
+Description
+    Abstract base class for renumbering
+
+SourceFiles
+    renumberMethod.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef renumberMethod_H
+#define renumberMethod_H
+
+#include "polyMesh.H"
+#include "pointField.H"
+#include "CompactListList.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                           Class renumberMethod Declaration
+\*---------------------------------------------------------------------------*/
+
+class renumberMethod
+{
+
+protected:
+
+    // Protected data
+
+        const dictionary& renumberDict_;
+
+private:
+
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        renumberMethod(const renumberMethod&);
+        void operator=(const renumberMethod&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("renumberMethod");
+
+
+    // Declare run-time constructor selection tables
+
+        declareRunTimeSelectionTable
+        (
+            autoPtr,
+            renumberMethod,
+            dictionary,
+            (
+                const dictionary& renumberDict
+            ),
+            (renumberDict)
+        );
+
+
+    // Selectors
+
+        //- Return a reference to the selected renumbering method
+        static autoPtr<renumberMethod> New
+        (
+            const dictionary& renumberDict
+        );
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        renumberMethod(const dictionary& renumberDict)
+        :
+            renumberDict_(renumberDict)
+        {}
+
+
+    //- Destructor
+    virtual ~renumberMethod()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every cell the new cell label.
+        //  This is only defined for geometric renumberMethods.
+        virtual labelList renumber(const pointField&) const
+        {
+            notImplemented
+            (
+                "renumberMethod:renumber(const pointField&)"
+            );
+            return labelList(0);
+        }
+
+        //- Return for every cell the new cell label. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber(const polyMesh&, const pointField&) const;
+
+        //- Return for every cell the new cell label. Gets
+        //  passed agglomeration map (from fine to coarse cells) and coarse
+        //  cell
+        //  location. Can be overridden by renumberMethods that provide this
+        //  functionality natively. Coarse cells are local to the processor
+        //  (if in parallel). If you want to have coarse cells spanning
+        //  processors use the globalCellCells instead.
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const labelList& cellToRegion,
+            const pointField& regionPoints
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const = 0;
+
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/springRenumber/springRenumber.C b/src/renumber/renumberMethods/springRenumber/springRenumber.C
new file mode 100644
index 0000000000..64a15145ce
--- /dev/null
+++ b/src/renumber/renumberMethods/springRenumber/springRenumber.C
@@ -0,0 +1,172 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+\*---------------------------------------------------------------------------*/
+
+#include "springRenumber.H"
+#include "addToRunTimeSelectionTable.H"
+#include "decompositionMethod.H"
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+namespace Foam
+{
+    defineTypeNameAndDebug(springRenumber, 0);
+
+    addToRunTimeSelectionTable
+    (
+        renumberMethod,
+        springRenumber,
+        dictionary
+    );
+}
+
+
+// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
+
+Foam::springRenumber::springRenumber(const dictionary& renumberDict)
+:
+    renumberMethod(renumberDict),
+    dict_(renumberDict.subDict(typeName+"Coeffs")),
+    maxCo_(readScalar(dict_.lookup("maxCo"))),
+    maxIter_(readLabel(dict_.lookup("maxIter"))),
+    freezeFraction_(readScalar(dict_.lookup("freezeFraction")))
+{}
+
+
+// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
+
+Foam::labelList Foam::springRenumber::renumber
+(
+    const polyMesh& mesh,
+    const pointField& points
+) const
+{
+    CompactListList<label> cellCells;
+    decompositionMethod::calcCellCells
+    (
+        mesh,
+        identity(mesh.nCells()),
+        mesh.nCells(),
+        false,                      // local only
+        cellCells
+    );
+
+    return renumber(cellCells(), points);
+}
+
+
+Foam::labelList Foam::springRenumber::renumber
+(
+    const labelListList& cellCells,
+    const pointField& points
+) const
+{
+    // Look at cell index as a 1D position parameter.
+    // Move cells to the average 'position' of their neighbour.
+
+    scalarField position(cellCells.size());
+    forAll(position, cellI)
+    {
+        position[cellI] = cellI;
+    }
+
+    labelList oldToNew(identity(cellCells.size()));
+
+    scalar maxCo = maxCo_ * cellCells.size();
+
+    for (label iter = 0; iter < maxIter_; iter++)
+    {
+        //Pout<< "Iteration : " << iter << nl
+        //    << "------------"
+        //    << endl;
+
+        //Pout<< "Position :" << nl
+        //    << "    min : " << min(position) << nl
+        //    << "    max : " << max(position) << nl
+        //    << "    avg : " << average(position) << nl
+        //    << endl;
+
+        // Sum force per cell.
+        scalarField sumForce(cellCells.size(), 0.0);
+        forAll(cellCells, oldCellI)
+        {
+            const labelList& cCells = cellCells[oldCellI];
+            label cellI = oldToNew[oldCellI];
+
+            forAll(cCells, i)
+            {
+                label nbrCellI = oldToNew[cCells[i]];
+
+                sumForce[cellI] += (position[nbrCellI]-position[cellI]);
+            }
+        }
+
+        //Pout<< "Force :" << nl
+        //    << "    min    : " << min(sumForce) << nl
+        //    << "    max    : " << max(sumForce) << nl
+        //    << "    avgMag : " << average(mag(sumForce)) << nl
+        //    << "DeltaT : " << deltaT << nl
+        //    << endl;
+
+        // Limit displacement
+        scalar deltaT = maxCo / max(mag(sumForce));
+
+        Info<< "Iter:" << iter
+            << "  maxCo:" << maxCo
+            << "  deltaT:" << deltaT
+            << "  average force:" << average(mag(sumForce)) << endl;
+
+        // Determine displacement.
+        scalarField displacement = deltaT*sumForce;
+
+        //Pout<< "Displacement :" << nl
+        //    << "    min    : " << min(displacement) << nl
+        //    << "    max    : " << max(displacement) << nl
+        //    << "    avgMag : " << average(mag(displacement)) << nl
+        //    << endl;
+
+        // Calculate new position and scale to be within original range
+        // (0..nCells-1) for ease of postprocessing.
+        position += displacement;
+        position -= min(position);
+        position *= (position.size()-1)/max(position);
+
+        // Slowly freeze.
+        maxCo *= freezeFraction_;
+    }
+
+    //writeOBJ("endPosition.obj", cellCells, position);
+
+    // Move cells to new position
+    labelList shuffle;
+    sortedOrder(position, shuffle);
+
+    // Reorder oldToNew
+    inplaceReorder(shuffle, oldToNew);
+
+    return oldToNew;
+}
+
+
+// ************************************************************************* //
diff --git a/src/renumber/renumberMethods/springRenumber/springRenumber.H b/src/renumber/renumberMethods/springRenumber/springRenumber.H
new file mode 100644
index 0000000000..30f7a3d838
--- /dev/null
+++ b/src/renumber/renumberMethods/springRenumber/springRenumber.H
@@ -0,0 +1,132 @@
+/*---------------------------------------------------------------------------*\
+  =========                 |
+  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
+   \\    /   O peration     |
+    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
+     \\/     M anipulation  |
+-------------------------------------------------------------------------------
+License
+    This file is part of OpenFOAM.
+
+    OpenFOAM is free software: you can redistribute it and/or modify it
+    under the terms of the GNU General Public License as published by
+    the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
+    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+    for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
+
+Class
+    Foam::springRenumber
+
+Description
+    Use spring analogy - attract neighbouring cells according to the distance
+    of their cell indices.
+
+    // Maximum jump of cell indices. Is fraction of number of cells
+    maxCo 0.1;
+
+    // Limit the amount of movement; the fraction maxCo gets decreased
+    // with every iteration.
+    freezeFraction 0.9;
+
+    // Maximum number of iterations
+    maxIter 1000;
+
+SourceFiles
+    springRenumber.C
+
+\*---------------------------------------------------------------------------*/
+
+#ifndef springRenumber_H
+#define springRenumber_H
+
+#include "renumberMethod.H"
+
+namespace Foam
+{
+
+/*---------------------------------------------------------------------------*\
+                       Class springRenumber Declaration
+\*---------------------------------------------------------------------------*/
+
+class springRenumber
+:
+    public renumberMethod
+{
+    // Private data
+
+        const dictionary& dict_;
+
+        const scalar maxCo_;
+
+        const label maxIter_;
+
+        const scalar freezeFraction_;
+
+    // Private Member Functions
+
+        //- Disallow default bitwise copy construct and assignment
+        void operator=(const springRenumber&);
+        springRenumber(const springRenumber&);
+
+
+public:
+
+    //- Runtime type information
+    TypeName("spring");
+
+
+    // Constructors
+
+        //- Construct given the renumber dictionary
+        springRenumber(const dictionary& renumberDict);
+
+
+    //- Destructor
+    virtual ~springRenumber()
+    {}
+
+
+    // Member Functions
+
+        //- Return for every coordinate the wanted processor number.
+        virtual labelList renumber(const pointField&) const
+        {
+            notImplemented("springRenumber::renumber(const pointField&)");
+            return labelList(0);
+        }
+
+        //- Return for every coordinate the wanted processor number. Use the
+        //  mesh connectivity (if needed)
+        virtual labelList renumber
+        (
+            const polyMesh& mesh,
+            const pointField& cc
+        ) const;
+
+        //- Return for every cell the new cell label.
+        //  The connectivity is equal to mesh.cellCells() except
+        //  - the connections are across coupled patches
+        virtual labelList renumber
+        (
+            const labelListList& cellCells,
+            const pointField& cc
+        ) const;
+};
+
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+} // End namespace Foam
+
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+#endif
+
+// ************************************************************************* //

From efadefb7092554809382e8a5b8c39f03ba5b6940 Mon Sep 17 00:00:00 2001
From: andy <andy>
Date: Fri, 23 Dec 2011 09:19:36 +0000
Subject: [PATCH 57/70] BUG: Pimple corrector loop counter not re-initialised
 on criteria satisfied - mantis #371

---
 .../general/solutionControl/pimpleControl/pimpleControl.C      | 3 ++-
 1 file changed, 2 insertions(+), 1 deletion(-)

diff --git a/src/finiteVolume/cfdTools/general/solutionControl/pimpleControl/pimpleControl.C b/src/finiteVolume/cfdTools/general/solutionControl/pimpleControl/pimpleControl.C
index 98a742e16b..7ff31db0ec 100644
--- a/src/finiteVolume/cfdTools/general/solutionControl/pimpleControl/pimpleControl.C
+++ b/src/finiteVolume/cfdTools/general/solutionControl/pimpleControl/pimpleControl.C
@@ -196,9 +196,10 @@ bool Foam::pimpleControl::loop()
     bool completed = false;
     if (criteriaSatisfied())
     {
-        Info<< algorithmName_ << ": converged in " << corr_ << " iterations"
+        Info<< algorithmName_ << ": converged in " << corr_ - 1 << " iterations"
             << endl;
         completed = true;
+        corr_ = 0;
     }
     else
     {

From d7d0a843926b8d07399fd535f90b22fddb55642b Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 23 Dec 2011 11:38:35 +0000
Subject: [PATCH 58/70] BUG: meshRefinementProblemCells: conversion of angle
 into cos

---
 .../meshRefinementProblemCells.C              | 26 ++++++++++++-------
 1 file changed, 16 insertions(+), 10 deletions(-)

diff --git a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C
index 296029b7d5..48eff18670 100644
--- a/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C
+++ b/src/mesh/autoMesh/autoHexMesh/meshRefinement/meshRefinementProblemCells.C
@@ -286,6 +286,10 @@ bool Foam::meshRefinement::isCollapsedFace
     const label faceI
 ) const
 {
+    // Severe nonorthogonality threshold
+    const scalar severeNonorthogonalityThreshold =
+        ::cos(degToRad(maxNonOrtho));
+
     vector s = mesh_.faces()[faceI].normal(points);
     scalar magS = mag(s);
 
@@ -301,11 +305,11 @@ bool Foam::meshRefinement::isCollapsedFace
     if (mesh_.isInternalFace(faceI))
     {
         label nei = mesh_.faceNeighbour()[faceI];
-        vector d = ownCc - mesh_.cellCentres()[nei];
+        vector d = mesh_.cellCentres()[nei] - ownCc;
 
         scalar dDotS = (d & s)/(mag(d)*magS + VSMALL);
 
-        if (dDotS < maxNonOrtho)
+        if (dDotS < severeNonorthogonalityThreshold)
         {
             return true;
         }
@@ -320,11 +324,11 @@ bool Foam::meshRefinement::isCollapsedFace
 
         if (mesh_.boundaryMesh()[patchI].coupled())
         {
-            vector d = ownCc - neiCc[faceI-mesh_.nInternalFaces()];
+            vector d = neiCc[faceI-mesh_.nInternalFaces()] - ownCc;
 
             scalar dDotS = (d & s)/(mag(d)*magS + VSMALL);
 
-            if (dDotS < maxNonOrtho)
+            if (dDotS < severeNonorthogonalityThreshold)
             {
                 return true;
             }
@@ -337,7 +341,7 @@ bool Foam::meshRefinement::isCollapsedFace
         {
             // Collapsing normal boundary face does not cause problems with
             // non-orthogonality
-            return true;
+            return false;
         }
     }
 }
@@ -663,7 +667,8 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells
                 )
                 {
                     nPrevented++;
-                    //Pout<< "Preventing collapse of 8 anchor point cell "
+                    //Pout<< "Preventing baffling/removal of 8 anchor point"
+                    //    << " cell "
                     //    << cellI << " at " << mesh_.cellCentres()[cellI]
                     //    << " since new volume "
                     //    << mesh_.cells()[cellI].mag(newPoints, mesh_.faces())
@@ -747,7 +752,7 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells
                     )
                     {
                         nPrevented++;
-                        //Pout<< "Preventing collapse of 7 anchor cell "
+                        //Pout<< "Preventing baffling of 7 anchor cell "
                         //    << cellI
                         //    << " at " << mesh_.cellCentres()[cellI]
                         //    << " since new volume "
@@ -853,7 +858,8 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells
                 )
                 {
                     nPrevented++;
-                    //Pout<< "Preventing collapse of face " << faceI
+                    //Pout<< "Preventing baffling (to avoid collapse) of face "
+                    //    << faceI
                     //    << " with all boundary edges "
                     //    << " at " << mesh_.faceCentres()[faceI]
                     //    << endl;
@@ -909,7 +915,7 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells
                         )
                         {
                             nPrevented++;
-                            //Pout<< "Preventing collapse of coupled face "
+                            //Pout<< "Preventing baffling of coupled face "
                             //    << faceI
                             //    << " with all boundary edges "
                             //    << " at " << mesh_.faceCentres()[faceI]
@@ -943,7 +949,7 @@ Foam::labelList Foam::meshRefinement::markFacesOnProblemCells
     {
         Info<< "markFacesOnProblemCells : prevented "
             << returnReduce(nPrevented, sumOp<label>())
-            << " internal faces fom getting converted into baffles."
+            << " internal faces from getting converted into baffles."
             << endl;
     }
 

From e4fe63a696a525aebcc90644951978c0a52381d1 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 23 Dec 2011 12:11:37 +0000
Subject: [PATCH 59/70] BUG: decompositionMethod: numbering across coupled
 boundaries

---
 .../decompositionMethod/decompositionMethod.C | 19 ++++++++-------
 .../decompose/ptscotchDecomp/ptscotchDecomp.C | 23 -------------------
 2 files changed, 9 insertions(+), 33 deletions(-)

diff --git a/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C b/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C
index 363000bad6..e0e96412d3 100644
--- a/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C
+++ b/src/parallel/decompose/decompositionMethods/decompositionMethod/decompositionMethod.C
@@ -236,8 +236,8 @@ void Foam::decompositionMethod::calcCellCells
                 label globalNei = globalNeighbour[bFaceI];
                 if
                 (
-                    globalAgglom.isLocal(globalNei)
-                 && globalAgglom.toLocal(globalNei) != own
+                   !globalAgglom.isLocal(globalNei)
+                 || globalAgglom.toLocal(globalNei) != own
                 )
                 {
                     nFacesPerCell[own]++;
@@ -285,10 +285,11 @@ void Foam::decompositionMethod::calcCellCells
                 label own = agglom[faceOwner[faceI]];
 
                 label globalNei = globalNeighbour[bFaceI];
+
                 if
                 (
-                    globalAgglom.isLocal(globalNei)
-                 && globalAgglom.toLocal(globalNei) != own
+                   !globalAgglom.isLocal(globalNei)
+                 || globalAgglom.toLocal(globalNei) != own
                 )
                 {
                     m[offsets[own] + nFacesPerCell[own]++] = globalNei;
@@ -304,15 +305,15 @@ void Foam::decompositionMethod::calcCellCells
     // Check for duplicates connections between cells
     // ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
     // Done as postprocessing step since we now have cellCells.
-    label startIndex = 0;
     label newIndex = 0;
     labelHashSet nbrCells;
     forAll(cellCells, cellI)
     {
         nbrCells.clear();
-        nbrCells.insert(cellI);
+        nbrCells.insert(globalAgglom.toGlobal(cellI));
 
-        label& endIndex = cellCells.offsets()[cellI+1];
+        label startIndex = cellCells.offsets()[cellI];
+        label endIndex = cellCells.offsets()[cellI+1];
 
         for (label i = startIndex; i < endIndex; i++)
         {
@@ -321,9 +322,7 @@ void Foam::decompositionMethod::calcCellCells
                 cellCells.m()[newIndex++] = cellCells.m()[i];
             }
         }
-
-        startIndex = endIndex;
-        endIndex = newIndex;
+        cellCells.offsets()[cellI+1] = newIndex;
     }
 
     cellCells.m().setSize(newIndex);
diff --git a/src/parallel/decompose/ptscotchDecomp/ptscotchDecomp.C b/src/parallel/decompose/ptscotchDecomp/ptscotchDecomp.C
index 54be6ad834..e7c4995a36 100644
--- a/src/parallel/decompose/ptscotchDecomp/ptscotchDecomp.C
+++ b/src/parallel/decompose/ptscotchDecomp/ptscotchDecomp.C
@@ -371,29 +371,6 @@ Foam::label Foam::ptscotchDecomp::decompose
         Pout<< "ptscotchDecomp : entering with xadj:" << xadj.size() << endl;
     }
 
-
-if (debug)
-{
-    Pout<< "nProcessors_:" << nProcessors_ << endl;
-
-    globalIndex globalCells(xadj.size()-1);
-
-    Pout<< "Xadj:" << endl;
-    for (label cellI = 0; cellI < xadj.size()-1; cellI++)
-    {
-        Pout<< "cell:" << cellI
-            << "  global:" << globalCells.toGlobal(cellI)
-            << " connected to:" << endl;
-        label start = xadj[cellI];
-        label end = xadj[cellI+1];
-        for (label i = start; i < end; i++)
-        {
-            Pout<< "    cell:" << adjncy[i] << endl;
-        }
-    }
-    Pout<< endl;
-}
-
     // Dump graph
     if (decompositionDict_.found("ptscotchCoeffs"))
     {

From 72520e6c9554b90bac4ee2351f03763858fa2ed2 Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 23 Dec 2011 12:12:50 +0000
Subject: [PATCH 60/70] ENH: snappyHexMeshDict: fixed (unused) setting

---
 .../simpleFoam/turbineSiting/system/snappyHexMeshDict           | 2 +-
 1 file changed, 1 insertion(+), 1 deletion(-)

diff --git a/tutorials/incompressible/simpleFoam/turbineSiting/system/snappyHexMeshDict b/tutorials/incompressible/simpleFoam/turbineSiting/system/snappyHexMeshDict
index 1e6f477fc4..8054858f2a 100644
--- a/tutorials/incompressible/simpleFoam/turbineSiting/system/snappyHexMeshDict
+++ b/tutorials/incompressible/simpleFoam/turbineSiting/system/snappyHexMeshDict
@@ -173,7 +173,7 @@ castellatedMeshControls
         }
     }
 
-    resolveFeatureAngle 2;
+    resolveFeatureAngle 30;
 
 
     // Region-wise refinement

From 208cfcfc3163724171728c1dd04dc177385d8e5c Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 23 Dec 2011 12:13:09 +0000
Subject: [PATCH 61/70] GIT: renumberMethods: moved to subdirectory

---
 .../CuthillMcKeeRenumber.C                    | 106 ---------
 .../CuthillMcKeeRenumber.H                    | 118 ----------
 src/renumberMethods/Make/files                |   8 -
 src/renumberMethods/Make/options              |   7 -
 .../boundaryFirstRenumber.C                   | 201 ------------------
 .../boundaryFirstRenumber.H                   | 129 -----------
 .../manualRenumber/manualRenumber.C           | 137 ------------
 .../manualRenumber/manualRenumber.H           | 125 -----------
 .../randomRenumber/randomRenumber.C           |  96 ---------
 .../randomRenumber/randomRenumber.H           | 108 ----------
 .../renumberMethod/renumberMethod.C           | 131 ------------
 .../renumberMethod/renumberMethod.H           | 161 --------------
 .../springRenumber/springRenumber.C           | 172 ---------------
 .../springRenumber/springRenumber.H           | 132 ------------
 14 files changed, 1631 deletions(-)
 delete mode 100644 src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
 delete mode 100644 src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
 delete mode 100644 src/renumberMethods/Make/files
 delete mode 100644 src/renumberMethods/Make/options
 delete mode 100644 src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
 delete mode 100644 src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
 delete mode 100644 src/renumberMethods/manualRenumber/manualRenumber.C
 delete mode 100644 src/renumberMethods/manualRenumber/manualRenumber.H
 delete mode 100644 src/renumberMethods/randomRenumber/randomRenumber.C
 delete mode 100644 src/renumberMethods/randomRenumber/randomRenumber.H
 delete mode 100644 src/renumberMethods/renumberMethod/renumberMethod.C
 delete mode 100644 src/renumberMethods/renumberMethod/renumberMethod.H
 delete mode 100644 src/renumberMethods/springRenumber/springRenumber.C
 delete mode 100644 src/renumberMethods/springRenumber/springRenumber.H

diff --git a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
deleted file mode 100644
index 2732484b36..0000000000
--- a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
+++ /dev/null
@@ -1,106 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-\*---------------------------------------------------------------------------*/
-
-#include "CuthillMcKeeRenumber.H"
-#include "addToRunTimeSelectionTable.H"
-#include "bandCompression.H"
-#include "decompositionMethod.H"
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-namespace Foam
-{
-    defineTypeNameAndDebug(CuthillMcKeeRenumber, 0);
-
-    addToRunTimeSelectionTable
-    (
-        renumberMethod,
-        CuthillMcKeeRenumber,
-        dictionary
-    );
-}
-
-
-// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
-
-Foam::CuthillMcKeeRenumber::CuthillMcKeeRenumber(const dictionary& renumberDict)
-:
-    renumberMethod(renumberDict),
-    reverse_
-    (
-        renumberDict.found(typeName + "Coeffs")
-      ? Switch(renumberDict.subDict(typeName + "Coeffs").lookup("reverse"))
-      : Switch(false)
-    )
-{}
-
-
-// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
-
-Foam::labelList Foam::CuthillMcKeeRenumber::renumber
-(
-    const polyMesh& mesh,
-    const pointField& points
-) const
-{
-    CompactListList<label> cellCells;
-    decompositionMethod::calcCellCells
-    (
-        mesh,
-        identity(mesh.nCells()),
-        mesh.nCells(),
-        false,                      // local only
-        cellCells
-    );
-
-    labelList orderedToOld = bandCompression(cellCells());
-
-    if (reverse_)
-    {
-        reverse(orderedToOld);
-    }
-
-    return invert(orderedToOld.size(), orderedToOld);
-}
-
-
-Foam::labelList Foam::CuthillMcKeeRenumber::renumber
-(
-    const labelListList& cellCells,
-    const pointField& points
-) const
-{
-    labelList orderedToOld = bandCompression(cellCells);
-
-    if (reverse_)
-    {
-        reverse(orderedToOld);
-    }
-
-    return invert(orderedToOld.size(), orderedToOld);
-}
-
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H b/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
deleted file mode 100644
index a4ec011b40..0000000000
--- a/src/renumberMethods/CuthillMcKeeRenumber/CuthillMcKeeRenumber.H
+++ /dev/null
@@ -1,118 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-Class
-    Foam::CuthillMcKeeRenumber
-
-Description
-    Cuthill-McKee renumbering
-
-SourceFiles
-    CuthillMcKeeRenumber.C
-
-\*---------------------------------------------------------------------------*/
-
-#ifndef CuthillMcKeeRenumber_H
-#define CuthillMcKeeRenumber_H
-
-#include "renumberMethod.H"
-#include "Switch.H"
-
-namespace Foam
-{
-
-/*---------------------------------------------------------------------------*\
-                   Class CuthillMcKeeRenumber Declaration
-\*---------------------------------------------------------------------------*/
-
-class CuthillMcKeeRenumber
-:
-    public renumberMethod
-{
-    // Private data
-
-        const Switch reverse_;
-
-
-    // Private Member Functions
-
-        //- Disallow default bitwise copy construct and assignment
-        void operator=(const CuthillMcKeeRenumber&);
-        CuthillMcKeeRenumber(const CuthillMcKeeRenumber&);
-
-
-public:
-
-    //- Runtime type information
-    TypeName("CuthillMcKee");
-
-
-    // Constructors
-
-        //- Construct given the renumber dictionary
-        CuthillMcKeeRenumber(const dictionary& renumberDict);
-
-
-    //- Destructor
-    virtual ~CuthillMcKeeRenumber()
-    {}
-
-
-    // Member Functions
-
-        //- Return for every coordinate the wanted processor number.
-        //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&) const
-        {
-            notImplemented("CuthillMcKeeRenumber::renumber(const pointField&)");
-            return labelList(0);
-        }
-
-        //- Return for every coordinate the wanted processor number. Use the
-        //  mesh connectivity (if needed)
-        virtual labelList renumber
-        (
-            const polyMesh& mesh,
-            const pointField& cc
-        ) const;
-
-        //- Return for every cell the new cell label.
-        //  The connectivity is equal to mesh.cellCells() except
-        //  - the connections are across coupled patches
-        virtual labelList renumber
-        (
-            const labelListList& cellCells,
-            const pointField& cc
-        ) const;
-};
-
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-} // End namespace Foam
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-#endif
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/Make/files b/src/renumberMethods/Make/files
deleted file mode 100644
index c19f1e6b6d..0000000000
--- a/src/renumberMethods/Make/files
+++ /dev/null
@@ -1,8 +0,0 @@
-renumberMethod/renumberMethod.C
-manualRenumber/manualRenumber.C
-CuthillMcKeeRenumber/CuthillMcKeeRenumber.C
-randomRenumber/randomRenumber.C
-springRenumber/springRenumber.C
-boundaryFirstRenumber/boundaryFirstRenumber.C
-
-LIB = $(FOAM_LIBBIN)/librenumberMethods
diff --git a/src/renumberMethods/Make/options b/src/renumberMethods/Make/options
deleted file mode 100644
index 03cb68d946..0000000000
--- a/src/renumberMethods/Make/options
+++ /dev/null
@@ -1,7 +0,0 @@
-EXE_INC = \
-    -I$(LIB_SRC)/parallel/decompose/decompositionMethods/lnInclude \
-    -I$(LIB_SRC)/meshTools/lnInclude
-
-LIB_LIBS = \
-    -ldecompositionMethods \
-    -lmeshTools
diff --git a/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C b/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
deleted file mode 100644
index 293e5ba19b..0000000000
--- a/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.C
+++ /dev/null
@@ -1,201 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-\*---------------------------------------------------------------------------*/
-
-#include "boundaryFirstRenumber.H"
-#include "addToRunTimeSelectionTable.H"
-#include "bandCompression.H"
-#include "decompositionMethod.H"
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-namespace Foam
-{
-    defineTypeNameAndDebug(boundaryFirstRenumber, 0);
-
-    addToRunTimeSelectionTable
-    (
-        renumberMethod,
-        boundaryFirstRenumber,
-        dictionary
-    );
-}
-
-
-// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
-
-Foam::boundaryFirstRenumber::boundaryFirstRenumber
-(
-    const dictionary& renumberDict
-)
-:
-    renumberMethod(renumberDict),
-    reverse_
-    (
-        renumberDict.found(typeName + "Coeffs")
-      ? Switch(renumberDict.subDict(typeName + "Coeffs").lookup("reverse"))
-      : Switch(true)
-    )
-{}
-
-
-// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
-
-Foam::labelList Foam::boundaryFirstRenumber::renumber
-(
-    const polyMesh& mesh,
-    const pointField& points
-) const
-{
-    const labelList& own = mesh.faceOwner();
-    const labelList& nei = mesh.faceNeighbour();
-
-    // Distance to boundary. Minimum of neighbours.
-    labelList distance(mesh.nCells(), -1);
-
-    // New order
-    labelList newOrder(mesh.nCells());
-    label cellInOrder = 0;
-
-
-    // Starting faces for walk. These are the zero distance faces.
-    DynamicList<label> frontFaces(mesh.nFaces()-mesh.nInternalFaces());
-
-    const polyBoundaryMesh& patches = mesh.boundaryMesh();
-
-    forAll(patches, patchI)
-    {
-        const polyPatch& pp = patches[patchI];
-
-        //- Note: cannot check for empty since these are introduced by
-        //  fvMeshSubset. Also most loops don't care about patch type.
-        //if (!isA<emptyPolyPatch>(pp))
-        {
-            forAll(pp, i)
-            {
-                frontFaces.append(pp.start()+i);
-            }
-        }
-    }
-
-    // Loop over all frontFaces
-    label currentDistance = 0;
-    while (frontFaces.size() > 0)
-    {
-        DynamicList<label> frontCells(frontFaces.size());
-
-        // Set all of frontFaces' neighbours to current distance
-
-        forAll(frontFaces, i)
-        {
-            label faceI = frontFaces[i];
-
-            if (mesh.isInternalFace(faceI))
-            {
-                label ownCellI = own[faceI];
-                if (distance[ownCellI] == -1)
-                {
-                    distance[ownCellI] = currentDistance;
-                    frontCells.append(ownCellI);
-                }
-                label neiCellI = nei[faceI];
-                if (distance[neiCellI] == -1)
-                {
-                    distance[neiCellI] = currentDistance;
-                    frontCells.append(neiCellI);
-                }
-            }
-            else
-            {
-                label ownCellI = own[faceI];
-                if (distance[ownCellI] == -1)
-                {
-                    distance[ownCellI] = currentDistance;
-                    frontCells.append(ownCellI);
-                }
-            }
-        }
-
-        //Pout<< "For distance:" << currentDistance
-        //    << " from " << frontFaces.size() << " faces to "
-        //    << frontCells.size() << " cells." << endl;
-
-
-        // TBD. Determine order within current shell (frontCells). For now
-        // just add them.
-        forAll(frontCells, i)
-        {
-            newOrder[cellInOrder] = frontCells[i];
-            cellInOrder++;
-        }
-
-        // From cells to faces
-        frontFaces.clear();
-        forAll(frontCells, i)
-        {
-            label cellI = frontCells[i];
-            const cell& cFaces = mesh.cells()[cellI];
-
-            forAll(cFaces, i)
-            {
-                label faceI = cFaces[i];
-                if (mesh.isInternalFace(faceI))
-                {
-                    label nbrCellI =
-                    (
-                        mesh.faceOwner()[faceI] == cellI
-                      ? mesh.faceNeighbour()[faceI]
-                      : mesh.faceOwner()[faceI]
-                    );
-                    if (distance[nbrCellI] == -1)
-                    {
-                        frontFaces.append(faceI);
-                    }
-                }
-            }
-        }
-
-        currentDistance++;
-    }
-
-    // Return furthest away cell first
-    if (reverse_)
-    {
-        reverse(newOrder);
-    }
-
-    //forAll(newOrder, i)
-    //{
-    //    label cellI = newOrder[i];
-    //
-    //    Pout<< "cell:" << cellI << endl;
-    //    Pout<< " at distance:" << distance[cellI]
-    //        << endl;
-    //}
-
-    return invert(newOrder.size(), newOrder);
-}
-
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H b/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
deleted file mode 100644
index 690af21455..0000000000
--- a/src/renumberMethods/boundaryFirstRenumber/boundaryFirstRenumber.H
+++ /dev/null
@@ -1,129 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-Class
-    Foam::boundaryFirstRenumber
-
-Description
-    Cuthill-McKee renumbering
-
-SourceFiles
-    boundaryFirstRenumber.C
-
-\*---------------------------------------------------------------------------*/
-
-#ifndef boundaryFirstRenumber_H
-#define boundaryFirstRenumber_H
-
-#include "renumberMethod.H"
-#include "Switch.H"
-
-namespace Foam
-{
-
-/*---------------------------------------------------------------------------*\
-                   Class boundaryFirstRenumber Declaration
-\*---------------------------------------------------------------------------*/
-
-class boundaryFirstRenumber
-:
-    public renumberMethod
-{
-    // Private data
-
-        const Switch reverse_;
-
-
-    // Private Member Functions
-
-        //- Disallow default bitwise copy construct and assignment
-        void operator=(const boundaryFirstRenumber&);
-        boundaryFirstRenumber(const boundaryFirstRenumber&);
-
-
-public:
-
-    //- Runtime type information
-    TypeName("boundaryFirst");
-
-
-    // Constructors
-
-        //- Construct given the renumber dictionary
-        boundaryFirstRenumber(const dictionary& renumberDict);
-
-
-    //- Destructor
-    virtual ~boundaryFirstRenumber()
-    {}
-
-
-    // Member Functions
-
-        //- Return for every coordinate the wanted processor number.
-        //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&) const
-        {
-            notImplemented
-            (
-                "boundaryFirstRenumber::renumber(const pointField&)"
-            );
-            return labelList(0);
-        }
-
-        //- Return for every coordinate the wanted processor number. Use the
-        //  mesh connectivity (if needed)
-        virtual labelList renumber
-        (
-            const polyMesh& mesh,
-            const pointField& cc
-        ) const;
-
-        //- Return for every cell the new cell label.
-        //  The connectivity is equal to mesh.cellCells() except
-        //  - the connections are across coupled patches
-        virtual labelList renumber
-        (
-            const labelListList& cellCells,
-            const pointField& cc
-        ) const
-        {
-            notImplemented
-            (
-                "boundaryFirstRenumber::renumber"
-                "(const labelListList&, const pointField&)"
-            );
-            return labelList(0);
-        }
-};
-
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-} // End namespace Foam
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-#endif
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/manualRenumber/manualRenumber.C b/src/renumberMethods/manualRenumber/manualRenumber.C
deleted file mode 100644
index 92b5c8e00c..0000000000
--- a/src/renumberMethods/manualRenumber/manualRenumber.C
+++ /dev/null
@@ -1,137 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-\*---------------------------------------------------------------------------*/
-
-#include "manualRenumber.H"
-#include "addToRunTimeSelectionTable.H"
-#include "IFstream.H"
-#include "labelIOList.H"
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-namespace Foam
-{
-    defineTypeNameAndDebug(manualRenumber, 0);
-
-    addToRunTimeSelectionTable
-    (
-        renumberMethod,
-        manualRenumber,
-        dictionary
-    );
-}
-
-
-// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
-
-Foam::manualRenumber::manualRenumber(const dictionary& renumberDict)
-:
-    renumberMethod(renumberDict),
-    dataFile_
-    (
-        renumberDict.subDict(typeName+"Coeffs").lookup("dataFile")
-    )
-{}
-
-
-// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
-
-Foam::labelList Foam::manualRenumber::renumber
-(
-    const polyMesh& mesh,
-    const pointField& points
-) const
-{
-    labelIOList oldToNew
-    (
-        IOobject
-        (
-            dataFile_,
-            mesh.facesInstance(),
-            mesh,
-            IOobject::MUST_READ,
-            IOobject::AUTO_WRITE,
-            false
-        )
-    );
-
-    // check if the final renumbering is OK
-
-    if (oldToNew.size() != points.size())
-    {
-        FatalErrorIn
-        (
-            "manualRenumber::renumber(const pointField&, const scalarField&)"
-        )   << "Size of renumber list does not correspond "
-            << "to the number of points.  Size: "
-            << oldToNew.size() << " Number of points: "
-            << points.size()
-            << ".\n" << "Manual renumbering data read from file "
-            << dataFile_ << "." << endl
-            << exit(FatalError);
-    }
-
-    // Invert to see if one to one
-    labelList newToOld(points.size(), -1);
-    forAll(oldToNew, i)
-    {
-        label newI = oldToNew[i];
-
-        if (newI < 0 || newI >= oldToNew.size())
-        {
-            FatalErrorIn
-            (
-                "manualRenumber::renumber(const pointField&"
-                ", const scalarField&)"
-            )   << "Renumbering is not one-to-one. Index "
-                << i << " maps onto " << newI
-                << ".\n" << "Manual renumbering data read from file "
-                << dataFile_ << "." << endl
-                << exit(FatalError);
-        }
-
-        if (newToOld[newI] == -1)
-        {
-            newToOld[newI] = i;
-        }
-        else
-        {
-            FatalErrorIn
-            (
-                "manualRenumber::renumber(const pointField&"
-                ", const scalarField&)"
-            )   << "Renumbering is not one-to-one. Both index "
-                << newToOld[newI]
-                << " and " << i << " map onto " << newI
-                << ".\n" << "Manual renumbering data read from file "
-                << dataFile_ << "." << endl
-                << exit(FatalError);
-        }
-    }
-
-    return oldToNew;
-}
-
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/manualRenumber/manualRenumber.H b/src/renumberMethods/manualRenumber/manualRenumber.H
deleted file mode 100644
index a4d4b2f46f..0000000000
--- a/src/renumberMethods/manualRenumber/manualRenumber.H
+++ /dev/null
@@ -1,125 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-Class
-    Foam::manualRenumber
-
-Description
-    Renumber given a cell-to-new cell association in a file
-
-SourceFiles
-    manualRenumber.C
-
-\*---------------------------------------------------------------------------*/
-
-#ifndef manualRenumber_H
-#define manualRenumber_H
-
-#include "renumberMethod.H"
-
-namespace Foam
-{
-
-/*---------------------------------------------------------------------------*\
-                      Class manualRenumber Declaration
-\*---------------------------------------------------------------------------*/
-
-class manualRenumber
-:
-    public renumberMethod
-{
-    // Private data
-
-        const fileName dataFile_;
-
-
-    // Private Member Functions
-
-        //- Disallow default bitwise copy construct and assignment
-        void operator=(const manualRenumber&);
-        manualRenumber(const manualRenumber&);
-
-
-public:
-
-    //- Runtime type information
-    TypeName("manual");
-
-
-    // Constructors
-
-        //- Construct given the renumber dictionary
-        manualRenumber(const dictionary& renumberDict);
-
-
-    //- Destructor
-    virtual ~manualRenumber()
-    {}
-
-
-    // Member Functions
-
-        //- Return for every coordinate the wanted processor number.
-        //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&) const
-        {
-            notImplemented("manualRenumber::renumber(const pointField&)");
-            return labelList(0);
-        }
-
-        //- Return for every coordinate the wanted processor number. Use the
-        //  mesh connectivity (if needed)
-        virtual labelList renumber
-        (
-            const polyMesh& mesh,
-            const pointField& cc
-        ) const;
-
-        //- Return for every cell the new cell label.
-        //  The connectivity is equal to mesh.cellCells() except
-        //  - the connections are across coupled patches
-        virtual labelList renumber
-        (
-            const labelListList& cellCells,
-            const pointField& cc
-        ) const
-        {
-            notImplemented
-            (
-                "manualRenumber::renumber"
-                "(const labelListList&, const pointField&)"
-            );
-            return labelList(0);
-        }
-};
-
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-} // End namespace Foam
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-#endif
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/randomRenumber/randomRenumber.C b/src/renumberMethods/randomRenumber/randomRenumber.C
deleted file mode 100644
index 2dae28e438..0000000000
--- a/src/renumberMethods/randomRenumber/randomRenumber.C
+++ /dev/null
@@ -1,96 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-\*---------------------------------------------------------------------------*/
-
-#include "randomRenumber.H"
-#include "addToRunTimeSelectionTable.H"
-#include "Random.H"
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-namespace Foam
-{
-    defineTypeNameAndDebug(randomRenumber, 0);
-
-    addToRunTimeSelectionTable
-    (
-        renumberMethod,
-        randomRenumber,
-        dictionary
-    );
-}
-
-
-// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
-
-Foam::randomRenumber::randomRenumber(const dictionary& renumberDict)
-:
-    renumberMethod(renumberDict)
-{}
-
-
-// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
-
-Foam::labelList Foam::randomRenumber::renumber
-(
-    const pointField& points
-) const
-{
-    Random rndGen(0);
-
-    labelList oldToNew(identity(points.size()));
-
-    for (label iter = 0; iter < 10; iter++)
-    {
-        forAll(oldToNew, i)
-        {
-            label j = rndGen.integer(0, oldToNew.size()-1);
-            Swap(oldToNew[i], oldToNew[j]);
-        }
-    }
-    return oldToNew;
-}
-
-
-Foam::labelList Foam::randomRenumber::renumber
-(
-    const polyMesh& mesh,
-    const pointField& points
-) const
-{
-    return renumber(points);
-}
-
-
-Foam::labelList Foam::randomRenumber::renumber
-(
-    const labelListList& cellCells,
-    const pointField& points
-) const
-{
-    return renumber(points);
-}
-
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/randomRenumber/randomRenumber.H b/src/renumberMethods/randomRenumber/randomRenumber.H
deleted file mode 100644
index 0665d5159b..0000000000
--- a/src/renumberMethods/randomRenumber/randomRenumber.H
+++ /dev/null
@@ -1,108 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-Class
-    Foam::randomRenumber
-
-Description
-    Random renumber. Just to see effect of renumbering.
-
-SourceFiles
-    randomRenumber.C
-
-\*---------------------------------------------------------------------------*/
-
-#ifndef randomRenumber_H
-#define randomRenumber_H
-
-#include "renumberMethod.H"
-
-namespace Foam
-{
-
-/*---------------------------------------------------------------------------*\
-                      Class randomRenumber Declaration
-\*---------------------------------------------------------------------------*/
-
-class randomRenumber
-:
-    public renumberMethod
-{
-    // Private Member Functions
-
-        //- Disallow default bitwise copy construct and assignment
-        void operator=(const randomRenumber&);
-        randomRenumber(const randomRenumber&);
-
-
-public:
-
-    //- Runtime type information
-    TypeName("random");
-
-
-    // Constructors
-
-        //- Construct given the renumber dictionary
-        randomRenumber(const dictionary& renumberDict);
-
-
-    //- Destructor
-    virtual ~randomRenumber()
-    {}
-
-
-    // Member Functions
-
-        //- Return for every coordinate the wanted processor number.
-        //  We need a polyMesh (to be able to load the file)
-        virtual labelList renumber(const pointField&) const;
-
-        //- Return for every coordinate the wanted processor number. Use the
-        //  mesh connectivity (if needed)
-        virtual labelList renumber
-        (
-            const polyMesh& mesh,
-            const pointField& cc
-        ) const;
-
-        //- Return for every cell the new cell label.
-        //  The connectivity is equal to mesh.cellCells() except
-        //  - the connections are across coupled patches
-        virtual labelList renumber
-        (
-            const labelListList& cellCells,
-            const pointField& cc
-        ) const;
-};
-
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-} // End namespace Foam
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-#endif
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/renumberMethod/renumberMethod.C b/src/renumberMethods/renumberMethod/renumberMethod.C
deleted file mode 100644
index 76ba1911e2..0000000000
--- a/src/renumberMethods/renumberMethod/renumberMethod.C
+++ /dev/null
@@ -1,131 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-InClass
-    renumberMethod
-
-\*---------------------------------------------------------------------------*/
-
-#include "renumberMethod.H"
-#include "decompositionMethod.H"
-
-// * * * * * * * * * * * * * * Static Data Members * * * * * * * * * * * * * //
-
-namespace Foam
-{
-    defineTypeNameAndDebug(renumberMethod, 0);
-    defineRunTimeSelectionTable(renumberMethod, dictionary);
-}
-
-// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
-
-Foam::autoPtr<Foam::renumberMethod> Foam::renumberMethod::New
-(
-    const dictionary& renumberDict
-)
-{
-    const word methodType(renumberDict.lookup("method"));
-
-    //Info<< "Selecting renumberMethod " << methodType << endl;
-
-    dictionaryConstructorTable::iterator cstrIter =
-        dictionaryConstructorTablePtr_->find(methodType);
-
-    if (cstrIter == dictionaryConstructorTablePtr_->end())
-    {
-        FatalErrorIn
-        (
-            "renumberMethod::New"
-            "(const dictionary& renumberDict)"
-        )   << "Unknown renumberMethod "
-            << methodType << nl << nl
-            << "Valid renumberMethods are : " << endl
-            << dictionaryConstructorTablePtr_->sortedToc()
-            << exit(FatalError);
-    }
-
-    return autoPtr<renumberMethod>(cstrIter()(renumberDict));
-}
-
-
-Foam::labelList Foam::renumberMethod::renumber
-(
-    const polyMesh& mesh,
-    const pointField& points
-) const
-{
-    CompactListList<label> cellCells;
-    decompositionMethod::calcCellCells
-    (
-        mesh,
-        identity(mesh.nCells()),
-        mesh.nCells(),
-        false,                      // local only
-        cellCells
-    );
-
-    // Renumber based on agglomerated points
-    return renumber(cellCells(), points);
-}
-
-
-Foam::labelList Foam::renumberMethod::renumber
-(
-    const polyMesh& mesh,
-    const labelList& fineToCoarse,
-    const pointField& coarsePoints
-) const
-{
-    CompactListList<label> coarseCellCells;
-    decompositionMethod::calcCellCells
-    (
-        mesh,
-        fineToCoarse,
-        coarsePoints.size(),
-        false,                      // local only
-        coarseCellCells
-    );
-
-    // Renumber based on agglomerated points
-    labelList coarseDistribution
-    (
-        renumber
-        (
-            coarseCellCells(),
-            coarsePoints
-        )
-    );
-
-    // Rework back into renumbering for original mesh_
-    labelList fineDistribution(fineToCoarse.size());
-
-    forAll(fineDistribution, i)
-    {
-        fineDistribution[i] = coarseDistribution[fineToCoarse[i]];
-    }
-
-    return fineDistribution;
-}
-
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/renumberMethod/renumberMethod.H b/src/renumberMethods/renumberMethod/renumberMethod.H
deleted file mode 100644
index ead92b1e41..0000000000
--- a/src/renumberMethods/renumberMethod/renumberMethod.H
+++ /dev/null
@@ -1,161 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-Class
-    Foam::renumberMethod
-
-Description
-    Abstract base class for renumbering
-
-SourceFiles
-    renumberMethod.C
-
-\*---------------------------------------------------------------------------*/
-
-#ifndef renumberMethod_H
-#define renumberMethod_H
-
-#include "polyMesh.H"
-#include "pointField.H"
-#include "CompactListList.H"
-
-namespace Foam
-{
-
-/*---------------------------------------------------------------------------*\
-                           Class renumberMethod Declaration
-\*---------------------------------------------------------------------------*/
-
-class renumberMethod
-{
-
-protected:
-
-    // Protected data
-
-        const dictionary& renumberDict_;
-
-private:
-
-    // Private Member Functions
-
-        //- Disallow default bitwise copy construct and assignment
-        renumberMethod(const renumberMethod&);
-        void operator=(const renumberMethod&);
-
-
-public:
-
-    //- Runtime type information
-    TypeName("renumberMethod");
-
-
-    // Declare run-time constructor selection tables
-
-        declareRunTimeSelectionTable
-        (
-            autoPtr,
-            renumberMethod,
-            dictionary,
-            (
-                const dictionary& renumberDict
-            ),
-            (renumberDict)
-        );
-
-
-    // Selectors
-
-        //- Return a reference to the selected renumbering method
-        static autoPtr<renumberMethod> New
-        (
-            const dictionary& renumberDict
-        );
-
-
-    // Constructors
-
-        //- Construct given the renumber dictionary
-        renumberMethod(const dictionary& renumberDict)
-        :
-            renumberDict_(renumberDict)
-        {}
-
-
-    //- Destructor
-    virtual ~renumberMethod()
-    {}
-
-
-    // Member Functions
-
-        //- Return for every cell the new cell label.
-        //  This is only defined for geometric renumberMethods.
-        virtual labelList renumber(const pointField&) const
-        {
-            notImplemented
-            (
-                "renumberMethod:renumber(const pointField&)"
-            );
-            return labelList(0);
-        }
-
-        //- Return for every cell the new cell label. Use the
-        //  mesh connectivity (if needed)
-        virtual labelList renumber(const polyMesh&, const pointField&) const;
-
-        //- Return for every cell the new cell label. Gets
-        //  passed agglomeration map (from fine to coarse cells) and coarse
-        //  cell
-        //  location. Can be overridden by renumberMethods that provide this
-        //  functionality natively. Coarse cells are local to the processor
-        //  (if in parallel). If you want to have coarse cells spanning
-        //  processors use the globalCellCells instead.
-        virtual labelList renumber
-        (
-            const polyMesh& mesh,
-            const labelList& cellToRegion,
-            const pointField& regionPoints
-        ) const;
-
-        //- Return for every cell the new cell label.
-        //  The connectivity is equal to mesh.cellCells() except
-        //  - the connections are across coupled patches
-        virtual labelList renumber
-        (
-            const labelListList& cellCells,
-            const pointField& cc
-        ) const = 0;
-
-};
-
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-} // End namespace Foam
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-#endif
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/springRenumber/springRenumber.C b/src/renumberMethods/springRenumber/springRenumber.C
deleted file mode 100644
index 64a15145ce..0000000000
--- a/src/renumberMethods/springRenumber/springRenumber.C
+++ /dev/null
@@ -1,172 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-\*---------------------------------------------------------------------------*/
-
-#include "springRenumber.H"
-#include "addToRunTimeSelectionTable.H"
-#include "decompositionMethod.H"
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-namespace Foam
-{
-    defineTypeNameAndDebug(springRenumber, 0);
-
-    addToRunTimeSelectionTable
-    (
-        renumberMethod,
-        springRenumber,
-        dictionary
-    );
-}
-
-
-// * * * * * * * * * * * * * * * * Constructors  * * * * * * * * * * * * * * //
-
-Foam::springRenumber::springRenumber(const dictionary& renumberDict)
-:
-    renumberMethod(renumberDict),
-    dict_(renumberDict.subDict(typeName+"Coeffs")),
-    maxCo_(readScalar(dict_.lookup("maxCo"))),
-    maxIter_(readLabel(dict_.lookup("maxIter"))),
-    freezeFraction_(readScalar(dict_.lookup("freezeFraction")))
-{}
-
-
-// * * * * * * * * * * * * * * * Member Functions  * * * * * * * * * * * * * //
-
-Foam::labelList Foam::springRenumber::renumber
-(
-    const polyMesh& mesh,
-    const pointField& points
-) const
-{
-    CompactListList<label> cellCells;
-    decompositionMethod::calcCellCells
-    (
-        mesh,
-        identity(mesh.nCells()),
-        mesh.nCells(),
-        false,                      // local only
-        cellCells
-    );
-
-    return renumber(cellCells(), points);
-}
-
-
-Foam::labelList Foam::springRenumber::renumber
-(
-    const labelListList& cellCells,
-    const pointField& points
-) const
-{
-    // Look at cell index as a 1D position parameter.
-    // Move cells to the average 'position' of their neighbour.
-
-    scalarField position(cellCells.size());
-    forAll(position, cellI)
-    {
-        position[cellI] = cellI;
-    }
-
-    labelList oldToNew(identity(cellCells.size()));
-
-    scalar maxCo = maxCo_ * cellCells.size();
-
-    for (label iter = 0; iter < maxIter_; iter++)
-    {
-        //Pout<< "Iteration : " << iter << nl
-        //    << "------------"
-        //    << endl;
-
-        //Pout<< "Position :" << nl
-        //    << "    min : " << min(position) << nl
-        //    << "    max : " << max(position) << nl
-        //    << "    avg : " << average(position) << nl
-        //    << endl;
-
-        // Sum force per cell.
-        scalarField sumForce(cellCells.size(), 0.0);
-        forAll(cellCells, oldCellI)
-        {
-            const labelList& cCells = cellCells[oldCellI];
-            label cellI = oldToNew[oldCellI];
-
-            forAll(cCells, i)
-            {
-                label nbrCellI = oldToNew[cCells[i]];
-
-                sumForce[cellI] += (position[nbrCellI]-position[cellI]);
-            }
-        }
-
-        //Pout<< "Force :" << nl
-        //    << "    min    : " << min(sumForce) << nl
-        //    << "    max    : " << max(sumForce) << nl
-        //    << "    avgMag : " << average(mag(sumForce)) << nl
-        //    << "DeltaT : " << deltaT << nl
-        //    << endl;
-
-        // Limit displacement
-        scalar deltaT = maxCo / max(mag(sumForce));
-
-        Info<< "Iter:" << iter
-            << "  maxCo:" << maxCo
-            << "  deltaT:" << deltaT
-            << "  average force:" << average(mag(sumForce)) << endl;
-
-        // Determine displacement.
-        scalarField displacement = deltaT*sumForce;
-
-        //Pout<< "Displacement :" << nl
-        //    << "    min    : " << min(displacement) << nl
-        //    << "    max    : " << max(displacement) << nl
-        //    << "    avgMag : " << average(mag(displacement)) << nl
-        //    << endl;
-
-        // Calculate new position and scale to be within original range
-        // (0..nCells-1) for ease of postprocessing.
-        position += displacement;
-        position -= min(position);
-        position *= (position.size()-1)/max(position);
-
-        // Slowly freeze.
-        maxCo *= freezeFraction_;
-    }
-
-    //writeOBJ("endPosition.obj", cellCells, position);
-
-    // Move cells to new position
-    labelList shuffle;
-    sortedOrder(position, shuffle);
-
-    // Reorder oldToNew
-    inplaceReorder(shuffle, oldToNew);
-
-    return oldToNew;
-}
-
-
-// ************************************************************************* //
diff --git a/src/renumberMethods/springRenumber/springRenumber.H b/src/renumberMethods/springRenumber/springRenumber.H
deleted file mode 100644
index 30f7a3d838..0000000000
--- a/src/renumberMethods/springRenumber/springRenumber.H
+++ /dev/null
@@ -1,132 +0,0 @@
-/*---------------------------------------------------------------------------*\
-  =========                 |
-  \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox
-   \\    /   O peration     |
-    \\  /    A nd           | Copyright (C) 2011 OpenFOAM Foundation
-     \\/     M anipulation  |
--------------------------------------------------------------------------------
-License
-    This file is part of OpenFOAM.
-
-    OpenFOAM is free software: you can redistribute it and/or modify it
-    under the terms of the GNU General Public License as published by
-    the Free Software Foundation, either version 3 of the License, or
-    (at your option) any later version.
-
-    OpenFOAM is distributed in the hope that it will be useful, but WITHOUT
-    ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
-    FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
-    for more details.
-
-    You should have received a copy of the GNU General Public License
-    along with OpenFOAM.  If not, see <http://www.gnu.org/licenses/>.
-
-Class
-    Foam::springRenumber
-
-Description
-    Use spring analogy - attract neighbouring cells according to the distance
-    of their cell indices.
-
-    // Maximum jump of cell indices. Is fraction of number of cells
-    maxCo 0.1;
-
-    // Limit the amount of movement; the fraction maxCo gets decreased
-    // with every iteration.
-    freezeFraction 0.9;
-
-    // Maximum number of iterations
-    maxIter 1000;
-
-SourceFiles
-    springRenumber.C
-
-\*---------------------------------------------------------------------------*/
-
-#ifndef springRenumber_H
-#define springRenumber_H
-
-#include "renumberMethod.H"
-
-namespace Foam
-{
-
-/*---------------------------------------------------------------------------*\
-                       Class springRenumber Declaration
-\*---------------------------------------------------------------------------*/
-
-class springRenumber
-:
-    public renumberMethod
-{
-    // Private data
-
-        const dictionary& dict_;
-
-        const scalar maxCo_;
-
-        const label maxIter_;
-
-        const scalar freezeFraction_;
-
-    // Private Member Functions
-
-        //- Disallow default bitwise copy construct and assignment
-        void operator=(const springRenumber&);
-        springRenumber(const springRenumber&);
-
-
-public:
-
-    //- Runtime type information
-    TypeName("spring");
-
-
-    // Constructors
-
-        //- Construct given the renumber dictionary
-        springRenumber(const dictionary& renumberDict);
-
-
-    //- Destructor
-    virtual ~springRenumber()
-    {}
-
-
-    // Member Functions
-
-        //- Return for every coordinate the wanted processor number.
-        virtual labelList renumber(const pointField&) const
-        {
-            notImplemented("springRenumber::renumber(const pointField&)");
-            return labelList(0);
-        }
-
-        //- Return for every coordinate the wanted processor number. Use the
-        //  mesh connectivity (if needed)
-        virtual labelList renumber
-        (
-            const polyMesh& mesh,
-            const pointField& cc
-        ) const;
-
-        //- Return for every cell the new cell label.
-        //  The connectivity is equal to mesh.cellCells() except
-        //  - the connections are across coupled patches
-        virtual labelList renumber
-        (
-            const labelListList& cellCells,
-            const pointField& cc
-        ) const;
-};
-
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-} // End namespace Foam
-
-// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
-
-#endif
-
-// ************************************************************************* //

From f4eeef024e1252e1a248add41b792fe4767916aa Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 23 Dec 2011 15:36:43 +0000
Subject: [PATCH 62/70] STYLE: duplicate ;;

---
 .../utilities/mesh/conversion/gambitToFoam/gambitToFoam.L | 2 +-
 .../USERD_get_number_of_files_in_dataset.H                | 2 +-
 .../cellPointWeight/cellPointWeight.C                     | 8 ++++----
 3 files changed, 6 insertions(+), 6 deletions(-)

diff --git a/applications/utilities/mesh/conversion/gambitToFoam/gambitToFoam.L b/applications/utilities/mesh/conversion/gambitToFoam/gambitToFoam.L
index 7706ccb272..dc4531fef6 100644
--- a/applications/utilities/mesh/conversion/gambitToFoam/gambitToFoam.L
+++ b/applications/utilities/mesh/conversion/gambitToFoam/gambitToFoam.L
@@ -433,7 +433,7 @@ mtype                 {space}"MTYPE:"{space}
         }
         else
         {
-            curGroupID = readLabel(groupStream);;
+            curGroupID = readLabel(groupStream);
         }
 
         BEGIN(cellStreams);
diff --git a/applications/utilities/postProcessing/graphics/ensightFoamReader/USERD_get_number_of_files_in_dataset.H b/applications/utilities/postProcessing/graphics/ensightFoamReader/USERD_get_number_of_files_in_dataset.H
index e2246d27da..ed936ee082 100644
--- a/applications/utilities/postProcessing/graphics/ensightFoamReader/USERD_get_number_of_files_in_dataset.H
+++ b/applications/utilities/postProcessing/graphics/ensightFoamReader/USERD_get_number_of_files_in_dataset.H
@@ -9,5 +9,5 @@ int USERD_get_number_of_files_in_dataset(void)
 
     // use 1 insted of 0 which gives an un-necessary warning.
     Num_dataset_files = 1;
-    return Num_dataset_files;;
+    return Num_dataset_files;
 }
diff --git a/src/finiteVolume/interpolation/interpolation/interpolationCellPoint/cellPointWeight/cellPointWeight.C b/src/finiteVolume/interpolation/interpolation/interpolationCellPoint/cellPointWeight/cellPointWeight.C
index 3ef207b702..13828ff7cf 100644
--- a/src/finiteVolume/interpolation/interpolation/interpolationCellPoint/cellPointWeight/cellPointWeight.C
+++ b/src/finiteVolume/interpolation/interpolation/interpolationCellPoint/cellPointWeight/cellPointWeight.C
@@ -83,8 +83,8 @@ void Foam::cellPointWeight::findTetrahedron
             )
             {
                 faceVertices_[0] = f[tetIs.faceBasePt()];
-                faceVertices_[1] = f[tetIs.facePtA()];;
-                faceVertices_[2] = f[tetIs.facePtB()];;
+                faceVertices_[1] = f[tetIs.facePtA()];
+                faceVertices_[2] = f[tetIs.facePtB()];
 
                 return;
             }
@@ -191,8 +191,8 @@ void Foam::cellPointWeight::findTriangle
                 weights_[3] = triWeights[2];
 
                 faceVertices_[0] = f[tetIs.faceBasePt()];
-                faceVertices_[1] = f[tetIs.facePtA()];;
-                faceVertices_[2] = f[tetIs.facePtB()];;
+                faceVertices_[1] = f[tetIs.facePtA()];
+                faceVertices_[2] = f[tetIs.facePtB()];
 
                 return;
             }

From b51dbec8d042fc4563014d4bc45537ffd7eb076e Mon Sep 17 00:00:00 2001
From: mattijs <mattijs>
Date: Fri, 23 Dec 2011 15:41:50 +0000
Subject: [PATCH 63/70] BUG: triangeI.H: barycentric coordinates error

---
 src/OpenFOAM/meshes/primitiveShapes/triangle/triangleI.H | 6 +++---
 1 file changed, 3 insertions(+), 3 deletions(-)

diff --git a/src/OpenFOAM/meshes/primitiveShapes/triangle/triangleI.H b/src/OpenFOAM/meshes/primitiveShapes/triangle/triangleI.H
index 3867915943..496442012d 100644
--- a/src/OpenFOAM/meshes/primitiveShapes/triangle/triangleI.H
+++ b/src/OpenFOAM/meshes/primitiveShapes/triangle/triangleI.H
@@ -277,9 +277,9 @@ Foam::scalar Foam::triangle<Point, PointRef>::barycentric
 
     bary.setSize(3);
 
-    bary[0] = (d11*d20 - d01*d21)/denom;
-    bary[1] = (d00*d21 - d01*d20)/denom;
-    bary[2] = 1.0 - bary[0] - bary[1];
+    bary[1] = (d11*d20 - d01*d21)/denom;
+    bary[2] = (d00*d21 - d01*d20)/denom;
+    bary[0] = 1.0 - bary[1] - bary[2];
 
     return denom;
 }

From a78a46e7c2196ecfcff3296afd86fee9ac90a554 Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 28 Dec 2011 17:46:51 +0000
Subject: [PATCH 64/70] symmTensor: Corrected symmTensor & symmTensor
 dot-product

---
 applications/test/tensor/Test-tensor.C                    | 4 ++++
 .../symmTensorFieldField/symmTensorFieldField.C           | 3 +++
 .../symmTensorFieldField/symmTensorFieldField.H           | 3 +++
 .../fields/Fields/symmTensorField/symmTensorField.C       | 3 +++
 .../fields/Fields/symmTensorField/symmTensorField.H       | 4 ++++
 .../GeometricSymmTensorField/GeometricSymmTensorField.C   | 3 +++
 .../GeometricSymmTensorField/GeometricSymmTensorField.H   | 4 ++++
 src/OpenFOAM/primitives/SymmTensor/SymmTensorI.H          | 8 ++++++--
 src/OpenFOAM/primitives/Tensor/Tensor.H                   | 4 +++-
 src/OpenFOAM/primitives/Tensor/TensorI.H                  | 2 ++
 10 files changed, 35 insertions(+), 3 deletions(-)

diff --git a/applications/test/tensor/Test-tensor.C b/applications/test/tensor/Test-tensor.C
index efc7824dd6..6da37d33ff 100644
--- a/applications/test/tensor/Test-tensor.C
+++ b/applications/test/tensor/Test-tensor.C
@@ -50,10 +50,14 @@ int main()
         << (t1 & t7 & t1.T()) << " " << transform(t1, t7) << endl;
 
     symmTensor st1(1, 2, 3, 4, 5, 6);
+    symmTensor st2(7, 8, 9, 10, 11, 12);
 
     Info<< "Check symmetric transformation "
         << transform(t1, st1) << endl;
 
+    Info<< "Check for dot product of symmetric tensors "
+        << (st1 & st2) << endl;
+
     vector v1(1, 2, 3);
 
     Info<< sqr(v1) << endl;
diff --git a/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.C b/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.C
index 4d1234dcb9..542493f182 100644
--- a/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.C
+++ b/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.C
@@ -55,6 +55,9 @@ UNARY_FUNCTION(symmTensor, symmTensor, inv)
 
 UNARY_OPERATOR(vector, symmTensor, *, hdual)
 
+BINARY_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+BINARY_TYPE_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
diff --git a/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.H b/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.H
index da45faa82c..56f5aac80b 100644
--- a/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.H
+++ b/src/OpenFOAM/fields/FieldFields/symmTensorFieldField/symmTensorFieldField.H
@@ -65,6 +65,9 @@ UNARY_FUNCTION(symmTensor, symmTensor, inv)
 
 UNARY_OPERATOR(vector, symmTensor, *, hdual)
 
+BINARY_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+BINARY_TYPE_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
diff --git a/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.C b/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.C
index 4d9e4b6dbc..fe5c4a3b79 100644
--- a/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.C
+++ b/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.C
@@ -164,6 +164,9 @@ tmp<Field<symmTensor> > transformFieldMask<symmTensor>
 
 UNARY_OPERATOR(vector, symmTensor, *, hdual)
 
+BINARY_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+BINARY_TYPE_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
diff --git a/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.H b/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.H
index b73e270e15..f3a8cabd23 100644
--- a/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.H
+++ b/src/OpenFOAM/fields/Fields/symmTensorField/symmTensorField.H
@@ -39,6 +39,7 @@ SourceFiles
 #include "vectorField.H"
 #include "sphericalTensor.H"
 #include "symmTensor.H"
+#include "tensor.H"
 
 #define TEMPLATE
 #include "FieldFunctionsM.H"
@@ -69,6 +70,9 @@ UNARY_FUNCTION(symmTensor, symmTensor, inv)
 
 UNARY_OPERATOR(vector, symmTensor, *, hdual)
 
+BINARY_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+BINARY_TYPE_OPERATOR(tensor, symmTensor, symmTensor, &, dot)
+
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
diff --git a/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.C b/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.C
index d513167527..23b616aa79 100644
--- a/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.C
+++ b/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.C
@@ -53,6 +53,9 @@ UNARY_FUNCTION(symmTensor, symmTensor, inv, inv)
 
 UNARY_OPERATOR(vector, symmTensor, *, hdual, transform)
 
+BINARY_OPERATOR(tensor, symmTensor, symmTensor, &, '&', dot)
+BINARY_TYPE_OPERATOR(tensor, symmTensor, symmTensor, &, '&', dot)
+
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
diff --git a/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.H b/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.H
index c0a8b81cde..67e1c84d0a 100644
--- a/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.H
+++ b/src/OpenFOAM/fields/GeometricFields/GeometricSymmTensorField/GeometricSymmTensorField.H
@@ -65,6 +65,10 @@ UNARY_FUNCTION(symmTensor, symmTensor, inv, inv)
 
 UNARY_OPERATOR(vector, symmTensor, *, hdual, transform)
 
+BINARY_OPERATOR(tensor, symmTensor, symmTensor, &, '&', dot)
+BINARY_TYPE_OPERATOR(tensor, symmTensor, symmTensor, &, '&', dot)
+
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 } // End namespace Foam
diff --git a/src/OpenFOAM/primitives/SymmTensor/SymmTensorI.H b/src/OpenFOAM/primitives/SymmTensor/SymmTensorI.H
index 5f9fbe9fe9..4566cc7550 100644
--- a/src/OpenFOAM/primitives/SymmTensor/SymmTensorI.H
+++ b/src/OpenFOAM/primitives/SymmTensor/SymmTensorI.H
@@ -24,6 +24,7 @@ License
 \*---------------------------------------------------------------------------*/
 
 #include "Vector.H"
+#include "Tensor.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
@@ -184,18 +185,21 @@ inline Vector<Cmpt> operator*(const SymmTensor<Cmpt>& st)
 
 //- Inner-product between two symmetric tensors
 template <class Cmpt>
-inline SymmTensor<Cmpt>
+inline Tensor<Cmpt>
 operator&(const SymmTensor<Cmpt>& st1, const SymmTensor<Cmpt>& st2)
 {
-    return SymmTensor<Cmpt>
+    return Tensor<Cmpt>
     (
         st1.xx()*st2.xx() + st1.xy()*st2.xy() + st1.xz()*st2.xz(),
         st1.xx()*st2.xy() + st1.xy()*st2.yy() + st1.xz()*st2.yz(),
         st1.xx()*st2.xz() + st1.xy()*st2.yz() + st1.xz()*st2.zz(),
 
+        st1.xy()*st2.xx() + st1.yy()*st2.xy() + st1.yz()*st2.xz(),
         st1.xy()*st2.xy() + st1.yy()*st2.yy() + st1.yz()*st2.yz(),
         st1.xy()*st2.xz() + st1.yy()*st2.yz() + st1.yz()*st2.zz(),
 
+        st1.xz()*st2.xx() + st1.yz()*st2.xy() + st1.zz()*st2.xz(),
+        st1.xz()*st2.xy() + st1.yz()*st2.yy() + st1.zz()*st2.yz(),
         st1.xz()*st2.xz() + st1.yz()*st2.yz() + st1.zz()*st2.zz()
     );
 }
diff --git a/src/OpenFOAM/primitives/Tensor/Tensor.H b/src/OpenFOAM/primitives/Tensor/Tensor.H
index c3dd5228e0..a1554dc916 100644
--- a/src/OpenFOAM/primitives/Tensor/Tensor.H
+++ b/src/OpenFOAM/primitives/Tensor/Tensor.H
@@ -40,13 +40,15 @@ SourceFiles
 
 #include "Vector.H"
 #include "SphericalTensor.H"
-#include "SymmTensor.H"
 
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 namespace Foam
 {
 
+template<class Cmpt>
+class SymmTensor;
+
 /*---------------------------------------------------------------------------*\
                            Class Tensor Declaration
 \*---------------------------------------------------------------------------*/
diff --git a/src/OpenFOAM/primitives/Tensor/TensorI.H b/src/OpenFOAM/primitives/Tensor/TensorI.H
index cbfe6772e1..237bb6ceb3 100644
--- a/src/OpenFOAM/primitives/Tensor/TensorI.H
+++ b/src/OpenFOAM/primitives/Tensor/TensorI.H
@@ -23,6 +23,8 @@ License
 
 \*---------------------------------------------------------------------------*/
 
+#include "SymmTensor.H"
+
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
 namespace Foam

From 49cd1382c5856e0163d0f2eaa458478d9e91e17b Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 28 Dec 2011 17:50:55 +0000
Subject: [PATCH 65/70] multiphaseEulerFoam: final version for ANL including ad
 hoc slamming energy attenuation source

---
 .../multiphase/multiphaseEulerFoam/UEqns.H    |  31 +-
 .../multiphaseEulerFoam/createFields.H        |   9 +
 .../multiphaseEulerFoam/interfacialCoeffs.H   |  80 --
 .../multiphaseEulerFoam/multiphaseEulerFoam.C |   1 -
 .../multiphase/multiphaseEulerFoam/pEqn.H     |  23 +-
 .../bubbleColumn/0/alphaair                   | 752 +++++++++---------
 .../multiphaseEulerFoam/bubbleColumn/0/alphas | 752 +++++++++---------
 .../bubbleColumn/0/alphawater                 | 752 +++++++++---------
 .../bubbleColumn/constant/LESProperties       |  59 +-
 .../bubbleColumn/system/setFieldsDict         |   2 +-
 10 files changed, 1178 insertions(+), 1283 deletions(-)
 delete mode 100644 applications/solvers/multiphase/multiphaseEulerFoam/interfacialCoeffs.H

diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/UEqns.H b/applications/solvers/multiphase/multiphaseEulerFoam/UEqns.H
index 1ee149c48e..bce95f7d5a 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/UEqns.H
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/UEqns.H
@@ -21,16 +21,27 @@ forAllIter(PtrDictionary<phaseModel>, fluid.phases(), iter)
               + fvm::div(phase.phiAlpha(), U)
               - fvm::Sp(fvc::ddt(alpha) + fvc::div(phase.phiAlpha()), U)
             )
-            - fvm::laplacian(alpha*nuEff, U)
-            - fvc::div
-              (
-                  alpha*(nuEff*dev(T(fvc::grad(U))) /*- ((2.0/3.0)*I)*k*/),
-                  "div(Rc)"
-              )
-          ==
-            - fvm::Sp(fluid.dragCoeff(phase, dragCoeffs())/phase.rho(), U)
-          //- (alpha*phase.rho())*fluid.lift(phase)
-            + (alpha/phase.rho())*fluid.Svm(phase)
+          - fvm::laplacian(alpha*nuEff, U)
+          - fvc::div
+            (
+                alpha*(nuEff*dev(T(fvc::grad(U))) /*- ((2.0/3.0)*I)*k*/),
+                "div(Rc)"
+            )
+         ==
+          - fvm::Sp(fluid.dragCoeff(phase, dragCoeffs())/phase.rho(), U)
+        //- (alpha*phase.rho())*fluid.lift(phase)
+          + (alpha/phase.rho())*fluid.Svm(phase)
+          - fvm::Sp
+            (
+                slamDampCoeff
+               *max
+                (
+                    mag(U.dimensionedInternalField()) - maxSlamVelocity,
+                    dimensionedScalar("U0", dimVelocity, 0)
+                )
+               /pow(mesh.V(), 1.0/3.0),
+                U
+            )
         )
     );
     mrfZones.addCoriolis(alpha, UEqns[phasei]);
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H b/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H
index 484ceae4ac..7e24071893 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H
@@ -53,6 +53,15 @@
         phi += fvc::interpolate(alpha)*phase.phi();
     }
 
+    scalar slamDampCoeff(readScalar(fluid.lookup("slamDampCoeff")));
+
+    dimensionedScalar maxSlamVelocity
+    (
+        "maxSlamVelocity",
+        dimVelocity,
+        fluid.lookup("maxSlamVelocity")
+    );
+
     // dimensionedScalar pMin
     // (
     //     "pMin",
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialCoeffs.H b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialCoeffs.H
deleted file mode 100644
index 436b68a2f2..0000000000
--- a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialCoeffs.H
+++ /dev/null
@@ -1,80 +0,0 @@
-volScalarField dragCoeff
-(
-    IOobject
-    (
-        "dragCoeff",
-        runTime.timeName(),
-        mesh
-    ),
-    mesh,
-    dimensionedScalar("dragCoeff", dimensionSet(1, -3, -1, 0, 0), 0)
-);
-
-volVectorField liftForce
-(
-    IOobject
-    (
-        "liftForce",
-        runTime.timeName(),
-        mesh
-    ),
-    mesh,
-    dimensionedVector("liftForce", dimensionSet(1, -2, -2, 0, 0), vector::zero)
-);
-
-volScalarField heatTransferCoeff
-(
-    IOobject
-    (
-        "heatTransferCoeff",
-        runTime.timeName(),
-        mesh
-    ),
-    mesh,
-    dimensionedScalar("heatTransferCoeff", dimensionSet(1, -1, -3, -1, 0), 0)
-);
-
-{
-    volVectorField Ur = U1 - U2;
-    volScalarField magUr = mag(Ur);
-
-    if (dispersedPhase == "1")
-    {
-        dragCoeff = drag1->K(magUr);
-        heatTransferCoeff = heatTransfer1->K(magUr);
-    }
-    else if (dispersedPhase == "2")
-    {
-        dragCoeff = drag2->K(magUr);
-        heatTransferCoeff = heatTransfer2->K(magUr);
-    }
-    else if (dispersedPhase == "both")
-    {
-        dragCoeff =
-        (
-            alpha2*drag1->K(magUr)
-          + alpha1*drag2->K(magUr)
-        );
-
-        heatTransferCoeff =
-        (
-            alpha2*heatTransfer1->K(magUr)
-          + alpha1*heatTransfer2->K(magUr)
-        );
-    }
-    else
-    {
-        FatalErrorIn(args.executable())
-            << "dispersedPhase: " << dispersedPhase << " is incorrect"
-            << exit(FatalError);
-    }
-
-    volScalarField alphaCoeff
-    (
-        (alpha1 + minInterfaceAlpha)*(alpha2 + minInterfaceAlpha)
-    );
-    dragCoeff *= alphaCoeff;
-    heatTransferCoeff *= alphaCoeff;
-
-    liftForce = Cl*(alpha1*rho1 + alpha2*rho2)*(Ur ^ fvc::curl(U));
-}
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseEulerFoam.C b/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseEulerFoam.C
index 4ca01f1a3a..c1d3126352 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseEulerFoam.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/multiphaseEulerFoam.C
@@ -82,7 +82,6 @@ int main(int argc, char *argv[])
             rho = fluid.rho();
             #include "zonePhaseVolumes.H"
 
-            //#include "interfacialCoeffs.H"
             //#include "TEqns.H"
             #include "UEqns.H"
 
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H b/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H
index 744faab968..b93ea3a020 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/pEqn.H
@@ -37,8 +37,10 @@
 
         U0s.set(phasei, new volVectorField(phase.U()));
         phi0s.set(phasei, new surfaceScalarField(phase.phi()));
+        mrfZones.absoluteFlux(phi0s[phasei]);
 
         phasei++;
+
     }
 
     surfaceScalarField phi0
@@ -67,6 +69,8 @@
 
         phase.U() = rAUs[phasei]*UEqns[phasei].H();
 
+        phase.phi().oldTime();
+        mrfZones.absoluteFlux(phase.phi().oldTime());
         mrfZones.absoluteFlux(phase.phi());
         phase.phi() =
         (
@@ -74,7 +78,8 @@
           + fvc::ddtPhiCorr(rAUs[phasei], alpha, phase.U(), phase.phi())
         );
         mrfZones.relativeFlux(phase.phi());
-        surfaceScalarField pphi0("pphi0", phase.phi());
+        mrfZones.relativeFlux(phase.phi().oldTime());
+        surfaceScalarField pphi0("pphi0", 1.0*phase.phi());
         pphi0 += rAlphaAUfs[phasei]*(g & mesh.Sf());
 
         multiphaseSystem::dragModelTable::const_iterator dmIter =
@@ -196,7 +201,7 @@
             p.relax();
             mSfGradp = pEqnIncomp.flux()/Dp;
 
-            U =  dimensionedVector("U", dimVelocity, vector::zero);
+            U = dimensionedVector("U", dimVelocity, vector::zero);
 
             phasei = 0;
             forAllIter(PtrDictionary<phaseModel>, fluid.phases(), iter)
@@ -254,9 +259,17 @@
                             phasej++;
                         }
 
-                        phase.U() +=
-                            (1.0/phase.rho())
-                           *rAUs[phasei]*(*dcIter())*U0s[phasej];
+                        // phase.U() +=
+                        //     (1.0/phase.rho())*rAUs[phasei]*(*dcIter())
+                        //    *U0s[phasej];
+
+                        phase.U() += fvc::reconstruct
+                        (
+                            fvc::interpolate
+                            (
+                                (1.0/phase.rho())*rAUs[phasei]*(*dcIter())
+                            )*phi0s[phasej]
+                        );
                     }
                 }
 
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair
index 459439ad6a..55830fd6c2 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair
@@ -17,7 +17,7 @@ FoamFile
 
 dimensions      [0 0 0 0 0 0 0];
 
-internalField   nonuniform List<scalar>
+internalField   nonuniform List<scalar> 
 1875
 (
 0
@@ -970,381 +970,381 @@ internalField   nonuniform List<scalar>
 0
 0
 0
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
-1
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
+0
 1
 1
 1
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas
index fc0a0cff80..dd956f6f6b 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas
@@ -17,7 +17,7 @@ FoamFile
 
 dimensions      [0 0 0 0 0 0 0];
 
-internalField   nonuniform List<scalar>
+internalField   nonuniform List<scalar> 
 1875
 (
 1
@@ -970,381 +970,381 @@ internalField   nonuniform List<scalar>
 1
 1
 1
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
 0
 0
 0
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater
index b54346a56e..5e4ea5a4bb 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater
@@ -17,7 +17,7 @@ FoamFile
 
 dimensions      [0 0 0 0 0 0 0];
 
-internalField   nonuniform List<scalar>
+internalField   nonuniform List<scalar> 
 1875
 (
 1
@@ -970,381 +970,381 @@ internalField   nonuniform List<scalar>
 1
 1
 1
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
-0
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
+1
 0
 0
 0
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/constant/LESProperties b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/constant/LESProperties
index 67d1183916..ec20bc01dc 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/constant/LESProperties
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/constant/LESProperties
@@ -15,7 +15,7 @@ FoamFile
 }
 // * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
 
-LESModel        Smagorinsky;
+LESModel        laminar;
 
 printCoeffs     on;
 
@@ -26,61 +26,4 @@ cubeRootVolCoeffs
     deltaCoeff      1;
 }
 
-PrandtlCoeffs
-{
-    delta           cubeRootVol;
-    cubeRootVolCoeffs
-    {
-        deltaCoeff      1;
-    }
-
-    smoothCoeffs
-    {
-        delta           cubeRootVol;
-        cubeRootVolCoeffs
-        {
-            deltaCoeff      1;
-        }
-
-        maxDeltaRatio   1.1;
-    }
-
-    Cdelta          0.158;
-}
-
-vanDriestCoeffs
-{
-    delta           cubeRootVol;
-    cubeRootVolCoeffs
-    {
-        deltaCoeff      1;
-    }
-
-    smoothCoeffs
-    {
-        delta           cubeRootVol;
-        cubeRootVolCoeffs
-        {
-            deltaCoeff      1;
-        }
-
-        maxDeltaRatio   1.1;
-    }
-
-    Aplus           26;
-    Cdelta          0.158;
-}
-
-smoothCoeffs
-{
-    delta           cubeRootVol;
-    cubeRootVolCoeffs
-    {
-        deltaCoeff      1;
-    }
-
-    maxDeltaRatio   1.1;
-}
-
-
 // ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/system/setFieldsDict b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/system/setFieldsDict
index 6c6bd80320..755148a96e 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/system/setFieldsDict
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/system/setFieldsDict
@@ -25,7 +25,7 @@ regions
 (
     boxToCell
     {
-        box (0 0 -0.1) (0.15 0.501 0.1);
+        box (0 0 -0.1) (0.15 0.701 0.1);
         fieldValues
         (
             volScalarFieldValue alphaair 0

From 2a6b61d1910f5db62d7bb22a9c1001a1d8d2f9f9 Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Wed, 28 Dec 2011 17:53:12 +0000
Subject: [PATCH 66/70] multiphaseEulerFoam/damBreak4phaseFine: new tutorial

---
 .../bubbleColumn/0/alphaair                   |   2 +-
 .../multiphaseEulerFoam/bubbleColumn/0/alphas |   2 +-
 .../bubbleColumn/0/alphawater                 |   2 +-
 .../damBreak4phaseFine/0.org/U                |  51 ++++
 .../damBreak4phaseFine/0.org/Uair             |  51 ++++
 .../damBreak4phaseFine/0.org/Umercury         |  51 ++++
 .../damBreak4phaseFine/0.org/Uoil             |  51 ++++
 .../damBreak4phaseFine/0.org/Uwater           |  51 ++++
 .../damBreak4phaseFine/0.org/alphaair         |  79 ++++++
 .../damBreak4phaseFine/0.org/alphamercury     |  49 ++++
 .../damBreak4phaseFine/0.org/alphaoil         |  49 ++++
 .../damBreak4phaseFine/0.org/alphas           |  47 ++++
 .../damBreak4phaseFine/0.org/alphawater       |  49 ++++
 .../damBreak4phaseFine/0.org/p                |  59 +++++
 .../damBreak4phaseFine/Allclean               |  11 +
 .../damBreak4phaseFine/Allrun                 |  19 ++
 .../damBreak4phaseFine/constant/LESProperties |  29 ++
 .../damBreak4phaseFine/constant/MRFZones      |  20 ++
 .../damBreak4phaseFine/constant/g             |  22 ++
 .../constant/motionProperties                 |  21 ++
 .../constant/polyMesh/blockMeshDict           | 108 ++++++++
 .../constant/polyMesh/boundary                |  52 ++++
 .../constant/transportProperties              | 248 ++++++++++++++++++
 .../constant/turbulenceProperties             |  21 ++
 .../damBreak4phaseFine/system/controlDict     |  56 ++++
 .../system/decomposeParDict                   |  45 ++++
 .../damBreak4phaseFine/system/fvSchemes       |  61 +++++
 .../damBreak4phaseFine/system/fvSolution      |  94 +++++++
 .../damBreak4phaseFine/system/setFieldsDict   |  65 +++++
 29 files changed, 1462 insertions(+), 3 deletions(-)
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/U
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uair
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Umercury
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uoil
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uwater
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaair
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphamercury
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaoil
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphas
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphawater
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/p
 create mode 100755 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allclean
 create mode 100755 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allrun
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/LESProperties
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/MRFZones
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/g
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/motionProperties
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/blockMeshDict
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/boundary
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/transportProperties
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/turbulenceProperties
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/controlDict
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/decomposeParDict
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSchemes
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSolution
 create mode 100644 tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/setFieldsDict

diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair
index 55830fd6c2..11b988820d 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphaair
@@ -17,7 +17,7 @@ FoamFile
 
 dimensions      [0 0 0 0 0 0 0];
 
-internalField   nonuniform List<scalar> 
+internalField   nonuniform List<scalar>
 1875
 (
 0
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas
index dd956f6f6b..b32a5dff46 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphas
@@ -17,7 +17,7 @@ FoamFile
 
 dimensions      [0 0 0 0 0 0 0];
 
-internalField   nonuniform List<scalar> 
+internalField   nonuniform List<scalar>
 1875
 (
 1
diff --git a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater
index 5e4ea5a4bb..e2a093f9e4 100644
--- a/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater
+++ b/tutorials/multiphase/multiphaseEulerFoam/bubbleColumn/0/alphawater
@@ -17,7 +17,7 @@ FoamFile
 
 dimensions      [0 0 0 0 0 0 0];
 
-internalField   nonuniform List<scalar> 
+internalField   nonuniform List<scalar>
 1875
 (
 1
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/U b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/U
new file mode 100644
index 0000000000..b82b7ce18a
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/U
@@ -0,0 +1,51 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volVectorField;
+    location    "0";
+    object      U;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 1 -1 0 0 0 0];
+
+internalField   uniform (0 0 0);
+
+boundaryField
+{
+    leftWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    rightWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    lowerWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    atmosphere
+    {
+        type            fluxCorrectedVelocity;
+        value           uniform (0 0 0);
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uair b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uair
new file mode 100644
index 0000000000..e6cb214d17
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uair
@@ -0,0 +1,51 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volVectorField;
+    location    "0";
+    object      Uair;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 1 -1 0 0 0 0];
+
+internalField   uniform (0 0 0);
+
+boundaryField
+{
+    leftWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    rightWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    lowerWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    atmosphere
+    {
+        type            fluxCorrectedVelocity;
+        value           uniform (0 0 0);
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Umercury b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Umercury
new file mode 100644
index 0000000000..71ee76460b
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Umercury
@@ -0,0 +1,51 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volVectorField;
+    location    "0";
+    object      Umercury;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 1 -1 0 0 0 0];
+
+internalField   uniform (0 0 0);
+
+boundaryField
+{
+    leftWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    rightWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    lowerWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    atmosphere
+    {
+        type            fluxCorrectedVelocity;
+        value           uniform (0 0 0);
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uoil b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uoil
new file mode 100644
index 0000000000..4f5e766638
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uoil
@@ -0,0 +1,51 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volVectorField;
+    location    "0";
+    object      Uoil;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 1 -1 0 0 0 0];
+
+internalField   uniform (0 0 0);
+
+boundaryField
+{
+    leftWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    rightWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    lowerWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    atmosphere
+    {
+        type            fluxCorrectedVelocity;
+        value           uniform (0 0 0);
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uwater b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uwater
new file mode 100644
index 0000000000..4977c8a6d5
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/Uwater
@@ -0,0 +1,51 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volVectorField;
+    location    "0";
+    object      Uwater;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 1 -1 0 0 0 0];
+
+internalField   uniform (0 0 0);
+
+boundaryField
+{
+    leftWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    rightWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    lowerWall
+    {
+        type            fixedValue;
+        value           uniform (0 0 0);
+    }
+    atmosphere
+    {
+        type            fluxCorrectedVelocity;
+        value           uniform (0 0 0);
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaair b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaair
new file mode 100644
index 0000000000..ba8f818579
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaair
@@ -0,0 +1,79 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volScalarField;
+    location    "0";
+    object      alphaair;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 0 0 0 0 0 0];
+
+internalField   uniform 0;
+
+boundaryField
+{
+    leftWall
+    {
+        type            alphaContactAngle;
+        thetaProperties
+        (
+            ( water air ) 90 0 0 0
+            ( oil air ) 90 0 0 0
+            ( mercury air ) 90 0 0 0
+            ( water oil ) 90 0 0 0
+            ( water mercury ) 90 0 0 0
+            ( oil mercury ) 90 0 0 0
+        );
+        value           uniform 0;
+    }
+    rightWall
+    {
+        type            alphaContactAngle;
+        thetaProperties
+        (
+            ( water air ) 90 0 0 0
+            ( oil air ) 90 0 0 0
+            ( mercury air ) 90 0 0 0
+            ( water oil ) 90 0 0 0
+            ( water mercury ) 90 0 0 0
+            ( oil mercury ) 90 0 0 0
+        );
+        value           uniform 1;
+    }
+    lowerWall
+    {
+        type            alphaContactAngle;
+        thetaProperties
+        (
+            ( water air ) 90 0 0 0
+            ( oil air ) 90 0 0 0
+            ( mercury air ) 90 0 0 0
+            ( water oil ) 90 0 0 0
+            ( water mercury ) 90 0 0 0
+            ( oil mercury ) 90 0 0 0
+        );
+        value           uniform 0;
+    }
+    atmosphere
+    {
+        type            inletOutlet;
+        inletValue      uniform 1;
+        value           uniform 1;
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphamercury b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphamercury
new file mode 100644
index 0000000000..598b083fef
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphamercury
@@ -0,0 +1,49 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volScalarField;
+    location    "0";
+    object      alphamercury;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 0 0 0 0 0 0];
+
+internalField   uniform 0;
+
+boundaryField
+{
+    leftWall
+    {
+        type            zeroGradient;
+    }
+    rightWall
+    {
+        type            zeroGradient;
+    }
+    lowerWall
+    {
+        type            zeroGradient;
+    }
+    atmosphere
+    {
+        type            inletOutlet;
+        inletValue      uniform 0;
+        value           uniform 0;
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaoil b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaoil
new file mode 100644
index 0000000000..21ce07a42c
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphaoil
@@ -0,0 +1,49 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volScalarField;
+    location    "0";
+    object      alphaoil;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 0 0 0 0 0 0];
+
+internalField   uniform 0;
+
+boundaryField
+{
+    leftWall
+    {
+        type            zeroGradient;
+    }
+    rightWall
+    {
+        type            zeroGradient;
+    }
+    lowerWall
+    {
+        type            zeroGradient;
+    }
+    atmosphere
+    {
+        type            inletOutlet;
+        inletValue      uniform 0;
+        value           uniform 0;
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphas b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphas
new file mode 100644
index 0000000000..10e3ea7a07
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphas
@@ -0,0 +1,47 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volScalarField;
+    location    "0";
+    object      alphas;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 0 0 0 0 0 0];
+
+internalField   uniform 0;
+
+boundaryField
+{
+    leftWall
+    {
+        type            zeroGradient;
+    }
+    rightWall
+    {
+        type            zeroGradient;
+    }
+    lowerWall
+    {
+        type            zeroGradient;
+    }
+    atmosphere
+    {
+        type            zeroGradient;
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphawater b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphawater
new file mode 100644
index 0000000000..a91b1a5968
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/alphawater
@@ -0,0 +1,49 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volScalarField;
+    location    "0";
+    object      alphawater;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 0 0 0 0 0 0];
+
+internalField   uniform 0;
+
+boundaryField
+{
+    leftWall
+    {
+        type            zeroGradient;
+    }
+    rightWall
+    {
+        type            zeroGradient;
+    }
+    lowerWall
+    {
+        type            zeroGradient;
+    }
+    atmosphere
+    {
+        type            inletOutlet;
+        inletValue      uniform 0;
+        value           uniform 0;
+    }
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/p b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/p
new file mode 100644
index 0000000000..7d12a33956
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/0.org/p
@@ -0,0 +1,59 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       volScalarField;
+    object      p;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [1 -1 -2 0 0 0 0];
+
+internalField   uniform 0;
+
+boundaryField
+{
+    leftWall
+    {
+        type            multiphaseFixedFluxPressure;
+        value           uniform 0;
+    }
+
+    rightWall
+    {
+        type            multiphaseFixedFluxPressure;
+        value           uniform 0;
+    }
+
+    lowerWall
+    {
+        type            multiphaseFixedFluxPressure;
+        value           uniform 0;
+    }
+
+    atmosphere
+    {
+        type            totalPressure;
+        p0              uniform 0;
+        U               Uair;
+        phi             phiair;
+        rho             rho;
+        psi             none;
+        gamma           1;
+        value           uniform 0;
+    }
+
+    defaultFaces
+    {
+        type            empty;
+    }
+}
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allclean b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allclean
new file mode 100755
index 0000000000..cd78b26599
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allclean
@@ -0,0 +1,11 @@
+#!/bin/sh
+cd ${0%/*} || exit 1    # run from this directory
+
+# Source tutorial clean functions
+. $WM_PROJECT_DIR/bin/tools/CleanFunctions
+
+cleanCase
+
+\rm -rf 0
+
+# ----------------------------------------------------------------- end-of-file
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allrun b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allrun
new file mode 100755
index 0000000000..300fc394aa
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/Allrun
@@ -0,0 +1,19 @@
+#!/bin/sh
+cd ${0%/*} || exit 1    # run from this directory
+
+# Source tutorial run functions
+. $WM_PROJECT_DIR/bin/tools/RunFunctions
+
+# Set application name
+application=`getApplication`
+
+\rm -rf 0
+cp -r 0.org 0
+
+runApplication blockMesh
+runApplication setFields
+runApplication decomposePar
+runParallel $application 4
+runApplication reconstructPar
+
+# ----------------------------------------------------------------- end-of-file
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/LESProperties b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/LESProperties
new file mode 100644
index 0000000000..ec20bc01dc
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/LESProperties
@@ -0,0 +1,29 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "constant";
+    object      LESProperties;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+LESModel        laminar;
+
+printCoeffs     on;
+
+delta           cubeRootVol;
+
+cubeRootVolCoeffs
+{
+    deltaCoeff      1;
+}
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/MRFZones b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/MRFZones
new file mode 100644
index 0000000000..0034a58c22
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/MRFZones
@@ -0,0 +1,20 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "constant";
+    object      MRFZones;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+0()
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/g b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/g
new file mode 100644
index 0000000000..e0ac2653b5
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/g
@@ -0,0 +1,22 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       uniformDimensionedVectorField;
+    location    "constant";
+    object      g;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+dimensions      [0 1 -2 0 0 0 0];
+value           ( 0 -9.81 0 );
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/motionProperties b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/motionProperties
new file mode 100644
index 0000000000..93e0701984
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/motionProperties
@@ -0,0 +1,21 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "constant";
+    object      motionProperties;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+movingFvMesh    staticFvMesh;
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/blockMeshDict b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/blockMeshDict
new file mode 100644
index 0000000000..fd11bf53fd
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/blockMeshDict
@@ -0,0 +1,108 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    object      blockMeshDict;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+convertToMeters 0.146;
+
+vertices
+(
+    (0 0 0)
+    (2 0 0)
+    (2.16438 0 0)
+    (4 0 0)
+    (0 0.32876 0)
+    (2 0.32876 0)
+    (2.16438 0.32876 0)
+    (4 0.32876 0)
+    (0 4 0)
+    (2 4 0)
+    (2.16438 4 0)
+    (4 4 0)
+    (0 0 0.1)
+    (2 0 0.1)
+    (2.16438 0 0.1)
+    (4 0 0.1)
+    (0 0.32876 0.1)
+    (2 0.32876 0.1)
+    (2.16438 0.32876 0.1)
+    (4 0.32876 0.1)
+    (0 4 0.1)
+    (2 4 0.1)
+    (2.16438 4 0.1)
+    (4 4 0.1)
+);
+
+blocks
+(
+    hex (0 1 5 4 12 13 17 16) (92 15 1) simpleGrading (1 1 1)
+    hex (2 3 7 6 14 15 19 18) (76 15 1) simpleGrading (1 1 1)
+    hex (4 5 9 8 16 17 21 20) (92 180 1) simpleGrading (1 1 1)
+    hex (5 6 10 9 17 18 22 21) (8 180 1) simpleGrading (1 1 1)
+    hex (6 7 11 10 18 19 23 22) (76 180 1) simpleGrading (1 1 1)
+);
+
+edges
+(
+);
+
+boundary
+(
+    leftWall
+    {
+        type wall;
+        faces
+        (
+            (0 12 16 4)
+            (4 16 20 8)
+        );
+    }
+    rightWall
+    {
+        type wall;
+        faces
+        (
+            (7 19 15 3)
+            (11 23 19 7)
+        );
+    }
+    lowerWall
+    {
+        type wall;
+        faces
+        (
+            (0 1 13 12)
+            (1 5 17 13)
+            (5 6 18 17)
+            (2 14 18 6)
+            (2 3 15 14)
+        );
+    }
+    atmosphere
+    {
+        type patch;
+        faces
+        (
+            (8 20 21 9)
+            (9 21 22 10)
+            (10 22 23 11)
+        );
+    }
+);
+
+mergePatchPairs
+(
+);
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/boundary b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/boundary
new file mode 100644
index 0000000000..04429b16df
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/polyMesh/boundary
@@ -0,0 +1,52 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       polyBoundaryMesh;
+    location    "constant/polyMesh";
+    object      boundary;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+5
+(
+    leftWall
+    {
+        type            wall;
+        nFaces          195;
+        startFace       68014;
+    }
+    rightWall
+    {
+        type            wall;
+        nFaces          195;
+        startFace       68209;
+    }
+    lowerWall
+    {
+        type            wall;
+        nFaces          206;
+        startFace       68404;
+    }
+    atmosphere
+    {
+        type            patch;
+        nFaces          176;
+        startFace       68610;
+    }
+    defaultFaces
+    {
+        type            empty;
+        nFaces          68400;
+        startFace       68786;
+    }
+)
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/transportProperties b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/transportProperties
new file mode 100644
index 0000000000..fad0a7a482
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/transportProperties
@@ -0,0 +1,248 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "constant";
+    object      transportProperties;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+phases
+(
+     water
+     {
+         nu         1e-06;
+         kappa      1e-06;
+         Cp         4195;
+         rho        1000;
+
+         diameterModel constant;
+         constantCoeffs
+         {
+             d               1e-3;
+         }
+     }
+
+     oil
+     {
+         nu         1e-06;
+         kappa      1e-06;
+         Cp         4195;
+         rho        500;
+
+         diameterModel constant;
+         constantCoeffs
+         {
+             d               1e-3;
+         }
+     }
+
+     mercury
+     {
+         nu         1.125e-07;
+         kappa      1e-06;
+         Cp         4195;
+         rho        13529;
+
+         diameterModel constant;
+         constantCoeffs
+         {
+             d               1e-3;
+         }
+     }
+
+     air
+     {
+         nu         1.48e-05;
+         kappa      2.63e-2;
+         Cp         1007;
+         rho        1;
+
+         diameterModel constant;
+         constantCoeffs
+         {
+             d              3e-3;
+         }
+     }
+);
+
+sigmas
+(
+    (air water)     0.07
+    (air oil)       0.07
+    (air mercury)   0.07
+    (water oil)     0
+    (water mercury) 0
+    (oil mercury)   0
+);
+
+interfaceCompression
+(
+    (air water)     1
+    (air oil)       1
+    (air mercury)   1
+    (water oil)     0
+    (water mercury) 0
+    (oil mercury)   0
+);
+
+virtualMass
+(
+    (air water)     0
+    (air oil)       0
+    (air mercury)   0
+    (water oil)     0.5
+    (water mercury) 0.5
+    (oil mercury)   0.5
+);
+
+drag
+(
+    (air water)
+    {
+        type blended;
+
+        air
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        water
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (air oil)
+    {
+        type blended;
+
+        air
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        oil
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (air mercury)
+    {
+        type blended;
+
+        air
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        mercury
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (water oil)
+    {
+        type blended;
+
+        water
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        oil
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (water mercury)
+    {
+        type blended;
+
+        water
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        mercury
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+
+    (oil mercury)
+    {
+        type blended;
+
+        oil
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        mercury
+        {
+            type SchillerNaumann;
+            residualPhaseFraction 0;
+            residualSlip 0;
+        }
+
+        residualPhaseFraction 1e-3;
+        residualSlip 1e-3;
+    }
+);
+
+
+// This is a dummy to support the Smagorinsky model
+transportModel  Newtonian;
+nu              nu [ 0 2 -1 0 0 0 0 ] 0;
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/turbulenceProperties b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/turbulenceProperties
new file mode 100644
index 0000000000..c2c3b28a1b
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/constant/turbulenceProperties
@@ -0,0 +1,21 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "constant";
+    object      turbulenceProperties;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+simulationType  laminar;
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/controlDict b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/controlDict
new file mode 100644
index 0000000000..9022441287
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/controlDict
@@ -0,0 +1,56 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "system";
+    object      controlDict;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+application     multiphaseEulerFoam;
+
+startFrom       startTime;
+
+startTime       0;
+
+stopAt          endTime;
+
+endTime         6;
+
+deltaT          0.001;
+
+writeControl    adjustableRunTime;
+
+writeInterval   0.01;
+
+purgeWrite      0;
+
+writeFormat     ascii;
+
+writePrecision  6;
+
+writeCompression uncompressed;
+
+timeFormat      general;
+
+timePrecision   6;
+
+runTimeModifiable yes;
+
+adjustTimeStep  yes;
+
+maxCo           0.5;
+maxAlphaCo      0.5;
+
+maxDeltaT       1;
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/decomposeParDict b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/decomposeParDict
new file mode 100644
index 0000000000..e7e490bf74
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/decomposeParDict
@@ -0,0 +1,45 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "system";
+    object      decomposeParDict;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+numberOfSubdomains 4;
+
+method          simple;
+
+simpleCoeffs
+{
+    n               ( 2 2 1 );
+    delta           0.001;
+}
+
+hierarchicalCoeffs
+{
+    n               ( 1 1 1 );
+    delta           0.001;
+    order           xyz;
+}
+
+manualCoeffs
+{
+    dataFile        "";
+}
+
+distributed     no;
+
+roots           ( );
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSchemes b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSchemes
new file mode 100644
index 0000000000..5a4bb79d96
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSchemes
@@ -0,0 +1,61 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "system";
+    object      fvSchemes;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+ddtSchemes
+{
+    default         Euler;
+}
+
+gradSchemes
+{
+    default         Gauss linear;
+}
+
+divSchemes
+{
+    "div\(phi,alpha.*\)"    Gauss vanLeer;
+    "div\(phir,alpha.*,alpha.*\)"   Gauss vanLeer;
+
+    "div\(phiAlpha.*,U.*\)" Gauss limitedLinearV 1;
+    div(Rc)                 Gauss linear;
+    "div\(phi.*,U.*\)"      Gauss limitedLinearV 1;
+}
+
+laplacianSchemes
+{
+    default         Gauss linear corrected;
+}
+
+interpolationSchemes
+{
+    default         linear;
+}
+
+snGradSchemes
+{
+    default         corrected;
+}
+
+fluxRequired
+{
+    default         no;
+    p;
+    pcorr;
+}
+
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSolution b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSolution
new file mode 100644
index 0000000000..296b0cd488
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/fvSolution
@@ -0,0 +1,94 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "system";
+    object      fvSolution;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+solvers
+{
+    p
+    {
+        solver          GAMG;
+        tolerance       1e-7;
+        relTol          0.05;
+        smoother        GaussSeidel;
+        nPreSweeps      0;
+        nPostSweeps     2;
+        nFinestSweeps   2;
+        cacheAgglomeration on;
+        nCellsInCoarsestLevel 10;
+        agglomerator    faceAreaPair;
+        mergeLevels     1;
+    }
+
+    pFinal
+    {
+        solver          PCG;
+        preconditioner
+        {
+            preconditioner  GAMG;
+            tolerance       1e-7;
+            relTol          0;
+            nVcycles        2;
+            smoother        GaussSeidel;
+            nPreSweeps      0;
+            nPostSweeps     2;
+            nFinestSweeps   2;
+            cacheAgglomeration on;
+            nCellsInCoarsestLevel 10;
+            agglomerator    faceAreaPair;
+            mergeLevels     1;
+        }
+        tolerance       1e-7;
+        relTol          0;
+        maxIter         20;
+    }
+
+    pcorr
+    {
+        $pFinal;
+        tolerance       1e-5;
+        relTol          0;
+    }
+
+    U
+    {
+        solver          smoothSolver;
+        smoother        GaussSeidel;
+        tolerance       1e-8;
+        relTol          0.1;
+        nSweeps         1;
+    }
+
+    UFinal
+    {
+        $U;
+        tolerance       1e-7;
+        relTol          0;
+    }
+}
+
+PIMPLE
+{
+    nCorrectors     3;
+    nNonOrthogonalCorrectors 0;
+    nAlphaSubCycles 3;
+}
+
+relaxationFactors
+{
+    "U.*"           1;
+}
+
+// ************************************************************************* //
diff --git a/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/setFieldsDict b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/setFieldsDict
new file mode 100644
index 0000000000..3abdf3f73a
--- /dev/null
+++ b/tutorials/multiphase/multiphaseEulerFoam/damBreak4phaseFine/system/setFieldsDict
@@ -0,0 +1,65 @@
+/*--------------------------------*- C++ -*----------------------------------*\
+| =========                 |                                                 |
+| \\      /  F ield         | OpenFOAM: The Open Source CFD Toolbox           |
+|  \\    /   O peration     | Version:  dev                                   |
+|   \\  /    A nd           | Web:      www.OpenFOAM.org                      |
+|    \\/     M anipulation  |                                                 |
+\*---------------------------------------------------------------------------*/
+FoamFile
+{
+    version     2.0;
+    format      ascii;
+    class       dictionary;
+    location    "system";
+    object      setFieldsDict;
+}
+// * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * //
+
+defaultFieldValues
+(
+    volScalarFieldValue alphaair 1
+    volScalarFieldValue alphawater 0
+    volScalarFieldValue alphaoil 0
+    volScalarFieldValue alphamercury 0
+    volVectorFieldValue U ( 0 0 0 )
+);
+
+regions
+(
+    boxToCell
+    {
+        box ( 0 0 -1 ) ( 0.1461 0.292 1 );
+        fieldValues
+        (
+            volScalarFieldValue alphawater 1
+            volScalarFieldValue alphaoil 0
+            volScalarFieldValue alphamercury 0
+            volScalarFieldValue alphaair 0
+        );
+    }
+    boxToCell
+    {
+        box ( 0.1461 0 -1 ) ( 0.2922 0.292 1 );
+        fieldValues
+        (
+            volScalarFieldValue alphawater 0
+            volScalarFieldValue alphaoil 1
+            volScalarFieldValue alphamercury 0
+            volScalarFieldValue alphaair 0
+        );
+    }
+    boxToCell
+    {
+        box ( 0 0 -1 ) ( 0.1461 0.1 1 );
+        fieldValues
+        (
+            volScalarFieldValue alphawater 0
+            volScalarFieldValue alphaoil 0
+            volScalarFieldValue alphamercury 1
+            volScalarFieldValue alphaair 0
+        );
+    }
+);
+
+
+// ************************************************************************* //

From d7fcc07675e04359d5678a186678747c2692bbcd Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Thu, 29 Dec 2011 14:01:02 +0000
Subject: [PATCH 67/70] compressibleTwoPhaseEulerFoam, multiphaseEulerFoam:
 correct drag coeff boundary field

---
 .../GidaspowErgunWenYu/GidaspowErgunWenYu.C   | 41 +++++++------------
 .../GidaspowSchillerNaumann.C                 | 14 +++----
 .../SchillerNaumann/SchillerNaumann.C         | 14 +++----
 .../dragModels/SyamlalOBrien/SyamlalOBrien.C  | 14 +++----
 .../dragModels/WenYu/WenYu.C                  | 14 +++----
 .../Schaeffer/SchaefferFrictionalStress.C     |  2 +
 .../GidaspowErgunWenYu/GidaspowErgunWenYu.C   | 41 +++++++------------
 .../GidaspowSchillerNaumann.C                 | 14 +++----
 .../SchillerNaumann/SchillerNaumann.C         | 14 +++----
 .../dragModels/SyamlalOBrien/SyamlalOBrien.C  | 14 +++----
 .../dragModels/WenYu/WenYu.C                  | 14 +++----
 .../Schaeffer/SchaefferFrictionalStress.C     |  2 +
 12 files changed, 74 insertions(+), 124 deletions(-)

diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C
index bac588c738..3f659d44ec 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C
@@ -76,34 +76,23 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::GidaspowErgunWenYu::K
     volScalarField bp(pow(beta, -2.65));
     volScalarField Re(max(Ur*d/phase2_.nu(), scalar(1.0e-3)));
 
-    volScalarField Cds(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     // Wen and Yu (1966)
-    tmp<volScalarField> tKWenYu(0.75*Cds*phase2_.rho()*Ur*bp/d);
-    volScalarField& KWenYu = tKWenYu();
-
-    // Ergun
-    forAll (beta, cellj)
-    {
-        if (beta[cellj] <= 0.8)
-        {
-            KWenYu[cellj] =
-                150.0*alpha_[cellj]*phase2_.nu().value()*phase2_.rho().value()
-               /sqr(beta[cellj]*d[cellj])
-              + 1.75*phase2_.rho().value()*Ur[cellj]
-               /(beta[cellj]*d[cellj]);
-        }
-    }
-
-    return tKWenYu;
+    return
+    (
+        pos(beta - 0.8)
+       *(0.75*Cds*phase2_.rho()*Ur*bp/d)
+      + neg(beta - 0.8)
+       *(
+           150.0*alpha_*phase2_.nu()*phase2_.rho()/(sqr(beta*d))
+         + 1.75*phase2_.rho()*Ur/(beta*d)
+        )
+    );
 }
 
 
diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C
index 99b5cacdf2..0a624c6b0a 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C
@@ -75,15 +75,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::GidaspowSchillerNaumann::K
     volScalarField bp(pow(beta, -2.65));
 
     volScalarField Re(max(beta*Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
-    volScalarField Cds(24.0*(scalar(1) + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     return 0.75*Cds*phase2_.rho()*Ur*bp/phase1_.d();
 }
diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C
index 79259cbe05..f68e5379d2 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C
@@ -72,15 +72,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::SchillerNaumann::K
 ) const
 {
     volScalarField Re(max(Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
-    volScalarField Cds(24.0*(scalar(1) + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     return 0.75*Cds*phase2_.rho()*Ur/phase1_.d();
 }
diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C
index 4f971b4bb7..541868cf87 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C
@@ -73,15 +73,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::SyamlalOBrien::K
 {
     volScalarField beta(max(scalar(1) - alpha_, scalar(1.0e-6)));
     volScalarField A(pow(beta, 4.14));
-    volScalarField B(0.8*pow(beta, 1.28));
-
-    forAll (beta, celli)
-    {
-        if (beta[celli] > 0.85)
-        {
-            B[celli] = pow(beta[celli], 2.65);
-        }
-    }
+    volScalarField B
+    (
+        neg(beta - 0.85)*(0.8*pow(beta, 1.28))
+      + pos(beta - 0.85)*(pow(beta, 2.65))
+    );
 
     volScalarField Re(max(Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
 
diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C
index f1126125bb..bf279a3990 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C
@@ -75,15 +75,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::WenYu::K
     volScalarField bp(pow(beta, -2.65));
 
     volScalarField Re(max(Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
-    volScalarField Cds(24.0*(scalar(1) + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     return 0.75*Cds*phase2_.rho()*Ur*bp/phase1_.d();
 }
diff --git a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C
index 4320bbad35..d458f07b75 100644
--- a/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C
+++ b/applications/solvers/multiphase/compressibleTwoPhaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C
@@ -149,6 +149,8 @@ Foam::kineticTheoryModels::frictionalStressModels::Schaeffer::muf
         }
     }
 
+    muff.correctBoundaryConditions();
+
     return tmuf;
 }
 
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C
index e34f219ebc..b52b766de9 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowErgunWenYu/GidaspowErgunWenYu.C
@@ -75,34 +75,23 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::GidaspowErgunWenYu::K
     volScalarField bp(pow(beta, -2.65));
     volScalarField Re(max(Ur*d/phase2_.nu(), scalar(1.0e-3)));
 
-    volScalarField Cds(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     // Wen and Yu (1966)
-    tmp<volScalarField> tKWenYu = 0.75*Cds*phase2_.rho()*Ur*bp/d;
-    volScalarField& KWenYu = tKWenYu();
-
-    // Ergun
-    forAll (beta, cellj)
-    {
-        if (beta[cellj] <= 0.8)
-        {
-            KWenYu[cellj] =
-                150.0*phase1_[cellj]*phase2_.nu().value()*phase2_.rho().value()
-               /sqr(beta[cellj]*d[cellj])
-              + 1.75*phase2_.rho().value()*Ur[cellj]
-               /(beta[cellj]*d[cellj]);
-        }
-    }
-
-    return tKWenYu;
+    return
+    (
+        pos(beta - 0.8)
+       *(0.75*Cds*phase2_.rho()*Ur*bp/d)
+      + neg(beta - 0.8)
+       *(
+           150.0*phase1_*phase2_.nu()*phase2_.rho()/(sqr(beta*d))
+         + 1.75*phase2_.rho()*Ur/(beta*d)
+        )
+    );
 }
 
 
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C
index ecd25eb386..25de6b1dc7 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/GidaspowSchillerNaumann/GidaspowSchillerNaumann.C
@@ -74,15 +74,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::GidaspowSchillerNaumann::K
     volScalarField bp(pow(beta, -2.65));
 
     volScalarField Re(max(beta*Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
-    volScalarField Cds(24.0*(scalar(1) + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     return 0.75*Cds*phase2_.rho()*Ur*bp/phase1_.d();
 }
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C
index 3259b5d0e0..d4d77a2bb3 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SchillerNaumann/SchillerNaumann.C
@@ -71,15 +71,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::SchillerNaumann::K
 ) const
 {
     volScalarField Re(max(Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
-    volScalarField Cds(24.0*(scalar(1) + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     return 0.75*Cds*phase2_.rho()*Ur/phase1_.d();
 }
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C
index 736be885e0..07f85b38a1 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/SyamlalOBrien/SyamlalOBrien.C
@@ -72,15 +72,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::SyamlalOBrien::K
 {
     volScalarField beta(max(phase2_, scalar(1.0e-6)));
     volScalarField A(pow(beta, 4.14));
-    volScalarField B(0.8*pow(beta, 1.28));
-
-    forAll (beta, celli)
-    {
-        if (beta[celli] > 0.85)
-        {
-            B[celli] = pow(beta[celli], 2.65);
-        }
-    }
+    volScalarField B
+    (
+        neg(beta - 0.85)*(0.8*pow(beta, 1.28))
+      + pos(beta - 0.85)*(pow(beta, 2.65))
+    );
 
     volScalarField Re(max(Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
 
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C
index 6cfc119c1c..6319276408 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/interfacialModels/dragModels/WenYu/WenYu.C
@@ -74,15 +74,11 @@ Foam::tmp<Foam::volScalarField> Foam::dragModels::WenYu::K
     volScalarField bp(pow(beta, -2.65));
 
     volScalarField Re(max(Ur*phase1_.d()/phase2_.nu(), scalar(1.0e-3)));
-    volScalarField Cds(24.0*(scalar(1) + 0.15*pow(Re, 0.687))/Re);
-
-    forAll(Re, celli)
-    {
-        if (Re[celli] > 1000.0)
-        {
-            Cds[celli] = 0.44;
-        }
-    }
+    volScalarField Cds
+    (
+        neg(Re - 1000)*(24.0*(1.0 + 0.15*pow(Re, 0.687))/Re)
+      + pos(Re - 1000)*0.44
+    );
 
     return 0.75*Cds*phase2_.rho()*Ur*bp/phase1_.d();
 }
diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C b/applications/solvers/multiphase/multiphaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C
index 4320bbad35..d458f07b75 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/kineticTheoryModels/frictionalStressModel/Schaeffer/SchaefferFrictionalStress.C
@@ -149,6 +149,8 @@ Foam::kineticTheoryModels::frictionalStressModels::Schaeffer::muf
         }
     }
 
+    muff.correctBoundaryConditions();
+
     return tmuf;
 }
 

From 411db54faaf5ab0caf66d9c1bc7b60175722fefe Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Thu, 29 Dec 2011 23:47:54 +0000
Subject: [PATCH 68/70] sonicDyMFoam: Corrected pressure-work for mesh motion

---
 .../compressible/sonicFoam/sonicDyMFoam/eEqn.H       | 12 ++++++++++++
 1 file changed, 12 insertions(+)
 create mode 100644 applications/solvers/compressible/sonicFoam/sonicDyMFoam/eEqn.H

diff --git a/applications/solvers/compressible/sonicFoam/sonicDyMFoam/eEqn.H b/applications/solvers/compressible/sonicFoam/sonicDyMFoam/eEqn.H
new file mode 100644
index 0000000000..0c17353ec4
--- /dev/null
+++ b/applications/solvers/compressible/sonicFoam/sonicDyMFoam/eEqn.H
@@ -0,0 +1,12 @@
+{
+    solve
+    (
+        fvm::ddt(rho, e)
+      + fvm::div(phi, e)
+      - fvm::laplacian(turbulence->alphaEff(), e)
+     ==
+      - p*fvc::div(phi/fvc::interpolate(rho) + mesh.phi())
+    );
+
+    thermo.correct();
+}

From c0798213189c40c62b3a9ef41628e9eb15641cdd Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Thu, 29 Dec 2011 23:48:09 +0000
Subject: [PATCH 69/70] rhoCentralDyMFoam: Improved the handling of relative
 fluxes and corrected the pressure-work term

---
 .../rhoCentralDyMFoam/rhoCentralDyMFoam.C        | 16 ++++++----------
 1 file changed, 6 insertions(+), 10 deletions(-)

diff --git a/applications/solvers/compressible/rhoCentralFoam/rhoCentralDyMFoam/rhoCentralDyMFoam.C b/applications/solvers/compressible/rhoCentralFoam/rhoCentralDyMFoam/rhoCentralDyMFoam.C
index 4d0927a6af..363a8fd2dc 100644
--- a/applications/solvers/compressible/rhoCentralFoam/rhoCentralDyMFoam/rhoCentralDyMFoam.C
+++ b/applications/solvers/compressible/rhoCentralFoam/rhoCentralDyMFoam/rhoCentralDyMFoam.C
@@ -109,6 +109,9 @@ int main(int argc, char *argv[])
         surfaceScalarField phiv_pos(U_pos & mesh.Sf());
         surfaceScalarField phiv_neg(U_neg & mesh.Sf());
 
+        fvc::makeRelative(phiv_pos, U);
+        fvc::makeRelative(phiv_neg, U);
+
         volScalarField c(sqrt(thermo.Cp()/thermo.Cv()*rPsi));
         surfaceScalarField cSf_pos
         (
@@ -161,17 +164,9 @@ int main(int argc, char *argv[])
         Info<< "Time = " << runTime.timeName() << nl << endl;
 
         mesh.movePoints(motionPtr->newPoints());
-        phiv_pos = U_pos & mesh.Sf();
-        phiv_neg = U_neg & mesh.Sf();
-        fvc::makeRelative(phiv_pos, U);
-        fvc::makeRelative(phiv_neg, U);
-        phiv_neg -= mesh.phi();
-        phiv_pos *= a_pos;
-        phiv_neg *= a_neg;
-        aphiv_pos = phiv_pos - aSf;
-        aphiv_neg = phiv_neg + aSf;
 
-        surfaceScalarField phi("phi", aphiv_pos*rho_pos + aphiv_neg*rho_neg);
+        phi = aphiv_pos*rho_pos + aphiv_neg*rho_neg;
+        Info<< phi.boundaryField()[0] << endl;
 
         surfaceVectorField phiUp
         (
@@ -183,6 +178,7 @@ int main(int argc, char *argv[])
         (
             aphiv_pos*(rho_pos*(e_pos + 0.5*magSqr(U_pos)) + p_pos)
           + aphiv_neg*(rho_neg*(e_neg + 0.5*magSqr(U_neg)) + p_neg)
+          + mesh.phi()*(a_pos*p_pos + a_neg*p_neg)
           + aSf*p_pos - aSf*p_neg
         );
 

From e1c876f59a19193d6996f89b2c49c48b121c5d80 Mon Sep 17 00:00:00 2001
From: Henry <Henry>
Date: Thu, 29 Dec 2011 23:48:26 +0000
Subject: [PATCH 70/70] multiphaseEulerFoam: Make the specification of the
 slamming damper optional

---
 .../solvers/multiphase/multiphaseEulerFoam/createFields.H  | 7 +++++--
 1 file changed, 5 insertions(+), 2 deletions(-)

diff --git a/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H b/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H
index 7e24071893..79fa72d758 100644
--- a/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H
+++ b/applications/solvers/multiphase/multiphaseEulerFoam/createFields.H
@@ -53,13 +53,16 @@
         phi += fvc::interpolate(alpha)*phase.phi();
     }
 
-    scalar slamDampCoeff(readScalar(fluid.lookup("slamDampCoeff")));
+    scalar slamDampCoeff
+    (
+        fluid.lookupOrDefault<scalar>("slamDampCoeff", 1)
+    );
 
     dimensionedScalar maxSlamVelocity
     (
         "maxSlamVelocity",
         dimVelocity,
-        fluid.lookup("maxSlamVelocity")
+        fluid.lookupOrDefault<scalar>("maxSlamVelocity", GREAT)
     );
 
     // dimensionedScalar pMin